Archives
2017
October

Questions Asked on October 7, 2017

Which best describes Christianity’s influence on the feudal system in Europe?the Christian church's promotion of democratic
1. 22 answers
2. asked by malia
3. 12,432 views
In a class of 83 students, 72 are present. What percentage of the students are absent? Provide answer up to two significant
1. 2 answers
2. asked by Bella
3. 3,985 views
Ray BD bisects ∠ABC so that m∠ABD = 5y – 3 and m∠CBD = 2y +12. Find the value of y.The midpoint of Line Segment AB is
1. 3 answers
2. asked by Anon
3. 3,550 views
If x=loga(bc), y=logb(ca), and Z=logc(ab). Prove that x+y+Z=xyZ-2
1. 1 answer
2. asked by Abass
3. 3,452 views
What is the repeating decimal 0.7777.... as a fraction in simplest form?
1. 3 answers
2. asked by Khalessi
3. 3,227 views
ST=x+3 and TU=4x-6 what is the value of ST and SUI know ST=6 and SU=12, but I'm not sure how to do the problem, can someone
1. 5 answers
2. asked by Ember Lovet
3. 2,407 views
I am so confused, please help!!∠1 and ∠2 are supplementary angles. m∠1= 11a+19. m∠2 = 6a – 9. Find m∠2.
1. 3 answers
2. asked by Anon
3. 2,361 views
Two factory plants are making TV panels. Yesterday, Plant A produced9000 panels. Ten percent of the panels from Plant A and 3%
1. 1 answer
2. asked by Sarah
3. 1,785 views
The Chinese civilization has provided many innovations. Some of these innovations includethe development of paper (1) medicines
1. 7 answers
2. asked by malia
3. 1,602 views
Ralph needs to earn a B in his Geology class. His current test scores are82,83, 90, and 77. His final exam is worth 4 test
1. 3 answers
2. asked by SAM
3. 1,501 views
Suppose a cell of volume V cc is surrounded by a homogeneous chemical solution of concentration C g/cc. Let y denote the
1. 2 answers
2. asked by Catherine
3. 1,321 views
It is known that a>0 and b<0. Compare the values of the following expressions to zero:ab^2 i dont understand why i always get
1. 2 answers
2. asked by Ashly
3. 1,321 views
Of the students in Rosalie’s dance class, 29 out of 59 have participated in dance class before. About how many of her students
1. 6 answers
2. asked by Kinaya
3. 1,259 views
how did the agricultural revolution impact religion and culture?
1. 3 answers
2. asked by malia
3. 1,210 views
IF 8.5g of KOH powder are placed in 100g of water at room temperature of 20degree Celsius, what is the final temperature of the
1. 2 answers
2. asked by Meena
3. 1,127 views
A 76 kg rock is rolling horizontally at the top of a vertical cliff that is 20m above the surface of lake.the top of the
1. 0 answers
2. asked by rebika
3. 1,018 views
The sum of the last three terms of a G.P having n terms is 1024 times the sum of the first three terms of the progression. If
1. 3 answers
2. asked by Abass
3. 995 views
If I’m enlarging a photo from 5 width x 7 length , to 21 inches long, how wide will the print be?
1. 1 answer
2. asked by Linda
3. 974 views
A person walks in the following pattern: 2.8 km north, then 2.9 km west, and finally 5.5 km south. (a) How far and (b) at what
1. 3 answers
2. asked by yousef
3. 966 views
HELP!!!A box rest on an incline making a 34 angle with the horizontal. It is found that a parallel force to the incline of at
1. 4 answers
2. asked by Randy
3. 754 views
Special telescopes, such as the Chandra X-ray Telescope, help astronomers see different kinds of electromagnetic radiation
1. 1 answer
2. asked by maddie
3. 701 views
Part A: For what real values of c is x^2 + 16x + c the square of a binomial? If you find more than one, then list your values
1. 2 answers
2. asked by Aria
3. 695 views
The length and breadth of a rectangular are in the ratio 5:3 .If the cost of reaping the field at 85 paise per square metre is
1. 1 answer
2. asked by Anonymous
3. 659 views
Write a let statement Debra has $67 in loonies and toonies. If there are 45 coins in total, how many loonies are there
1. 2 answers
2. asked by Variables
3. 634 views
In a straight 3 lottery you choose a 3 digit number. A 3 digit number is chosen at random, If your number mataches you win $250.
