Archives
2017
October

Questions Asked on October 6, 2017

1. What was one reason Tecumseh wanted to form a confederation?A. to end fur trading amongst setters B. to stop the advancement
1. 66 answers
2. asked by plz help
3. 30,408 views
[ number 1 & 2are a rule of sequence ]1: Write a rule for the sequence. 2,6,10,14 a; start with two and subtract four repeatedly
1. 54 answers
2. asked by eri
3. 15,987 views
What is the topic sentence of this paragraph from life without gravity?
1. 88 answers
2. asked by BB
3. 11,409 views
1. What two factors caused retrenchment from 1731-1745?A. Apache raids and poorly timed military cutbacks B. Border disputes and
1. 11 answers
2. asked by Help!
3. 4,894 views
In a study by Peter D. Hart Research Associates for the Nasdaq Stock Market, it was determined that 20% of all stock investors
1. 5 answers
2. asked by Brahmprakash
3. 4,526 views
Rounding to significant figures99.98 to 3 significant figures Can it apply to this number as if I round to 100 this is one
1. 5 answers
2. asked by NJay
3. 4,359 views
In the beginning, the Crusades had been about protecting Christians from the Saracens and reclaiming the city of Jerusalem (1).
1. 13 answers
2. asked by malia
3. 4,165 views
what difficulties did the U.S faced in preparing for war with Britain? select all that apply> France backed out after offering
1. 7 answers
2. asked by need help
3. 3,651 views
5. Which of the following examples best represents how the vice presidency has evolved over time?A. Vice Presidents are now
1. 11 answers
2. asked by Ban
3. 3,249 views
8 is added to a certain number and the sum is multiplied by 3 the result is 57.find the number
1. 7 answers
2. asked by word problem
3. 3,211 views
Determine whether y varies directly with x. If so, find the constant of variation and write the equation.X | Y ------ 1 | -2 3 |
1. 3 answers
2. asked by anon
3. 3,001 views
An estimate for negative square root of 93 is ___A-8.1 B-8.5 C-9.1** D-9.5 Julie is digging a square area in her backyard for a
1. 8 answers
2. asked by Ella
3. 2,863 views
Which Native American group had hunters and gatherers who followed the vast herds of buffalo and relied upon the buffalo for
1. 2 answers
2. asked by Manilla
3. 2,818 views
Each month, Allen pays a total of $150 for both cable TV and internet service. If he were to switch to a rival service provider,
1. 1 answer
2. asked by Azine
3. 2,508 views
if cos(B-C)+cos(C-A)+cos(A-B)=-3/2 then prove that cosA+cosB+cosC=O and sinA+sinB+sinC=O after that prove that
1. 1 answer
2. asked by Binoy kumar mahato
3. 2,337 views
A pole-vaulter just clears the bar at 4.24 m and falls back to the ground. The change in the vaulter's potential energy during
1. 3 answers
2. asked by zack
3. 2,271 views
Corinne was driving erratically and the police stopped her. The officer immediately asked Corinne to take a sobriety test
1. 2 answers
2. asked by Alin
3. 2,254 views
A student collected concentration data to determine the rate of the decomposition of N2O5 to NO2 and O2. The data were recorded
1. 2 answers
2. asked by pre
3. 2,046 views
In his farewell address, what did Washington say about the U.S. forming alliances with specific European countries?A) it would
1. 5 answers
2. asked by SS
3. 2,009 views
Is the equation true, false, or open? 9p+8=10p+7
1. 2 answers
2. asked by Anonymous
3. 1,828 views
A tourist traveled 10 km away from the city by bus, and then continued his journey by foot in the same direction at the speed of
1. 1 answer
2. asked by Sam
3. 1,680 views
Assume that the rate of change of the unit price of a commodity is propirtional to the difference between the demand and the
1. 1 answer
2. asked by Catherine
3. 1,369 views
Let $$f(x) = \frac{x^2}{x^2 - 1}.$$Find the largest integer $n$ so that $f(2) \cdot f(3) \cdot f(4) \cdots f(n-1) \cdot f(n) <
1. 1 answer
2. asked by Help
3. 1,360 views
Find the x intercept and the y intercept: x – 5y = –5I think the y intercept is 1 so do I just substitute?
