Archives
2016
May

Questions Asked on May 6, 2016

Please check this. Thanks!1. Which of the following should be put in italics to correct the following sentence? Other famous
1. 59 answers
2. asked by Mame
3. 22,721 views
how can simulations be used in education?1. They are allowed people to touch a real item throug the computer. They provide a
1. 26 answers
2. asked by Bryan
3. 14,014 views
this diagram shows the dimensions of a rectangular tabletop. find the perimeter of the rectangle.A.P=11 ft B.P=18 ft C.P=20 ft
1. 76 answers
2. asked by Emma Empossible
3. 13,608 views
Which of the following passages from the novel support the idea that the Giver is a heroic character?A. I do know that I sat
1. 27 answers
2. asked by ASAP!!! HEEEEEEELP
3. 13,252 views
A 100 point test contains a total of 20 questions. The multiple choice questions are worth 3 points each and the short response
1. 9 answers
2. asked by Steven
3. 7,310 views
2.David wants to build a pen for his goat. He wants the area of the pen to be 48 square feet. If the length and width of the pen
1. 32 answers
2. asked by Jeanie Troy
3. 7,246 views
In which of the following besides the irony in the short story "The Gift of the Magie" and "The necklace?"A.The protagonists
1. 24 answers
2. asked by GummyBears
3. 5,475 views
1.Which of the author's specific word choices in the following passage from "The Morning of June 28,1948 and "The Lottery" best
1. 3 answers
2. asked by GummyBears
3. 4,762 views
What is the lateral area of a regular pentagonal pyramid that has a slant height of 18 in. and a base side length of 9 in.?405
1. 2 answers
2. asked by SkatingDJ
3. 4,520 views
A lunch menu has 4 different sandwiches, 2 different soups, and 5 different drinks. How many different lunches consisting of
1. 17 answers
2. asked by FluttershyK22
3. 4,442 views
A coin tossed. If heads appears, a spinner that can land on any number from 1 to 4 is spun. If tails appears, a second coin is
1. 12 answers
2. asked by FluttershyK22
3. 4,275 views
Which of the following is not an example of malicious code?A. Trojan horse B. worm C. virus D. spy gear ••
1. 8 answers
2. asked by Bryan
3. 4,222 views
James bought 24 bolts at the hardware store for a total of $9.00. Some were 3−inch bolts that cost 36 cents each and the
1. 3 answers
2. asked by Victoria
3. 3,983 views
A car went 60 km in 5/6 of an hour while a second car went 54 km in 2/3 hour. Which car was faster? How many times faster?
1. 14 answers
2. asked by Anonymous
3. 3,778 views
seven horses are entered in a race. If two horses are tied for first place, and there are no ties among the other five
1. 2 answers
2. asked by sarah
3. 3,714 views
from the giver please check my answers1. At the beginning of the novel, Jonas describes himself as apprehensive. Why is he
1. 11 answers
2. asked by lisa
3. 3,529 views
Which of the following is not a quality of a successful AUP?State acceptable use for school computers Covers network etiquette
1. 7 answers
2. asked by Bryan
3. 3,519 views
Which of the following helps prevent your computer from becoming infected with malicious code?Open all emails with attachments
1. 5 answers
2. asked by Bryan
3. 3,463 views
Suppose you have two similar rectangular prisms. The volume of the smaller rectangular prism is 343 in^3 and the volume of the
1. 4 answers
2. asked by SkatingDJ
3. 3,343 views
What is the molar mass of toluene if 0.85 g of toluene depresses the freezing point of 100 g of benzene by 0.47 degrees celsius?
