Archives
2016
September

Questions Asked on September 24, 2016

Village B is 7km due south of village A and village C is 9km due south of B. Village D is 8km from A and is due east of B. Find
1. 6 answers
2. asked by Jane
3. 2,741 views
Of the following choices, which ones are concidered democratic values?(2 points)Serving the military Honesty **** Patriotism
1. 8 answers
2. asked by Lexi
3. 908 views
What is the name given to a hook or curved area of land that extends into a sea or a Ocean
1. 2 answers
2. asked by Mimi
3. 328 views
Identify: May I go to the library?
1. 1 answer
2. asked by Jordan
3. 747 views
Are there two integers with a product of -12 and a sum of -3?
1. 1 answer
2. asked by Becky-G
3. 1,342 views
Given a 800 mg sample of Thorium-231 decomposes via beta emission with a half life of 25.5 hours, how long would it take, in
1. 1 answer
2. asked by Lauren
3. 551 views
You prepare a 1L solution of 0.5 M imidazole. (pKa= 7.05). Calculate the pH of the solution after you add 0.1 moles of HCl.I
1. 0 answers
2. asked by Ashley
3. 1,072 views
One more thing...To be a citizen, one of the options include being a person of foreign birth successfully completes the
1. 1 answer
2. asked by Lexi
3. 623 views
// Program: name of program// Author: your name // Date Written: date you began writing the program /* Abstract: Brief
1. 1 answer
2. asked by Frank
3. 2,259 views
A dart is being thrown at a board that is 2.80 m away. When it hits the board it is 0.486 m below the point where it was aimed
1. 0 answers
2. asked by Brooklyn
3. 662 views
I have a 91 as my average now. I only have two weeks left. What do I need to get and a (93)?
1. 1 answer
2. asked by Lexi
3. 290 views
ted Williams made deposits of 500.00 at the end of each year for eight years. the rat is 8% compounded annually. calculate the
1. 3 answers
2. asked by jackie
3. 3,054 views
Christiano Ronaldo kicks a soccer ball with an initial velocity of 24.0 m/s at an angle of 25.0°. How far away does the ball
1. 1 answer
2. asked by Brooklyn
3. 1,067 views
In a large building, oil is used in a steam boiler heating system. The combustion of 1.0 lb of oil provides 2.2×107J.Part A How
1. 1 answer
2. asked by john
3. 4,390 views
when are annuity due payments made
1. 1 answer
2. asked by jackie
3. 428 views
I am lost ..Why did the great compromise establish a two-house legislature? A:to fairly represent all states B:to allow for
1. 4 answers
2. asked by Lexi
3. 1,533 views
1. Determine the resultant of each vector suma) 45 km/h vertically and then 75 km/h horizontally. b) 300 m east and then 400 m
1. 1 answer
2. asked by WON
3. 801 views
Nancy is a pilot in Canada¡¯s North. She needs to deliver emergency supplies to a location that is 500 km away.Nancy has set
1. 1 answer
2. asked by WON
3. 1,531 views
In an orienteering race, you walk 100 m due east and then walk N70¡ÆE for 60 m. How far are you from yourstarting position,
1. 1 answer
2. asked by WON
3. 1,118 views
If there are 7.48 gallons of water in a cubic foot, how many gallons of water is needed to fill a pool that is 2,260.8 cubic
1. 3 answers
2. asked by Nae
3. 999 views
A sample of CaCl2⋅2H2O/K2C2O4⋅H2O solid salt mixture is dissolved in ~150 mLde-ionized H2O. The oven dried precipitate has a
1. 3 answers
2. asked by maricela
3. 2,123 views
what is the difference between a regular session of congress and a special session of congressA. a regular session has all the
1. 4 answers
2. asked by Us
3. 1,153 views
The limit as x approaches negative infinity is(3x^5 + x + 2) / (8x^4 - 5) a. DNE b. 0 c. -3/8 d. 3/8 I think the answer is
1. 2 answers
2. asked by Dave
3. 393 views
A 0.5kg mass connected to a light spring of constant 20N/M occilates on a frictionless track. Calculate the total energy of the
1. 0 answers
2. asked by Charles
3. 764 views
Raimo borrowed $830 from Chris on October 19 and agreed to repay the debt with simple interest at the rate of 5.1% on May 18.How
1. 1 answer
2. asked by sukhman
3. 620 views
An arrow is shot from a height of 1.4 m toward a cliff of height H. It is shot with a velocity of 28 m/s at an angle of 60°
1. 2 answers
2. asked by A
3. 7,856 views
To solve by the elimination method.5x+7y=40,x=y+3
1. 1 answer
2. asked by Ann
3. 489 views
To solve by elimination4x-6y=10,x+y=0
1. 1 answer
2. asked by Ann
3. 436 views
Ron has a piece of rope 6 1/2 long,Tony has one that is 7 2/3m long.How long are their ropes if put together?
