Archives
2017
November

Questions Asked on November 14, 2017

The 7-digit numbers 74A52B1 and 326AB4C are each multiples of 3. Which of the following could be the value of C ?A) 1 B) 2 c) 3
1. 7 answers
2. asked by dam
3. 4,963 views
explain why it is important to correctly line up numbers according to their place value when doing a division problem
1. 15 answers
2. asked by Eunji
3. 5,060 views
solve the proportion 4/5=x/27
1. 4 answers
2. asked by betty
3. 2,370 views
getting caught is luckygetting caught is the only way to avoid punishment getting caught will help a person correct a mistake A
1. 5 answers
2. asked by Bri
3. 683 views
the difference of two numbers is 10. the sum of three times the smaller number and four times the larger is 75. find the numbers
1. 1 answer
2. asked by ella
3. 665 views
How to write an good essay
1. 0 answers
2. asked by munchie
3. 440 views
If a angle measure 2y 3y 4y what is y
1. 0 answers
2. asked by munchie
3. 373 views
A 5 gram sample of a gaseous substance occupies10 L at 48◦C and 697 torr. What is the density of the gas under these
1. 4 answers
2. asked by Jason
3. 2,050 views
This question is about The Tragedy of Julius Caesar.What are the consequences of Brutus's decision to join the conspirators and
1. 1 answer
2. asked by kitkat
3. 801 views
What is a correct classification of triangle DEF with vertices D(-3, -2), E(-2, 3), and F(1, 0)?
1. 1 answer
2. asked by Richie
3. 717 views
1. 23/40 - 11/30 (1 point)A. 0 B. 1 C. 1/2
1. 33 answers
2. asked by no name 4 u lol
3. 5,312 views
Graph f (x) = 3cos (4pix -pi/2) -2
1. 2 answers
2. asked by Jessica
3. 686 views
Which of the following are possible statistically significant findings from a 2 X 2 factorial design?a. two main effects but no
1. 0 answers
2. asked by Ann
3. 485 views
Olympic diver performs a dive from the 10 m platform and achieves a speed of 14 m/s just before entering the water. Neglecting
1. 1 answer
2. asked by Ashley
3. 1,543 views
If you have an ideal spring with a mass m on it, and you measure a spring constant of8 N/m, what do you expect to happen to the
1. 1 answer
2. asked by Brad
3. 426 views
I'm writing an essay about the play "Antigone".The question is: "Write an essay in which you argue whether Antigone did the
1. 1 answer
2. asked by :)
3. 719 views
How does the geography of Eastern Europe most affect farming in the region?
1. 18 answers
2. asked by kawaii~chan
3. 1,956 views
I'm writing a movie review of the film "Beasts of No Nation." I am struggling to come up with a creative title for it. Any
1. 1 answer
2. asked by Maya
3. 586 views
A particle accelerates from rest at 6.1 m/s2 . What is its speed 4.6 s after the particle starts moving?
1. 1 answer
2. asked by stephanie
3. 611 views
The 7-digit numbers 74A52B1 and 326AB4C are each multiples of 3. Which of the following could be the value of C ?
1. 1 answer
2. asked by dam
3. 619 views
What is family solidarity, and how can it affect a culture?
