Archives
2017
January

Questions Asked on January 5, 2017

This table is used to calculate annual commissionsand salaries for car salespeople. What would the total yearly earnings of a
1. 5 answers
2. asked by esther
3. 3,165 views
What are some issues that Russia is dealing with right now, and how can they be potentially solved? What are some good things
1. 1 answer
2. asked by courtnie
3. 410 views
Which adjective best describes Ming China’s position toward European trade?a.diplomatic b.equivalent c.inviting d.restrictive
1. 2 answers
2. asked by Brian
3. 1,243 views
James spends $10 on supplies for a lemonade stand and sells $30 worth of lemonade What was his profit?
1. 1 answer
2. asked by Aaliyah
3. 797 views
Ben is helping plant tulips.He plants bulbs in two rows and has one bulb left over. So he tries again. He plants bulbs in three
1. 1 answer
2. asked by James
3. 315 views
Reposting question because I think I messed up!____________________________________________ What are some issues that Russia is
1. 1 answer
2. asked by courtnie
3. 532 views
1.How did the Portuguese use geographic factors to help them control the spice trade? *a.They conquered inland kingdoms, which
1. 21 answers
2. asked by Leah
3. 2,407 views
Crystal buy headphones that are on sale with a 40% discount. If she paid $24 for the headphones with the discount, what is the
1. 1 answer
2. asked by Darryl
3. 520 views
Find the empirical formula of a compound found to contain 63.15 percent carbon 5.30 percent hydrogen and 31.55 percent oxygenI
1. 2 answers
2. asked by Anonymous
3. 1,141 views
4th GradeMost processes change land slowly, but people can change the land----------------- What the answer
1. 3 answers
2. asked by Ashley
3. 451 views
1.Of the students in Rosalie’s dance class, 29 out of 59 have participated in dance class before. About how many of her
1. 73 answers
2. asked by Kailyn
3. 10,499 views
u have been a great help thanks 100% more helpful than anyone i have met today
1. 1 answer
2. asked by Leah
3. 322 views
Lisa is thinking about two positive integers. The larger integer is seven less than twice the smaller integer. The larger
1. 1 answer
2. asked by edgard
3. 553 views
During an experimento a sunny Day,stu dental pour water on the sidewalk.every 30 minutes,they check the water to record antes
1. 1 answer
2. asked by Judith
3. 478 views
Barb is making a bead necklace. She strings 1 white bead, then 3 blue beads, then 1 white bead, and so on.Write the numbers for
1. 2 answers
2. asked by Justin
3. 615 views
Why did Korea and Japan choose a policy of isolationism? *a.They were following Chinese policies toward foreigners. b.They
1. 2 answers
2. asked by Leah
3. 1,915 views
Find an equation of the line that passes through the given points. (Let x be the independent variable and y be the dependent
1. 3 answers
2. asked by Terry
3. 609 views
An inverted conical tank (with vertex down) is 14 feet across the top and 24 feet deep. If water is flowing in at a rate of 12
1. 5 answers
2. asked by Danni
3. 1,041 views
Cutting down trees for ---------- can increase soil erosion.can some one help me please with this. fill in the blank.
1. 1 answer
2. asked by Ashley
3. 466 views
Success in business depends on many factors. Buying habits of consumers, trends in fashion and taste, seasonal trends, the
1. 1 answer
2. asked by lesley
3. 557 views
Cutting down trees for -------------- can increase soil erosion.It fill in the blank. four grade science I do not know it.
1. 1 answer
2. asked by Ashley
3. 929 views
darry and nay eat dinner at a restaurant with 6% sales tax. They leave an 18% tip on the pre tax amount of the bill. If they
1. 1 answer
2. asked by Darryl
3. 479 views
explain why 9997 is not a prime using euclidean algorithm
1. 0 answers
2. asked by Phyllis
3. 350 views
The annual sales of Crimson Pharmacy are expected to be given by S = 2.4 + 0.3t million dollars t years from now, whereas the
1. 1 answer
2. asked by Terry
3. 1,999 views
Find the solution to 4X + 7 =2 (mod15)
1. 1 answer
2. asked by Phyllis
3. 305 views
Assume the number of U.S. dial-up Internet households stood at 38.5 million at the beginning of 2004 and was projected to
1. 1 answer
2. asked by Terry
3. 1,512 views
What does 5 yards 2 feet 3 inches plus 2 yards 2 feet 9 inches equal?
