Archives
2015
September

Questions Asked on September 19, 2015

What rhyme scheme is used in the excerpt from Ballard of Birmingham by Dudley Randall
1. 2 answers
2. asked by Toney
3. 987 views
Find the mean, median, and mode. Round to the nearest tenth when necessary.1) Given these board lengths: 20.2, 1.2, 5, 5.8, 16,
1. 1 answer
2. asked by Jacqueline
3. 675 views
The five sales people at Southwest Appliances earned commissions last year of $13,000, $22,000,$47,000, $15,000, and $24,000.
1. 2 answers
2. asked by Jacqueline
3. 2,201 views
Need to know if I have it right or not in the program please . Input a list of positive numbers (terminated by 0) into an array,
1. 3 answers
2. asked by Poohboi
3. 592 views
How can you evaluate scientific claims?NEED HELP!
1. 1 answer
2. asked by Iris
3. 381 views
The total yearly food bill for a family of four is $9395.59. To the nearest cent, what is the mean weekly food bill?
1. 2 answers
2. asked by Jacqueline
3. 790 views
A compact car is driven 144mi. If it had traveled 4mph faster, it could have made the trip in 1/2 hour less time. What was the
1. 2 answers
2. asked by Laure
3. 497 views
A boy threw a rock straight down from a tree top with a velocity of 5.00 m/s. If the rock struck the ground below 1.80 s later,
1. 1 answer
2. asked by Kali
3. 373 views
How would a correlation -.68 look on a scatter diagram?
1. 1 answer
2. asked by Pauline Brown
3. 446 views
In college softball, the distance from the pitcher's mound to the batter is 43 feet.If the ball leaves the bat at 105 mph, how
1. 1 answer
2. asked by Laura
3. 683 views
True or falseTo accurately label exact locations on a map, geographers go to that specific location. If false what is correct
1. 2 answers
2. asked by Niki
3. 669 views
The circumference of a certain circle is doubled. By what factor is its area increased?
1. 1 answer
2. asked by Anonymous
3. 582 views
Use logarithms for these questionsAfter every 10 pages of painting, the ribbon in the dot matrix printer loses about 0.5% of its
1. 2 answers
2. asked by Joe
3. 582 views
using logarithms to solve exponential equations.5^1+x = 2^1-x I need exact numbers. I did one on my own already. 5^x-1 = 9 5^x-1
1. 4 answers
2. asked by Joe
3. 641 views
Use a calculator to find sin 217 degrees.-0.6018?
1. 1 answer
2. asked by Anonymous
3. 527 views
Use a calculator to find cot 175 degs.-11.43?
1. 2 answers
2. asked by Anonymous
3. 445 views
Create a sentence for the following words for a 6th grader:1. partisanship 2. preconceived 3. subjective 4. blithe
1. 3 answers
2. asked by f
3. 427 views
How much heat (in kJ) is required to warm 13.0 g of ice, initially at -13.0 ∘C, to steam at 111.0 ∘C? The heat capacity of
1. 1 answer
2. asked by Alexus
3. 1,187 views
A solution containing 0.0158 M maleic acid and 0.0226 M disodium maleate. The Ka values for maleic acid are 1.20 × 10-2 (Ka1)
1. 0 answers
2. asked by Alex
3. 932 views
I have been attempting this problem so many times. I don't know if I am plugging in the numbers correctly but I cannot seem to
1. 1 answer
2. asked by Sabrina
3. 949 views
Which statement is not true regarding illness associated with malfunctioning cellular organelles? The illness _____a. can result
1. 1 answer
2. asked by Gina
3. 683 views
A 11.0-µF capacitor and a 50.0-µF capacitor are charged by being connected across separate 55.0-V batteries.(a) Determine the
1. 1 answer
2. asked by Nick
3. 801 views
1.A white flowered plants is crossed with a plant that is heterozygous for the trait. What percentage of he offspring will have
1. 3 answers
2. asked by Gina
3. 4,103 views
Mrs Wong baked some pizzas for her students. The boy received twice as many pizzas as the girls. There were as many girls as
1. 2 answers
2. asked by John
3. 608 views
If the electric field inside a capacitor exceeds the dielectric strength of the dielectric between its plates, the dielectric
1. 0 answers
2. asked by Anonymous
3. 862 views
Mrs Raja and Mrs lee have some eggs to sell. If mrs raja sells 30 eggs per day and mrs lee sells 15 eggs per day , mrs lee will
1. 2 answers
2. asked by Ellie
3. 767 views
Mathematical literacy albert need a car for 12 day,to travel 106km per day.determine the amout he'll have to pay for the corrola
1. 1 answer
2. asked by Ondwela
3. 330 views
y=ln(tan(3pi/2 -^coshx))
1. 1 answer
2. asked by Aldrin santos
3. 328 views
How do you write,45 less than the sum of the other two angle
1. 1 answer
2. asked by rhonda
3. 394 views
The cholesterol levels of adult American women has a mound-shaped and symmetric distributionwith a mean of 188mg/dL and a
1. 1 answer
2. asked by katie
3. 557 views
Two contemporary social issues in your community
1. 18 answers
2. asked by lindiwe liango
3. 1,844 views
Posted by rfvv on Monday, August 25, 2014 at 4:45am.1. It's been a long time. 2. It's been a while. 3. I haven't seen you for a
1. 1 answer
2. asked by rfvv
3. 699 views
If shahida can iron 5 handkerchiefs in 7 minutes , how long will she take to iron 35 handkerchiefs.