1. 12 answers
2. asked by Elizabeth
3. 805 views
"Cab companies often charge a flat fee for picking someone up and then charge anadditional fee per mile driven. Pick a U.S. city
1. 6 answers
2. asked by Dave
3. 7,246 views
Cos^2x-sin^2x/sin^4x-cos^4xSimplify
1. 1 answer
2. asked by Jessica
3. 350 views
1. What is the difference in composition between the prokaryotic (E. coli) core polymerase and holoenzyme? How does the E. coli
1. 0 answers
2. asked by Lex
3. 484 views
8+24+√5
1. 3 answers
2. asked by Help i need somebody not just anybody
3. 365 views
THe dumonts take- home pay ( after deductions for taxes and benefits ) is approximately $6045 monthly. currently nonmortgage
1. 1 answer
2. asked by Janey
3. 697 views
Which of the following statements describes the conservation of a natural resource?A. A timber company only cuts some trees down
1. 4 answers
2. asked by Pepsi
3. 3,467 views
Tan 165°Use appropriate identity and evaluate
1. 2 answers
2. asked by Jessica
3. 1,735 views
A force is applied to a 22.5 kg object causing it to move at a constant velocity of 4.2 m/s with a coefficient of friction of
1. 1 answer
2. asked by Anon
3. 534 views
CHECK AND CORRECT MY ANSWERS!! PLEASE!!:D:DWrite the ratio in the simplest form. 45:15 9:3 3:1*** 1:3 4:1 Solve the following
1. 3 answers
2. asked by Anonymous
3. 2,370 views
This question is for the play AntigoneIn the last few lines of Ode 4, the chorus places responsibility for Antigone's death on
1. 4 answers
2. asked by yupp
3. 2,142 views
Light travels at 186,000 miles per second. Light takes about 11⁄3 seconds to travel from the earth to the moon. Calculate the
1. 11 answers
2. asked by princessleaya
3. 3,795 views
It took 3.5 hours for an airplane traveling at a constant speed of 550 miles per hour to reach its destination. What distance
1. 16 answers
2. asked by princessleaya
3. 4,595 views
During his presidency, Thomas Jefferson cut prices on land and encouraged westward settlement. What was Jefferson's motive for
1. 3 answers
2. asked by Trinity
3. 1,995 views
ProveSin 8theta -sin 10theta= cot 9theta (cos 10theta - cos 8 theta)
1. 2 answers
2. asked by Jessica
3. 529 views
the life span of a calculator manufactured by the intel corporation has a normal distribution with a mean of 54 months and a
1. 1 answer
2. asked by Shriya Sharma
3. 838 views
In a 21 meter race between a turtle and a hare, the turtle leaves 8 minutes before the hare. The hare, by running at an average
1. 2 answers
2. asked by Devin
3. 4,659 views
1. Complete the paragraph proofGiven: ∠A and ∠B are complementary, and ∠B and ∠C are complementary Prove: ∠A ≌ ∠C
1. 3 answers
2. asked by Anon
3. 1,726 views
A 17 kg crate is placed on a horizontal conveyor belt. The materials are such that μs = 0.44 and μk = 0.21. A) What is the
1. 1 answer
2. asked by Hayden
3. 1,349 views
Two workers are sliding 450 kg crate across the floor. One worker pushes forward on the crate with a force of 380 N while the
1. 1 answer
2. asked by Zachary
3. 2,691 views
1. I have a talking dog.2. I have a dog that is talking. 3. I have a dog which is talking. 4. I have a dog who is talking.
1. 1 answer
2. asked by rfvv
3. 467 views
Lynn invites some friends for lunch. She needs to cater for 24 people.She decides to make pancakes. How much milk does Lynn need
1. 4 answers
2. asked by Ange
3. 3,843 views
which economic impact did the crusades have on medieval europe?
1. 1 answer
2. asked by Anon
3. 1,303 views
I think it is a trick question as I can not balance this equation .Balance this equation Na(CO3)2+H2SO4=NA(SO4)2+H2O+CO2
1. 0 answers
2. asked by Julia
3. 550 views
A force is applied to a 22.5 kg object causing it to move at a constant velocity of 4.2 m/s with a coefficient of friction of
1. 1 answer
2. asked by Anon
3. 580 views
Fig.19 shows a crane lifting a car of mass 850 kg at constant velocity through a height of 12m in a time of 40s. The crane has a
1. 3 answers
2. asked by cake
3. 3,691 views
A cyclist moves along a horizontal road. She pushes on the pedals with a constant power of 250W. The mass of the cyclist and
1. 1 answer
2. asked by pack
3. 1,489 views
From the list of compounds below identify the molecules (find out the no. of molecules):1) Propanone C3H6O Mr:58 2) Chromium
1. 0 answers
2. asked by cake
3. 431 views
Q14. Describe the fighting during the American Revolution in Georgia with the correct terms:The Battle of Rice Boats started in
1. 3 answers
2. asked by Lexi-girl
3. 587 views
as magma cool,it forms ? rock by the process of ?.
