Archives
2016
March

Questions Asked on March 21, 2016

A 5-foot ladder is leaning against a 4-foot wall. How far must the bottom of the ladder be from the base of the wall so that the
1. 4 answers
2. asked by Ingrid
3. 15,593 views
Nut C fits on Bolt C. Nut B fits on Bolt B. Nut A fits on Bolt A. Bolt C is larger than Bolt B. bolt A and Bolt B are exactly
1. 4 answers
2. asked by Ingrid
3. 12,943 views
Describe the speed of the remote-control car over time.A. The speed of the car decreases from 4 mi/h to 2 mi/h in the first 3
1. 62 answers
2. asked by Summer
3. 11,722 views
Nut B fits on Bolt B. Nut A fits on Bolt C, but does not fit on Bolt A. Bolt B and Bolt A are exactly the same. Given this
1. 3 answers
2. asked by Ingrid
3. 11,365 views
Anna has two aunts, Gertie and Samantha. She has one Uncle, jimbo. Jimbo has a nephew on Anna's side of the family, Timothy, who
1. 5 answers
2. asked by Ingrid
3. 8,624 views
Antoine went on vacation. His room cost $115.62 each night. His flight there cost $45.70. His flight home cost $32.49. He
1. 7 answers
2. asked by Ingrid
3. 7,751 views
The number of bagels sold daily for two bakeries is shown in the table.Bakery A Bakery B 53 34 52 40 50 36 48 38 53 41 47 44 55
1. 7 answers
2. asked by Elena - Help please
3. 7,631 views
The area of a rectangular garden is given by the trinomial x^2+x-30. What are the possible dimensions of the rectangle? Use
1. 8 answers
2. asked by Evan
3. 7,236 views
Bob has a brother, Jim, who has a daughter named Bertha. Bertha's daughter, Jennifer, has a sister named Penny. Which of the
1. 10 answers
2. asked by Ingrid
3. 7,202 views
nut B fits on Bolt B. Nut A fits on Bolt C, but does not fit on Bolt A. Bolt B and Bolt A are exactly the same. Will Nut A fit
1. 4 answers
2. asked by Ingrid
3. 6,556 views
Rena knows a dollar coin has a mass of a little than 10 grams. She guessed that 1 kilogram of dollar coins would be worth
1. 13 answers
2. asked by Aidan
3. 4,879 views
if electricity of sufficient voltage is passed into a solution of potassium iodide in water, a reaction takes place in which
1. 1 answer
2. asked by Mandy
3. 4,405 views
suppose you put money into teo different bank accounts. In account #1 you deposit $500 and you will be earning 6% interest
1. 4 answers
2. asked by Sarah
3. 4,256 views
nut A fits on Bolt B. Bolt C does not fit Nut A or Nut B. Nut D fits on Bolt B. Bolt C is the same size as Bolt D, but smaller
1. 3 answers
2. asked by Ingrid
3. 3,775 views
6. Given the function rule f(x)=x^2-3x+2, what is the output of f(-2)?A. -8 B. 0 C. 4 D. 12 7. Suppose you earn $15 for each car
1. 9 answers
2. asked by Summer
3. 3,514 views
The layer cake has both vanilla and chocolate frosting. What percent of the surface area of the cake (not including the bottom)
1. 8 answers
2. asked by Anonymous
3. 3,428 views
Find the solution of the differential equation that satisfies the given initial condition.dp/dt=2 sqrt(pt), P(1)=5 my answer:
1. 1 answer
2. asked by kyle
3. 3,041 views
How can I change 33(1/3) percent into fraction?I've done this so far: Change 1/3 into decimal, therefore =0.33 =33.33 TO change
1. 4 answers
2. asked by Jonny
3. 2,932 views
What is the sum or difference?A)-7y^5* B)-30y^5 C)-30y^10 D)-7y^10
1. 5 answers
2. asked by Evan
3. 2,804 views
Use the Law of Sines to find the missing angle of the triangle. Find m∠B given that c = 83, a = 44, andm∠A = 31. A. 76.3°
1. 2 answers
2. asked by Carpe_Diem
3. 2,767 views
A transparent photographic slide is placed in front of a converging lens with a focal length of 2.41 cm. An image of the slide
1. 2 answers
2. asked by Deaven
3. 2,765 views
You are setting up a system of programming codes for a universal TV remote. Each code will have five digits and cannot include a
1. 2 answers
2. asked by Rose
3. 2,763 views
Do the data in the table represent a linear function? If so, write a rule for the function.x –3 –2 –1 0 1 y 1 –2 –5
1. 3 answers
2. asked by Summer
3. 2,577 views
1. What were the ideals of movement related to this medallion? @liberty of CongressA. abolition and suffrage B. freedom and
1. 14 answers
2. asked by Summer
3. 2,548 views
You have 67.0 mL of a 0.400 M stock solution that must be diluted to 0.100 M. Assuming the volumes are additive, how much water
1. 2 answers
2. asked by Anonymous
3. 2,349 views
Could someone check my work?A 200-foot cliff drops vertically into the ocean. The angle of elevation from a ship to the top of
1. 2 answers
2. asked by Matt
3. 2,326 views
Four major candidates ran in the 1824 election, all under the "Democratic-Republican" name. One of the candidates, Andrew
1. 4 answers
2. asked by jai
3. 2,047 views
How many grams of potassium nitrate, KNO3 are required to make 250 mL solution with a molarity of 0.40 M?
