Questions Asked on April 23, 2023

1. Natural selection causes changes inpopulations. individuals. genotypes. phenotypes. 2. Which statement is accurate about
1. 15 answers
2. asked by Anonymous
3. 1,011 views
I need my answers checked please:Q: Natural selection causes changes in 1. Individuals 2. Populations <- 3. Genotypes 4.
1. 13 answers
2. asked by ⚡️LightningCat2000⚡️
3. 660 views
Josephine bought a bag of garri for 320 naira and sold it for 400naira what was her percentage profit?
1. 1 answer
2. asked by Tes
3. 438 views
Why did farmers let some fields lie fallow?A. to reduce the surplus of crops B. to bring new land under cultivation C. to
1. 3 answers
2. asked by vicluvr69
3. 398 views
6823617 to the nearest 5
1. 17 answers
2. asked by Botlhokwa
3. 384 views
Why did cattle owners have to buy private property on which to
1. 1 answer
2. asked by khloe
3. 364 views
Why do authors write in a particular style? Select the two correct answers.(1 point)Responses to demonstrate their understanding
1. 1 answer
2. asked by Kim
3. 320 views
In one or two sentences, explain how the chemical equation for cellular respiration shows that plants cycle matter. Include the
1. 1 answer
2. asked by Mia
3. 312 views
write the number of permutations in factorial form. then simplify. how many different ways can you and four of your friends sit
1. 1 answer
2. asked by Work it out
3. 310 views
When should the personal a be used in a sentence, and why? Write your answer in English. Next, write a complete sentence in
1. 1 answer
2. asked by Spanish
3. 306 views
Hey, Someone Claims that Queen Elizabeth Is Alive: But, How? I saw On google That She died. I'm not making Any false claims. We
1. 71 answers
2. asked by New Jersey Avenue De Felia
3. 300 views
Why do workers mostly sell their labor?a. to earn income b. to grow their productivity c. to become entrepreneurs d. to avoid
1. 5 answers
2. asked by rstaats88
3. 294 views
Given: A 20ft. Span, simple supported beam is uniformly loaded with 8kips/ft.-Find shear and bending stresses for a rectangular
1. 1 answer
2. asked by Dan
3. 291 views
The Tuscan countryside is a wonder to behold. Acres upon acres of grapevines are woven like a natural quilt. In the afternoons,
1. 1 answer
2. asked by Kim
3. 288 views
Which of these factors contribute to the income potential of a job? Select all that apply.a. the education required to be
1. 1 answer
2. asked by rstaats88
3. 285 views
Design the Relational Schema for the E-R diagram that you have drawn for Question 1. The relations must be at least in 3NF.
1. 1 answer
2. asked by Ruhi
3. 282 views
Hi, I need help with the Connexus Algebra 2 Semester B exam
1. 3 answers
2. asked by Dan
3. 282 views
Which of the following statements is the MOST compelling argument that fungi are more closely related to animals than plants?A.
1. 1 answer
2. asked by im am not that guy
3. 280 views
Note: Enter your answer and show all the steps that you use to solve this problem in the space provided.Maria has the following
1. 13 answers
2. asked by Lucygirl23
3. 280 views
In one or two sentences, explain how the chemical equation for cellular respiration shows that plants cycle matter. Include the
1. 1 answer
2. asked by Mia
3. 274 views
Linda is making a line plot of the data below.11.25, 12.5, 11.25, 14.125, 10.5, 11.25, 12 Which line plot represents the data
1. 1 answer
2. asked by rstaats88
3. 260 views
Plants, bison, elk, and wolves are all members of an ecosystem. The bison and elk are both primary consumers in this ecosystem,
1. 1 answer
2. asked by Olivia
3. 259 views
Emission Spectra Quick Check1. What do the characteristics of electromagnetic radiation include? characteristics of both waves
1. 1 answer
2. asked by Tablesaur
3. 258 views
What is the area off the trapezoid? The diagram is not drawn to scale.
