Ask a New Question
Search
CH2=CH-CH2CH3+H2O
What is the product of the reaction above
1 answer
Ch3-ch2ohch3
Similar Questions
what is the major product of this reaction CH2=CH-CH2CH3+H2O H2SO4
1 answer
The reaction are free radicals what are the product...
1)CH3-CH2-CH2 +CH3-CH2CH3 2)CH3-CH2-CH3 +CH3-CH-CH3 3)CH3-CH2-CH2
2 answers
PROvide a systematic name for this compound : CH3CH2CH2CH(CH3)CH2CH(CH2CH3)CH(CH2CH2CH3)CH(CH3)CH2CH3
1 answer
What is the IUPAC name of the following compounds?
a) ---CHO ---I CH3CCH3 ---I ---CH2CH3 b) -----------CH3 -----------I
1 answer
more similar questions