1. 1 answer
2. asked by Morgan
3. 632 views
The pricing of pharmaceutical products can be controversial. A recent example is EpiPenproduced by Mylan which is used to treat
1. 0 answers
2. asked by Claudia
3. 627 views
Special telescopes, such as the Chandra X-ray Telescope, help astronomers see different kinds of electromagnetic radiation
1. 1 answer
2. asked by maddie
3. 615 views
A company's stick lost $3.15 of its value each day for 5 consecutive days. What was the total change in the stock price?
1. 1 answer
2. asked by Jayla
3. 613 views
in a survey of 900 people, 620 approved of the current mayor. Judging from this sample, what is the mayor's percentage approval?
1. 1 answer
2. asked by Bo
3. 602 views
Can you check my answer?4. Solve. 6 tenths = ___ thousandths Answer = 600 5. Write 347.392 in expanded form. Answer:
1. 4 answers
2. asked by Jared
3. 588 views
A taut massless string connects two boxes as shown in the figure. The boxes are placed on an incline plane at θ = 31.00. What
1. 2 answers
2. asked by Randy
3. 576 views
and for this one I got no clue:By what percent will the fraction increase if its numerator is decreased by 10% and denominator
1. 1 answer
2. asked by Ashly
3. 574 views
Simplifyi^1+i^2+i^3+... i^97 + i^98+i^99
1. 2 answers
2. asked by Jane
3. 559 views
In what way does Saudi Arabia play an important role in foreign and security aspects in the Middle East
1. 1 answer
2. asked by Amy
3. 545 views
Question from lab regarding Conservation of EnergyWhy doesn't the potential energy of the pulley matter when calculating the
1. 1 answer
2. asked by Brad
3. 530 views
Pretend you are a medical professional and it your job to make an I.V. solution for a patient that has a total cellular solute
1. 0 answers
2. asked by Sal
3. 522 views
There are a lot of components to the question. How can I answer this with a paragraph? Need help.Explain the role of sex
1. 0 answers
2. asked by A
3. 486 views
Devante is 2 years older than Victoria. In 5 years the sum of their ages will be 82. How old is Devante now?
1. 1 answer
2. asked by Anonymous
3. 476 views
Special telescopes, such as the Chandra X-ray Telescope, help astronomers see different kinds of electromagnetic radiation
1. 1 answer
2. asked by maddie
3. 472 views
What volume in liter will be occupied by 162.3 g of carbon monoxide at 273k and 760 torr?
1. 2 answers
2. asked by Tammy
3. 462 views
Calculate the no:of moles of a gas in 44.28L at STP
1. 0 answers
2. asked by Nisha
3. 452 views
No matter what i do i can't seem to find a reasonable answer for this problem! I've done everything I can think of.Block m1( 7
1. 1 answer
2. asked by Randy
3. 447 views
The population of a town decreased from 15,400 to 12,950. What is the percentage decrease?
1. 1 answer
2. asked by Shelly
3. 444 views
why do you fall forward when a moving bus decelerates to a stop ?
1. 1 answer
2. asked by amgad
3. 434 views
What are the long-term effects of banning plastic bags, and who is impacted by this issue or problem?
1. 2 answers
2. asked by UB
3. 426 views
Divide the rational expression.a^3+x^3\2a^3-2a+2x^2÷a^2-x^2\10.
1. 2 answers
2. asked by Keonn`a
3. 419 views
cos(A-B)+cos(B-C)+cos(C-A)=-3/2 then prove that cos A+cos B+cos C=0 and sin A+sin B+sin C=0 and also prove that
1. 1 answer
2. asked by Binoy kumar mahato
3. 417 views
Find both the -intercept and the -intercept of the line given by the equation. Round your answers to decimal places.
1. 1 answer
2. asked by LJ
3. 400 views
Divide the rational expression.x-11\6-x÷x^2-121\x-6
1. 1 answer
2. asked by Keonn`a
3. 386 views
GHOST's are on the earth (yes& no)?
1. 1 answer
2. asked by xddz
3. 385 views
Divide the rational expression.3x^2+8x+5/3x+15÷x^2+4x+3/x^2+8x+15
1. 1 answer
2. asked by Keonn`a
3. 354 views
Find R(x)=f(x)/g(x), where f(x) and g(x) are givenf(x)=2a^2+7a+5/5a+25 g(x)=a^2-2a-3/a^2+2a-15
1. 4 answers
2. asked by Keonn`a
3. 334 views

Back to October 2017

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025