Archives
2017
January

Questions Asked on January 5, 2017

1.Of the students in Rosalie’s dance class, 29 out of 59 have participated in dance class before. About how many of her
1. 73 answers
2. asked by Kailyn
3. 10,570 views
A 70.0-kg astronaut pushes to the left on a spacecraft with a force in "gravity-free" space. The spacecraft has a total mass of
1. 2 answers
2. asked by Kyle
3. 8,229 views
After which type of assessment will you be asked to set goals for yourself?
1. 37 answers
2. asked by Andrea
3. 7,124 views
Please check my answers.1. Which of the following is a reason explaining why prison populations have increased dramatically? A.
1. 13 answers
2. asked by M
3. 5,967 views
Identify one example of a real-life application where knowledge of lines and planes is important and explain why.
1. 0 answers
2. asked by DustyRose<3
3. 5,685 views
Find the x-coordinates of any relative extrema and inflection point(s) for the function f(x) = 3x(1/3) + 6x(4/3). You must
1. 1 answer
2. asked by Ke$ha
3. 4,709 views
A rectangle made of square tiles measures 8 tiles wide and 10 tiles long. What is the length in tiles of a similar rectangle 12
1. 3 answers
2. asked by Annika
3. 4,227 views
Water is drained out of tank, shaped as an inverted right circular cone that has a radius of 6cm and a height of 12cm, at the
1. 8 answers
2. asked by Ke$ha
3. 3,754 views
Consider a box that contains 14 red balls,12 blue balls and 9 yellow balls.A ball is drawn at random and the color is noted and
1. 3 answers
2. asked by Anonymous
3. 3,574 views
Determine whether the system of linear equations has one and only one solution, infinitely many solutions, or no solution.3x −
1. 1 answer
2. asked by Melissa
3. 3,418 views
Your answer8.5 (C) 1. The Federalists and the Democratic-Republicans emerged as separate political parties partly as a result of
1. 1 answer
2. asked by ...vmju788i dumb guy/./////
3. 3,394 views
This table is used to calculate annual commissionsand salaries for car salespeople. What would the total yearly earnings of a
1. 5 answers
2. asked by esther
3. 3,195 views
This table is used to calculate annual commissionsand salaries for car salespeople. What would the total yearly earnings of a
1. 4 answers
2. asked by esther
3. 3,083 views
3.How did Spanish colonies differ from French and English colonies?a.Missionaries sought to convert Native Americans to
1. 7 answers
2. asked by Leah<3
3. 2,895 views
1. Which of the following is present in this painting? (Adoration of the Shepherds)warm colors movement value asymmetrical
1. 2 answers
2. asked by Lana Byrne
3. 2,853 views
If the rain does not come, then the crops are ruined and the people will starve. The crops are not ruined or the people will not
1. 11 answers
2. asked by Yesuf
3. 2,820 views
In a circle centered at point O, the ratio of the area of sector AOB to the area of the circle is . What is the approximate
1. 2 answers
2. asked by Mallory
3. 2,708 views
draw a flow chart to print odd numbers below 20 in descending order
1. 1 answer
2. asked by draw a flow chart
3. 2,492 views
1.How did the Portuguese use geographic factors to help them control the spice trade? *a.They conquered inland kingdoms, which
1. 21 answers
2. asked by Leah
3. 2,435 views
The annual sales of Crimson Pharmacy are expected to be given by S = 2.4 + 0.3t million dollars t years from now, whereas the
1. 1 answer
2. asked by Terry
3. 2,019 views
Why did Korea and Japan choose a policy of isolationism? *a.They were following Chinese policies toward foreigners. b.They
1. 2 answers
2. asked by Leah
3. 1,941 views
Given f'(x)=(x-4)(6-2x) find the x-coordinate for the relative minimum of the graph f(x).OPTIONS: 8 6 3 None of these I think it
1. 2 answers
2. asked by Ke$ha
3. 1,874 views
Which of the following statements is/are true1. If f'(c)=0 then f has a local maximum of minimum at x=c 2. If f is continuous on
1. 2 answers
2. asked by Ke$ha
3. 1,829 views
Read this excerpt from Alexander Pope's The of Lock"No common weapons in their hands are found/ Like gods they fight l, nor dead
1. 1 answer
2. asked by lyla
3. 1,775 views
A painter mixed 56 quarts of blue and yellow paint using a ratio of 3 blue to 11 yellow how many quarts of blue paint were used
1. 2 answers
2. asked by Leland
3. 1,680 views
The angle of elevation of the top of a building from a point 10m away in level ground is 30.calculate the height of the building
1. 3 answers
2. asked by Anonymous
3. 1,623 views
If the father's age in 3 years will be twice the son's age 4 years ago, and if the sum of their ages now is 106, how old is the
1. 5 answers
2. asked by BLAH
3. 1,617 views
Assume the number of U.S. dial-up Internet households stood at 38.5 million at the beginning of 2004 and was projected to
1. 1 answer
2. asked by Terry
3. 1,534 views
Consider the following structural description. Check which blocks are digital systems.
