Archives
2016
November

Questions Asked on November 7, 2016

a boy sold $88.50 worth of stationery. If he received a 33 1/3% commission, what was the amount of his commission?
1. 2 answers
2. asked by chris
3. 4,584 views
(ln(100))/ln(10) =I know the answer is 2 so can you explain why. Thank you :)
1. 3 answers
2. asked by cool
3. 3,819 views
The angles of a triangle are 45degree, 65degree,and 75 degree. Express these angle in radians
1. 1 answer
2. asked by Priyanka.
3. 643 views
Thank you Advance...;;Q: A body of mass 10 kg is moving over a smooth surface, whose equation of motion is given by the
1. 4 answers
2. asked by abodd
3. 3,766 views
a book contains 312 pages 1/6th pages of book has pictures. how many pages have pictures in book?
1. 5 answers
2. asked by sanskar
3. 2,011 views
a) What is the ratio of the momentum of a 3kg mass moving at 3 m/s to that of a 2 kg mass moving at 4 m/s?b) What is the ratio
1. 2 answers
2. asked by Anonymous
3. 634 views
Show that the kinetic energy of an object can be written in terms of the momentum asKE = p2/2m. Help ASAP please. Step by step
1. 2 answers
2. asked by Anonymous
3. 526 views
Three carts of masses 4kg, 10 kg, and 3 kg move on a frictionless horizontal surface with initial speeds of 5 m/s, 3 m/s, and 4
1. 3 answers
2. asked by Anonymous
3. 758 views
Each of the underlined premises can be taken as an unacceptable premise in an argument. In each case, identify the condition of
1. 1 answer
2. asked by John
3. 717 views
Two cars approach along icy streets which meet at a right angle to one another. The cars collide and stick together. One car has
1. 2 answers
2. asked by Anonymous
3. 704 views
A 10 kg object (m1) initially moving to the right at 20 m/s makes a totally elastic head on collision with a 15 kg object (m2)
1. 2 answers
2. asked by Anonymous
3. 632 views
Mr. Jackson sold 3 computers in the first year. In the second year he sold 4 times as many computers. In the third year he was
1. 3 answers
2. asked by teresa
3. 1,359 views
The average daily metabolic rate for rodents can be expressed by the function m=85.65w^0.54, where w is the weight in kg and m
1. 1 answer
2. asked by Kyle
3. 886 views
1. The accident left it possible for him to take a rest in hospital.2. The heavy snow left it impossible for him to go to work
1. 3 answers
2. asked by rfvv
3. 539 views
two boats leave at the same time. one sails south and for a distance of 20 miles and finds itself 25 miles from the other boat
1. 1 answer
2. asked by gabi
3. 604 views
Suppose that30% of all college students smoke cigarettes. A sample of 18 is selected randomly. What is the probability that
1. 2 answers
2. asked by Anonymous
3. 5,743 views
The function C(m) = -.41m^2 + 6.7m - 44/ .7m represents Miles Traveled per lb. of CO 2released as a function of speed(in MPH)
1. 5 answers
2. asked by Liz
3. 465 views
A communication tower is 34m tall. Jane stands somewhere in front of the tower to the right and measures the angle of elevation
1. 1 answer
2. asked by cha
3. 528 views
A pilot is asked to approach the airport at an 6° angle of descent. If the plane is travelling at an altitude of 27000 ft, at
1. 1 answer
2. asked by cha
3. 495 views
When an airplane leaves the runway, its angle of ascent is 13° with a speed of 82 metres per second. Find the altitude of the
1. 1 answer
2. asked by cha
3. 584 views
A ship leaves port at 7 am and heads due east at 34 knots. At 10 am, to avoid a storm the ship changes course to N 57Â° east
1. 2 answers
2. asked by cha
3. 672 views
Instructions: Modifique el párrafo por cambiar las palabras entre comillas al tiempo FUTURO.Modelo: Mi familia ‘va a
1. 0 answers
2. asked by Jessie
3. 641 views
A box slides down a frictionless 35 degree incline. Determine its acceleration. If the incline is 10.0 m long and the box starts
1. 1 answer
2. asked by rick
3. 1,712 views
The probability P, as a percent, that a certain computer keyboard in a public library will last more than t years can be
1. 1 answer
2. asked by Dale
3. 973 views
The intensity I of an x-ray after it has passed through a material that is x centimeters thick is given by I = I0e^–kx, where
1. 1 answer
2. asked by Dale
3. 2,338 views
I really need help with this question plz help.Mrs. miller sells a house for $179.000. if she earns a commission of 6%, how much
1. 7 answers
2. asked by URGENT HELP
3. 1,531 views
an archer shoots arrows at the bull's eye of a target and measures the distance from the center of the target to the arrow.