1. 1 answer
2. asked by katarayoung
3. 604 views
ProblemThe data entry clerk is requirTomâ€™s Paper Company Ltd wants to produce a payroll register using a program.ed to
1. 1 answer
2. asked by Calisha
3. 696 views
Ytterbium, atomic number, 70 is the first element in the periodic table to have the first four shells full.work out the number
1. 1 answer
2. asked by cake
3. 1,454 views
bromine has two isotopes Br,79 and Br-81the relative atomic mass of bromine is 79.9 calculate the percentage or br 79 atoms in a
1. 0 answers
2. asked by cake
3. 925 views
In an explosion, a piece of debris is tossed 99 meters N 45 W. what is the displacement in the north and west directions. I'm
1. 1 answer
2. asked by Zackary
3. 728 views
Describe the fighting during the American Revolution in Georgia with the correct terms: The Battle of Rice Boats started in 1776
1. 6 answers
2. asked by Lexi-girl
3. 712 views
Question 7The first three terms of a geometric sequence are as follows. 10,30,90
1. 2 answers
2. asked by shriek
3. 2,094 views
find the cost of sending 25 text messages.
1. 1 answer
2. asked by Aaliyah
3. 699 views
what does the excerpt say about Washington's views on political parties
1. 2 answers
2. asked by jake pls help!!
3. 3,151 views
In a class, 2/7 of the pupils are girls. 1/2 of the girls and 1/3 of the boys in the class wear glasses. If 10 boys wear
1. 2 answers
2. asked by Mazhar
3. 2,418 views
6y=3=32y=2=2 9x=2=2 7x=2=2 5x= 12y= 13x= 6y=
1. 1 answer
2. asked by Riliwan
3. 442 views
Can someone explain how to answer these questions given the different variables given? I have a test soon.Dr. Martin Brenner and
1. 4 answers
2. asked by Allie
3. 961 views
Find the volume of the rectangular prism with the dimensions 11 by 9 by 3. 23 in 297 in 318in 159in I think the answer is c 318
1. 29 answers
2. asked by 360 nocsope
3. 12,429 views
Kyle types college reports for $2.15 per page. He also charges $5 to cover the cost of supplies. Write an expression for total
1. 4 answers
2. asked by Bella
3. 944 views
A car with a 65cm diameter wheel travels 3.0km. How many revolutions does the wheel make in this distance?
1. 1 answer
2. asked by Lala
3. 545 views
For the reaction 2HI(g) <----> H2(g) + I2(g),Kc = 0.0198 at 721K. What is the HI concentration at 721K if [H2] = 0.120 M and
1. 0 answers
2. asked by Annika
3. 511 views
If a scientists is looking at a circle of 1.15 millimeters in diameter, how much of the circle can he see in centimeters?
1. 1 answer
2. asked by Susan
3. 429 views
1.in Microsoft®️ execel graphs are refered to as?a. sparklines b. illustrations c. tables d. charts 2. What is one of the
1. 7 answers
2. asked by Girl Gamer
3. 2,267 views
Carolina runs 3 1/2 miles in 22 1/4 Minutes. how many miles does she run per minuteA.) 3/22 mike per minute B.) 62/221 mile per
1. 4 answers
2. asked by CC
3. 941 views
At room temperature, 20° C, water (H2O) is a liquid and oxygen (O2) is a gas. Based on kinetic molecular theory, which answer
1. 2 answers
2. asked by yo
3. 1,110 views
when a tennis ball is served, it is a contact with the racket for a time that is typical 0.005 seconds. find the force needed to
1. 1 answer
2. asked by tasha
3. 1,162 views
What is the average useful power output of a person who does 5.50×106 J of useful work in 6.50 h?Working at this rate, how long
1. 1 answer
2. asked by stephanie
3. 3,328 views
Nasreen is designing an obstacle course that includes two ladders leaning against a pole. In order for the ladders to fit in the
1. 2 answers
2. asked by Trig
3. 1,270 views
A 77.6 kg ice skater is skating along in a straight line (in the positive direction) at 10.3 m/s when he bends down and scoops
1. 1 answer
2. asked by stephanie
3. 751 views
Calculate the force needed to bring a 1070–kg car to rest from a speed of 89.0 km/h in a distance of 110 m (a fairly typical
1. 3 answers
2. asked by stephanie
3. 702 views
Suppose a 300–g kookaburra (a large kingfisher bird) picks up a 77.0–g snake and raises it 2.70 m from the ground to a
1. 1 answer
2. asked by stephanie
3. 701 views
How much work is done by the boy pulling his sister d = 25.0 m in a wagon as shown in figure below? Assume no friction acts on
1. 1 answer
2. asked by stephanie
3. 1,902 views
Which of the following functions like a fulcrum in a lever?A:tendons connecting a muscle to a bone at a joint. B:ligaments
1. 1 answer
2. asked by Jamie
3. 1,029 views
In the nail puller shown in the figure below you exert a force 53.2 cm from the pivot and the nail is 1.50 cm on the other side.