1. 1 answer
2. asked by nithya
3. 1,525 views
In a quarter-mile drag race, two cars start simultaneously from rest, and each accelerates at a constant rate until it either
1. 1 answer
2. asked by Thomas
3. 1,498 views
Determine whether the system of linear equations has one and only one solution, infinitely many solutions, or no solution.5/4x
1. 1 answer
2. asked by Melissa
3. 1,495 views
given the relationship 2x^2 + y^3 =10, with y > 0 and dy/dt = 3 units/min., find the value of dx/dt at the instant x = 1 unit.SU
1. 1 answer
2. asked by Ke$ha
3. 1,489 views
$6300 is invested, part of it at 11% and part of it at 8%. For a certain year, the total yield is $nbsp 597.00 .
1. 1 answer
2. asked by lobna
3. 1,464 views
Chloroform, CHCl3, has a boiling point of 62 oC, whereas methane, CH4, has a much lower boiling point of -164 oC. Using
1. 1 answer
2. asked by iris
3. 1,461 views
Dinitrogen pentoxide (N2O5) decomposes in chloroform as a solvent to yield NO2 and O2. The decomposition is first order with a
1. 1 answer
2. asked by Mckinley
3. 1,356 views
write the equation in the slope-intercept form 8x − 3y + 6 = 0
1. 1 answer
2. asked by Matthew
3. 1,346 views
Two of the vertices of a rectangle are 1,-6 and-8,-6 the rectangle has a perimeter of 26 units, what are the coordinates of the
1. 2 answers
2. asked by Brenden
3. 1,307 views
Jaya had three ribbon with her. The length of the green ribbon was 12 metres 50 cm. The red ribbon was 3/4 of the lengh of the
1. 3 answers
2. asked by Tehzeeb
3. 1,276 views
Which adjective best describes Ming China’s position toward European trade?a.diplomatic b.equivalent c.inviting d.restrictive
1. 2 answers
2. asked by Brian
3. 1,259 views
Find the empirical formula of a compound found to contain 63.15 percent carbon 5.30 percent hydrogen and 31.55 percent oxygenI
1. 2 answers
2. asked by Anonymous
3. 1,171 views
4.What was the encomienda system?A. a system in which Spanish monarchs shared with Native Americans the right to demand labor
1. 2 answers
2. asked by Leah<3
3. 1,166 views
An inverted conical tank (with vertex down) is 14 feet across the top and 24 feet deep. If water is flowing in at a rate of 12
1. 5 answers
2. asked by Danni
3. 1,075 views
Rewrite the set Q by listing its elements. Make sure to use the appropriate set notation.Q={x|x is an integer and -4<x<-2}
1. 1 answer
2. asked by Brenda
3. 1,059 views
the potential energy of a system of two particle separated by a distance r is given by u(r) = A/r , where A is constant . find
1. 1 answer
2. asked by asnke
3. 1,054 views
One way an English sonnet is different from a Petrarchan sonnet because an English sonnet containsA couplet < A sestet Give
1. 1 answer
2. asked by Dee
3. 1,044 views
PLEASE check my answer this is my last test and i d not want to mess up PLEASE1. Which sentence contains an opinion? (1 point)
1. 2 answers
2. asked by Michael
3. 1,042 views
What is the range of f(x)=−3x−1?the set of real numbers less than 0 the set of real numbers greater than 0 the set of real
1. 1 answer
2. asked by Vicky
3. 1,010 views
if seven workers dig a piece of ground in 10 days.How long will 5 workers take.
