Archives
2016
June

Questions Asked on June 10, 2016

In a course a student's final exam is weighted as heavily as his mid term exam.if a student receives a score of 84 on his final
1. 5 answers
2. asked by tish
3. 3,722 views
A cylindrical water tank is 70cm in diameter to begin with it is full of water a leak starts in the bottom so that it looses 10
1. 32 answers
2. asked by Daniel
3. 4,542 views
All the following are recognized roles of a health information management professional by American Health Information Management
1. 1 answer
2. asked by Anonymous
3. 559 views
One of the major challenges and obstacles for providers is timeliness and efficiency of access to patient information.True False
1. 2 answers
2. asked by Anonymous
3. 458 views
Because of the Health Insurance Portability and Accountability Act (HIPAA), privacy and security of health information
1. 2 answers
2. asked by Anonymous
3. 824 views
One of the earliest means of HIT automation was the administrative functions of patient billing and patient registration, and
1. 2 answers
2. asked by Anonymous
3. 599 views
Hey, can someone please check my work for me? I've done this over and over but cannot find my mistake. Am I just supposed to
1. 2 answers
2. asked by Anonymous
3. 458 views
Continuing education is mandatory for maintenance of certification as a health information professional.True False False?
1. 0 answers
2. asked by Anonymous
3. 505 views
Writing the net ionic equation for sodium fluoride+hydrochloride,magnesium iodide + lead (II) acetate sliver (I) acetate +
1. 1 answer
2. asked by Lesley
3. 990 views
When did the recording of clinical information begin in the United States?Late 1700s Early 1800s Late 1800s Early 1900s 1920s
1. 1 answer
2. asked by Anonymous
3. 864 views
Which of the following is a legitimate and stated use of health information according to American Health Information Management
1. 1 answer
2. asked by Anonymous
3. 1,127 views
equal moles of ethane and hydrogen are mixed in container at 25 c what will be the pressure exerted by hydreogen?
1. 1 answer
2. asked by Musfera iqbal
3. 438 views
bernard burrows rm8889 at 15%per annum simple interest. he agrees to settle the loan by paying x ringgit, 2x ringgit and 3x
1. 0 answers
2. asked by Ali
3. 855 views
find the range of the function rule y=5x-2 for the domain {-1/2, 1/4, 2/5}
1. 1 answer
2. asked by Eden
3. 1,154 views
Please explain to me how to figure out the answers to these questions because I got them all wrong.Don't worry there's only 2..
1. 1 answer
2. asked by Myah
3. 595 views
Marta’s math textbook weighs mc017-1.jpg of a pound less than 4 times the weight of the book she is reading for her language
1. 1 answer
2. asked by david
3. 1,492 views
A 1000kg rocket is set vertically on its launching pad. The propellent is expelled at the rate of 2kg/s. Find the minimum
1. 1 answer
2. asked by swastik
3. 984 views
If the third term of a gp =4 than product of first five term=
1. 1 answer
2. asked by Abhi
3. 473 views
The midnight temperature of Delhi in the month of December was 100C If dropped by 40C in the next three hours.What was the
1. 5 answers
2. asked by Priya
3. 1,424 views
Chuchu is a pet dog. His master is an office worker. Master comes back. He is happy. Master got married. Master gave food to the
1. 1 answer
2. asked by rfvv
3. 742 views
Why ionic compounds have high melting points?
1. 1 answer
2. asked by Umair
3. 475 views
the resistance of a platinum resistant thermometer is 1.2ohms. when the measuring in Kelvin temperature of oil and 1.0ohms at
1. 1 answer
2. asked by Izrel
3. 528 views
Two charges of magnitude +2×10^–6 C each are 60cm apart. find the magnitude of the force exerted by these charges on a third
1. 0 answers
2. asked by jay
3. 790 views
How much will be the value of a house that was bought 9 years ago?X Y 0 100,000 1 105,000 2 107,000 3 110,000 4 115,000 5
1. 1 answer
2. asked by Ronlecia
3. 701 views
At high noon (sun rays fall perpendicular to the surface of the earth), the sun delivers 990 W to each square meter of a
1. 0 answers
2. asked by Anonymous
3. 561 views
What was the main goal of Greek colonization in the archaic period
1. 2 answers
2. asked by lee
3. 743 views
Two metal plates with the same dimension are soldered together face to face. The face of plate 1 that is not touching plate two
1. 0 answers
2. asked by Anonymous
3. 667 views
X is partly constant and partly varies with y.when y=3,x=7
1. 2 answers
2. asked by Ademiju ayokunle
3. 459 views
Was the density you determined accurate, taking into account the total instrument uncertainty?I got 0.778 g/ml the theoretical
1. 4 answers
2. asked by nevadaschool
3. 473 views
"Question: What factors led to the rise of Fascism?""I'm not here to cheat, I'm here for help, any ideas? Thank You!" Throughout
1. 4 answers
2. asked by Jimmy
3. 9,024 views
Which phrase best describes Grover's Corners? (This is for Our Town by Thornton Wilder)A) Full of surprises B) Drab and boring
1. 4 answers
2. asked by Delilah Garcia
3. 1,230 views
Hi! My son Zakeri is having trouble with polynomials. Could yp please provide some worksheets for my son Zakeri to work on? He's
1. 1 answer
2. asked by Nancy Hamilton (Zakeri H's Mom)
3. 569 views
What does the variable a equal when a = 4.9?3a + 6a = ?
