Archives
2021
December

Questions Asked on December 11, 2021

Which nonfiction genre teaches the reader a process? *1 point History Biography How To Humor The platypus is an Australian
1. 9 answers
2. asked by .
3. 1,537 views
) A saturated aqueous solution of NaBr at 20 oC contains 116 g NaBr / 100 H2O g. Expressthis composition as percent by mass
1. 1 answer
2. asked by Mohamad kourabi
3. 1,626 views
Draw the angle θ=3 radians in standard position.What quadrant does θ terminate in?
1. 4 answers
2. asked by Scott
3. 391 views
a ball rolls off the edge of a table with a velocity of 1m/s if the table is 1m talla, how far from the edge of the table does
1. 2 answers
2. asked by mahir
3. 342 views
Draw the graphy of (v-t) and(s-t)
1. 1 answer
2. asked by Abera dabesa
3. 214 views
If two vector , A vector = 1i+6j-5k , B vector = 2i+3j+4k represents the two adjecents sides of a parallelogram , find the area
1. 1 answer
2. asked by Jyoti
3. 336 views
Prove the following by mathematical induction for all integers (n>or=1)1^3+2^3+3^3+-----+n^3=(n(n+1)/2)^2
1. 1 answer
2. asked by Elosy
3. 288 views
I really tried to answer this, but I cannot. Pls. help me. I will really appreciate it. Thank you.The following names are
1. 0 answers
2. asked by Cons
3. 584 views
most games are sold on CD rom than floppy disk give 3 reasons why
1. 2 answers
2. asked by Anonymous
3. 286 views
A ladder of mass M and length 4 m rests against a frictionless wall at an angle of 50 degrees to the horizontal. The coefficient
1. 1 answer
2. asked by ryan
3. 347 views
4y+2x=3;(1.5,0)
1. 1 answer
2. asked by Lauren
3. 259 views
Which Graph represents the given inequality?y>5x-1
1. 1 answer
2. asked by Alexdell
3. 1,541 views
((1)/(2)a^(2)b^(5))*((3)/(8)a^(4)bc^(2))
1. 1 answer
2. asked by person
3. 197 views
What is y
1. 1 answer
2. asked by Jes
3. 201 views
2y-x=4
1. 1 answer
2. asked by Jes
3. 321 views
What is the chemical formula potassium dioxonitrate (5)
1. 2 answers
2. asked by USMAN
3. 631 views
One pump can empty a pool in 4 days, whereas a second pump can empty the pool in 12 days. How long will it take the two pumps,
1. 1 answer
2. asked by jess
3. 415 views
Let F(x)=f(x^4) and G(x)=(f(x))^4You also know that a^3=6 , f(a)=3 , f'(a)=9 , f'(a^4)=14 Then F'(a)= ? and G'(a)= ?
1. 1 answer
2. asked by Ellie
3. 135 views
An angle measures . What is the measure of its supplement?
1. 1 answer
2. asked by Anonymous
3. 232 views
When Mrs. Jacobs accused Hannah of cheating, she took it as a personal affront because she had never done anything that
1. 3 answers
2. asked by shgfd
3. 501 views
how did European exploration affect east Asian countries?This is a unit test question Essay question
1. 2 answers
2. asked by Akkito
3. 574 views
sec(θ)=9 with 3π/2<θ<2π, determine tan(θ)
1. 1 answer
2. asked by Kisani
3. 192 views
Find the GCF of each set of numbers. 14,56,63
1. 1 answer
2. asked by Michael
3. 405 views
I am throwing a ball on the groundfrom the 12th floor of abuilding. The height, in meters, of the of the ball is above the
1. 1 answer
2. asked by sarah
3. 250 views
A solution was made by dissolving 3.75 g of a pure non volatile solute in 95 g of acetone. The boiling point of pure acetone was
1. 2 answers
2. asked by Senait
3. 1,028 views
when going from smaller units to bigger units you what by 10a.divided b.add c.subtarct d.multiply
1. 1 answer
2. asked by Obama
3. 199 views
need answers for UNIT 7Circles LESSON 4 Angle Measures and Segment Lengths has 5 questions
1. 5 answers
2. asked by unknown b.
3. 1,232 views
A shed has dimensions of 12m in length and 5 m in width. Both the length and width are "increased by the same amount" in order
1. 1 answer
2. asked by Thnx
3. 278 views
A box of mass 14.3 kg with an initial velocity of 1.32 m/s slides down a plane, inclined at 20 with respect to the horizontal.
1. 2 answers
2. asked by anna
3. 339 views
The sum of the first four terms of an AP is 2/3 and the sum of the first eight term is -1.find the sum of the first twelve terms
1. 2 answers
2. asked by Sharon
3. 231 views
A 2000 kg truck traveling due north 10 m/s is hitby a 1200 kg car driven by a crazy driver traveling due east 25 m/s out of a
1. 1 answer
2. asked by John
3. 368 views
A sports store makes a profit of $50 on every pair of cross-country skies sold and $125 on every set of snowshoes sold. The
1. 1 answer
2. asked by Thnx
3. 493 views
it takes 90 mintues to wash 20 vehicles at a car wash. at this rate how many minutes does it take to wash 5 vechicles.
1. 1 answer
2. asked by bright
3. 309 views
