Archives
2021
March

Questions Asked on March 4, 2021

Investigating Gravity quick checkA student is investigating gravity and falling objects. She drops three balls and times how
1. 43 answers
2. asked by CocoMelon
3. 26,415 views
Which option describes a reason that an author of a narrative might describe events out of the order in which they occurred?A.
1. 39 answers
2. asked by Moon
3. 13,494 views
hey, again I do this my way...Lesson 11: Details Quick Check Language Arts 6 B Unit 7: Writing a Narrative
1. 33 answers
2. asked by First Name here...
3. 5,644 views
Which of the following is the Spanish word for “dinner”?
1. 12 answers
2. asked by Homework Helper
3. 5,335 views
Which option describes a transition?(1 point)a period of time during which events occur the logical order in which events occur
1. 14 answers
2. asked by Anonymous
3. 4,276 views
Determine whether each characteristic describes first person, third person limited, or third person omniscient point of view.
1. 18 answers
2. asked by Serenity
3. 3,426 views
What are the coordinates of the vertex of the graph is it maximum or minimum?
1. 3 answers
2. asked by Alyssa
3. 3,138 views
A current of 45A is pass through a solution of gold salt for 1hours 45minute. Calculate Mass of gold deposited, b) number of
1. 6 answers
2. asked by Abimbola
3. 2,920 views
2KClO3----->KCl2 +3O2the equation is balanced How many grams of O2 will be formed from 3.76 grams of KClO3? How many grams of
1. 3 answers
2. asked by Anonymous
3. 2,901 views
What is the voltage if a resistance of 25 ohms produces a current of 250 amps
1. 4 answers
2. asked by kent
3. 2,730 views
Read this excerpt from “Incidents in Life of a Slave Girl.”I went about my evening work with trembling steps. Mr. Flint
1. 18 answers
2. asked by aCK
3. 2,583 views
write an equation of the line that passes through (2, -1) and (-3,3).
1. 5 answers
2. asked by Jennifer
3. 2,298 views
1.Which is a set of collinear points?Two lines intersect at point H. One line goes through points L and J. The other line goes
1. 5 answers
2. asked by KitKat;)
3. 1,979 views
600 people in the audience5/6 are older than 10 years. What fraction in the audience are younger than 10 years
1. 10 answers
2. asked by Slondiwe
3. 1,884 views
Eight holiday lights are connected in parallel as shown in Fig.3. a. If the set is connected to a 120 V source, what is the
1. 2 answers
2. asked by Royston Tasher
3. 1,857 views
For 4 weeks, William volunteered as a helper for swimming classes. The first week, he volunteered for 8 hours. He volunteered
1. 1 answer
2. asked by Anonymous
3. 1,823 views
Tire bicycle window house explained the relationship in the analogy
1. 1 answer
2. asked by Hannah
3. 1,768 views
fractions between 1/3 and 2/3
1. 1 answer
2. asked by retwer
3. 1,739 views
Rule 1: Multiply by 3 starting from 10. Rule 2: Subtract 7 starting from 58. What is the first term that appears in both
1. 7 answers
2. asked by Darian K. Thomas
3. 1,678 views
Select the letter that best answers each question. Use the formula for the area of a trapezoid to help you solve the problems.1.
1. 9 answers
2. asked by Just a friendly Kid
3. 1,563 views
Does a reaction occur when aqueous solutions of chromium(II) sulfate and potassium hydroxide are combined?
1. 1 answer
2. asked by Andres
3. 1,547 views
A piece of square paper has a perimeter of 32 centimeters. Nicky's dog, Rocky, tore off 1/4 of the paper. What is the area of
1. 1 answer
2. asked by Anonymous
3. 1,495 views
Suppose that you flip a coin 11 times. What is the probability that you achieve at least 4 tails?
1. 2 answers
2. asked by Sky
3. 1,473 views
The height of the cylinder is 10 centimeters. The circumference of the base of the cylinder is 8pi centimeters. Which
1. 1 answer
2. asked by mya
3. 1,459 views
How should the fossils in the sediment layers of Earth appear if species have evolved over time?
1. 5 answers
2. asked by Mackenzie B.