1. 3 answers
2. asked by Noor
3. 2,245 views
The ratio of milk to water in a container is 5:1 by volume. If the total volume of the mixture is 9 liters, find the volume of
1. 2 answers
2. asked by Noor
3. 697 views
In a certain town the ratio of the number of cars to that of taxis is 15:4. If there are 172 taxis in the town , find the number
1. 3 answers
2. asked by Noor
3. 1,327 views
Would you say that the division of the world in the northern and the southern part is based on economic development,sustainable
1. 1 answer
2. asked by melissa
3. 595 views
3 PARTICLES OF MASS 1KG,2KG,3KG PLACED AT CORNER A,B,C OF AN EQUILARERA TRIANGLE A,B AND C.LOCATE THE POSITION OF PARTICLE/FIND
1. 2 answers
2. asked by ARYAN
3. 513 views
At a school with 100 students, 35 take French, 32 take German, and 30 take Spanish. Twenty students take only French, 20 take
1. 3 answers
2. asked by Spencer
3. 1,632 views
A plane mirror is mounted at the back of the truck that is moving at 25 km/h. How fast does the image of a man standing on the
1. 1 answer
2. asked by trsgts
3. 442 views
Two plane mirrors, A and B, are separated by 30.0 cm facing each other. An object is placed 20 cm from mirror A. Locate the
1. 2 answers
2. asked by trsgts
3. 506 views
Solve these simultaneous linear equations using elimination method :3a = 2b + 1 and 3b = 5a - 3
1. 7 answers
2. asked by Olayemi
3. 2,447 views
change fraction 3/4 to a percent
1. 1 answer
2. asked by sue
3. 415 views
In school I have Developed, NICs (Industrialising) and Developing countries. I have done most of it. The NICs and Developing are
1. 1 answer
2. asked by Damian
3. 564 views
using logarithms to solve exponential equations.5^1+x = 2^1-x I need exact numbers. I did one on my own already. 5^x-1 = 9 5^x-1
1. 1 answer
2. asked by Joe
3. 725 views
Name and draw the molecular structure of this compound CH3CH(C2H5)CH(CH3)CH(C3H7)CH2CH3
1. 1 answer
2. asked by dan
3. 1,251 views
A fireman used a ladder with 56 rungs. The rungs are 14 inches apart and 1.5 inches thick. What is the distance from the bottom
1. 2 answers
2. asked by Spencer
3. 2,158 views
Problem 3:Consider water as the substance. (a) Find the specific internal energy (Btu/lbm) when T = 500F and P = 375 psia (b)
1. 1 answer
2. asked by sara
3. 664 views
Three ways on how water pollution can impact negatively to the health of the people in our community
1. 1 answer
2. asked by Sizwe mavuso
3. 566 views
Births are approximately uniformly distributed between the 52 weeks of the year. They can be said to follow a uniform
1. 1 answer
2. asked by BORNIUCS
3. 1,883 views
Time taken by light to travel 1 meter is roughly 3 x 10 to the negative 8th power. pls. formulate a problem and solution.