1. 1 answer
2. asked by Anonymous
3. 1,110 views
Imagine making a tent in the shape of a pyramid. Assume we want the volume to be 2.2m3 to sleep two or three people. Draw a
1. 1 answer
2. asked by Cheyenne
3. 698 views
Can someone please explain how to do the following?Baxter Company manufactures two products, Product F and Product G4. The
1. 0 answers
2. asked by Patte
3. 694 views
What mass of carbon dioxide is formed by the complete combustion of 760 g of ethanol?
1. 1 answer
2. asked by Jay
3. 477 views
A particle accelerates from rest at a constant rate for some time and attains a velocity of 8 meter per second. Afterwards it
1. 1 answer
2. asked by Priyanka
3. 752 views
A car was valued at 30k in 1994, it depreciated to 15k by 2000.What was the annual rate of change between 94 and 2000?
1. 4 answers
2. asked by Nicole
3. 574 views
Two cars approach along icy streets which meet at a right angle to one another. The cars collide and stick together. One car has
1. 2 answers
2. asked by Anonymous
3. 711 views
What diff will appear in the mass no.if the no. of neutron is halved no. of electron is doubled in 8 O 16
1. 1 answer
2. asked by Ayushi
3. 413 views
Which two systems work with the muscular systems to allow the body to move
1. 1 answer
2. asked by Brana
3. 1,875 views
Find the distance between the x-intercept and the y-intercept of the graph of the equation 5x - 12y = 60.
1. 2 answers
2. asked by Jeff
3. 1,627 views
Consider the diatomic molecule Na2. For simplicity let the basis set consist of the orbitals: and . In the molecule the overlap
1. 0 answers
2. asked by Soso
3. 491 views
A couple of people have asked this question before, but I still do not understand.Highest/Lowest elevation for Long Beach = 360
1. 1 answer
2. asked by StephAA
3. 1,552 views
Ball A is thrown vertically upwards with a velocity of 30m/s from the ground. After 3 seconds ball B is also thrown vertically
1. 1 answer
2. asked by abd
3. 998 views
if your score is an exam in 80 with a mean of 60 what would be the standarised score of the exam if the standard deviation is 15
1. 1 answer
2. asked by Arif Ali
3. 412 views
The perimeter of a rectangle is 42 feet the length is 5 feet longer than the width what are the dimensions
1. 1 answer
2. asked by Cindy cook
3. 497 views
Some have none but some have more than a hundred
1. 1 answer
2. asked by kim
3. 361 views
If tringle MSQ is coungrent of triangle uvw , then state all the air of corresponding congruent angle and congruent sides
1. 1 answer
2. asked by Mashnaf
3. 462 views
on a certain day, the temperature range from -2f to 10f. what is the difference between the high and low temperatures for that
1. 1 answer
2. asked by chris
3. 742 views
Mike Drago took out a loan for $3,800 at the Gold Coast Bank for 280 days. If the bank uses the ordinary interest method, what
1. 1 answer
2. asked by wanda
3. 1,283 views
Kirti kept a metal spoon in a glass jar filled with pickle for a few days. She observed there were holes in the spoon. What
1. 1 answer
2. asked by Manavi
3. 725 views
A factory's worker productivity is normally distributed. One worker produces an average of 72 units per day with a standard
1. 0 answers
2. asked by Tima
3. 953 views
When might the consumption possibilities frontier with trade not be outside the consumption possibilities frontier under
1. 0 answers
2. asked by Emanuel Andrew
3. 490 views
In triangle UVW state the side opposite to angle U and angle V ?
