Archives
2017
January

Questions Asked on January 5, 2017

1.Of the students in Rosalie’s dance class, 29 out of 59 have participated in dance class before. About how many of her
1. 73 answers
2. asked by Kailyn
3. 10,595 views
A 70.0-kg astronaut pushes to the left on a spacecraft with a force in "gravity-free" space. The spacecraft has a total mass of
1. 2 answers
2. asked by Kyle
3. 8,262 views
After which type of assessment will you be asked to set goals for yourself?
1. 37 answers
2. asked by Andrea
3. 7,152 views
Please check my answers.1. Which of the following is a reason explaining why prison populations have increased dramatically? A.
1. 13 answers
2. asked by M
3. 5,985 views
Identify one example of a real-life application where knowledge of lines and planes is important and explain why.
1. 0 answers
2. asked by DustyRose<3
3. 5,709 views
Find the x-coordinates of any relative extrema and inflection point(s) for the function f(x) = 3x(1/3) + 6x(4/3). You must
1. 1 answer
2. asked by Ke$ha
3. 4,736 views
A rectangle made of square tiles measures 8 tiles wide and 10 tiles long. What is the length in tiles of a similar rectangle 12
1. 3 answers
2. asked by Annika
3. 4,257 views
Water is drained out of tank, shaped as an inverted right circular cone that has a radius of 6cm and a height of 12cm, at the
1. 8 answers
2. asked by Ke$ha
3. 3,772 views
Consider a box that contains 14 red balls,12 blue balls and 9 yellow balls.A ball is drawn at random and the color is noted and
1. 3 answers
2. asked by Anonymous
3. 3,599 views
Determine whether the system of linear equations has one and only one solution, infinitely many solutions, or no solution.3x −
1. 1 answer
2. asked by Melissa
3. 3,441 views
Your answer8.5 (C) 1. The Federalists and the Democratic-Republicans emerged as separate political parties partly as a result of
1. 1 answer
2. asked by ...vmju788i dumb guy/./////
3. 3,426 views
This table is used to calculate annual commissionsand salaries for car salespeople. What would the total yearly earnings of a
1. 5 answers
2. asked by esther
3. 3,222 views
This table is used to calculate annual commissionsand salaries for car salespeople. What would the total yearly earnings of a
1. 4 answers
2. asked by esther
3. 3,099 views
3.How did Spanish colonies differ from French and English colonies?a.Missionaries sought to convert Native Americans to
1. 7 answers
2. asked by Leah<3
3. 2,922 views
1. Which of the following is present in this painting? (Adoration of the Shepherds)warm colors movement value asymmetrical
1. 2 answers
2. asked by Lana Byrne
3. 2,874 views
If the rain does not come, then the crops are ruined and the people will starve. The crops are not ruined or the people will not
1. 11 answers
2. asked by Yesuf
3. 2,842 views
In a circle centered at point O, the ratio of the area of sector AOB to the area of the circle is . What is the approximate
1. 2 answers
2. asked by Mallory
3. 2,734 views
draw a flow chart to print odd numbers below 20 in descending order
1. 1 answer
2. asked by draw a flow chart
3. 2,524 views
1.How did the Portuguese use geographic factors to help them control the spice trade? *a.They conquered inland kingdoms, which
1. 21 answers
2. asked by Leah
3. 2,462 views
The annual sales of Crimson Pharmacy are expected to be given by S = 2.4 + 0.3t million dollars t years from now, whereas the
1. 1 answer
2. asked by Terry
3. 2,038 views
Why did Korea and Japan choose a policy of isolationism? *a.They were following Chinese policies toward foreigners. b.They
1. 2 answers
2. asked by Leah
3. 1,965 views
Given f'(x)=(x-4)(6-2x) find the x-coordinate for the relative minimum of the graph f(x).OPTIONS: 8 6 3 None of these I think it
1. 2 answers
2. asked by Ke$ha
3. 1,891 views
Which of the following statements is/are true1. If f'(c)=0 then f has a local maximum of minimum at x=c 2. If f is continuous on
1. 2 answers
2. asked by Ke$ha
3. 1,852 views
Read this excerpt from Alexander Pope's The of Lock"No common weapons in their hands are found/ Like gods they fight l, nor dead
1. 1 answer
2. asked by lyla
3. 1,794 views
If the father's age in 3 years will be twice the son's age 4 years ago, and if the sum of their ages now is 106, how old is the
1. 5 answers
2. asked by BLAH
3. 1,700 views
A painter mixed 56 quarts of blue and yellow paint using a ratio of 3 blue to 11 yellow how many quarts of blue paint were used
1. 2 answers
2. asked by Leland
3. 1,698 views
The angle of elevation of the top of a building from a point 10m away in level ground is 30.calculate the height of the building
1. 3 answers
2. asked by Anonymous
3. 1,644 views
Assume the number of U.S. dial-up Internet households stood at 38.5 million at the beginning of 2004 and was projected to
1. 1 answer
2. asked by Terry
3. 1,555 views
Consider the following structural description. Check which blocks are digital systems.
