Archives
2018
November

Questions Asked on November 3, 2018

What factors helped the economies of the Muslim empires prosper?
1. 79 answers
2. asked by thepersonwhoneedshelp
3. 13,915 views
What was Muhammad's role in establishing and spreading islam?
1. 37 answers
2. asked by thepersonwhoneedshelp
3. 10,914 views
Use the map to answer the question.Map of agriculture in the South during the 1860's Mostly Cotton Which of the following
1. 12 answers
2. asked by YAY#@!ZOOFUN!@#YAY
3. 6,294 views
A car travels 3km due North, then 5km East.Represent these displacements grafically and determine the resultant displacement
1. 13 answers
2. asked by Abdulhakim
3. 6,262 views
Which option accurately describes the role of trade during the Age of Discovery?4. Explorers such as Ferdinand Magellan sought
1. 4 answers
2. asked by Honey
3. 6,015 views
By what means did Zhou rulers keep control over all the different regions of their kingdom?A. by keeping a strong army ready to
1. 12 answers
2. asked by unknown
3. 5,137 views
A tennis ball machine fires a ball vertically upwards at time t=0 at 19.6 m/s. Assume that air resistance is negligible and take
1. 7 answers
2. asked by Chernet
3. 4,011 views
How were the economies of the Northern and Southern states different? How were they the same? What factors led them to develop
1. 4 answers
2. asked by Warrior Cat Lover
3. 3,443 views
1. To what was the 1836 Constitution of Texas similar?A. Mexican Constitution of 1824 B. Turtle Bayou Resolutions C. Texas
1. 7 answers
2. asked by Wednesday_my_dudes
3. 3,111 views
Which of the following was the Delhi sultanate?A. it was the government of the Mongols in india B. it was the government in the
1. 8 answers
2. asked by thepersonwhoneedshelp
3. 3,069 views
what was Xuanzang's accomplishment?
1. 2 answers
2. asked by thepersonwhoneedshelp
3. 2,892 views
Which religion was dominant in the Ottoman Empire during the Middle Ages?
1. 2 answers
2. asked by Honey
3. 2,794 views
need help now ms sueWhy did the ancient Chinese make loud noises at festivals and during holiday celebrations? A. to show
1. 4 answers
2. asked by unknown
3. 2,521 views
A g.p has 8 terms.If the sum of first 4 terms is 45 and the sum of the last 4 term is 720, find the common ratio and the first
1. 4 answers
2. asked by subash
3. 2,444 views
Maura is making a timeline of important events in Texas history during 1835. Which event should she put last on the timeline?A.
1. 10 answers
2. asked by Wednesday_my_dudes
3. 2,410 views
A ball of mass 0.5kg is dropped from a height of 10m and rebound with a velocity 1/3 of that before impact. The height reached
1. 2 answers
2. asked by Kehinde Emmanuel
3. 2,120 views
Why did Santa Anna decide to attack the Alamo?A. It had a supply of gold. B. It was an important strategic location. C. It was
1. 7 answers
2. asked by Wednesday_my_dudes
3. 2,015 views
Which most accurately describes consequences of the Renaissance in Europe?A. The Renaissance led to the Catholic Church having a
1. 9 answers
2. asked by Fish
3. 1,967 views
The sum of Lisa's age and Myra's age is 19. In 10 years, Lisa will be 5 years older than Myra. How old is each girl now?
1. 3 answers
2. asked by Alice
3. 1,941 views
The speed limit outside a school is 40 km / h. Year 11 students measured the speed of passing vehicles over a period of time.
1. 1 answer
2. asked by Anonymous
3. 1,716 views
What is the value of the greatest of four consecutive integers if the least minus twice the greatest equal 8?Please show the
1. 4 answers
2. asked by John
3. 1,633 views
Problem 2. Hypothesis test between two coins5 points possible (graded)Alice has two coins. The probability of Heads for the rst
1. 1 answer
2. asked by andi
3. 1,616 views
find each quotient1. 1/4 / 3/8 a 1/3 b 2/3 c 3/4 d 3/8 2. 1/3 / 5/6 a 2/3 b 2/5 c 2/6 d 1/5 3. 1 3/4 / 3 a 21/4 b 3 1/4 c 1 4/7
1. 4 answers
2. asked by Kain
3. 1,365 views
5. Phosphorus fertilizers are derived from phosphate rocks, called fluorapatite, Ca5(PO4)3F(s) . Fluorapatite is insoluble in
1. 1 answer
2. asked by Lupe Gomez