1. 2 answers
2. asked by jm
3. 2,397 views
Understanding Reciprocal DeterminismI understand it means "individual's behavior influences and is influenced by both the social
1. 2 answers
2. asked by anonymous
3. 517 views
Jay Z has multiple sides to him; he teaches us how to be a successful person, and show us what's important in life v.s. what's
1. 4 answers
2. asked by Mrs. Keon Meadows
3. 638 views
Maria throws a ball straight up with an initial velocity of 10 m/s.What is its velocity at the highest point? What is its
1. 6 answers
2. asked by Joyce
3. 14,404 views
Which are the four environmental issues that cause I'll health in our communities
1. 1 answer
2. asked by Thozama
3. 418 views
Formulate a problem and spolution of the diameter ofvthe atomic nucleus of a lead atom is 1.75 X 10 to the negative 15th meter.
1. 3 answers
2. asked by jm
3. 899 views
formulate a problem to the charge on an electron is roughly 1.6 X 10 to negative 19th power columbs.
1. 1 answer
2. asked by jm
3. 455 views
period of a 100 MHz FM radio were is roughly 1 X 10 to the negative 8th s. formulate a problem and solution.
1. 1 answer
2. asked by jm
3. 1,588 views
C. Consider the reaction 2C3H6 + 9O2 6CO2 + 6H2O. If the rate at which C3H6 is reacting is 0.40 mol liter−1s−1, then the
1. 2 answers
2. asked by Jim
3. 1,581 views
Hi! I'm trying to find a lit device for this quote. This quote is from "The Story of An Hour" by Kate Chopin. I'm struggling to
1. 1 answer
2. asked by Richard
3. 629 views
Critically analyze the impact of crime as a contemporary social issue on local communities and poverty on global communities
1. 2 answers
2. asked by Tumelo koloti
3. 777 views
Police find skid marks 65.0 m long on a highway showing where the car made an emergency stop. Assuming the acceleration was
1. 1 answer
2. asked by Tyler
3. 1,941 views
hundred people apply for three jobs. 110 of the applicants are women.(a) If three persons are selected at random, what is the
1. 2 answers
2. asked by MiMi
3. 684 views
A wall has an area of 7.2 square meter. It was painted yellow and brown. The area of the wall painted yellow was 3 times as
1. 1 answer
2. asked by George
3. 508 views
Using GRAPHICAL METHOD, find the vector sum of a force of 20 N directed 60 degrees east of north and a force of 60 N directed
1. 1 answer
2. asked by Alyssa
3. 672 views
1 of 15I tried to get there on time, but there was an accident on the freeway: Yo ____(1)____ llegar a tiempo, pero ____(2)____
1. 2 answers
2. asked by Matt
3. 2,175 views
Bromine gas is allowed to reach equilibrium according to the equation.Br2=2Br Kc=0.0011 at 1280°C Initial concentration of br2
1. 5 answers
2. asked by han
3. 1,781 views
When 6.853 mg of sex hormone was burned in a combustion analysis,19.73 mg of CO2 and 6.391 mg of H2O were obtained. What is the
1. 2 answers
2. asked by chancy xdicey
3. 2,350 views
A solution containing 0.0158 M maleic acid and 0.0226 M disodium maleate. The Ka values for maleic acid are 1.20 × 10-2 (Ka1)
1. 9 answers
2. asked by Alex
3. 2,943 views
p (x)=x^6 a*x^5 b*x^4 c*x^3 d*x^2 e*x f
1. 0 answers
2. asked by Edward
3. 240 views
Why does the distance traveled by the ball in each half second after it is released change in the way that it does?A.Gravity is
1. 1 answer
2. asked by rachel
3. 958 views
what is mock data? And how does it work or what do you do??