1. 1 answer
2. asked by Time
3. 256 views
Design an ER diagram for a University, which manages the students, Programmes, courses and student results. You should clearly
1. 1 answer
2. asked by Ruhi
3. 251 views
Which of the following is plot
1. 1 answer
2. asked by Zoey
3. 245 views
The perimeter of a room is 24cm.if it's length is 8cm,find the area
1. 1 answer
2. asked by Grace
3. 244 views
What type of drugs cause rapid increased heart rate, and faster breathing?
1. 1 answer
2. 244 views
In which situation would you use a book instead of another type of media?(1 point)Responses when you want to get a spatial
1. 1 answer
2. asked by Kim
3. 241 views
Which step is first in conducting a research project
1. 1 answer
2. asked by khloe
3. 240 views
Three of the main forms of media people use to present a story are text, _____, and video.(1 point)Responses tactile tactile
1. 1 answer
2. asked by Kim
3. 236 views
14 ft. column is subjected to total compressive load of 550 kips.Design it as reinforced concrete square tied column. Use
1. 1 answer
2. asked by Dan
3. 236 views
2. Based on the data below, which group of animals is genetically diverse?# of different types of species in the world Birds |
1. 3 answers
2. asked by Anonymous
3. 235 views
What is the product in simplest form? State any restrictions on the variable.x^2 + 7x + 10/x + 3 * x^2 - 3x - 18/x^2 + x - 2
1. 1 answer
2. asked by Iwannaknow
3. 234 views
Match the medium of exchange with its definition.(2 points)Put responses in the correct input to answer the question. Select a
1. 1 answer
2. asked by fthgrsrsggs
3. 234 views
How many different ways are there to rearrange the letters of the word EXAM, if you don’t care if the results is a
1. 19 answers
2. asked by Lila England
3. 233 views
Mass relationships in chemical reaction. Make a solutionConsider the reaction KOH + CO2 -----> KHCO3 How many grams of KOHCO3
1. 1 answer
2. 233 views
Hii (sorry for not posting for a while, I'm back.) I JUST came back from church and I got baptized today :DAnyways, How does the
1. 33 answers
2. asked by Jesus is real❤️
3. 231 views
Match the medium of exchange with its definition.(2 points)Put responses in the correct input to answer the question. Select a
1. 25 answers
2. asked by fthgrsrsggs
3. 231 views
Identify the sentence in each group in which the underlined verb does not agree with its subject.
1. 1 answer
2. asked by social studies
3. 229 views
How can a reader determine bias in an author's writing?(1 point)Responses with the bibliography with the bibliography by the
1. 1 answer
2. asked by Kim
3. 225 views
The circle graph represents a family’s monthly budget if the total monthly budget is 5000 how much does the family spend on
1. 1 answer
2. asked by Zoey
3. 225 views
The French Revolution Quick Check all answers please
1. 3 answers
2. asked by help pls
3. 223 views
Each day, Calvin saves $7 and Dave saves $3 more than Calvin, Calvin starts to save one week earlier than Dave. How much money
1. 1 answer
2. 222 views
Beavers, large members of the rodent family in North America, are often referred to as “ecosystem/keystone engineers” by
1. 1 answer
2. asked by Olivia
3. 221 views
Eating foods that are high in _____is a great way to keep the digestive system moving naturally
1. 7 answers
2. 219 views
Which of the following capacity measurements are equal to 24 pints? Select all that apply.A. 48 cups B. 192 fluid ounces C. 3
1. 1 answer
2. asked by rstaats88
3. 217 views