1. 1 answer
2. asked by nithya
3. 1,543 views
In a quarter-mile drag race, two cars start simultaneously from rest, and each accelerates at a constant rate until it either
1. 1 answer
2. asked by Thomas
3. 1,521 views
Determine whether the system of linear equations has one and only one solution, infinitely many solutions, or no solution.5/4x
1. 1 answer
2. asked by Melissa
3. 1,516 views
given the relationship 2x^2 + y^3 =10, with y > 0 and dy/dt = 3 units/min., find the value of dx/dt at the instant x = 1 unit.SU
1. 1 answer
2. asked by Ke$ha
3. 1,505 views
Chloroform, CHCl3, has a boiling point of 62 oC, whereas methane, CH4, has a much lower boiling point of -164 oC. Using
1. 1 answer
2. asked by iris
3. 1,488 views
$6300 is invested, part of it at 11% and part of it at 8%. For a certain year, the total yield is $nbsp 597.00 .
1. 1 answer
2. asked by lobna
3. 1,486 views
Dinitrogen pentoxide (N2O5) decomposes in chloroform as a solvent to yield NO2 and O2. The decomposition is first order with a
1. 1 answer
2. asked by Mckinley
3. 1,372 views
write the equation in the slope-intercept form 8x − 3y + 6 = 0
1. 1 answer
2. asked by Matthew
3. 1,364 views
Two of the vertices of a rectangle are 1,-6 and-8,-6 the rectangle has a perimeter of 26 units, what are the coordinates of the
1. 2 answers
2. asked by Brenden
3. 1,328 views
Jaya had three ribbon with her. The length of the green ribbon was 12 metres 50 cm. The red ribbon was 3/4 of the lengh of the
1. 3 answers
2. asked by Tehzeeb
3. 1,299 views
Which adjective best describes Ming China’s position toward European trade?a.diplomatic b.equivalent c.inviting d.restrictive
1. 2 answers
2. asked by Brian
3. 1,274 views
Find the empirical formula of a compound found to contain 63.15 percent carbon 5.30 percent hydrogen and 31.55 percent oxygenI
1. 2 answers
2. asked by Anonymous
3. 1,193 views
4.What was the encomienda system?A. a system in which Spanish monarchs shared with Native Americans the right to demand labor
1. 2 answers
2. asked by Leah<3
3. 1,184 views
An inverted conical tank (with vertex down) is 14 feet across the top and 24 feet deep. If water is flowing in at a rate of 12
1. 5 answers
2. asked by Danni
3. 1,096 views
Rewrite the set Q by listing its elements. Make sure to use the appropriate set notation.Q={x|x is an integer and -4<x<-2}
1. 1 answer
2. asked by Brenda
3. 1,082 views
the potential energy of a system of two particle separated by a distance r is given by u(r) = A/r , where A is constant . find
1. 1 answer
2. asked by asnke
3. 1,077 views
One way an English sonnet is different from a Petrarchan sonnet because an English sonnet containsA couplet < A sestet Give
1. 1 answer
2. asked by Dee
3. 1,063 views
PLEASE check my answer this is my last test and i d not want to mess up PLEASE1. Which sentence contains an opinion? (1 point)
1. 2 answers
2. asked by Michael
3. 1,061 views
What is the range of f(x)=−3x−1?the set of real numbers less than 0 the set of real numbers greater than 0 the set of real
1. 1 answer
2. asked by Vicky
3. 1,031 views
Mean titre of 0.2M sodium thiosulphate = 32.2 ml1) Calculate number of moles of S2O32- which react in the titration 2)Calculate
1. 0 answers
2. asked by Chirag
3. 1,026 views
if seven workers dig a piece of ground in 10 days.How long will 5 workers take.