1. 4 answers
2. asked by Harry
3. 1,006 views
Mean titre of 0.2M sodium thiosulphate = 32.2 ml1) Calculate number of moles of S2O32- which react in the titration 2)Calculate
1. 0 answers
2. asked by Chirag
3. 1,005 views
Two horizontal forces, and , are acting on a box, but only is shown in the drawing. can point either to the right or to the
1. 6 answers
2. asked by Xavier
3. 978 views
Cutting down trees for -------------- can increase soil erosion.It fill in the blank. four grade science I do not know it.
1. 1 answer
2. asked by Ashley
3. 954 views
Only two forces act on an object (mass=3.19 kg), as in the drawing. Find (a) the magnitude and (b) the direction (relative to
1. 1 answer
2. asked by Thomas
3. 930 views
A survey conducted in a school showed that 65% of the pupils walked to school.the remaining number of pupils took buses to
1. 1 answer
2. asked by Peachie
3. 918 views
Lesson 11: Unit reviewReconstruction and economic growth Practice. If you know the right answers to this unit review practice
1. 1 answer
2. asked by Molly
3. 902 views
Scientists are experimenting with a kind of gun that may eventually be used to fire payloads directly into orbit. In one test,
1. 1 answer
2. asked by Thomas
3. 882 views
The trial of a person charged with a federal crime, or a suit involving the infringement of a patent or a copyright, or one
1. 3 answers
2. asked by Abby
3. 850 views
SIMPLIFY:p^2+pq-6q^2/p^2-3pq+2q^2
1. 2 answers
2. asked by EMMA
3. 842 views
James spends $10 on supplies for a lemonade stand and sells $30 worth of lemonade What was his profit?
1. 1 answer
2. asked by Aaliyah
3. 821 views
Following the previous question, indicate which of the following signals are digital signals.
1. 1 answer
2. asked by nithya
3. 819 views
Construct a right triangle whose base is 12cm and sum of its hypotenuse and other side is 18cm
1. 1 answer
2. asked by lakshay
3. 803 views
Find the average rate of change in height of the orange from t=2 to t=5 (in feet per second)The equation is h (t)=605+15t-4.9t^2
1. 1 answer
2. asked by John
3. 802 views
Currently, you have $80 and your sister has $145. You decide to save $6 of your allowance each week, while your sister decides
1. 1 answer
2. asked by Jared
3. 772 views
Two skaters, a man and a woman, are standing on ice. Neglect any friction between the skate blades and the ice. The mass of the
1. 0 answers
2. asked by Thomas
3. 746 views
A rectangular field is to be fenced on three sides, leaving a side of 20m uncovered. If the area is 680m2 ,find length of
1. 2 answers
2. asked by Ho
3. 737 views
Two forces and are applied to an object whose mass is 5.75 kg. The larger force is . When both forces point due east, the
1. 1 answer
2. asked by Thomas
3. 701 views
The study on calories burned per minute of walking, depending on weight, has a regression equation of ŷ = 1.0 + .06x.The
1. 2 answers
2. asked by rrb
3. 697 views
Can someone please help me? I am having a really hard time with physics. This is not a test question. It is a practice problem
1. 2 answers
2. asked by anonymous
3. 681 views
Your lunch bill is $19.75. A 5% sales tax will be added, and you want to give a tip of about 20% of $19.75. Estimate how much
1. 1 answer
2. asked by ...
3. 680 views
if sec theta =13/12 then find the value of sin theta and cot theta
1. 0 answers
2. asked by jamima akhter
3. 679 views
Let z=-8+15i and w=6-8i. Computezz/ww (each of the second ones, z and w, have a bar over them) where the bar represents the
1. 2 answers
2. asked by Mark
3. 669 views
Find the point of intersection of the pair of straight lines.y = −5x − 4 −y = 6x + 3
1. 1 answer
2. asked by Laura
3. 661 views
A group orders three large pizzas. Each slice represents 1/12 of the entire pizza. The group eats 3/4 of the pizza. How many
1. 1 answer
2. asked by Papa
3. 658 views
an airplane is flying to east 200k m/h which is a velocity relative to the air,while a 100km/h wind blows towards the
1. 1 answer
2. asked by value
3. 657 views
When a parachute opens, the air exerts a large drag force on it. This upward force is initially greater than the weight of the
1. 0 answers
2. asked by Thomas
3. 646 views
Barb is making a bead necklace. She strings 1 white bead, then 3 blue beads, then 1 white bead, and so on.Write the numbers for
1. 2 answers
2. asked by Justin
3. 641 views
Find an equation of the line that passes through the given points. (Let x be the independent variable and y be the dependent
1. 3 answers
2. asked by Terry
3. 629 views
How did spices change life in europe?