1. 2 answers
2. asked by lea
3. 790 views
Hello everyone I'm working on this problem and I need some clarification.A 40 tonne jumbo jet accelerates down the runway at 5
1. 0 answers
2. asked by Jadon
3. 571 views
A 40 tonne jumbo jet accelerates down the runway at 5 m/s^2. What must be the thrust on each of its four engines? What is the
1. 0 answers
2. asked by Jadon
3. 501 views
Find the measure of angle BCA and angle BAC if the measure of angle B is 65°
1. 1 answer
2. asked by Charvita
3. 738 views
The binding energy of election is 13.6 v .the loss of mass in formation of h atom is
1. 0 answers
2. asked by Jinkal
3. 378 views
In a right angle traingle ANCIENT, ANGLE B=90 DEGREES. IF AB/AC=1/ROOT2 FIND BC/AC.
1. 1 answer
2. asked by Debina
3. 380 views
A variable tangent to the ellipse (x/a)^2 +(y/b)^2 meets the parabola y^2=4ax at L and M. Find the locus of the midpoint of LM.
1. 1 answer
2. asked by joel
3. 609 views
Prove that in any triangle ABC Sin2A+Sin2B+Sin2C/SinA+SinB+SinC=8Sin(A/2)Sin(B/2)Sin(C/2)
1. 1 answer
2. asked by joel
3. 1,037 views
1. Is John Hajun¡¯s gold friend or silver friend?He is Hajun¡¯s gold friend. 2. What do you want to do in Yosemite? I want
1. 1 answer
2. asked by rfvv
3. 680 views
2logxbase5+3logybase3=8and 6logxbase5+2logybase3=2 solve silmultaneously
1. 1 answer
2. asked by samson
3. 303 views
The intensity of solar radiation at the surface of the earth is1kW/m2 . A roof has a square solar panel of sides 10m that
1. 1 answer
2. asked by OWOLABI
3. 616 views
Give me some equations about angle of elevation, angle of depression and angle of inclination that is related to my course. Im a
1. 1 answer
2. asked by Rowena
3. 537 views
Meaning, types and feautures of digital divide
1. 1 answer
2. asked by Moyo
3. 392 views
An element has three stable isotopes. One has a mass number of 63 and an abundance of 50%. The second has a mass number of 65
1. 15 answers
2. asked by Robert
3. 8,259 views
Ari had twice as much money as Rita. After Ari spent $800 and Rita spent $240 both of them had the same amount of money left
1. 1 answer
2. asked by Krish
3. 869 views
1. When did they arrive at Yosemite?- They arrived at Yosemite in the afternoon on July 20. 1-2. When did they arrive at
1. 1 answer
2. asked by rfvv
3. 548 views
I am doing 7th grade algebra, and my homework is due by 9:00 and I don't know how to solve this question:Find the measures of
1. 1 answer
2. asked by Ava
3. 528 views
I have another question that stumped meLine segment AB with length a is divided by points P and Q into three line segments: AP ,
1. 2 answers
2. asked by Ava
3. 3,281 views
angles of a certain polygon are in arithmetic sequence. The smallest interior angle measures 80 degrees and the largest interior
1. 7 answers
2. asked by phum
3. 2,025 views
If you want to add 2/3 and 3/5, you will find the LCM of the denominators then divide the LCM of the denominators and multiply
1. 2 answers
2. asked by Sheena Jane
3. 509 views
Paper pulp is sold on the basis that it contains 12% moisture; if the moisture exceeds thisvalue, the purchaser can deduct any
1. 2 answers
2. asked by jana
3. 2,668 views
What is the least number of rolls should a fair standard 6-sided die be done so that the recorded numbers that have been shown
1. 0 answers
2. asked by wqa
3. 400 views
Hey! I have this problem - i'm currently working on Quadratics at school, and i got homework. One of the questions is
1. 1 answer
2. asked by Simon
3. 732 views
7 is subtracted from the quotient of 48 divided by sum of 5 and difference of 11 and 8
1. 3 answers
2. asked by sumit
3. 2,822 views
How many pieces of 4Inches of ribbon can get from a roll of 25 feet ribbon?