1. 4 answers
2. asked by Harry
3. 1,023 views
Two horizontal forces, and , are acting on a box, but only is shown in the drawing. can point either to the right or to the
1. 6 answers
2. asked by Xavier
3. 1,000 views
Cutting down trees for -------------- can increase soil erosion.It fill in the blank. four grade science I do not know it.
1. 1 answer
2. asked by Ashley
3. 981 views
Only two forces act on an object (mass=3.19 kg), as in the drawing. Find (a) the magnitude and (b) the direction (relative to
1. 1 answer
2. asked by Thomas
3. 947 views
A survey conducted in a school showed that 65% of the pupils walked to school.the remaining number of pupils took buses to
1. 1 answer
2. asked by Peachie
3. 935 views
Lesson 11: Unit reviewReconstruction and economic growth Practice. If you know the right answers to this unit review practice
1. 1 answer
2. asked by Molly
3. 920 views
Scientists are experimenting with a kind of gun that may eventually be used to fire payloads directly into orbit. In one test,
1. 1 answer
2. asked by Thomas
3. 900 views
The trial of a person charged with a federal crime, or a suit involving the infringement of a patent or a copyright, or one
1. 3 answers
2. asked by Abby
3. 869 views
SIMPLIFY:p^2+pq-6q^2/p^2-3pq+2q^2
1. 2 answers
2. asked by EMMA
3. 862 views
James spends $10 on supplies for a lemonade stand and sells $30 worth of lemonade What was his profit?
1. 1 answer
2. asked by Aaliyah
3. 845 views
Following the previous question, indicate which of the following signals are digital signals.
1. 1 answer
2. asked by nithya
3. 838 views
Find the average rate of change in height of the orange from t=2 to t=5 (in feet per second)The equation is h (t)=605+15t-4.9t^2
1. 1 answer
2. asked by John
3. 827 views
Construct a right triangle whose base is 12cm and sum of its hypotenuse and other side is 18cm
1. 1 answer
2. asked by lakshay
3. 822 views
Currently, you have $80 and your sister has $145. You decide to save $6 of your allowance each week, while your sister decides
1. 1 answer
2. asked by Jared
3. 801 views
A rectangular field is to be fenced on three sides, leaving a side of 20m uncovered. If the area is 680m2 ,find length of
1. 2 answers
2. asked by Ho
3. 769 views
Two skaters, a man and a woman, are standing on ice. Neglect any friction between the skate blades and the ice. The mass of the
1. 0 answers
2. asked by Thomas
3. 769 views
Two forces and are applied to an object whose mass is 5.75 kg. The larger force is . When both forces point due east, the
1. 1 answer
2. asked by Thomas
3. 718 views
The study on calories burned per minute of walking, depending on weight, has a regression equation of ŷ = 1.0 + .06x.The
1. 2 answers
2. asked by rrb
3. 718 views
Can someone please help me? I am having a really hard time with physics. This is not a test question. It is a practice problem
1. 2 answers
2. asked by anonymous
3. 706 views
Your lunch bill is $19.75. A 5% sales tax will be added, and you want to give a tip of about 20% of $19.75. Estimate how much
1. 1 answer
2. asked by ...
3. 699 views
if sec theta =13/12 then find the value of sin theta and cot theta
1. 0 answers
2. asked by jamima akhter
3. 693 views
Let z=-8+15i and w=6-8i. Computezz/ww (each of the second ones, z and w, have a bar over them) where the bar represents the
1. 2 answers
2. asked by Mark
3. 688 views
A group orders three large pizzas. Each slice represents 1/12 of the entire pizza. The group eats 3/4 of the pizza. How many
1. 1 answer
2. asked by Papa
3. 680 views
an airplane is flying to east 200k m/h which is a velocity relative to the air,while a 100km/h wind blows towards the
1. 1 answer
2. asked by value
3. 679 views
Find the point of intersection of the pair of straight lines.y = −5x − 4 −y = 6x + 3
1. 1 answer
2. asked by Laura
3. 677 views
Barb is making a bead necklace. She strings 1 white bead, then 3 blue beads, then 1 white bead, and so on.Write the numbers for
1. 2 answers
2. asked by Justin
3. 670 views
When a parachute opens, the air exerts a large drag force on it. This upward force is initially greater than the weight of the
1. 0 answers
2. asked by Thomas
3. 666 views
Find an equation of the line that passes through the given points. (Let x be the independent variable and y be the dependent
1. 3 answers
2. asked by Terry
3. 653 views
How did spices change life in europe?
