Archives
2016
September

Questions Asked on September 24, 2016

Revise the question:4. Use the given property to complete the statement. Distributive Property of Equality If a(b + c) = ab +
1. 0 answers
2. asked by Lilly
3. 8,615 views
An element has three stable isotopes. One has a mass number of 63 and an abundance of 50%. The second has a mass number of 65
1. 15 answers
2. asked by Robert
3. 8,317 views
An arrow is shot from a height of 1.4 m toward a cliff of height H. It is shot with a velocity of 28 m/s at an angle of 60°
1. 2 answers
2. asked by A
3. 7,893 views
Aqueous solutions of copper (II) sulfate, CuSO4, and potassium carbonate, K2CO3, a blue parcipitate of copper (II) carbonate
1. 1 answer
2. asked by Sarah
3. 5,358 views
what expressed powers show that the framers wished congress to have the power to secure the nation against?1. raise armies and a
1. 23 answers
2. asked by leslie
3. 5,193 views
In a large building, oil is used in a steam boiler heating system. The combustion of 1.0 lb of oil provides 2.2×107J.Part A How
1. 1 answer
2. asked by john
3. 4,425 views
I have another question that stumped meLine segment AB with length a is divided by points P and Q into three line segments: AP ,
1. 2 answers
2. asked by Ava
3. 3,341 views
ted Williams made deposits of 500.00 at the end of each year for eight years. the rat is 8% compounded annually. calculate the
1. 3 answers
2. asked by jackie
3. 3,084 views
which of the following gives congress the power to fund parts of the executive branch such as the department of education?A.
1. 16 answers
2. asked by leslie
3. 2,969 views
7 is subtracted from the quotient of 48 divided by sum of 5 and difference of 11 and 8
1. 3 answers
2. asked by sumit
3. 2,869 views
Village B is 7km due south of village A and village C is 9km due south of B. Village D is 8km from A and is due east of B. Find
1. 6 answers
2. asked by Jane
3. 2,794 views
A 36 inch board is to be cut into three pieces so that the second piece is 3 times as long as the first piece and the third
1. 1 answer
2. asked by Colleen
3. 2,741 views
Paper pulp is sold on the basis that it contains 12% moisture; if the moisture exceeds thisvalue, the purchaser can deduct any
1. 2 answers
2. asked by jana
3. 2,707 views
A room measures 6m by 8m to the nearest meter. A carpet tile measures 50cm exactly. What is the maximum number of carpets tiles
1. 8 answers
2. asked by Lucifer
3. 2,599 views
// Program: name of program// Author: your name // Date Written: date you began writing the program /* Abstract: Brief
1. 1 answer
2. asked by Frank
3. 2,317 views
When might I need to estimate a sum?
1. 2 answers
2. asked by Caleb
3. 2,249 views
A sample of CaCl2⋅2H2O/K2C2O4⋅H2O solid salt mixture is dissolved in ~150 mLde-ionized H2O. The oven dried precipitate has a
1. 3 answers
2. asked by maricela
3. 2,166 views
which of the following best describes the interpretation of the constitution by a strict constructionist?A. favors a powerful
1. 3 answers
2. asked by Leslie
3. 2,161 views
angles of a certain polygon are in arithmetic sequence. The smallest interior angle measures 80 degrees and the largest interior
1. 7 answers
2. asked by phum
3. 2,074 views
A Statistics professor assigned 10 quizzes over the course of the semester. He wanted to see if there was a relationship between
1. 1 answer
2. asked by Papi
3. 2,055 views
A BMX rider is coming up to a ramp that is set to 23.0° and the end point is 1.60 m above the ground. They travel up the ramp
1. 1 answer
2. asked by Brooklyn
3. 1,785 views
Reaction: 1/2N2 + 3/2H2 --> NH3Delta H = -46Kj/mol 1) Find delta H n(NH3)formed=5 mol. M(NH3=8.5g) 2) Find delta H a)3 mol H2 +
1. 1 answer
2. asked by Christine
3. 1,725 views
Before 1720, what was the difference in the relationships between the Spanish and the Apache compared to the Spanish and
1. 3 answers
2. asked by Pier
3. 1,612 views
I am lost ..Why did the great compromise establish a two-house legislature? A:to fairly represent all states B:to allow for
1. 4 answers
2. asked by Lexi
3. 1,575 views
Nancy is a pilot in Canada¡¯s North. She needs to deliver emergency supplies to a location that is 500 km away.Nancy has set
1. 1 answer
2. asked by WON
3. 1,570 views
What is the value of 4^2 - 2(3 x 5 + 1)?My answer~ I took (3 x 5 + 1) = 16 x 4^2 = 16 - 2 = 14, and I got 254, but that's not on
1. 5 answers
2. asked by Fieroh
3. 1,443 views
You are walking a dog when the dog sees a cat and runs away from you. You immediately run after the dog at 4.90 m/s. You jump at
1. 1 answer
2. asked by Tom
3. 1,437 views
Are there two integers with a product of -12 and a sum of -3?