1. 2 answers
2. asked by Ariana
3. 1,356 views
Consider 30.0 mL of water that has absorbed 1540 J of heat from a chemical reaction. What is the change in temperature that
1. 6 answers
2. asked by AmyTT
3. 1,324 views
In a particular manufacturing plant, two machines (A and B) produce a particular part. One machine (B) is newer and faster. In
1. 0 answers
2. asked by Brahmprakash
3. 1,209 views
How do I find the continuity or discontinuity of a graphed function? I am stuck on this problem and cannot whatsoever get past
1. 1 answer
2. asked by Girly Girl
3. 1,033 views
A box is on a flat plane and has a force of 16 N applied downward to it at an angle of 55 degrees. The box has a mass of 28 kg.W
1. 1 answer
2. asked by Alyssa
3. 987 views
After Louis XVI was executed, Maximilien Robespierre led the Committee of Public Safety in carrying out what became known as the
1. 5 answers
2. asked by Jay
3. 976 views
A particle moving along a straight line with a constant acceleration of -4m/s*2 passes through a point A with a velocity of
1. 0 answers
2. asked by Thousif
3. 842 views
Hello, I have to discuss a topic for my homework. I am having a really hard time finding a discussion starter (for I have a
1. 3 answers
2. asked by Rylie
3. 828 views
Consider a particle initially moving with a velocity of 5m/s starts deaccelarating at a constant rate of 2m/s*2 find the
1. 1 answer
2. asked by Thousif
3. 807 views
Use inverse operations to solve each equation.1. 1.6+y=-7.3 2. -2/3n=12
1. 1 answer
2. asked by Come save me
3. 779 views
Who are some prominent obese role models?
1. 2 answers
2. asked by Jen
3. 762 views
Solve by using your knowledge of the Distributive Property and combining like terms.1. 5x-(9x-10)=34 -4x-10=34 -4x=44 X=-11 Did
1. 4 answers
2. asked by Stephon
3. 759 views
what do political cartoons tell anyone about the U.S. government’s approach to immigration regulation during the 19th century?
1. 3 answers
2. asked by Anonymous
3. 746 views
How should the success of the United States be evaluated and measured? What tools or data should be used to do this? What are
1. 4 answers
2. asked by Gurl nerd
3. 711 views
1. He helped to organize the party.2. He helped to arrange the party. 3. He helped to prepare the party. 4. He helped to prepare
1. 1 answer
2. asked by rfvv
3. 697 views
A is the doubling time for y=26e^0.5t, and B is the doubling time for y=13e^0.5t. Then(a) A=2B (b) B=2A (c) A=B (d) A=(ln2)B The
1. 1 answer
2. asked by Kiki
3. 650 views
1. A chemist conducted a recrystallization on 18.5 g of a solid and collected 11.2 g as a first crop. She re-cooled the mother
1. 1 answer
2. asked by Parm
3. 649 views
You know the population of your nation was 151 million in 1990 and173 million in 2000. Use the model f(t) = P e^rt to model your
1. 1 answer
2. asked by Kristian
3. 635 views
Jack has 1 1/2 pound cake.He wants to cut it in to 2/3 equal pieces.how many pieces will he have and what fraction is he left
1. 1 answer
2. asked by Liya
3. 634 views
1. Solve for x.4(x – b) = x b= 4/3x b=3/4x x=4/3b x=3/4b Solve for y, then find the value of y when given x = –2. 6x = 7 –
1. 11 answers
2. asked by Christopher wood
3. 603 views
Find the midpoint of the line segment with endpoints (-5, 7) and (9, -3)
1. 1 answer
2. asked by Ariana
3. 603 views
can someone give me an example of an ancient civilization who created culture and religion during the agricultural revolution.
1. 3 answers
2. asked by malia
3. 591 views
1. He helped Mother wash the dishes.2. He helped Mother with the dishes. 3. He helped his brother study math. 4. He helped his
1. 1 answer
2. asked by rfvv
3. 586 views
A particle travels 10m in 5sec and 10m in 5sec and 10m in 3sec assuming constant acceleration what is the distance travelled in
1. 2 answers
2. asked by Thousif
3. 574 views
can someone give me an example of an ancient civilization who created government and laws during the agricultural revolution.