1. 1 answer
2. asked by Veronica
3. 2,039 views
A 0.109g sample of a pure gaseous compound occupies 112ml at 100degrees and 750torr: what is the molecular weight of the
1. 2 answers
2. asked by charles
3. 2,021 views
On the average, 7 people per hour use an express teller machine situated inside a commercial complex. What is the probability
1. 3 answers
2. asked by NARUTO
3. 1,984 views
Describe the speed of the remote-control car over time.A. The speed of the car decreases from 4 mi/h to 2 mi/h in the first 3
1. 4 answers
2. asked by Summer
3. 1,908 views
1.What led to increased trade between Europe and AsiaA.The Black Death B.The Crusades C.The Hundred Years' War D.The Reconquista
1. 20 answers
2. asked by Sid.V
3. 1,826 views
A vehicle travels equal distances at 60km/h and 90km/h.calculate its average speed
1. 2 answers
2. asked by peter
3. 1,639 views
a spinner used for a game is divided into sections: yellow, green, and orange. Janie spins the spinner 20 times. The spinner
1. 3 answers
2. asked by Crystal
3. 1,630 views
A model car has a scale of 1:24, where the model dimensions are in the numerator and the actual dimensions are in the
1. 1 answer
2. asked by Anonymous
3. 1,606 views
What is the average caloric burn rate (in calories per hour) for a 180-lb person engaging in high-intensity interval training
1. 0 answers
2. asked by Summer
3. 1,602 views
Write the polynomial in standard form. Then name the polynomial based on its degree and number of terms. 2-11x^2-8x+6x^2.A)
1. 2 answers
2. asked by Evan
3. 1,601 views
Which of the following is least like the others?a. bear b. elephant c. badger d. hamster
1. 1 answer
2. asked by Ingrid
3. 1,582 views
The angle of a sector of a circle with radius 42cm is 120 degree.if the sector is cut out and used to make a cone,what is the
1. 1 answer
2. asked by Bright ulubi
3. 1,564 views
Consider the transformation T(ax^2 + bx + c) = 2ax + b of P2 → P1.(a) Find T((ax^2 + bx + c) + (px^2 + qx + r)). (b) Find
1. 2 answers
2. asked by Anonymous
3. 1,548 views
Read the following passage. Then answer questions 1-5 on the online portion of the Unit Assessment.From The Lost Prince By
1. 3 answers
2. asked by Sarah Lott
3. 1,521 views
In which sentence does the prepositional phrase act as an adverb?A)Last evening, Anne suffered from a headache. B)The door to
1. 4 answers
2. asked by UNKNOWN
3. 1,481 views
A ball is thrown straight up from a rooftop 9696 feet high. The formula below describes the ball's height above the
1. 1 answer
2. asked by lisa
3. 1,477 views
A store owner complains that, on the average, 3 bottles per case of a certain brand of softdrink are underfilled. Assuming this
1. 8 answers
2. asked by NARUTO
3. 1,468 views
Given the data set (5, 9), (13, 12), (23, 16), which of the following equations best represents a line of best fit?y = three
1. 4 answers
2. asked by Peter
3. 1,443 views
What is the appositive in this sentence?Sarah's dog Buddy dug in the garden. A. Sarah's B. Buddy C. in D. the A or B
1. 4 answers
2. asked by Like I'd Tell You.