1. 1 answer
2. asked by Becky-G
3. 1,370 views
Two kittens are running toward each other, one is named Chloe and the other is named Luna. Chloe runs at a speed of 2.00 m/s and
1. 1 answer
2. asked by Brooklyn
3. 1,272 views
1. What number on the pH scale is the strongest acid?2. What number on the pH scale is the strongest base? Can you please help
1. 3 answers
2. asked by Matt-Please Help
3. 1,269 views
what is the difference between a regular session of congress and a special session of congressA. a regular session has all the
1. 4 answers
2. asked by Us
3. 1,194 views
national emergencies, advances in technology, and demand for services have increased congress's acceptance of which view?A.
1. 7 answers
2. asked by leslie
3. 1,153 views
In an orienteering race, you walk 100 m due east and then walk N70¡ÆE for 60 m. How far are you from yourstarting position,
1. 1 answer
2. asked by WON
3. 1,152 views
You prepare a 1L solution of 0.5 M imidazole. (pKa= 7.05). Calculate the pH of the solution after you add 0.1 moles of HCl.I
1. 0 answers
2. asked by Ashley
3. 1,113 views
Christiano Ronaldo kicks a soccer ball with an initial velocity of 24.0 m/s at an angle of 25.0°. How far away does the ball
1. 1 answer
2. asked by Brooklyn
3. 1,104 views
You can jump 2 feet vertically on Earth. Figure out how high you would be able to jump on the Moon, where acceleration due to
1. 2 answers
2. asked by BunBun
3. 1,096 views
CaCl2(s) -> Ca(aq) + 2Cl(aq) ΔH_rxn = +198.0 KJ"If that g sample of calcium chloride was dissolved in 1000.0g of water, with
1. 5 answers
2. asked by Maddison
3. 1,083 views
A solution contains a mixture of pentane and hexane at room temperature. The solution has a vapor pressure of 252 torr . Pure
1. 1 answer
2. asked by liz
3. 1,079 views
Prove that in any triangle ABC Sin2A+Sin2B+Sin2C/SinA+SinB+SinC=8Sin(A/2)Sin(B/2)Sin(C/2)
1. 1 answer
2. asked by joel
3. 1,075 views
"You can jump 2 feet vertically on Earth. Figure out how high you would be able to jump on the Moon, where acceleration due to
1. 2 answers
2. asked by BunBun
3. 1,039 views
A solution contains naphthalene (C10H8) dissolved in hexane (C6H14) at a concentration of 11.07 % naphthalene by mass.Calculate
1. 0 answers
2. asked by elizabeth
3. 1,037 views
If there are 7.48 gallons of water in a cubic foot, how many gallons of water is needed to fill a pool that is 2,260.8 cubic
1. 3 answers
2. asked by Nae
3. 1,032 views
Teen Financier Gets Oprah's Attention.How did Lesley Scorgie acquire the money to make her investments? Why is Lesley Scorgie
1. 0 answers
2. asked by Anonymous
3. 1,029 views
There is a text named Adolescent Confusion by Maya Angelou, and I have to write a paragraph about :Most teenagers are, at times,
1. 2 answers
2. asked by angie
3. 1,020 views
You are walking a dog when the dog sees a cat and runs away from you. You immediately run after the dog at 4.20 m/s. You jump at
1. 0 answers
2. asked by Brooklyn
3. 1,020 views
Juan sells suits in a major department store on weekends.He earns a commission of 5% on the first 10 suits, and if he sells more
1. 2 answers
2. asked by donna
3. 1,001 views
Two kittens are running toward each other, one is named Chloe and the other is named Luna. Chloe runs at a speed of 2.80 m/s and
1. 1 answer
2. asked by Tom
3. 946 views
If you have 25 glucose molecules transporting out to 5 glucose molecules how will the molecules need to move to reach
1. 1 answer
2. asked by Hayden
3. 943 views
Of the following choices, which ones are concidered democratic values?(2 points)Serving the military Honesty **** Patriotism
1. 8 answers
2. asked by Lexi
3. 941 views
HARRY GIVES SAM A 30m head start in 100m dash. Harry can run 10m/s, while sam only runs 6.0 m/s per second, how much of a head
1. 1 answer
2. asked by brahtherfrmanothermather
3. 914 views
Ari had twice as much money as Rita. After Ari spent $800 and Rita spent $240 both of them had the same amount of money left
1. 1 answer
2. asked by Krish
3. 913 views
Find the percentage of pure gold in 22-carat gold, if 24-carat gold is 100% pure gold.