1. 3 answers
2. asked by Matthew
3. 3,143 views
A school store has 1,200 pencils in stock and sells and average of 25 pencils per day. The manager reorders when the number of
1. 3 answers
2. asked by Ashley
3. 2,718 views
Which of the following is a sign that your computer may have been infected with malicious code?Your computer runs faster than
1. 12 answers
2. asked by Bryan
3. 2,508 views
which is Q=200p/l solved for p is it p=QL/200
1. 2 answers
2. asked by kim
3. 2,428 views
Find the perimeter and the area of the rectangle.I cant upload pics. Its a rectangle with 12cm at the bottom and theres a
1. 10 answers
2. asked by Amy Pond
3. 2,349 views
The following relationship is known to be true for two angles A and B:cos(A)cos(B)-sin(A)sin(B)=0.957269 Express A in terms of
1. 5 answers
2. asked by Giovanni
3. 2,255 views
A bowl has red,green and blue marbles.There are 95 red marbles.the nuber of blue marbles is 5 timesthe number of green mables
1. 2 answers
2. asked by Adam
3. 2,223 views
Jillian has $50 that she plans on investing in an account that will double her money every week. This can be represented by the
1. 2 answers
2. asked by Ryne
3. 2,073 views
1. The Himalayas separate _________. (1 point)Pakistan and India the Indian subcontinent from the rest of Asia Afghanistan from
1. 17 answers
2. asked by Help please
3. 2,064 views
A circuit employs a silicon solar cell to detect flashes of light lasting 0.25 s. The smallest current the circuit can detect
1. 1 answer
2. asked by Joshua
3. 1,951 views
Mark wants to visit the 10 colleges he is considering attending. He can only spend the night at 3 of them. What is the
1. 2 answers
2. asked by Boboerto
3. 1,859 views
A ladder 35 foot long is leaning against an embankment, inclined 62.5 degrees to the horizontal. if the bottom of the ladder is
1. 1 answer
2. asked by Anonymous
3. 1,848 views
John starts out in the basement parking garage, 11m below street level. He climbs all the steps to the roof of the building and
1. 1 answer
2. asked by noluthando
3. 1,799 views
A group of twelve people are going to take a ride on a roller coaster at the same time in two different trains, one of which
1. 1 answer
2. asked by -
3. 1,686 views
Israel signed a simple discount promissory note for $15,000. The discount rate is 7.5%, and the term of the note is 120 days.
1. 1 answer
2. asked by Angie
3. 1,653 views
An SRS of size n is taken from a large population whose distribution of income is extremely right-skewed and the mean income is
1. 1 answer
2. asked by Sam
3. 1,649 views
A cockroach traveling 2 feet per second takes how long to scurry a distance of 46 feet?
1. 5 answers
2. asked by Anonymous
3. 1,618 views
What two numbers multiply to 42 and add to 3
1. 2 answers
2. asked by Anonymous
3. 1,597 views
The host of a dinner party purchases wine based on the weighted average of clarity (10%), bouquet (5%), friendliness to the
1. 2 answers
2. asked by Monica
3. 1,549 views
Can you please help me out with a few problems?1. Which of the following most caused the Civil War? A.) different views on
1. 5 answers
2. asked by SchoolHelp
3. 1,456 views
Webster Digital received a promissory note of $8,000 for 9 months at 7% simple interest from one of its customers. After 4
1. 1 answer
2. asked by Angie
3. 1,411 views
The surface area of the right circular cone topped with hemisphere is? 2cm radius and 4cm height
1. 2 answers
2. asked by Anonymous
3. 1,382 views
Which of the following inference is best supported by Ridwan's storya. the Indonesian government discourages the practice of the
1. 9 answers
2. asked by DDJMike
3. 1,367 views
war memorials honor those who fought and died for a nation. which of the following is not a reasons war memorials are important?
1. 14 answers
2. asked by Jake
3. 1,347 views
Algebra 2There is a graphs of the sequence f(n)=2n-3 and a graph of the function f(x)=2x-3 What difference exist between the two
1. 1 answer
2. asked by Brenda
3. 1,336 views
Which court case legally ended segregation within the United States?A.) Plessy v. Ferguson B.) Smith v. Allwright C.) Brown v.
1. 7 answers
2. asked by Social Studies Help
3. 1,304 views
calculate the number of moles of Mg in 0.12g(relative mass of Mg=24)
1. 2 answers
2. asked by jan
3. 1,272 views
What is the annual percentage yield (APY) of a simple discount note for $7,000 at a bank discount rate of 6%, for 3 months?