An area rug is Rachel's room is shown below. 144 inches by 108 inches. How can you convert the dimensions of the area rug from
1. 1 answer
2. asked by rstaats88
3. 215 views
If a binary operation (+) is defined on the R of real numbers by x (+) y = x + y + xy where x,y € R . Calculate 5 (+) (-2) (+)
1. 11 answers
2. asked by Kenny Afams
3. 215 views
While there are differences between the three main forms of media, they should all have the same _____ when presenting the same
1. 1 answer
2. asked by Kim
3. 215 views
Of 48 cars taking road worthiness test, each of them had at least one fault in brakes, lights and steering. 14 had faults in
1. 13 answers
2. asked by Sandra
3. 214 views
The area of a rectangle is (16x2 − 9y2) square units. Determine the dimensions of the rectangle by factoring the area
1. 3 answers
2. asked by Eggy#6091
3. 214 views
Given the following data:C2H4 (g) + 3O2 (g) -> 2CO2 (g) + 2H2O (l) H = –1411.0 kJ 2C2H6 (g) + 7O2 (g) -> 4CO2 (g) + 6H2O (l) H
1. 1 answer
2. asked by Chao
3. 210 views
Explain the following behaviour of molecules :When it is raining it is advisable not to touch a canvas tent from inside
1. 13 answers
2. asked by Mitchell Knight
3. 203 views
Which job would likely have the lowest income?a. a job that many people are willing to do b. a job that takes highly specialized
1. 1 answer
2. asked by rstaats88
3. 202 views
Which ecosystem is most resilient to change due to its high diversity?(1 point)A. arctic tundra B. stormwater pond C. mountain
1. 1 answer
2. asked by Mia
3. 201 views
Answer the following queries using SQL for the database created in Question I and Question 2List the names of all the students
1. 1 answer
2. asked by Ruhi
3. 200 views
Constance has an apple that weighs 85,000 milligrams and a peach that weighs. 0.15 kilograms. which fruit has the greater mass?
1. 1 answer
2. asked by rstaats88
3. 199 views
Which of the following businesses specializes?(1 point)Responses A mechanic shop stating it has every car part under the sun. A
1. 1 answer
2. asked by fthgrsrsggs
3. 199 views
6823617 to the nearest 100
1. 1 answer
2. asked by Botlhokwa
3. 199 views
Which of the following measurements are less than 5 feet? Select the two that apply.A. 56 inches B. 1 yard C. 1 yard 2 feet D. 1
1. 1 answer
2. asked by rstaats88
3. 195 views
Matilda measures the perimeter of her bedroom to determine how many feet of border she needs to go around the tops of the walls.
1. 3 answers
2. asked by rstaats88
3. 194 views
When should the personal a be used in a sentence, and why? Write your answer in English. Next, write a complete sentence in
1. 1 answer
2. asked by Spanish
3. 194 views
A binary operation * is defined as the set of real numbers by a*b=a/b + b/a where a and b belong to R. Simplify (x+1)*2=3
1. 3 answers
2. asked by Kenny Afams
3. 193 views
Mass relationships in chemical reaction.Make a solutionFor the combustion of ethane,beginning with 0.27 mole of CH3 CH3. How
1. 1 answer
2. 191 views
A train left Kano on Monday at 9.05 a.m. and arrived Lagos on Tuesday at 12:00 noon how long did the journey take?
1. 1 answer
2. asked by Tes
3. 190 views
Find the quotientz1/z2 in standard form. Convert to trigonometric form and find the quotient to check your answer. z1=2+2i ,
1. 1 answer
2. asked by Dan
3. 190 views
alex use the data to make the graph below. a) in what way could the graph be misleading? b) how could you redraw the graph so
1. 1 answer
2. asked by Lucygirl23
3. 190 views
Indicate the quadrant(s) in which the terminal side ofθ must lie in order that: csc θ and sec θ have the same sign..