1. 3 answers
2. asked by Tairdelbach_R
3. 346 views
Which logging category does not appear in Event Viewer by default?A. Application B. System C. Volume D. Security
1. 1 answer
2. asked by Melanie
3. 1,182 views
I do't understand what this is. how do I solve or simplify 100^12/100^8? Am I supposed to add the exponent or multiply them?
1. 5 answers
2. asked by me...
3. 605 views
32.) What is the slope for the line that passes through a pair of points?(-4,4), (3,2) -2/5 -2/7 6/7 -1/7 Still stuck on this
1. 1 answer
2. asked by Mari
3. 578 views
Write an expression for the x-values where the the maximum in the expression occurs:y=6cos((2pi/14)x)-2 I know that the maximum
1. 2 answers
2. asked by Jana
3. 1,192 views
in a parallel plate capacitor the separation between the plates is 3mm with air between them. now a 1mm thick layer of a
1. 0 answers
2. asked by Anushka
3. 447 views
Mr. Bobby bought 50 shares at $60, and 2 months later purchased 25 shares a $56.at what price should he purchase 25 additional
1. 2 answers
2. asked by bev
3. 1,990 views
(3.x10^-2) + (0.2)round to significant digits required
1. 1 answer
2. asked by AMELIA
3. 335 views
Three blocks, with masses m1 = 5.90 kg, m2 = 5.50 kg, and m3 = 7.10 kg, are pull on a horizontal frictionless surface by a 18.00
1. 1 answer
2. asked by Last Try Please help!
3. 3,405 views
What is the simplified form of the expression 8[60÷(4^2-2^2)-2]I am so tired of looking at this equation I want to cry I keep
1. 3 answers
2. asked by Mari
3. 2,661 views
Why is that instantaneous rate of reaction does not change when a part of the reacting solution is taken out?
1. 0 answers
2. asked by Vikrant
3. 439 views
5. Come up with a new linear function that has a slope that falls in the range −1 < m < 0 . Choose two different initial
1. 14 answers
2. asked by deanna
3. 3,619 views
Question 1: Dan is pulling on his dog’s leash, the dog is pulling with 40N of force and Dan is pulling with 50N of force, how
1. 0 answers
2. asked by Mike
3. 608 views
1. In the early 1990's, President George H.W. Bush did not want Saddam Hussein, the leader of what country, to get a hold of oil
1. 6 answers
2. asked by Shelby (please help!)
3. 710 views
Information Set 4:Consider the reaction between 500 mL of 0.100 mol L–1 Pb(NO3)2(aq) and 500 mL of 0.200 mol L–1Na2CrO4(aq).
1. 1 answer
2. asked by duke
3. 957 views
How does tax benefit a family?
1. 3 answers
2. asked by Eu gosto bolos *-*
3. 332 views
Write the equation of the line in slope intercept form; passing through (3,11) with slope 7/3
1. 2 answers
2. asked by Student
3. 1,840 views
which sentence is correctly capitalized?
1. 1 answer
2. asked by Anonymous
3. 406 views
Create a rational function with a linear binomial in both the numerator and denominator.Part 1. Graph your function using
1. 9 answers
2. asked by MOM
3. 1,847 views
Both threads are now lengthened such that L=1.00m, while the charges q1 and q2 remain unchanged. What new angle will each thread
1. 4 answers
2. asked by someone
3. 435 views
Create a rational function with a linear binomial in both the numerator and denominator.Part 1. Graph your function using
1. 1 answer
2. asked by Kassie
3. 1,433 views
what is the surface area of cardboard box? l= 4cm w= 5cm h=10cm
1. 2 answers
2. asked by sunil
3. 523 views
Mike wants to make a free throw; he realizes that if the ball is exactly 20cm above the hoop as it hits the backboard at the top
1. 1 answer
2. asked by Mike
3. 501 views
Create a rational function with a linear binomial in both the numerator and denominator.Part 1. Graph your function using
1. 2 answers
2. asked by Kassie
3. 1,490 views
Create a rational function with a linear binomial in both the numerator and denominator.Part 1. Graph your function using
1. 1 answer
2. asked by John
3. 733 views
A basketball player drops a 0.60-kg basketball vertically so that it is traveling at 6.0 m/s when it reaches the floor. The ball
1. 1 answer
2. asked by T
3. 1,396 views
You shop for bikes and find 7 types priced at 119 139 149 179 189 199 and 209. you want to buy the 189 bike would you use the
1. 6 answers
2. asked by PLEASE HELP
3. 419 views
Your journey to the centre of the earth took 64 hours at 100km/h. What was the total distance you traveled??