3. 1,414 views
What is best• ½ pint of oil at $0.90, or • 1 pint of oil at $1.65, or • 2 pints of oil at $3.40, or • 5 pints of oil at
1. 7 answers
2. asked by Sarah Lott
3. 1,379 views
1. What were the ideals of movement related to this medallion? @liberty of CongressA. abolition and suffrage B. freedom and
1. 5 answers
2. asked by Summer
3. 1,368 views
can someone Explain the process of succession plz
1. 2 answers
2. asked by sunshine
3. 1,352 views
It is necessary to add iodide ions to precipitatethe lead(II) ions from 250 mL of 0.076 M Pb(NO3)2(aq). What minimum iodide ion
1. 1 answer
2. asked by Jacaria
3. 1,264 views
Choose the correct answer for the following problem.dieciseis + diecisiete = ? trienta y tres viente y dos cuarenta y siete
1. 2 answers
2. asked by Azariah
3. 1,253 views
Q: Write a quadratic equation with integral coefficients whose roots are -6+i and -6-iMy Answer: x^2+12x+37 (first) sum=-12
1. 1 answer
2. asked by Bryan
3. 1,248 views
A math teacher observes that on the average 3 students came to their 8-9AM class late. The probability 5 students will be late
1. 2 answers
2. asked by NARUTO
3. 1,242 views
the study of great classical composers is called...
1. 4 answers
2. asked by No one special
3. 1,219 views
We can measure angles in degrees or radians. When studying angular motion, we will tend to use radians. If you are looking at a
1. 1 answer
2. asked by Anonymous
3. 1,154 views
A multiple-choice quiz has 15 questions, each with 4 possible answers of which only 1 is the correct answer. What is the
1. 3 answers
2. asked by NARUTO
3. 1,150 views
Choose the best answer to the following question.Cuantos minutos hay en una hora? a. cuarenta b. sesenta c. cincuenta d. setenta
1. 2 answers
2. asked by Jennifer Matthews
3. 1,124 views
If you had observed the fate of an ice cube at 25 degrees Celsius, what would you conclude about the spontaneity of the process
1. 1 answer
2. asked by Chelsea
3. 1,101 views
The rental rate at rent a wreck is 30$per day plus $0.25 per mile driven
1. 2 answers
2. asked by Anonymous
3. 1,080 views
What is the best activity to do immediately after playing tennis?a.Drink plenty of juice and sit in the shade to cool your body
1. 1 answer
2. asked by im new here
3. 1,034 views
When incorporating a business, which one of the following is not a major step to take?A. Filing your employee policies with the
1. 0 answers
2. asked by Anonymous
3. 1,015 views
Two charges +q and −q are separated by a distance d. Find an expression for the potential difference VBA = VB − VA, where
1. 1 answer
2. asked by kim
3. 1,007 views
The probability that a certain production process will produce a defective part is 0.20. If a box contains 12 parts, the
1. 0 answers
2. asked by NARUTO
3. 977 views
For the geometric sequence, -100,50,-25,12.5, find the next two terms and the general term.
1. 1 answer
2. asked by Anonymous666_2
3. 975 views
If you have 100 feet of fence, which measurements would give you the largest area?
1. 2 answers
2. asked by kristina
3. 967 views
A child of mass 40kg jumps off a wall and hits the ground at 4m/s.He bends his knees and stops in 1s.Calculate the force
1. 5 answers
2. asked by yaekob
3. 963 views
Which of the following is least like the others?a. rotator b. deified c. racecar d. alright
1. 2 answers
2. asked by Ingrid
3. 957 views
Kinetic Energy and the Work/Energy Theorem:1.) How much kinetic energy does a 700-gram baseball have that is travelling at 20
1. 5 answers
2. asked by S.A
3. 953 views
A math teacher observes that on the average 3 students came to their 8-9AM class late. The probability 5 students will be late
1. 1 answer
2. asked by NARUTO
3. 934 views
A 5kg block is being pulled on a horizontal frictionless surface. The tension in the string is 30N. If the block has an initial
1. 1 answer
2. asked by Donna
3. 929 views
In a water park, people walk a distance of 20 meters up an inclined ramp before getting on a water slide. If the spot from where
1. 1 answer
2. asked by Adrian Watkins
3. 913 views
The primary purpose of the passage is to __________.A. describe the best way to consume chocolate B. discuss current theories
1. 2 answers
2. asked by Sarah Lott
3. 906 views
The path of a baseball after being hit is given by the function f(x)= -.007x^2+x+4 where f(x) is the height of the baseball (in
1. 1 answer
2. asked by Anonymous
3. 900 views
Amanda has a ribbon that is 1-meter long. She wants to put a bead at every of a meter. She puts the first bead at and the last
1. 2 answers
2. asked by mom
3. 896 views
A 5 kg block is being pulled on a frictionless surface by a string at an angle of 30o to the horizontal. The tension in the
1. 1 answer
2. asked by Donna
3. 886 views
(7 points)1. The reaction that you just witnessed in while doing your titration was: HCl + NaOH  H2O + NaCl. This equation is
1. 1 answer
2. asked by kat
3. 866 views
Which of the following best completes the sequence below?<3, ^4, >7, <6,^8, >14, <9, ^12...