1. 3 answers
2. asked by Vivek
3. 904 views
which of the following powers can congress exercise according to the constitution?1. abolishing jury trials 2. collecting taxes
1. 3 answers
2. asked by leslie
3. 851 views
Block A (Mass = 3.500 kg) and Block B (Mass = 2.450 kg) are attached by a massless string Block A sits on a horizontal tabletop.
1. 1 answer
2. asked by ASak
3. 837 views
1. Determine the resultant of each vector suma) 45 km/h vertically and then 75 km/h horizontally. b) 300 m east and then 400 m
1. 1 answer
2. asked by WON
3. 831 views
Ron has a piece of rope 6 1/2 long,Tony has one that is 7 2/3m long.How long are their ropes if put together?
1. 2 answers
2. asked by lea
3. 817 views
Information: Juan plans to build a bookcase t store his paperback books, DVDs, and CDs. he has lumber that he will use for the
1. 1 answer
2. asked by Josephine URGENT PLEASE ANSWER
3. 808 views
A hypothetical molecule, X–Y, has a dipole moment of 1.76 D and a bond length of 151 pm. Calculate the percent ionic character
1. 0 answers
2. asked by Alsiha
3. 796 views
A 0.5kg mass connected to a light spring of constant 20N/M occilates on a frictionless track. Calculate the total energy of the
1. 0 answers
2. asked by Charles
3. 792 views
Four charges are located at the four corners of a square of side b:Q1 = 3 nC at the top right corner, Q2 = -4 nC at the bottom
1. 1 answer
2. asked by Steve
3. 791 views
Block A (Mass = 3.146 kg) and Block B (Mass = 2.330 kg) are attached by a massless string Block A sits on a horizontal tabletop.
1. 0 answers
2. asked by Quaz
3. 784 views
Hey! I have this problem - i'm currently working on Quadratics at school, and i got homework. One of the questions is
1. 1 answer
2. asked by Simon
3. 773 views
Identify: May I go to the library?
1. 1 answer
2. asked by Jordan
3. 771 views
Find the measure of angle BCA and angle BAC if the measure of angle B is 65°
1. 1 answer
2. asked by Charvita
3. 759 views
How many pieces of 4Inches of ribbon can get from a roll of 25 feet ribbon?
1. 3 answers
2. asked by Ann
3. 730 views
what expressed powers show that the framers wished congress to have the power to secure the nation against?1. raise armies and a
1. 2 answers
2. asked by leslie
3. 724 views
Points P and Q are both in the line segment AB and on the same side of its midpoint. P divides AB in the ratio 2:3, and Q
1. 1 answer
2. asked by Samhitha
3. 716 views
guys need help on ODE questions,i just need you guys to tell me what method to use for the following equations and i will try
1. 2 answers
2. asked by lim
3. 709 views
1. Is John Hajun¡¯s gold friend or silver friend?He is Hajun¡¯s gold friend. 2. What do you want to do in Yosemite? I want
1. 1 answer
2. asked by rfvv
3. 707 views
Reaction: 1/2N2 + 3/2H2 --> NH3Delta H = -46Kj/mol 1) Find delta H n(NH3)formed=5 mol. M(NH3=8.5g) 2) Find delta H a)3 mol H2 +
1. 3 answers
2. asked by Christine
3. 704 views
A dart is being thrown at a board that is 2.80 m away. When it hits the board it is 0.486 m below the point where it was aimed
1. 0 answers
2. asked by Brooklyn
3. 698 views
Can anyone write a short paragraph explaining how things are similar and/or different between the U.S. states that border
1. 3 answers
2. asked by Lilly
3. 695 views
Could you pls check this time line1, king George issues Proclamation of 1763 2, stamp act 3. Sons of Liberty 4. Boston Massacre
1. 1 answer
2. asked by lulu
3. 695 views
Can anyone write a short paragraph explaining how things are similar and/or different between the U.S. states that border
1. 2 answers
2. asked by Lilly
3. 693 views
One more thing...To be a citizen, one of the options include being a person of foreign birth successfully completes the
1. 1 answer
2. asked by Lexi
3. 664 views
Raimo borrowed $830 from Chris on October 19 and agreed to repay the debt with simple interest at the rate of 5.1% on May 18.How
1. 1 answer
2. asked by sukhman
3. 660 views
what happens when a solution of iron 2 sulphate in a test tube was bubbled through chlorine gas
1. 2 answers
2. asked by value
3. 652 views
The intensity of solar radiation at the surface of the earth is1kW/m2 . A roof has a square solar panel of sides 10m that
1. 1 answer
2. asked by OWOLABI
3. 651 views
A variable tangent to the ellipse (x/a)^2 +(y/b)^2 meets the parabola y^2=4ax at L and M. Find the locus of the midpoint of LM.