Solve each equation on the given interval. If answers can be exact, leave the exact. If approximations are required, round
1. 5 answers
2. asked by Walter
3. 355 views
Camphor melts at 179.8C and has a Kf = 40.0 C/m. When 0.186 g of an unknown nonvolatile nonelectrolyte is dissolved in 22.01 g
1. 1 answer
2. asked by Anonymous
3. 283 views
1. When the net is folded into the rectangular prism shown beside it, which letters will be on the front and left side of the
1. 43 answers
2. asked by Connexus
3. 9,687 views
The denominator of a fraction is 4 more than the numerator. If both the numerator and the denominator of the fraction are
1. 1 answer
2. asked by Kenner
3. 206 views
Consider the reaction mechanism below:2 BF3 → B2F6 slow B2F6 + NH3 → BF3 + F3BNH3 fast a. What is the overall reaction that
1. 1 answer
2. asked by Anonymous
3. 348 views
Have you ever seen the lights downtown during the holidays they are amazing.(1 pt) run-on sentence Our neighborhood looks really
1. 6 answers
2. asked by htsrhtdyjy
3. 4,063 views
The life of light bulbs is distributed normally. The variance of the lifetime is 225 and the mean lifetime of a bulb is 590
1. 1 answer
2. asked by Anonymous
3. 643 views
1. A length of rope is stretched between the top edge of a building and a stake in the ground. The head of the stake is at
1. 11 answers
2. asked by Connexus
3. 2,761 views
Function h(t) = sin (t) cos(pi/6)+sin(pi/6)cos(t) represents height of a wave in an ocean, where h, is height in meters, and t,
1. 1 answer
2. asked by Albert
3. 414 views
A 16.0 kg canoe moving to the left at -12.5 m/s makes an elastic head on collision with a 14.0 raft movingto the right at 16.0
1. 1 answer
2. asked by Braxson
3. 912 views
Why do you turn your back on Me, O children? How else will you get eternal life?
1. 1 answer
2. asked by God
3. 1,297 views
1. If ΔRST symbol ΔNPQ, then RT line is congruent to _____. (1 point)A. NP B. NQ C. PQ D. QP
1. 2 answers
2. asked by Connexus
3. 1,066 views
Solve the system below using the substitution method y=2x^2+7x-1 14+2y=24x Please show all you work.
1. 1 answer
2. asked by Thnx
3. 329 views
If 3x^2+3x+xy=4 and y(4)=−14,find y'(4) by implicit differentiation.
1. 3 answers
2. asked by Ellie
3. 583 views
Write the system of equations for the following scenario:The sum of twice the square of the first number plus the second number
1. 2 answers
2. asked by Thnx
3. 459 views
1. Which of these transformations are isometries? The diagrams are not drawn to scale.*two pictures* (I) parallelogram EFGH →
1. 18 answers
2. asked by Connexus
3. 6,542 views
1. Two horizontal lines are shown. The top one is a dashed line. A diagonal line passes through both of them and points are
1. 1 answer
2. asked by Connexus
3. 1,033 views
1. A statement that can be expressed in if-then form is a (1 point)A. converse. B. conditional. C. biconditional. D.
1. 5 answers
2. asked by Connexus
3. 3,034 views
1. A(n) ______ shows a corner view of a three-dimensional figure. (1 point)A.net B. orthographic drawing C. isometric drawing D.
1. 11 answers
2. asked by Connexus
3. 3,898 views
A spinner with 15 equal parts is spun one time what is the probability that the result is a multiple of 6 or 4
1. 2 answers
2. asked by Jack
3. 2,025 views
There is no mail delivery on holidays. Tomorrow is Thanksgiving. So I know my student loan check won't be delivered.
1. 1 answer
2. asked by Aly
3. 344 views
2. what is the most likely reason the artist used the color red in the art?A) to create contrast to attract the viewer's
1. 4 answers
2. asked by Michael Jackson
3. 901 views
Which trend is true regarding China’s ECONOMIC impact on transportation use
1. 1 answer
2. asked by Laney
3. 526 views
A man pushes a box , initially at rest towards another man by exerting a constant horizontalforce of magnitude 5N through a
1. 2 answers
2. asked by Areeb
3. 560 views
8.99g of scandium and 8.99g of oxygen react to give scandium oxide and a left -over of oxygen 4.19g, what percentage by mass, of
1. 2 answers
2. asked by Peace
3. 1,162 views
Find the fifth terms of the G.P is 4,4/3,4/9
1. 1 answer
2. asked by Find the fifth terms of G.P 4,4/3,4/9
3. 186 views
A company selling widgets has found that the number of items sold, depends upon the price, at which they're sold, according to
1. 1 answer
2. asked by Ellie
3. 398 views
I am supposed to be doing the Writing a Argument Portfolio for Language Arts, but I can't seem to understand what to do. I've
1. 7 answers
2. asked by Izzy
3. 618 views

Back to December 2021

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024