1. 0 answers
2. asked by Anoymous
3. 366 views
You have a different rock with a volume of 30m3 and a mass of 60 g
1. 1 answer
2. asked by Anonymous
3. 408 views
Solve-12 / 3 * [-8 + (-14)2 – 6] + 2 =
1. 1 answer
2. asked by la
3. 285 views
A dart leaves the barrel of a blowgun at a speed v. The length of the blowgun barrel is L. Assume that the acceleration of the
1. 1 answer
2. asked by rachel
3. 6,742 views
A mining company ha 10 000 m of fencing available.It wants to use a fencing to enclose a rectangular field. one side of the
1. 1 answer
2. asked by Victor Anukam
3. 517 views
Hey guys! I'm really lost on this equation. Any help?H2(g) yIelds 2H(g) Delta H = 436 kJ/mol F2(g) yields 2F(g) DeltaH = 158
1. 1 answer
2. asked by Allie
3. 665 views
What are the differences between primary succesion and secondary? Why are there these differences?How do I answer the second
1. 1 answer
2. asked by Anonymous
3. 665 views
what is fault?
1. 1 answer
2. asked by zaini
3. 431 views
At 668K 1 mol each of CO and Cl2 are introduced into an evacuated 1.75 L flask. At equilibrium, the total pressure of the
1. 1 answer
2. asked by han
3. 3,373 views
Please create a sentence for each word for a 6th grader:1. partisanship 2. preconceived 3. subjective 4. blithe
1. 1 answer
2. asked by f
3. 503 views
6 events of the book the great rat hunt
1. 2 answers
2. asked by Tisy
3. 565 views
Calculate the amount of heat required to raise the temperature of a 65-g sample of water from 32∘C to 65∘C. (The specific
1. 2 answers
2. asked by Rachel
3. 1,380 views
Once you acquire these two basic skills, you'll be able to transform a vague idea in your mind into a coherent piece of writing
1. 1 answer
2. asked by deidra jones
3. 457 views
A 1100 kg car accelerates from rest to 27 m/s in 6.0 seconds. Neglecting friction, hat is the average power consumption in
1. 2 answers
2. asked by Brandi
3. 772 views
The Caddo lived on a million acres of land. What characteristics of their culture demonstrated a need for vast amounts of land?A
1. 9 answers
2. asked by Shi Buringa
3. 698 views
I wonder how to calculate the Kp if the question gives us the total pressure and no of mol of reactant. Without giving the mol
1. 1 answer
2. asked by elly
3. 648 views
What was the main purpose of the settlers who established Jamestown?a.to trap animals and sell furs b.to find gold and silver
1. 10 answers
2. asked by AJ
3. 2,506 views
MP is the angle bisector of angle LMN Given that angle LMP is a right angle what type of angle is LMN
1. 2 answers
2. asked by Anonymous
3. 966 views
Show that C is an integerC=16*25-32*75/64*6*16 16(25-2*3*25)/16*6*64 25(1-6)/6*64 -125/384 -0.3255208 Which is a decimal and not
1. 1 answer
2. asked by Dany
3. 343 views
Third Person Limited Narrative ideas?
1. 1 answer
2. asked by Anonymous
3. 354 views
The leaders of the Virginia Company recruited more settlers and reorganized the colony. They allowed the new settlers to own
1. 8 answers
2. asked by Trent Brown
3. 2,324 views
Plastic plates come in packs of 8, plastic utensils come in packs of 12, andplastic cups come in packs of 20. What are the least
1. 4 answers
2. asked by lakshmi
3. 1,647 views
X/1/3=1/2X=
1. 1 answer
2. asked by lakshmi
3. 278 views
12/X=4X= PLEASE SHOW WORK
1. 2 answers
2. asked by lakshmi
3. 338 views
A man drops a stone into a water well onhis farm. He hears the sound of the splash 3.55 s later. How deep is the well? The
1. 0 answers
2. asked by Anonymous
3. 862 views
If the trend in the graph continues through the summer, what would you expect the average high temperature in Louisville,
1. 3 answers
2. asked by Shi Buringa
3. 1,625 views
You are planning to save for retirement over the next 15 years. To do this, you will invest $1,100 a month in a stock account
1. 1 answer
2. asked by Caroline
3. 763 views
According to the Articles of Confederation, this power was granted to Congress.to regulate trade to enforce laws to amend the
1. 1 answer
2. asked by Sandra
3. 903 views
greg traveled from his work at an average rate of 25km/hr. By traveling 50km/hr, he took 30 minutes less to return home. how far
1. 1 answer
2. asked by mary joy tecson
3. 906 views
which one of the following philosophies makes every employee a quality inspector for his or her own work
1. 1 answer
2. asked by dina
3. 446 views

Back to September 2015

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024