what does the structure of 2-ethyl- 3-methyl-4-ethyl -heptane look like?

Question

IS a correct name for it 5-ethyl- , 3,4- dimethyl -octane?

Answer 1

also the correct name is 3 methyl pentane for 2 ethyl butane who do we get that? I understand where the ethyl group goes and that there is 5 carbons in a chain instead of 4, but how is it methyl instead of ethyl when at 3. It still has the chain -CH2-CH3

Answer 2

I typed all of this in and it didn't post. So I'll try again.
CH3CH2CH(CH3)CH(CH3)CH2CH2CH2CH3
Your name is correct except for the -octane. Omit the -.

I don't understand the second question. Is that why insted of who? at 3? whats at 3? I don't know what's confusing you.

Answer 3

Why is the correct name of 2 ethyl butane determined to be 3 methyl pentane? I understand it has 5 carbons to have it be considered pentane, but how is there a methyl group? The group of methyl is at 3.

Answer 4

CH3
|
CH2
|
HC-CH3
|
CH2
|
CH3