1. 6 answers
2. asked by malia
3. 569 views
the width of a rectangle is six less than the length the area of the rectangle is 58 square feet write and solve and equation to
1. 1 answer
2. asked by Payton
3. 561 views
An Uber fare in Columbus is $3.50 for the first ½ mile and additional mileage charged at a rate of $0.30 for each additional
1. 2 answers
2. asked by MR. needshelp
3. 559 views
A trolley of mass 1.2kg is resting on a smooth surface attached to two identical springs constant k=25Nm-1,on either sides.when
1. 1 answer
2. asked by Zati
3. 554 views
Given that f(150)=100, f'(150)= -2.5, approximate the value of f(151.5).The answer is approximately 96.25, but I'm unsure of how
1. 1 answer
2. asked by Kiki
3. 549 views
can someone explain the Mesopotamian culture during the agricultural revolution
1. 8 answers
2. asked by malia
3. 543 views
The Catholic Church condemned Galileo because in his teachings earth and humans were not the center of all things.Identify
1. 1 answer
2. asked by sofie
3. 539 views
Describe the phases of the nitrogen cycle, in the marine environment, starting with the death of a fish.Could someone help me
1. 0 answers
2. asked by mstv1112
3. 527 views
What is the mass, in grams, of 7.18 x 10^24 molecules of chlorine?
1. 0 answers
2. asked by Kristian
3. 519 views
Consider reacting 100.0mg magnesium with 20.0mL of 1.0M hydrochloric acid. Which reactant is the limiting reagent? What is the
1. 0 answers
2. asked by AmyTT
3. 511 views
Jonathon is starting a new job where he will earn $100 per week plus 15% commission on all sales. Write an equation and solve it
1. 1 answer
2. asked by mark
3. 506 views
Is the y intercept a point on the line?
1. 2 answers
2. asked by Ariana
3. 492 views
what is the equation of a line parallel to the given line and passing though the given point y=x+4 ;(-7, 1)
1. 2 answers
2. asked by sha
3. 479 views
Find the slope of the line that goes through the points (-3,-3) and (5, 6).
1. 1 answer
2. asked by Kenna
3. 476 views
A shopkeeper buys 11 hair clips for $10 and sells 10 clips for $11. Find out the gain or the loss percent.
1. 2 answers
2. asked by Parmod
3. 472 views
how can I divide (3+4i)/(2-5i)?? If there's work, that would help me too
1. 1 answer
2. asked by Mariam
3. 471 views
A particle travels 10m in 5sec and 10m in 3sec assuming constant acceleration what is the distance travelled in next 2sec?
1. 0 answers
2. asked by Thousif
3. 467 views
Can you please help me to explain how to divide complex numbers by an imaginary number
1. 1 answer
2. asked by Lily
3. 466 views
particle travels 10m in 5sec and 10m in 3sec assuming constant acceleration what is the distance travelled in next 2sec?
1. 0 answers
2. asked by Thousif
3. 461 views
was hiding He in a canyon mountains in the
1. 2 answers
2. asked by Anonymous
3. 457 views
calculate the relative change in population if the year is 2000 with 281.42 million population to year 2010 with population of
1. 2 answers
2. asked by Bo
3. 441 views
If 4^x-4^x-1=24 find the value of x
1. 2 answers
2. asked by Deepak
3. 440 views
a monkey climb a tree first 1 minutes 3 meter and then next 1 minutes he slips 1 meter. so 3 minutes he take to end the climb
1. 1 answer
2. asked by sunil
3. 423 views
-11 1/8+ 15 5/12=??a:4 7/24 b:4 7/12** c:-4 1/3 d:-4 7/24*
1. 3 answers
2. asked by davonte
3. 310 views
-11 1/8+ 15 5/12=??a:4 7/24** b:4 7/12 c:-4 1/3* d:-4 7/24
1. 2 answers
2. asked by hi
3. 308 views
copper with seven neurons more than its atomic number
1. 0 answers
2. asked by LUKKA
3. 290 views

Back to October 2017

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025