1. 3 answers
2. asked by Ann
3. 699 views
A fired bullet sounds is heard after2sec .its speed in air is 340m\sec.what is the distance of sound.
1. 1 answer
2. asked by Pratham
3. 528 views
Connie has 18 and mae has 16 apple also. How many apple they have? Solve in four different ways.
1. 2 answers
2. asked by shirly
3. 325 views
How many circles are there whose central lines on X axis and passes through origin?
1. 1 answer
2. asked by sanjay
3. 355 views
Points P and Q are both in the line segment AB and on the same side of its midpoint. P divides AB in the ratio 2:3, and Q
1. 1 answer
2. asked by Samhitha
3. 674 views
A solution contains naphthalene (C10H8) dissolved in hexane (C6H14) at a concentration of 11.07 % naphthalene by mass.Calculate
1. 0 answers
2. asked by elizabeth
3. 982 views
The narrative of a crime report and the narrative of an arrest report:a. are totally different b. need to be written in present
1. 1 answer
2. asked by Tracy
3. 545 views
to determine the concentration of ascorbic acid in fruit juice using DCPIP
1. 0 answers
2. asked by Zanele
3. 447 views
If 10.0 L of butane and oxygen are combined at the same temperature and pressure, which gas will be left over after reaction?
1. 0 answers
2. asked by Darren
3. 437 views
A solution contains a mixture of pentane and hexane at room temperature. The solution has a vapor pressure of 252 torr . Pure
1. 1 answer
2. asked by liz
3. 1,032 views
When might I need to estimate a sum?
1. 2 answers
2. asked by Caleb
3. 2,213 views
A hypothetical molecule, X–Y, has a dipole moment of 1.76 D and a bond length of 151 pm. Calculate the percent ionic character
1. 0 answers
2. asked by Alsiha
3. 771 views
There is a text named Adolescent Confusion by Maya Angelou, and I have to write a paragraph about :Most teenagers are, at times,
1. 2 answers
2. asked by angie
3. 995 views
Reaction: 1/2N2 + 3/2H2 --> NH3Delta H = -46Kj/mol 1) Find delta H n(NH3)formed=5 mol. M(NH3=8.5g) 2) Find delta H a)3 mol H2 +
1. 1 answer
2. asked by Christine
3. 1,679 views
Q1-Who gave the equation (E=MC^2).Q2-Who gave the equation (V=IR). Q3-What was Newton's second law?. Q4-What was Newton's first
1. 1 answer
2. asked by Varun Dhawan
3. 431 views
Find the percentage of pure gold in 22-carat gold, if 24-carat gold is 100% pure gold.
1. 3 answers
2. asked by Vivek
3. 873 views
Before 1720, what was the difference in the relationships between the Spanish and the Apache compared to the Spanish and
1. 3 answers
2. asked by Pier
3. 1,563 views
You are walking a dog when the dog sees a cat and runs away from you. You immediately run after the dog at 4.20 m/s. You jump at
1. 0 answers
2. asked by Brooklyn
3. 987 views
three numbers are in harmonic progression. their mean is 20.if the first term is twice the third term find the three numbers???