3. 1,296 views
two observers P and Q, 75 metres apart observes a kite (k) in the same vertical plane from the same side of the kite. The angle
1. 1 answer
2. asked by ayomide
3. 1,128 views
Enough concentrated sulfuric acid solution was added to provide 3.00 grams of sulfuric acid which dissolved 4.00 grams of pure
1. 1 answer
2. asked by Lupe Gomez
3. 1,084 views
Hydroxyapatite, Ca10(PO4)6(OH)2Ca10(PO4)6(OH)2 , has a solubility constant of Ksp = 2.34×10−592.34×10−59 , and dissociates
1. 2 answers
2. asked by TS
3. 1,078 views
This is for a portfolio that is way overdue, so if I can get some help it'd be great.In what present-day countries can the sites
1. 1 answer
2. asked by Vixen - Connexus
3. 1,011 views
Who wrote a letter from the Alamo? Describe the letter. What was he asking for in the letter? How many Mexican soldiers did he
1. 3 answers
2. asked by ILTHSM_
3. 1,005 views
In a concert hall, 60% of the seats were taken. 520 seats were empty. What is the total number of seats in the concert hall?
1. 2 answers
2. asked by Gary
3. 996 views
Events that occurred before recorded history are_____?Which correctly completes the sentence? 1. prehistoric 2.Neolithic
1. 2 answers
2. asked by Miso
3. 847 views
Which describes the science of extracting metals from rocky ore?metrology metallurgy metal forging metal working
1. 3 answers
2. asked by Miso
3. 798 views
Granda's soup company packages soup that serves 4 in cylindrical cans having a base diameter of 8cm and a height of 10cm. It
1. 1 answer
2. asked by John
3. 790 views
An aeroplane flies horizontally at 80m/s in still air. If the aviator wishes to fly due south and the wind is blowing from the
1. 1 answer
2. asked by Alfred
3. 746 views
Mention ways by which government can protect the interests of their followers
1. 1 answer
2. asked by Edward francisca.
3. 696 views
I need help, I don't know what to write as a thesis statement for a literary analysis of the poem “Aunt Jennifer’s Tigers”
1. 3 answers
2. asked by Sally123
3. 663 views
Hi there,This isn't really, a question. I just want more thoughts about how the U.S. creates domestic policies and conducts
1. 3 answers
2. asked by Jay
3. 649 views
Because every day Americans vote on representatives who in turn vote on legislation, rather than Americans voting on issues
1. 1 answer
2. asked by lydia
3. 631 views
How to prove that the{The integral with limit a to b *(the integral with limit x to b f(t)dt}dx=integral with limit a to b
1. 3 answers
2. asked by Buh
3. 621 views
Mr Smith paid $30,000 for a rectangular lot 1,200 feet wide and 1,600 feet long. What is the approximate cost per square foot?Pl
1. 3 answers
2. asked by John
3. 575 views
line a is parallel to line b and m ∠ 18 = 42. Find m ∠ 20.
1. 1 answer
2. asked by 2 + 2 =
3. 564 views
A man will deposit 6750 in a fund at the end of each 6 months for 10 yrs. Find the size of the fund at the end of 3 yrs if it is
1. 3 answers
2. asked by Lopee
3. 548 views
Ms. Jones borrows 3.120M for 5.5% interest compounded monthly. What is the periodic payment needed after 15yrs?
1. 0 answers
2. asked by Kat
3. 535 views
To provide 250,000, Marlou decided to place equal deposit in a fund at the end of each 6 months. A money is invested at 6%
1. 1 answer
2. asked by Clammy
3. 513 views
What is the molecular structure of water? What are the physical and chemical properties of water?
1. 3 answers
2. asked by somayee
3. 503 views
What did the founders of the United States consider when creating the national government?
1. 5 answers
2. asked by Narha
3. 465 views
what are the main things i need to know in algebra II
1. 1 answer
2. asked by somayee
3. 439 views
9/1-7/11with work thank you i dont understand how i get the mixed number 8 4/11
1. 4 answers
2. asked by somayee
3. 396 views
Find the net single premium for a 50,000 policy issued to a 35 y/o woman using 5 yr term.
1. 1 answer
2. asked by Hou
3. 368 views
What is pi
1. 2 answers
2. asked by Hayy
3. 347 views

Back to November 2018

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025