1. 3 answers
2. asked by Dan
3. 189 views
In a class of 36 students, 18 offers chemistry, 16 offers physics, 22 offers mathematics, 6 offered all the 3 subjects, 3 offers
1. 1 answer
2. asked by Sandra
3. 186 views
i need help on special angles quick check
1. 7 answers
2. asked by help pls
3. 186 views
Mass relationships in chemical reaction.Make a solutionFor the combustion of ethane,beginning with 0.27 mole of CH3 CH3. How
1. 1 answer
2. 185 views
Let tan A=−12/5 with A in QII and findcsc(2A)=
1. 3 answers
2. asked by Dan
3. 185 views
What is the product in simplest form? State any restrictions on the variable.x^2 + 7x + 10/x + 3 * x^2 - 3x - 18/x^2 + x - 2
1. 1 answer
2. asked by Iwannaknow
3. 184 views
Which one of the following animals is most likely to be a keystone species, based on the food web provided?(1 point) Responses
1. 1 answer
2. asked by Olivia
3. 183 views
Which set of output values correctly complete the function table
1. 1 answer
2. asked by Hope
3. 181 views
A man travels a distance of 84km in 1hr 20mins.Find his average speed
1. 1 answer
2. asked by Tes
3. 181 views
Convert 67,000 pounds to tons. Choose the words and numbers to complete the statements.A pound is ___than a ton, so ___the
1. 1 answer
2. asked by rstaats88
3. 180 views
Mass relationships in chemical reaction.Make a solutionFor the combustion of ethane,beginning with 0.27 mole of CH3 CH3. How
1. 1 answer
2. 180 views
Which abiotic factors?Cold temperatures Partially frozen soil Varying sunlight throughout the year Percolation predominantly in
1. 1 answer
2. asked by Zoey
3. 180 views
Mass relationships in chemical reaction.For the combustion of methane, beginning with 3.15 mole of CH4. How many moles of CO2
1. 1 answer
2. 178 views
which option best answers the following question ¿viste
1. 2 answers
2. asked by Lol
3. 178 views
Environmental changes like increased temperature can stress an ecosystem. Why is this an issue with regard to invasive
1. 1 answer
2. asked by Olivia
3. 178 views
Simplify the expression√81−y ^2 as much as possible after substituting 9 sin x for y.
1. 1 answer
2. asked by Dan
3. 177 views
Write the number of permutations in factorial form. Then simplify.J K L M N O P A. 7!; 720 B. 8!; 40,320 C. 7!; 49 D. 7!; 5,040
1. 1 answer
2. asked by Lila England
3. 176 views
Familiesare effected by hiv and aids
1. 1 answer
2. 176 views
Mass relationships in chemical reaction. Make a solutionConsider the reaction KOH + CO2 -----> KHCO3 How many grams of KOH are
1. 1 answer
2. 175 views
Which of the following is a requirement of all service sector occupations?• expertise • transportation • haste •
1. 1 answer
2. asked by two
3. 175 views
Connection as in Fig. 11.6 carries a total load of 200 kips. Plates of A992 with Fy=50ksi, Fu=65 ksi are attached with 6/8 in
1. 1 answer
2. asked by Dan
3. 175 views
Calculate the diameter of a circle whose circumference is 77cm(take pia=22/7)
1. 13 answers
2. asked by Tes
3. 174 views
Which of the following are common types of informational text? Select the two correct answers.(1 point)Responses influential
1. 1 answer
2. asked by Kim
3. 174 views
Rewrite the expression as a sum or difference, then simplify if possible.4sin(6x)cos(5x)=
1. 1 answer
2. asked by Dan
3. 173 views
Which of the following is an example of a human resource at a computer company?(1 point)Responses a shipping truck a shipping
1. 1 answer
2. asked by fthgrsrsggs
3. 172 views
Harold measures the heights in inches of the new plants that are growing in his greenhouse.He records the lengths shown below
1. 1 answer
2. asked by rstaats88
3. 170 views
Using molarity and molality to described the solution. Make a solutionCalculate the percent concentration of 2.78g NaHCO3
1. 1 answer
2. 169 views
Mass relationships in chemical reaction.Make a solutionFor the combustion of ethane,beginning with 0.27 mole of CH3 CH3. How
1. 1 answer
2. 167 views
Is Actress, Katherine De Belen Dead?
1. 19 answers
2. asked by Medicine
3. 167 views
Mass relationships in chemical reaction. Make a solutionFor the combustion of ethane,beginning with 0.27 mole of CH3 CH3. How
1. 1 answer
2. 164 views
Mass relationships in chemical reaction.Make a solutionFor the combustion of methane, beginning with 3.15 mole of CH4. How many
1. 1 answer
2. 161 views
Solve the equation forx if 0≤x<2π . 4sin^2x+4cosx−5=0 theta =
1. 5 answers
2. asked by Dan
3. 158 views

Back to April 2023