1. 1 answer
2. asked by Fida
3. 454 views
A room measures 6m by 8m to the nearest meter. A carpet tile measures 50cm exactly. What is the maximum number of carpets tiles
1. 8 answers
2. asked by Lucifer
3. 2,557 views
You can jump 2 feet vertically on Earth. Figure out how high you would be able to jump on the Moon, where acceleration due to
1. 2 answers
2. asked by BunBun
3. 1,057 views
"You can jump 2 feet vertically on Earth. Figure out how high you would be able to jump on the Moon, where acceleration due to
1. 2 answers
2. asked by BunBun
3. 1,008 views
Reaction: 1/2N2 + 3/2H2 --> NH3Delta H = -46Kj/mol 1) Find delta H n(NH3)formed=5 mol. M(NH3=8.5g) 2) Find delta H a)3 mol H2 +
1. 3 answers
2. asked by Christine
3. 658 views
guys need help on ODE questions,i just need you guys to tell me what method to use for the following equations and i will try
1. 2 answers
2. asked by lim
3. 666 views
what happens when a solution of iron 2 sulphate in a test tube was bubbled through chlorine gas
1. 2 answers
2. asked by value
3. 621 views
Aqueous solutions of copper (II) sulfate, CuSO4, and potassium carbonate, K2CO3, a blue parcipitate of copper (II) carbonate
1. 1 answer
2. asked by Sarah
3. 5,317 views
Explain the structure of a water molecule and how hydrogen bonding leads to some of its very special properties. Be sure to
1. 1 answer
2. asked by Kayla
3. 606 views
A Statistics professor assigned 10 quizzes over the course of the semester. He wanted to see if there was a relationship between
1. 1 answer
2. asked by Papi
3. 2,020 views
Block A (Mass = 3.146 kg) and Block B (Mass = 2.330 kg) are attached by a massless string Block A sits on a horizontal tabletop.
1. 0 answers
2. asked by Quaz
3. 746 views
What countries are the following? is 20 degrees S, 140E?40N, 20E? 40N, 100W?
1. 1 answer
2. asked by RD
3. 563 views
Can anyone write a short paragraph explaining how things are similar and/or different between the U.S. states that border
1. 3 answers
2. asked by Lilly
3. 649 views
A BMX rider is coming up to a ramp that is set to 23.0° and the end point is 1.60 m above the ground. They travel up the ramp
1. 1 answer
2. asked by Brooklyn
3. 1,752 views
Two kittens are running toward each other, one is named Chloe and the other is named Luna. Chloe runs at a speed of 2.00 m/s and
1. 1 answer
2. asked by Brooklyn
3. 1,232 views
What country or continent is located at 40°S,100°E?
1. 3 answers
2. asked by RD
3. 503 views
Teen Financier Gets Oprah's Attention.How did Lesley Scorgie acquire the money to make her investments? Why is Lesley Scorgie
1. 0 answers
2. asked by Anonymous
3. 993 views
2,383-1,907 ----------
1. 1 answer
2. asked by Faith
3. 344 views
1. What number on the pH scale is the strongest acid?2. What number on the pH scale is the strongest base? Can you please help
1. 3 answers
2. asked by Matt-Please Help
3. 1,243 views
Revise the question:4. Use the given property to complete the statement. Distributive Property of Equality If a(b + c) = ab +
1. 0 answers
2. asked by Lilly
3. 8,588 views
what expressed powers show that the framers wished congress to have the power to secure the nation against?1. raise armies and a
1. 2 answers
2. asked by leslie
3. 590 views
The pressure in pressure cooker is 1.90 what will be the temperature
1. 1 answer
2. asked by Humza Alvi
3. 369 views
How do acidity and surface area affect the weathering of most materials?Can you also provide me with a website to read about
1. 1 answer
2. asked by Matt-Please Help
3. 542 views
Block A (Mass = 3.500 kg) and Block B (Mass = 2.450 kg) are attached by a massless string Block A sits on a horizontal tabletop.
1. 1 answer
2. asked by ASak
3. 795 views
what expressed powers show that the framers wished congress to have the power to secure the nation against?1. raise armies and a
1. 2 answers
2. asked by leslie
3. 692 views
You are walking a dog when the dog sees a cat and runs away from you. You immediately run after the dog at 4.90 m/s. You jump at
1. 1 answer
2. asked by Tom
3. 1,391 views
What is the value of 4^2 - 2(3 x 5 + 1)?My answer~ I took (3 x 5 + 1) = 16 x 4^2 = 16 - 2 = 14, and I got 254, but that's not on
1. 5 answers
2. asked by Fieroh
3. 1,404 views
If you had an equation zero is less than or equal to 2 would you say that's true because 0 is less than 2 or false because it
1. 2 answers
2. asked by Anonymous
3. 428 views
Five year old Andrew weighs 45 lbs and requires insulin. His doctor has prescribed 0.150 units of insulin/kg body weight/hr
1. 1 answer
2. asked by Laura
3. 478 views
what expressed powers show that the framers wished congress to have the power to secure the nation against?1. raise armies and a
1. 23 answers
2. asked by leslie
3. 5,139 views

Back to September 2016

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024