1. 0 answers
2. asked by stephanie
3. 582 views
How did the constitution most likely encourage immigration?A. By guaranteeing individual rights and freedoms B. By opening the
1. 5 answers
2. asked by Some Dude
3. 570 views
Two children push on opposite sides of a door during play. Both push horizontally and perpendicular to the door. One child
1. 1 answer
2. asked by stephanie
3. 1,734 views
When opening a door, you push on it perpendicularly with a force of 55.4 N at a distance of 0.728m from the hinges. What torque
1. 1 answer
2. asked by stephanie
3. 651 views
A supertanker (mass = 1.57E+8 kg) is moving with a constant velocity. Its engines generate a forward thrust of 7.47E+5 N.
1. 5 answers
2. asked by stephanie
3. 1,084 views
If a substance is a mineral, how could you identify what type of mineral it is?help me!!
1. 2 answers
2. asked by princessleaya
3. 716 views
What are major differences between ancient Aksum and modern day Ethiopia???? Need help fast!!!!!!
1. 2 answers
2. asked by Joe
3. 590 views
At room temperature, 20° C, water (H2O) is a liquid and oxygen (O2) is a gas. Based on kinetic molecular theory, which answer
1. 1 answer
2. asked by Britt
3. 1,827 views
Which of the following is not an example of a physical property of a substance?density combustion solubility freezing point thx
1. 1 answer
2. asked by hi
3. 814 views
A supertanker (mass = 1.57E+8 kg) is moving with a constant velocity. Its engines generate a forward thrust of 7.47E+5 N.
1. 4 answers
2. asked by larry
3. 544 views
Hey guys, I would appreciate it if y'all took some time to answer this for me. Thanks ahead of time!!I am involved in many
1. 2 answers
2. asked by LR
3. 709 views
When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration,
1. 1 answer
2. asked by gary lee
3. 716 views
If the demand function=9000-30p and the cost function=90000+30x then find break even point
1. 4 answers
2. asked by ibsaa
3. 1,180 views
A car with a 65cm diameter wheel travels 3.0km. How many revolutions does the wheel make in this distance?
1. 1 answer
2. asked by Lala
3. 528 views
Where did the most immigrants to the United States come from prior to the Civil War?Please help!
1. 1 answer
2. asked by Some Dude
3. 469 views
A charged capacitor,C=10e-6 F, with an initial stored energy of 3.5J, is discharged across a resistor, R. The charge on the
1. 1 answer
2. asked by Taj
3. 590 views
When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration,
1. 0 answers
2. asked by gary lee
3. 640 views
How can the constitution be amended??I don't understand?
1. 17 answers
2. asked by Madison/kayla
3. 6,345 views
1. The breaking down or disintegration of substances such as rocks and minerals by physical, chemical, or biological processes
1. 23 answers
2. asked by boi
3. 5,881 views
When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration,
1. 1 answer
2. asked by gary lee
3. 798 views
When 9.6 grams of NaBr are dissolved in enough water to create a 165-gram solution, what is the solution's concentration,
1. 2 answers
2. asked by gary lee
3. 922 views
Sin 8theta -sin 10theta= cot 9theta (cos 10theta - cos 8 theta)
1. 3 answers
2. asked by Jes
3. 707 views
A 20.0-kg crate sits at rest at the bottom of a 20.0 m -long ramp that is inclined at 40 ∘ above the horizontal. A constant
1. 1 answer
2. asked by Klas
3. 914 views

Back to November 2017

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024