3. 1,396 views
What were the events leading up to World War II and how did they impact the start of the Cold War?An entirely new question about
1. 0 answers
2. asked by Tyler
3. 1,371 views
Which is NOT one of the 5 essential functions of inquiry?Helps students "know how we know" in science Develops dispositions to
1. 1 answer
2. asked by may
3. 1,362 views
If point C (-2, 3) is translated up 3 units, then what are the coordinates of its image C’ ?A (1, 3) B (-2, 6) C (-2, 0) D
1. 1 answer
2. asked by Camille
3. 1,361 views
A chord length 14cm is midway a radius of a circle.calculate the radius of a circle
1. 1 answer
2. asked by Ay
3. 1,283 views
Has anyone done the sample work "Algebra 1B Unit 4 Graphing Quadratics"?
1. 2 answers
2. asked by detox
3. 1,262 views
Answer the question with a complete sentence. Write your answer in Spanish.¿Dónde duermes?
1. 2 answers
2. asked by John
3. 1,212 views
what is the measurement of each interior angle of a heptagon
1. 1 answer
2. asked by nina
3. 1,194 views
Which passage from "The Lady or the Tiger” is an example of exposition?
1. 5 answers
2. asked by some guy
3. 1,193 views
Given The historical Context of "The Land" how is the way Robert behaves towards Paul surprising?How does the historical setting
1. 13 answers
2. asked by Fox Girl
3. 1,181 views
what is the circumference of the circle round your answer to the nearest foot?this is a circle with 28 ft in the middle A. 88 B.
1. 4 answers
2. asked by Confused turkey
3. 1,103 views
Which expressions can be added to find the volume of the solid figure?Select all that apply. A solid shape is made up of 2
1. 4 answers
2. asked by K.P.E
3. 1,086 views
What was the purpose of the War Productions Board?A. to tell the factories how many planes or tanks each factory had to produce
1. 4 answers
2. asked by Kungowo Shintari
3. 1,050 views
On Wednesday, a local hamburger shop sold a combined total of 544 hamburgers and cheeseburgers. The number of cheeseburgers sold
1. 1 answer
2. asked by JULY
3. 1,046 views
In mayfield, the taxi fare is $3.50 for the first mile and an additional $.50 for each mile after the first. You plan to give
1. 1 answer
2. asked by Krista
3. 1,046 views
For the reaction 2Na + 2H2O -> 2NaOH + H2, how many grams of hydrogen are produced if there are 48 g of sodiumif you can show me
1. 1 answer
2. asked by Ty
3. 1,038 views
Tyler's brother works in a shoe store. Tyler's brother earns commission. He makes 2.5% of the amount he sells. Last week, he
1. 5 answers
2. asked by taleyah simmons
3. 1,021 views
Mrs. Tran makes 2 gallons of punch for her party. How many cups of punch did she make?(Hint: 1 gallon = ? cups ) 1 gallon =. 4
1. 2 answers
2. asked by looooo
3. 1,007 views
How do different colors of light interact with mirrors? (2 points)
1. 0 answers
2. asked by simpforlevi
3. 969 views
A 36 foot long ribbon is cut into 3 pieces the first piece of the ribbon is half as long he second piece of ribbon the third
1. 1 answer
2. asked by 하림리
3. 956 views
calculate the value of g at 1000m above the surface of the earth. The radius of the earth is 6378.1km👍 👎
1. 6 answers
2. asked by B
3. 945 views
The perimeter of a rectangle is 122 cm. The length is ten more than twice the width. What are the dimensions?
1. 2 answers
2. asked by Nick
3. 937 views
Thank you!!1.Explain (not describe) the solubility behavior of table salt in water. 2. Explain (not describe) the behavior of
1. 1 answer
2. asked by Thomas
3. 922 views
Use exponents to write the numbers 81 and 64 in as many different ways as you can. Then write 64/81 using exponents in as many
1. 2 answers
2. asked by k
3. 899 views
14Elena has 66 yards of ribbon. 1/4 yard of ribbon to make a bow. How many bows can she make with the ribbon that she has?