1. 1 answer
2. asked by joel
3. 648 views
Explain the structure of a water molecule and how hydrogen bonding leads to some of its very special properties. Be sure to
1. 1 answer
2. asked by Kayla
3. 642 views
what expressed powers show that the framers wished congress to have the power to secure the nation against?1. raise armies and a
1. 2 answers
2. asked by leslie
3. 620 views
Hello everyone I'm working on this problem and I need some clarification.A 40 tonne jumbo jet accelerates down the runway at 5
1. 0 answers
2. asked by Jadon
3. 612 views
What countries are the following? is 20 degrees S, 140E?40N, 20E? 40N, 100W?
1. 1 answer
2. asked by RD
3. 596 views
A car moves at 20 meters in 2 seconds. What is the momentum of the car if it has a mass of 3,000 kg?A football player runs
1. 2 answers
2. asked by YOLANDA
3. 596 views
Given a 800 mg sample of Thorium-231 decomposes via beta emission with a half life of 25.5 hours, how long would it take, in
1. 1 answer
2. asked by Lauren
3. 590 views
The narrative of a crime report and the narrative of an arrest report:a. are totally different b. need to be written in present
1. 1 answer
2. asked by Tracy
3. 578 views
1. When did they arrive at Yosemite?- They arrived at Yosemite in the afternoon on July 20. 1-2. When did they arrive at
1. 1 answer
2. asked by rfvv
3. 574 views
How do acidity and surface area affect the weathering of most materials?Can you also provide me with a website to read about
1. 1 answer
2. asked by Matt-Please Help
3. 573 views
Give me some equations about angle of elevation, angle of depression and angle of inclination that is related to my course. Im a
1. 1 answer
2. asked by Rowena
3. 565 views
I am doing 7th grade algebra, and my homework is due by 9:00 and I don't know how to solve this question:Find the measures of
1. 1 answer
2. asked by Ava
3. 565 views
A fired bullet sounds is heard after2sec .its speed in air is 340m\sec.what is the distance of sound.
1. 1 answer
2. asked by Pratham
3. 560 views
If you want to add 2/3 and 3/5, you will find the LCM of the denominators then divide the LCM of the denominators and multiply
1. 2 answers
2. asked by Sheena Jane
3. 559 views
Andrew weighs 45 lbs and requires insulin. His doctor has prescribed 0.150 units of insulin/kg body weight/hr while he is in the
1. 0 answers
2. asked by Amy
3. 555 views
What country or continent is located at 40°S,100°E?
1. 3 answers
2. asked by RD
3. 532 views
A 40 tonne jumbo jet accelerates down the runway at 5 m/s^2. What must be the thrust on each of its four engines? What is the
1. 0 answers
2. asked by Jadon
3. 530 views
To solve by the elimination method.5x+7y=40,x=y+3
1. 1 answer
2. asked by Ann
3. 525 views
If you had an inequality x is less than or equal to 8 would you shade towards the origin or away from the origin
1. 2 answers
2. asked by Anonymous
3. 523 views
Five year old Andrew weighs 45 lbs and requires insulin. His doctor has prescribed 0.150 units of insulin/kg body weight/hr
1. 1 answer
2. asked by Laura
3. 509 views
How many ml of 12M HCl are needed to prepare 500ml of 0.10 M solution?Step by step if you can please.
1. 1 answer
2. asked by Areli
3. 495 views
three numbers are in harmonic progression. their mean is 20.if the first term is twice the third term find the three numbers???
1. 1 answer
2. asked by Fida
3. 484 views

Back to September 2016

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025