1. 0 answers
2. asked by Angie
3. 1,252 views
An object is attached to a coiled spring. The object is pulled down (from its rest position) and then released. Given that the
1. 0 answers
2. asked by victoria
3. 1,249 views
To the nearest tenth of a centimeter, what is the length of the hypotenuse of a right triangle with leg lengths of 5 cm and 6
1. 3 answers
2. asked by Elijah
3. 1,248 views
Which is the result of zero population growth?population stability no natural increase*** a rapid decline in human population
1. 3 answers
2. asked by Mandy
3. 1,239 views
List a repeating decimal that is equal to an integer.I have 0.999 because if you divide it by 9's its equal to 1, 999/999=1 Also
1. 1 answer
2. asked by BT
3. 1,142 views
find the derivative of d^2x/dt^2if x^3=at^2 thanks
1. 1 answer
2. asked by philip
3. 1,133 views
Kate Davidson signed a simple discount note for $9,000. The discount rate is 5%, and the term of the note is 18 months. What is
1. 0 answers
2. asked by Angie
3. 1,092 views
The farmer sells a 41.9915-tonne load to a buyer who takes asingle scoop of tomatoes from a random spot in the load. If the
1. 0 answers
2. asked by jim
3. 1,085 views
1. You mix the letters S, E, M, I, T, R, O, P, I, C, A, and L thoroughly. Without looking, you draw one letter. Findthe
1. 6 answers
2. asked by Layla
3. 1,067 views
I have a project for science and we have to design an experiment to support the hypothesis that light travels in straight lines
1. 4 answers
2. asked by Twenty One Pilots fan
3. 1,022 views
8. How did the economic boom of the 1920s affect the majority of South Carolina?A. More people were able to invest in new cars
1. 1 answer
2. asked by Sierra Elizabeth💓💓
3. 1,017 views
In a class 20% students failed 60% students scored average marks and the remaining above average marks find number of students
1. 1 answer
2. asked by Rahul
3. 1,014 views
Which of the following does not qualify as intellectual property?a)a poem that you write b)a CD your friend bought that you
1. 4 answers
2. asked by Bryan
3. 1,004 views
I will try and explain this since I can't draw the picture that went with this question.A circular glass overlay was placed on
1. 4 answers
2. asked by sara
3. 999 views
The gas-phase reaction, A2 + B2 --> 2AB, proceeds by bimolecular collisions between A2 and B2 molecules. If the concentrations
1. 1 answer
2. asked by pepe
3. 996 views
13. A red car of mass m is heading north (direction 0°). It collides at an intersection with a yellow car of mass 1.3m heading
1. 1 answer
2. asked by Phillip
3. 996 views
Tasha and Lee played a series of games against each other. Tasha won three more than twice as many games as Lee. Lee won 15
1. 1 answer
2. asked by Anonymous
3. 977 views
calculate the number of grams of Al2S3 which can be prepared by the reaction of 20g of Al and 30gm of sulphur. how much the
1. 0 answers
2. asked by Ahsan
3. 974 views
For your discussion assessment, you will present your proposal of a device that minimizes heat transfer.
1. 3 answers
2. asked by Aidyn
3. 962 views
Rob had a pitcher containing 2 liters of lemonade. He poured an equal amount of lemonade into 14 glasses. How much lemonade was
1. 2 answers
2. asked by Terri
3. 956 views
1. Given one side of a golden rectangle is 3.7 inches, find the possible lengths of the other side. Notice that the other side
1. 1 answer
2. asked by BOBBY WALKER PLEASE HELP
3. 953 views
A radioactive kind of nitrogen has a half life of 10 minutes. If you start with 64 grams of the substance, how much will be left
1. 1 answer
2. asked by Ana Y
3. 949 views
Clearly describe a recent corruption and fraud case in the country making headlines in the media:who the role players are who
1. 8 answers
2. asked by kamogelo
3. 937 views
1.-3f^2+4f-3+8f^2+7f+1a.5f^2-11f+2 b.11f^2+11f+2*** c.5f^2+11f-2 d.-5f+3f-2 2.3x^2+5X-5X^2-4X-2 a.-8x^2-9x+3 b.2x^2+x+3
1. 2 answers
2. asked by Connexus
3. 925 views
QUESTION 14The game commission introduces 100 deer into newly acquired state game lands. The population N of the herd is modeled
1. 0 answers
2. asked by Betty
3. 919 views
which is M = 9pn solved for p?
1. 1 answer
2. asked by kim
3. 889 views
How can you find the distance of each number from the mean?50,56,52,46,48,42,38 Im not sure so please help.