1. 6 answers
2. asked by #HOMEWORKPPL
3. 609 views
if A+B+C=π prove that sin(B+2C)+sin(C+2A)+sin(A+2B)=4sin(B-C)/2 sin(C-A)/2 sin(A-B)/2
1. 1 answer
2. asked by rabin
3. 599 views
A diesel engine's piston compresses 16 cm3 of fuel-air mixture into 1 cm3. The pressure changes from 1 atmosphere to 48
1. 1 answer
2. asked by okay
3. 592 views
Success in business depends on many factors. Buying habits of consumers, trends in fashion and taste, seasonal trends, the
1. 1 answer
2. asked by lesley
3. 591 views
In the amusement park ride known as Magic Mountain Superman, powerful magnets accelerate a car and its riders from rest to 46.6
1. 1 answer
2. asked by Thomas
3. 591 views
Lisa is thinking about two positive integers. The larger integer is seven less than twice the smaller integer. The larger
1. 1 answer
2. asked by edgard
3. 581 views
Julie has 8 more than three times as many quarters as dimes. The total value of the coins is $12.20. How many of each kind of
1. 2 answers
2. asked by Ryan
3. 581 views
Girlie can make five rag dolls from six discarded socks .Write four ratios equal to this.
1. 1 answer
2. asked by Charir
3. 578 views
how do i get the answer for this limit limit x to 0 (4^2x-1)without using direct substitution my work so far is limit x to 0=
1. 1 answer
2. asked by Anonymous
3. 578 views
What does 5 yards 2 feet 3 inches plus 2 yards 2 feet 9 inches equal?
1. 1 answer
2. asked by Lulu
3. 572 views
For what real values of c is x^2 + 16x + c the square of a binomial? If you find more than one, then list your values separated
1. 1 answer
2. asked by Aidan
3. 571 views
the average of 937, 762 and 941 is what percent of their sum?
1. 3 answers
2. asked by Marco
3. 569 views
With level 3 in English first additional language do I qualify to study Journalism at universities.
1. 4 answers
2. asked by Le Tough
3. 550 views
Convert these dates to BP dates (using 1950 as "the present.") Wood fragments from the floor of a palace in Syria - Syro-Hittite
1. 0 answers
2. asked by bailey
3. 549 views
Reposting question because I think I messed up!____________________________________________ What are some issues that Russia is
1. 1 answer
2. asked by courtnie
3. 548 views
Crystal buy headphones that are on sale with a 40% discount. If she paid $24 for the headphones with the discount, what is the
1. 1 answer
2. asked by Darryl
3. 545 views
Shawna looked at a study on mortality rates for men and women aged 65 to 74. When the researchers looked at calories of
1. 1 answer
2. asked by rrd
3. 540 views
An object is projected at an angle of elevation of 45 degree with a velocity of 100m/s. Calculate it's range
1. 1 answer
2. asked by Prithvi
3. 534 views
Last month,sam spent 12% of a sum of money on transport and 25% of the remainder on food.of the rest,he gave $1320 to his
1. 1 answer
2. asked by Peachie
3. 532 views
An electron is a subatomic particle (m = 9.11 x 10-31 kg) that is subject to electric forces. An electron moving in the +x
1. 0 answers
2. asked by Thomas
3. 532 views
A table top measures 2m by 1m50cm. What is its area in square metres
1. 1 answer
2. asked by Parv
3. 526 views
the specific volume of water vapor at 150 kPa and 120 degree celsius is 1.188 cubic meter/kg. determine the molar-specific
1. 1 answer
2. asked by joan
3. 519 views
Find the point of intersection of the pair of straight lines.2x + 4y = 19 −3x + 3y = 3
1. 1 answer
2. asked by Laura
3. 512 views
i have £12 per week pocket money. I spend £3.50 on bus fare, what is this as a fraction of £12 ?
1. 1 answer
2. asked by noidea
3. 509 views

Back to January 2017

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025