1. 4 answers
2. asked by zack
3. 887 views
This is for lesson 9 unit 2 science test: The current atomic model would be revised if A:better microscopes were being used to
1. 3 answers
2. asked by Jjjjj
3. 875 views
Guys I need help, please!A Ritual Box Tibetan The Walters Art Museum, Baltimore. Match the image with the appropriate
1. 11 answers
2. asked by Lol you wish you knew
3. 867 views
Which of these is an example of an abiotic factor?A creosote plant B rocky desert soil C kangaroo rat D coyote
1. 1 answer
2. asked by kk❤️❤️🥰
3. 866 views
Find the surface area of the solid figure
1. 2 answers
2. asked by Anonymous
3. 854 views
PLEASE HELP! Answer the following in several complete sentences:Identify the positive and negative consequences of diagnostic
1. 1 answer
2. asked by April
3. 849 views
Which of the following world events prompted large numbers of non-Europeans to move to Europe after World War II?A. the Cold War
1. 6 answers
2. asked by anonymous
3. 831 views
A triangular flower garden measure 10m, 15m and 24m. find the area of the garden
1. 2 answers
2. asked by vincent
3. 831 views
Figurative language is a language that(1 point)A. is made up of words that contradict each other. B.goes beyond the words’
1. 5 answers
2. asked by pellowlemon
3. 827 views
A puddle of water on the sidewalk evaporates and becomes water vapor. The water vapor travels through the air and comes into
1. 5 answers
2. asked by kat
3. 825 views
Explain how vacuum flask construction minimizes heat exchange with the surroundings
1. 3 answers
2. asked by Blessing
3. 813 views
Balanced equation of Fe(NH4)2(SO4)2.12H2O+KMnO4+H2SO4
1. 0 answers
2. asked by Sammy
3. 811 views
DE bisects BC. If BC = 5x - 3 and CE = 2x + 25, find the value of x
1. 2 answers
2. asked by Bee
3. 795 views
Solve 9=v÷5.The solution is v=
1. 4 answers
2. asked by Saraya
3. 788 views
In one or two sentences, make and justify a claim about the frequency of a wave if the wavelength increases and the velocity
1. 3 answers
2. asked by Can I get a "OWA OWA?"
3. 768 views
Mitchell is taking a 500-mile road trip. If he is 48% of the way there, how many miles has he driven?
1. 2 answers
2. asked by looooo
3. 767 views
What factors helped the economies of the Muslim empires prosper?I need help
1. 2 answers
2. asked by RIP UwU
3. 750 views
Given The historical Context of "The Land" how is the way Robert behaves towards Paul surprising?How does the historical setting
1. 1 answer
2. asked by Fox Girl
3. 749 views
3. The population P (in thousands) of a colony of rabbits at time (t) years is given byP(t) = 5 + ae−bt, t ≥ 0 where a and b
1. 1 answer
2. asked by AVENUE
3. 748 views
There are 35 boys out for football. This is about 5% of the total enrollment. How many total kids are in the school?
1. 2 answers
2. asked by money is a good 😌 for
3. 748 views
Hi, I really need help with these questions, I wanna get my grade up. Please do not just give me the answers, Id like to know
1. 4 answers
2. asked by Turg
3. 739 views
What is the percent of the rectangle NOT SHADED?7/10 shaded A 7% B 70 % C 3% D 30%
1. 2 answers
2. asked by looooo
3. 737 views
Benny spent half of his allowance going to the movies. To make more money, he washed the family car and earned more 6 dollars.