1. 1 answer
2. asked by Ingrid
3. 862 views
A student used 5.06g of copper sulphate pentahydrate and salicyclic acid in the performance of the experiment. The student
1. 4 answers
2. asked by Tolu
3. 847 views
A math teacher observes that on the average 3 students came to their 8-9AM class late. The probability 5 students will be late
1. 1 answer
2. asked by NARUTO
3. 837 views
On Earth, an astronaut weighs about 600 Newtons. The mass of the Earth is about 6 x 1024 kg, and the radius of the Earth is
1. 0 answers
2. asked by bob
3. 820 views
Another problem I need to confirm:A ship is 60 miles west and 91 miles south of the harbor. a) What bearing should the ship take
1. 2 answers
2. asked by Matt
3. 813 views
A fireworks show is designed so that the time between fireworks is between one and five seconds, and follows a uniformdistributi
1. 0 answers
2. asked by Nandini
3. 810 views
Suppose that airplane engines operate independently in flight and fail with probability 1/5. Assuming that a plane makes a safe
1. 0 answers
2. asked by NARUTO
3. 802 views
Would someone be willing to grade or check my rough draft of a critical review?
1. 2 answers
2. asked by Katie
3. 802 views
Which expression best represents the views a fatalist would have?a. “whatever will be , will be”*** b. “the best is yet to
1. 1 answer
2. asked by UNKNOWN
3. 797 views
CH3-C(Cl)(C2H5)-CH(CH3)-C(NH2)(Br)-CH2-CH2-C(CH3)3 IUPAC name of this compound
1. 0 answers
2. asked by Anonymous
3. 790 views
A piece of rectangular paper measures 8x by 12x. If a circle with a radius of 3x is cut out of the middle of the paper, what
1. 2 answers
2. asked by XenaGonzalez
3. 787 views
2. In 2004 Z is having a conversation with his friend X and X’s wife Y. Y is a U.S. citizen and a ‘Bushy’ (a supporter of
1. 1 answer
2. asked by sisikeri
3. 777 views
Consider the following mechanism:STEP 1: A ---> B +C (slow) STEP 2: C+D ---> E (fast) OVERALL: A+D---> B+E Determine the rate
1. 0 answers
2. asked by Anna
3. 773 views
If a wheel turns around 6.00 complete rotations, what would the angular displacement of that wheel be in radians?
1. 1 answer
2. asked by Em
3. 768 views
can someone give me 3 examples of how where Carolina lives shapes her life and the opportunities available for her and her
1. 7 answers
2. asked by im new here
3. 763 views
1 number is selected at random from 0-9,find the probability that number is odd number
1. 1 answer
2. asked by kapil
3. 759 views
In a certain city district, the need for money to buy drugs is given as the reason for 65% of all thefts. What is the
1. 0 answers
2. asked by NARUTO
3. 732 views
A student reacts 57g of salicylic acid with 21 mL of acetic anhydride producing 10.5g of acetyl salicylic acid. What is the
1. 1 answer
2. asked by Kennedy
3. 729 views
On the average, 6 people per hour use an express teller machine situated inside a commercial complex. What is the probability
1. 2 answers
2. asked by NARUTO
3. 725 views
A 5 kg block is being pulled on a frictionless surface by a string at an angle of 30o to the horizontal. The tension in the
1. 2 answers
2. asked by Danny
3. 716 views
Write an equation, in point-slope form, for the line that is perpendicular to y – 10 = 3/2 (x – 4) and that passes through
1. 2 answers
2. asked by Scarlet (Scar for short)
3. 716 views
A wheel has a 12 inch radius rotating at 620 RPM. What is the speed of the car in MPH?
1. 1 answer
2. asked by John
3. 711 views
can someone give me 3 examples of how where Carolina lives shapes her life and the opportunities available for her and her
1. 2 answers
2. asked by im new here
3. 692 views
8] Find the minimum stopping distance for a car moving at 108km/h if the coefficient of static friction between the tires and
1. 1 answer
2. asked by Amelie
3. 690 views

Back to March 2016

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025