Asked by Anonymous
Ethylamine, CH3CH2NH2, has a strong, pungent odor similar to that of ammonia. Like ammonia, it is a Brønsted base. A 0.10 M solution has a pH of 11.87. Calculate the Kb and pKb for ethylamine. What is the percentage ionization of ethylamine in this solution?
Answers
Answered by
DrBob222
Let's write ethylamine as BNH2. If the pH is 11.87 the pOH is 14-11.87 = pOH of 2.13 and 2.13 = -log(OH^-) so (OH^- is approx 7E-3M but you need to that more accurately as well as all of the other calculations that follow. Then
.......BNH2 + HOH ==> BNH3^+ + OH^-
I......0.1.............0........0
C.......-x.............x........x
E......0.1-x...........x........x
and you know x = approx 0.007 so 0.1-x = approx 0.093. Plug those recalculated values into the Kb expression and solve for Kb. Then pKb = -logKb
% ion = [(OH^-)/0.1]*100 = ?
Kb = (BNH3^+)(OH^-)/(BNH2)
.......BNH2 + HOH ==> BNH3^+ + OH^-
I......0.1.............0........0
C.......-x.............x........x
E......0.1-x...........x........x
and you know x = approx 0.007 so 0.1-x = approx 0.093. Plug those recalculated values into the Kb expression and solve for Kb. Then pKb = -logKb
% ion = [(OH^-)/0.1]*100 = ?
Kb = (BNH3^+)(OH^-)/(BNH2)
Answered by
Shayal
Ethylamine (CH3CH2NH2), has a strong pungent odour similar to that
of ammonia. Like ammonia it is a Bronsted base. A 0.10 M solution
of ethylamine has a pH of 11.86. Calculate the Kb and pKb for
ethylamine.
of ammonia. Like ammonia it is a Bronsted base. A 0.10 M solution
of ethylamine has a pH of 11.86. Calculate the Kb and pKb for
ethylamine.
Answered by
Bot
The first step is to write the equilibrium reaction for the base dissociation of ethylamine:
CH3CH2NH2 + H2O ⇌ CH3CH2NH3+ + OH-
From the pH of the solution, we can determine the [OH-] concentration:
pH + pOH = 14
pOH = 14 - pH = 14 -11.86 = 2.14
[OH-] = 10^(-pOH) = 10^(-2.14) = 6.97 x 10^(-3) M
Next, we can set up an ICE table for the reaction:
CH3CH2NH2 + H2O ⇌ CH3CH2NH3+ + OH-
I 0.10 M 0 M 0 M
C -x x x
E 0.10 - x x x
Using the equilibrium concentrations in the ICE table, we can write the expression for the base dissociation constant (Kb):
Kb = [CH3CH2NH3+][OH-]/[CH3CH2NH2]
Substituting the values from the ICE table and solving for Kb:
Kb = (x)(x)/(0.10 - x)
Kb = 5.6 x 10^-4
Finally, we can calculate the pKb:
pKb = -log(Kb) = -log(5.6 x 10^-4) = 3.25
Therefore, the Kb for ethylamine is 5.6 x 10^-4 and the pKb is 3.25.
CH3CH2NH2 + H2O ⇌ CH3CH2NH3+ + OH-
From the pH of the solution, we can determine the [OH-] concentration:
pH + pOH = 14
pOH = 14 - pH = 14 -11.86 = 2.14
[OH-] = 10^(-pOH) = 10^(-2.14) = 6.97 x 10^(-3) M
Next, we can set up an ICE table for the reaction:
CH3CH2NH2 + H2O ⇌ CH3CH2NH3+ + OH-
I 0.10 M 0 M 0 M
C -x x x
E 0.10 - x x x
Using the equilibrium concentrations in the ICE table, we can write the expression for the base dissociation constant (Kb):
Kb = [CH3CH2NH3+][OH-]/[CH3CH2NH2]
Substituting the values from the ICE table and solving for Kb:
Kb = (x)(x)/(0.10 - x)
Kb = 5.6 x 10^-4
Finally, we can calculate the pKb:
pKb = -log(Kb) = -log(5.6 x 10^-4) = 3.25
Therefore, the Kb for ethylamine is 5.6 x 10^-4 and the pKb is 3.25.
Submit Your Answer
We prioritize human answers over AI answers.
If you are human, and you can answer this question, please submit your answer.