1. 1 answer
2. asked by Lulu
3. 554 views
4.What was the encomienda system?A. a system in which Spanish monarchs shared with Native Americans the right to demand labor
1. 2 answers
2. asked by Leah<3
3. 1,143 views
write the equation in the slope-intercept form 8x − 3y + 6 = 0
1. 1 answer
2. asked by Matthew
3. 1,324 views
Find an equation of the vertical line that passes through(x, y) = (−3, 4).
1. 1 answer
2. asked by Terry
3. 409 views
3.How did Spanish colonies differ from French and English colonies?a.Missionaries sought to convert Native Americans to
1. 7 answers
2. asked by Leah<3
3. 2,870 views
Two of the vertices of a rectangle are 1,-6 and-8,-6 the rectangle has a perimeter of 26 units, what are the coordinates of the
1. 2 answers
2. asked by Brenden
3. 1,282 views
I am trying to figure out how to do a sun and finding the product or quotient and writing the strategy that I use. I'M IN GRADE
1. 1 answer
2. asked by Kaelicia
3. 438 views
A rectangular field is to be fenced on three sides, leaving a side of 20m uncovered. If the area is 680m2 ,find length of
1. 2 answers
2. asked by Ho
3. 709 views
How is 1/7 reasonable in the Jordan is making a necklace
1. 1 answer
2. asked by izaiah
3. 286 views
Two horizontal forces, and , are acting on a box, but only is shown in the drawing. can point either to the right or to the
1. 6 answers
2. asked by Xavier
3. 952 views
the points A,B,C,D,and E are evenly spaced, what is the point of A and C on the number line__(a)___(b)-2.83_____c___d___(e)1.64
1. 1 answer
2. asked by Darryl
3. 480 views
For what real values of c is x^2 + 16x + c the square of a binomial? If you find more than one, then list your values separated
1. 1 answer
2. asked by Aidan
3. 535 views
In the amusement park ride known as Magic Mountain Superman, powerful magnets accelerate a car and its riders from rest to 46.6
1. 1 answer
2. asked by Thomas
3. 560 views
Chloroform, CHCl3, has a boiling point of 62 oC, whereas methane, CH4, has a much lower boiling point of -164 oC. Using
1. 1 answer
2. asked by iris
3. 1,423 views
If the rain does not come, then the crops are ruined and the people will starve. The crops are not ruined or the people will not
1. 11 answers
2. asked by Yesuf
3. 2,782 views
Find the average rate of change in height of the orange from t=2 to t=5 (in feet per second)The equation is h (t)=605+15t-4.9t^2
1. 1 answer
2. asked by John
3. 762 views
3= -50/6 + bdo you times 3/1 by 6 getting 18/6 in the end then do you add 50/6 getting 68/6????
1. 1 answer
2. asked by Geometry
3. 255 views
One way an English sonnet is different from a Petrarchan sonnet because an English sonnet containsA couplet < A sestet Give
1. 1 answer
2. asked by Dee
3. 1,017 views
A craane lifts an 8000N height 75m to the top of a buildings in 30s. How much power does the crane use?