1. 3 answers
2. asked by LOVE
3. 881 views
A nurse at a local hospital is interested in estimating the birth weight of infants. How large a sample must she select if she
1. 0 answers
2. asked by mike
3. 874 views
what can happen if music is downloaded illegally from a p2p network?A.Large fines may have to be paid**** B.Your computer screen
1. 3 answers
2. asked by Slim shaady
3. 850 views
horses are entered in a race. If two horses are tied for first place, and there are no ties among the other five horses,
1. 0 answers
2. asked by sarah
3. 842 views
A convex mirror of focal length 30cm. produces a real and inverted image of magnification 0.5.by how much distance the object
1. 1 answer
2. asked by kanupriya
3. 841 views
When an airplane leaves the runway, its angle of elevation is 18 and its speed is 275 feet per second. Find the airplane’s
1. 0 answers
2. asked by victoria
3. 802 views
The first term of a geometric sequence is 9 and the common ratio is -1 over 3. find the fourth term
1. 1 answer
2. asked by Anonymous
3. 800 views
Word for illegal or immoral behavior by officialsWord for experts working together to problem solve Word for economic pressure
1. 5 answers
2. asked by Leena
3. 783 views
What are the systems that move the body?
1. 1 answer
2. asked by Marwas
3. 783 views
Which of the following rules is most likely to be used in an A.U.P.?A. Communication should be civil and respectful of one
1. 1 answer
2. asked by Bryan
3. 777 views
Which of the following characterizes a stage 3 population?produces many offspring lives in rural areas experiences a sharp
1. 3 answers
2. asked by Mandy
3. 776 views
I don't want links I want answers please and please make sure it's in your own words.What are the causes of problems the Mayans
1. 15 answers
2. asked by FluttershyK22
3. 769 views
A stone projected at an angle of 60 degree and intial velocity of 20 meter second determing the time of flight
1. 1 answer
2. asked by abdullahi
3. 766 views
-10x+4+y=4 use the function rule to complete the table x -2 -1 0 1 2 y _ _ _ _ _
1. 1 answer
2. asked by ginger
3. 742 views
QUESTION 21Condense the expression to the logarithm of a single quantity. ln310 + ln3x ln3(10 - x) ln310/x ln3(10 + x) ln310x
1. 1 answer
2. asked by Betty
3. 736 views
1. The team usually plays in a 4-4-2 formation. (at a soccer game)2. two center forwards (= two strikers) 3. side midfielder
1. 1 answer
2. asked by rfvv
3. 735 views
Scenario:Write a program that will determine the average mark of each student. The average is dependent on the subjects which
1. 2 answers
2. asked by JP
3. 734 views
Adam made 19 paper cranes Monday and 8 more Tuesday He gave 9 friends an equal number of cranes. How many cranes did each friend
1. 1 answer
2. asked by Vickie
3. 714 views
A man start from point A and walks 5km east to B. He then walks 7km on a bearing of 162 degree to reach point C. Find the
1. 1 answer
2. asked by Khalid
3. 713 views
How many 2-digit numbers can be formed using only the digits 2, 3, 5, and 6. if the digits are not repeated within a number?11
1. 2 answers
2. asked by FluttershyK22
3. 710 views
Compare and contrast of Chile and Venezuela.
1. 11 answers
2. asked by FluttershyK22
3. 706 views
a pan of cake was left out on the counter ana 1/4 of the cake has already been eaten.Then zwell came along and ate 2/3 of the
1. 3 answers
2. asked by brock leasner!!!
3. 694 views
QUESTION 25The populations (in thousands) of Pittsburgh, Pennsylvania from 2000 through 2007 can be modele by where t represents
1. 1 answer
2. asked by Betty
3. 692 views
Alicia borrowed $8,500 at 6% ordinary interest for 180 days. After 40 days, she made a partial payment of $2,000. After another
1. 1 answer
2. asked by Angie
3. 681 views
calculus. suppose dR/dt= (d/R)^(2) and P(1) 4. separate the differential equation, integrate both sides
1. 0 answers
2. asked by Aishwarya
3. 681 views
Sandra ha a rectangular garden with dimensions 8 feet by 12 feet. If she needs a garden hose that is at least as long as the
1. 1 answer
2. asked by Marybeth
3. 677 views
Jocelyn has read 156 pages of a book. This is 4/5 of the entire book. How many pages does the book have?
1. 2 answers
2. asked by Anonymous
3. 672 views
How many times bigger is 8*10^6 than 2*10^2?
1. 1 answer
2. asked by Chris
3. 667 views

Back to May 2016

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025