1. 6 answers
2. asked by #HOMEWORKPPL
3. 623 views
if A+B+C=π prove that sin(B+2C)+sin(C+2A)+sin(A+2B)=4sin(B-C)/2 sin(C-A)/2 sin(A-B)/2
1. 1 answer
2. asked by rabin
3. 621 views
Success in business depends on many factors. Buying habits of consumers, trends in fashion and taste, seasonal trends, the
1. 1 answer
2. asked by lesley
3. 616 views
Convert these dates to BP dates (using 1950 as "the present.") Wood fragments from the floor of a palace in Syria - Syro-Hittite
1. 0 answers
2. asked by bailey
3. 616 views
In the amusement park ride known as Magic Mountain Superman, powerful magnets accelerate a car and its riders from rest to 46.6
1. 1 answer
2. asked by Thomas
3. 615 views
A diesel engine's piston compresses 16 cm3 of fuel-air mixture into 1 cm3. The pressure changes from 1 atmosphere to 48
1. 1 answer
2. asked by okay
3. 611 views
how do i get the answer for this limit limit x to 0 (4^2x-1)without using direct substitution my work so far is limit x to 0=
1. 1 answer
2. asked by Anonymous
3. 603 views
Julie has 8 more than three times as many quarters as dimes. The total value of the coins is $12.20. How many of each kind of
1. 2 answers
2. asked by Ryan
3. 597 views
Lisa is thinking about two positive integers. The larger integer is seven less than twice the smaller integer. The larger
1. 1 answer
2. asked by edgard
3. 596 views
What does 5 yards 2 feet 3 inches plus 2 yards 2 feet 9 inches equal?
1. 1 answer
2. asked by Lulu
3. 594 views
For what real values of c is x^2 + 16x + c the square of a binomial? If you find more than one, then list your values separated
1. 1 answer
2. asked by Aidan
3. 594 views
Girlie can make five rag dolls from six discarded socks .Write four ratios equal to this.
1. 1 answer
2. asked by Charir
3. 593 views
the average of 937, 762 and 941 is what percent of their sum?
1. 3 answers
2. asked by Marco
3. 586 views
With level 3 in English first additional language do I qualify to study Journalism at universities.
1. 4 answers
2. asked by Le Tough
3. 579 views
Crystal buy headphones that are on sale with a 40% discount. If she paid $24 for the headphones with the discount, what is the
1. 1 answer
2. asked by Darryl
3. 569 views
Reposting question because I think I messed up!____________________________________________ What are some issues that Russia is
1. 1 answer
2. asked by courtnie
3. 568 views
A table top measures 2m by 1m50cm. What is its area in square metres
1. 1 answer
2. asked by Parv
3. 563 views
Shawna looked at a study on mortality rates for men and women aged 65 to 74. When the researchers looked at calories of
1. 1 answer
2. asked by rrd
3. 561 views
An object is projected at an angle of elevation of 45 degree with a velocity of 100m/s. Calculate it's range
1. 1 answer
2. asked by Prithvi
3. 557 views
An electron is a subatomic particle (m = 9.11 x 10-31 kg) that is subject to electric forces. An electron moving in the +x
1. 0 answers
2. asked by Thomas
3. 551 views
Last month,sam spent 12% of a sum of money on transport and 25% of the remainder on food.of the rest,he gave $1320 to his
1. 1 answer
2. asked by Peachie
3. 550 views
the specific volume of water vapor at 150 kPa and 120 degree celsius is 1.188 cubic meter/kg. determine the molar-specific
1. 1 answer
2. asked by joan
3. 541 views
darry and nay eat dinner at a restaurant with 6% sales tax. They leave an 18% tip on the pre tax amount of the bill. If they
1. 1 answer
2. asked by Darryl
3. 533 views
Find the point of intersection of the pair of straight lines.2x + 4y = 19 −3x + 3y = 3
1. 1 answer
2. asked by Laura
3. 533 views

Back to January 2017

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025