1. 2 answers
2. asked by jacob
3. 736 views
What can readers infer from the following quote from Act V, Scene 3 of Romeo and Juliet?Prince: A gloomy peace this morning with
1. 0 answers
2. asked by ack
3. 736 views
How can you use an equation to make a prediction from a pattern
1. 1 answer
2. asked by okay
3. 733 views
which of the following situations can be represented by 14/5
1. 1 answer
2. asked by Anonymous
3. 727 views
Kimiko has a pet salamander. She notices that part of his tail is missing. After a while, Kimiko sees that her salamander has
1. 2 answers
2. asked by chis
3. 724 views
Can someone check over my answers for the area of a circle quick checkso my first answer was 25.12 my 2nd answer was 1017 cm2
1. 3 answers
2. asked by bonjour
3. 704 views
. The Haber process for the synthesis of ammonia is kinetically and thermodynamically controlled.N2(g) + 3 H2(g) f 2 NH3(g) for
1. 3 answers
2. asked by Jay
3. 645 views
which formula should be used to find the area of the composite shape? choose all that applyA=4(1/2xbh)+lw A=4bh+lw A=2bh+lw
1. 3 answers
2. asked by NEEDS HELP
3. 639 views
This diagram shows the dimensions of a plastic tab used in a toy.What is the volume of the plastic tab? Enter your answer in the
1. 1 answer
2. asked by JENNA
3. 621 views
There are 70 historical fiction books in the school library. Historical fiction books make up 110 of the library’s collection.
1. 2 answers
2. asked by 🕴🏿somUng
3. 617 views
why is the equator region the hottest part of the earth’s surface?
1. 1 answer
2. asked by Anonymous
3. 613 views
One side of a rectangle is 5 inches and the other side is x inches. What values of x will make the perimeter at least 26
1. 1 answer
2. asked by noah
3. 611 views
Forty-six percent of people believe that there is life on other planets in the universe. A scientist does not agree with this
1. 0 answers
2. asked by Isabella
3. 607 views
There are 720 apple trees, peach trees and lemon trees altogether in an orchard. The number of apple trees is 2 times the number
1. 1 answer
2. asked by Anonymous
3. 594 views
The change c of a telephone company is partly constant and partly varies as the number of units of call u. The cost of 90units
1. 4 answers
2. asked by Ayomide
3. 583 views
calculate the number of mole of cacl that can be obtained from 30g of caco3 in the presence of excess Hcl(Ca
1. 2 answers
2. asked by Michael
3. 580 views
Write a rule for the table belowHours Number of Bacteria 1 32 2 256 3 2048 4 16384 5 131072 6 1048567
1. 1 answer
2. asked by Avisibleghost
3. 552 views
what is the image of -3,5 under the Translation of what
1. 2 answers
2. asked by arianna
3. 548 views
A rectangular prism has a base that measures 5 centimeters by 3 centimeters and a height of 2 centimeters. Cameron fills the
1. 1 answer
2. asked by Coogle
3. 532 views
Mary wants an 80% on her ﬁnal exam to keep an A for the semester. The exam has 75 questions. How many questions is Mary
1. 1 answer
2. asked by Anonymous
3. 528 views
A foam cooler of negligible mass contains 1.75 kg of water. Ice from a refrigerator at -15°C, is then added to the water in the
1. 0 answers
2. asked by Please
3. 514 views
Two watermelons and three honeydews cost $48. The cost of eachhoneydew is twice as much as each watermelon. What is the cost of
1. 1 answer
2. asked by Anonymous
3. 509 views
Because Moon’s rotation and revolution times are so close, the Moon appears to us on Earth to ____________________ the same
1. 2 answers
2. asked by lee
3. 508 views
Steven was beginning his training to run a half marathon. He ran 6 1/2 miles on Sunday, 5 1/4 miles on Tuesday, 7 miles on
1. 1 answer
2. asked by Anonymous
3. 499 views
what challenges do digital artists face
1. 1 answer
2. asked by alex
3. 490 views
A compound is 36.1% water. After drying off the water, the rest is 40.1% oxygen, 39.8% copper, and 20.1% sulfur.
1. 3 answers
2. asked by science
3. 489 views
Spheres A, B, and C have charges +8.0 C, +12.0 C, and -5.0 C, respectively. The three spheres are allowed to touch each other
1. 0 answers
2. asked by Kristal
3. 489 views
A band that will be the opening act for a concert charges a $500.00 flat fee as well as 10% of all profits from ticket sales. If
1. 1 answer
2. asked by Bri
3. 484 views
For nitrogen molecules, the average translational kinetic energy is what percent of the escape kinetic energy?
1. 0 answers
2. asked by aan
3. 466 views
To find the distance from the house at A to the house at B a surveyor measures the angle ACB which is found to be 50° and then
1. 1 answer
2. asked by Bella
3. 454 views

Back to March 2021

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025