1. 1 answer
2. asked by Rahul
3. 403 views
if A+B+C=π prove that sin(B+2C)+sin(C+2A)+sin(A+2B)=4sin(B-C)/2 sin(C-A)/2 sin(A-B)/2
1. 1 answer
2. asked by rabin
3. 583 views
P +4- 2 (p-10)> 0Please check, it was marked wrong P+4 -2p +20 > 0 -p+ 24> 0 -p >-24 P > 24 Answer choices are 29, 26, 24, 22
1. 1 answer
2. asked by lulu
3. 471 views
What constant must we place in the question markbelow in order to be able to factor the resulting expression into the product of
1. 1 answer
2. asked by Mark
3. 392 views
Let z=-8+15i and w=6-8i. Computezz/ww (each of the second ones, z and w, have a bar over them) where the bar represents the
1. 2 answers
2. asked by Mark
3. 651 views
This table is used to calculate annual commissionsand salaries for car salespeople. What would the total yearly earnings of a
1. 4 answers
2. asked by esther
3. 3,040 views
PLEASE check my answer this is my last test and i d not want to mess up PLEASE1. Which sentence contains an opinion? (1 point)
1. 2 answers
2. asked by Michael
3. 1,021 views
What is the missing number3, 5, 8, ?, 18, 24
1. 1 answer
2. asked by Carol
3. 330 views
Lesson 11: Unit reviewReconstruction and economic growth Practice. If you know the right answers to this unit review practice
1. 1 answer
2. asked by Molly
3. 870 views
given the relationship 2x^2 + y^3 =10, with y > 0 and dy/dt = 3 units/min., find the value of dx/dt at the instant x = 1 unit.SU
1. 1 answer
2. asked by Ke$ha
3. 1,467 views
Given f'(x)=(x-4)(6-2x) find the x-coordinate for the relative minimum of the graph f(x).OPTIONS: 8 6 3 None of these I think it
1. 2 answers
2. asked by Ke$ha
3. 1,853 views
Which of the following statements is/are true1. If f'(c)=0 then f has a local maximum of minimum at x=c 2. If f is continuous on
1. 2 answers
2. asked by Ke$ha
3. 1,793 views
Describe how you would investigate effect of pH on enzyme rate. draw labelled diagram?
1. 0 answers
2. asked by abdulaziz
3. 431 views
the potential energy of a system of two particle separated by a distance r is given by u(r) = A/r , where A is constant . find
1. 1 answer
2. asked by asnke
3. 1,032 views
A table top measures 2m by 1m50cm. What is its area in square metres
1. 1 answer
2. asked by Parv
3. 503 views
I posted yesterday but feel I confused the issue with an incorrect calculation of an angle, I have just realised my mistake!. I
1. 10 answers
2. asked by Mike
3. 477 views
What is the missing number3, 5, 8, ?, 18, 24 Please write down the pattern, how you got the answer
1. 1 answer
2. asked by Carol
3. 425 views
the outer curved surface area of a pipe with length 18cm and diameter 10mm is what cm
1. 1 answer
2. asked by mini
3. 424 views
SIMPLIFY:p^2+pq-6q^2/p^2-3pq+2q^2
1. 2 answers
2. asked by EMMA
3. 827 views
Consider the following structural description. Check which blocks are digital systems.
1. 1 answer
2. asked by nithya
3. 1,506 views
the specific volume of water vapor at 150 kPa and 120 degree celsius is 1.188 cubic meter/kg. determine the molar-specific
1. 1 answer
2. asked by joan
3. 494 views
Following the previous question, indicate which of the following signals are digital signals.
1. 1 answer
2. asked by nithya
3. 799 views
Girlie can make five rag dolls from six discarded socks .Write four ratios equal to this.
1. 1 answer
2. asked by Charir
3. 558 views
if seven workers dig a piece of ground in 10 days.How long will 5 workers take.
1. 4 answers
2. asked by Harry
3. 987 views
if sec theta =13/12 then find the value of sin theta and cot theta
1. 0 answers
2. asked by jamima akhter
3. 645 views
Consider a box that contains 14 red balls,12 blue balls and 9 yellow balls.A ball is drawn at random and the color is noted and
1. 3 answers
2. asked by Anonymous
3. 3,541 views
an airplane is flying to east 200k m/h which is a velocity relative to the air,while a 100km/h wind blows towards the
1. 1 answer
2. asked by value
3. 627 views
given that p=i+j-2k and q=2i-j+2k.find two vectors m and n satisfying that m is perpendicular to p,n is parallel to p and m+n=q
1. 1 answer
2. asked by Samuel
3. 363 views
If frank earned in a simple interest for oneyear on an investment of 9000 .what annual rate of interest was paid
1. 1 answer
2. asked by Anonymous
3. 366 views
how do i get the answer for this limit limit x to 0 (4^2x-1)without using direct substitution my work so far is limit x to 0=
1. 1 answer
2. asked by Anonymous
3. 554 views
A survey conducted in a school showed that 65% of the pupils walked to school.the remaining number of pupils took buses to
1. 1 answer
2. asked by Peachie
3. 885 views
With level 3 in English first additional language do I qualify to study Journalism at universities.