1. 1 answer
2. asked by Kim
3. 519 views
Pick a two-digit number greater than 25. Rewrite your two-digit number as a difference of two numbers. Show how to use the
1. 9 answers
2. asked by brandy
3. 5,377 views
Create a quadratic polynomial function f(x) and a linear binomial in the form (x − a).Part 1. Show all work using long
1. 3 answers
2. asked by ted
3. 1,760 views
Using the equation below as a model, fill in numbers in the place of a and b to create a rational equation that has an
1. 1 answer
2. asked by rocky
3. 1,167 views
Can you summarize this case study 300 words minimum?Overview Hospital A: Porter Regional Medical Center (PRMC) Located on the
1. 1 answer
2. asked by sarah
3. 679 views
Which form of literature was most common among th Aztecs
1. 1 answer
2. asked by Angelicaa
3. 362 views
a circular pool is 300 and height is 250 find the radius
1. 1 answer
2. asked by rita
3. 372 views
Give two examples to show how physics help in understanding the concept of evolution, biological systems of living organisms.
1. 1 answer
2. asked by simran
3. 572 views
Changing area under forest and its impact on environment
1. 4 answers
2. asked by Kabir Singh
3. 667 views
The resistance of 10m long wire is 10 . Its length is increased uniformly by 25% by stretching the wireuniformly. The
1. 1 answer
2. asked by janvi
3. 1,354 views
In 450 words write an essay on the topic the harmattan
1. 5 answers
2. asked by Ebubechi
3. 1,584 views
a fruit seller buys 712 fruits ,of which 3/4 are apples. of all apples that he bought 1/3 were found to be rotten. if he sold
1. 15 answers
2. asked by marvin
3. 9,513 views
Find the values of m and n if y^4 + my^3 + 2y^2- 3y + n is divisible by y^2-1
1. 2 answers
2. asked by sim
3. 3,165 views
You use a line of best fit for a set of data to make a prediction about an unknown value. The correlation coefficient for your
1. 2 answers
2. asked by Mari
3. 1,703 views
1.10a – 8b (-) 4a + 5b 2. 5b + 3c (-) 4b + 3c 3. 6d + 6e (-) 9d – 8e 4. 8x – 3y (-) -4x + 8y 5. 6rs – 7bc (-) 9rs –
1. 2 answers
2. asked by ANONYMUS
3. 1,114 views
1830s-1840sA. Evaluate the presidency of Andrew Jackson. Do you think that his actions were considered normal during his time?
1. 1 answer
2. asked by ANONYMUS
3. 1,096 views
Create a rational function with a linear binomial in both the numerator and denominator.Part 1. Graph your function using
1. 4 answers
2. asked by Sally
3. 1,023 views
If your mass is 76kg, find your acceleration.
1. 2 answers
2. asked by Hannah
3. 2,747 views
To receive a C grade, a student must average more than a 77 but less than 85. If Emma received a C in the course and had five
1. 1 answer
2. asked by Sheba
3. 3,018 views
Find the Inverse function of f:f(x)=8+[square root of(8+x)] f^(-1)(x)=_______, x>8
1. 1 answer
2. asked by Jennifer
3. 416 views
rony who is sixteen years old, is four times as old as her brother. How old will Mary be when he is twice as old as her brother?
1. 2 answers
2. asked by nehal
3. 728 views
Triangles ABC and DEF are similar. Find side AC. Round your answer to the nearest tenth.cm
1. 2 answers
2. asked by Irma
3. 2,560 views
Please explain this to me because im really stumped here!!: The probability of winning a game is 20%. If you play 20 times, how
1. 31 answers
2. asked by Myah
3. 1,010 views
I figured out problems 1-7, arithmetically (thank you all for the help on that) But not number 8:f(x)=5/x , g(x)=7/(x+7) #7).
1. 1 answer
2. asked by Ashley
3. 350 views
What are the next three terms in the sequence?-6, 5, 16, 27 Answers: 38, 49, 60 37, 47, 57 36, 45, 54 36, 46, 57
1. 1 answer
2. asked by Hannah Montana
3. 679 views
Jordan has three bills in her wallet. They might be any combination of $5,$10, and/or $20 bills.a) Fill in the organized list to
1. 2 answers
2. asked by nawab
3. 1,242 views

Back to June 2016

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024