Hexenoates are esters derived from hexenoic acids and alcohols. To draw a general structure of a hexenoate compound, you should follow these steps:
1. Identify the basic ester structure: R-C(=O)-O-R’.
2. For the hexenoate, the R group should be derived from hexenoic acid, which contains six carbon atoms with a double bond in its chain.
Let’s consider a generic example: hex-2-enoate (indicating a double bond between C2 and C3 in the hexanoic acid backbone).
1. Draw the hexenoic acid structure:
- Write 6 carbon atoms in a chain.
- Insert a double bond between C2 and C3.
- Attach a carboxyl group (-COOH) to C1.
```
CH3-CH=CH-(CH2)2-COOH
```
2. Convert the carboxyl group into an ester group:
- Replace the hydrogen in the carboxyl group's -OH with the -O-R’ group from the alcohol.
For methyl hex-2-enoate (R’ is CH3):
```
CH3-CH=CH-(CH2)2-C(=O)-O-CH3
|
O
```
The general structure would be:
```
H H
\ /
H3C—C=C—C—C(O)—O—R’
/
H
```
Here, the "R’" denotes an alkyl group (methyl in our example), and the double bond location (2-position) is specified for a specific isomer.
To summarize, hexenoate compounds feature:
- A 6-carbon chain from the hexenoic acid.
- One double bond within the carbon chain.
- An ester linkage where the carboxyl hydrogen is replaced by an -O-R’ group.
Draw the structure of Hexenoate compounds
1 answer