okay the molecular formula is:
(CH3)(COHCH3)(CHCH2CH3)(CHCH3)(CH2)(CH2)(CH3)
...the brackets represent one of the seven parent carbon atoms (hepta- informs that there are 7 of them)
it is difficult to illustrate the structure on this post but it is exacty like in the molecular formula but with symbols and bonds represented by lines.
draw the structure of 2,4-dimethyl-3-ethyl-2-heptanol and give the molecular formula.
3 answers
We can't draw structures on the board.
CH3-COH(CH3)-CH(CH2CH3)-CH(CH3)-CH2-CH2-CH3