1. 1 answer
2. asked by Mashnaf
3. 459 views
An object of mass 1.00kg is moving over a horizontal circular path of radius 2.00m, with a speed of 3.00ms^-1. Determine:(a) its
1. 2 answers
2. asked by Stevie
3. 652 views
a shape ABCDE is made up of an isosceles triangle and a rectangle. The perimeter of ABCDE is 46cm.What is the length of AB?
1. 5 answers
2. asked by joshua
3. 579 views
Write a program to compute discount percentage given the marked price and selling price. the user inputs marked and selling
1. 1 answer
2. asked by Linus
3. 737 views
write a program to capture personal details: names, address, telephone, age, city then display them. use both "readline: and
1. 1 answer
2. asked by Linus
3. 629 views
A six faced is so constructed that the probability of getting an even number is twice the probability of getting an odd number.
1. 2 answers
2. asked by deepak
3. 440 views
A store had a sale with 20% off on all items. How much would you pay for a picture. which had a regular price is 580?
1. 1 answer
2. asked by Marry
3. 513 views
if you added 4ml NaOH 1M to your 100ml 0.1M buffer, would it still be a usable buffer according to our convention? Explain why
1. 0 answers
2. asked by yy
3. 1,233 views
Calculate enthalpy of reaction C2H4 + H2 gives C2H6.enthalpy of combustion of ethene, H2,and ethane are -1410,-286,-15.60kj/mol
1. 2 answers
2. asked by Shaika
3. 2,620 views
Calculate the volume of HNO3 that must be introduced in the calorimeter,knowing that it were used 60 ml NaOH, Cc=100cal/grd and
1. 0 answers
2. asked by Alberto
3. 356 views
the length of the rectangular field is thrice of its width if the perimeter of this field is 1.6 kilometres find its area in
1. 1 answer
2. asked by veena madhuri
3. 673 views
Choose a room you'd like to decorate:*I chose my bedroom* Measure the length of one wall in inches: 72in. 2. Choose a size of
1. 1 answer
2. asked by Anonymous
3. 1,230 views
The gradient of the tangent to a curve y=ax^2+bx at the point (2,8)is the parallel to x-axis. Find the values of a and b.
1. 1 answer
2. asked by Lam
3. 889 views
the description of a tv is based on diagonal length. if the height of the tv is 10 inches and the width is 7 inches, what is the
1. 1 answer
2. asked by pls help
3. 1,309 views
So my teacher marked this 0/6 but only told me to correct 2 things. Can some one check over this? If I'm right I need to email
1. 1 answer
2. asked by Sami
3. 651 views
Can you check my answers? Thanks!!!!What would happen to the volume-to-temperature ratio if: 1. One student failed to replenish
1. 1 answer
2. asked by Steve
3. 1,987 views
write a program that accepts & displays the pricing of 10 different items from a suppermarket
1. 1 answer
2. asked by maigua
3. 491 views
"In politics, a political party acts as a 'bonding agent' to ensure the good performance of it's candidates and elected
1. 8 answers
2. asked by Ashley
3. 1,570 views
What is 62 percent in a whole number
1. 3 answers
2. asked by Gnapika
3. 1,547 views
a book contains 312 pages of book has pictures how many pages have pictures in book?