1. 4 answers
2. asked by Le Tough
3. 519 views
Rewrite the set Q by listing its elements. Make sure to use the appropriate set notation.Q={x|x is an integer and -4<x<-2}
1. 1 answer
2. asked by Brenda
3. 1,036 views
Last month,sam spent 12% of a sum of money on transport and 25% of the remainder on food.of the rest,he gave 1320% to his
1. 1 answer
2. asked by Peachie
3. 435 views
$6300 is invested, part of it at 11% and part of it at 8%. For a certain year, the total yield is $nbsp 597.00 .
1. 1 answer
2. asked by lobna
3. 1,425 views
Calculatr morality of a solution containing 2.5g of K2CO3 in 1liter of solution (density of solution is 0.85 gram/ml
1. 1 answer
2. asked by bilal
3. 392 views
Construct a right triangle whose base is 12cm and sum of its hypotenuse and other side is 18cm
1. 1 answer
2. asked by lakshay
3. 777 views
Last month,sam spent 12% of a sum of money on transport and 25% of the remainder on food.of the rest,he gave $1320 to his
1. 1 answer
2. asked by Peachie
3. 511 views
Mean titre of 0.2M sodium thiosulphate = 32.2 ml1) Calculate number of moles of S2O32- which react in the titration 2)Calculate
1. 0 answers
2. asked by Chirag
3. 968 views
draw a flow chart to print odd numbers below 20 in descending order
1. 1 answer
2. asked by draw a flow chart
3. 2,468 views
Jaya had three ribbon with her. The length of the green ribbon was 12 metres 50 cm. The red ribbon was 3/4 of the lengh of the
1. 3 answers
2. asked by Tehzeeb
3. 1,238 views
What is the function of eustachian tube?
1. 1 answer
2. asked by Cccccc
3. 377 views
In a circle centered at point O, the ratio of the area of sector AOB to the area of the circle is . What is the approximate
1. 2 answers
2. asked by Mallory
3. 2,680 views
Please check my answers.1. Which of the following is a reason explaining why prison populations have increased dramatically? A.
1. 13 answers
2. asked by M
3. 5,941 views
The trial of a person charged with a federal crime, or a suit involving the infringement of a patent or a copyright, or one
1. 3 answers
2. asked by Abby
3. 832 views
a ball is thrown Vatican upward with a velocity of 20.0m/s.a) what is the retardation of the ball? b) what distance does it
1. 1 answer
2. asked by comfort
3. 476 views
What is the range of f(x)=−3x−1?the set of real numbers less than 0 the set of real numbers greater than 0 the set of real
1. 1 answer
2. asked by Vicky
3. 984 views
An object is projected at an angle of elevation of 45 degree with a velocity of 100m/s. Calculate it's range
1. 1 answer
2. asked by Prithvi
3. 512 views
A person in a kayak starts paddling, and it accelerates from 0 to 0.614 m/s in a distance of 0.372 m. If the combined mass of
1. 1 answer
2. asked by Thomas
3. 479 views
How did spices change life in europe?
1. 6 answers
2. asked by #HOMEWORKPPL
3. 589 views
Scientists are experimenting with a kind of gun that may eventually be used to fire payloads directly into orbit. In one test,
1. 1 answer
2. asked by Thomas
3. 864 views
The angle of elevation of the top of a building from a point 10m away in level ground is 30.calculate the height of the building
1. 3 answers
2. asked by Anonymous
3. 1,594 views
Two forces and are applied to an object whose mass is 5.75 kg. The larger force is . When both forces point due east, the
1. 1 answer
2. asked by Thomas
3. 680 views
In the figure, ABCD is aparallelogram in which BCis produced to E such thatCE = BC. AE intersects CDat F. Show that ar (∆BDF)=
1. 1 answer
2. asked by rosy
3. 485 views
Identify one example of a real-life application where knowledge of lines and planes is important and explain why.
1. 0 answers
2. asked by DustyRose<3
3. 5,657 views
Read this excerpt from Alexander Pope's The of Lock"No common weapons in their hands are found/ Like gods they fight l, nor dead
1. 1 answer
2. asked by lyla
3. 1,733 views

Back to January 2017

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024