1. 1 answer
2. asked by sanskar
3. 433 views
simplify cosec40(sin40+sin80+cos120)help step
1. 2 answers
2. asked by Anonymous
3. 396 views
simplify cosec40(sin40+sin80+cos120)help step
1. 0 answers
2. asked by Anonymous
3. 300 views
Contributing $1,500 to his retirement fund at the end of each year beginning at age 18 through age 50, with an average annual
1. 1 answer
2. asked by Mike
3. 682 views
Kendra bought a gallon of milk and 5/6 of a pound of oranges. If the gallon of milk cost $3.60 and she spent a total of $4.35,
1. 4 answers
2. asked by adrian c
3. 2,012 views
The lenght of the rectangle is one inch less than three times the width find the Dimensions if the perimeter is 40 inches
1. 1 answer
2. asked by Jayjay santos
3. 472 views
At a height of 500km above earth, a satellite will orbit the earth once every 95 minutes. Find the mass of the earth based on
1. 0 answers
2. asked by Matt
3. 606 views
A) the earth year is 365.25 days long. How long would our year be if earth followed the same orbit, but was only the mass of
1. 0 answers
2. asked by Matt
3. 467 views
Suppose that instead of our sun, our star were a giant star such as Betelgeuse. The mass of Betelgeuse is estimated to be about
1. 0 answers
2. asked by Matt
3. 598 views
A company wants to build a cylindrical container with a semi-sphere lid.For a fixed volume V , the company wants to use a
1. 2 answers
2. asked by Kevin Land
3. 861 views
in Mrs. chin class 1/3 of the students drank juice. 1/4 of the remainder drank water and the others drank soft drinks.1) what
1. 3 answers
2. asked by indira
3. 1,593 views
If you want to increase the pH of the stomach from 1 to 2 using an antacid tablet, how many grams of CaCO3 will be required to
1. 1 answer
2. asked by ashley
3. 796 views
in a school each class has 7 charts to display on a notice board. Each chart must have 9 thumb tacks to support it.a) How many
1. 3 answers
2. asked by indira
3. 765 views
Tyrone, age 25, expects to retire at age 60. He expects to live until age 90. He anticipates needing $45,000 per year in
1. 1 answer
2. asked by Anonymous
3. 656 views
A class of 50 students has to perform exercises in groups of 2 OR 3 students. The numberof groups with 2 students is the same as
1. 1 answer
2. asked by indira
3. 1,242 views
which of the following statements true about king gelawdewos capital??It was built in the 1700s It was a palace decorated with
1. 20 answers
2. asked by URGENT
3. 1,990 views
f'(x)=sqrt(x)*sin(x)The first derivative of the f is given above. If f(0)=0, at what value of x does the function f attain its
1. 2 answers
2. asked by Mike
3. 1,599 views
In an A.P., the first term is 2 and the sum of the first five terms is one-fourth of the next terms. Show that 20th term is
1. 1 answer
2. asked by Tanisha
3. 499 views
A car uniformly accelerates from 0 to 27.0 m/s. A 68.0-kg passenger experiences a horizontal force of 390.0 N.1)How much time
1. 2 answers
2. asked by Casey
3. 2,150 views
One angle of a parallelogram is two third of the Other find the angle of the parallelog9ram
1. 1 answer
2. asked by drasti
3. 317 views
fill in the blank. Big snapping turtles don't get to weigh so much without eating a lot of food. Here's how they do it: Most
1. 0 answers
2. asked by Anonymous
3. 726 views
Every year, Eli and his family visit the Great Sand Dunes desert in Colorado. Eli notices that more sand dunes with varied
1. 40 answers
2. asked by Agala
3. 4,652 views
7 • 68Use distributive property and write it down.
1. 1 answer
2. asked by Britney
3. 628 views
Bacl2.2H2O+KCl what the reaction?
1. 6 answers
2. asked by dushan
3. 2,398 views
Two crates rest on top of one another.There is a crate of mass 4.62 kg on top of another crate of mass 2.19 kg. The coefficient
1. 1 answer
2. asked by 2FUN
3. 622 views
(6x^3-8x^2-6x)/(3-11x-8x^3)
1. 2 answers
2. asked by Mohamed
3. 381 views
Horizantal limit of (6x^3-8x^2-6x)/(3-11x-8x^3)
1. 1 answer
2. asked by Mohamed
3. 377 views
Name the two factors that give federal courts jurisdiction over a case?
1. 1 answer
2. asked by Me
3. 1,256 views
If the area of rectangle is 24 sqm and its perimeter 20 m.Fram the quadratic equation find lenght and breath.
1. 1 answer
2. asked by poonam
3. 431 views
If one train is going north at 60m/s, and the other train is going south at 30m/s, what stop do i get off at?
1. 1 answer
2. asked by Susan Sue
3. 348 views
Sam is now four times as old as her cousin Patty. Next, year, Sam's age will be three times Patty's age then. How old are they
1. 1 answer
2. asked by Dante
3. 416 views
A certain number of identical resistors are connected in series and their total resistance is measured. When the resistors are
1. 5 answers
2. asked by Charles
3. 688 views
What was the significance of the battle of AntietamA) it was the first battle of the civil war B) it was a confederate victory
1. 6 answers
2. asked by PRetty little liars
3. 1,750 views

Back to November 2016

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024