Archives
2015
June

Questions Asked on June 10, 2015

Typically, 10% of students make a D on their tests, 60% make a C on their test, and 30% make an A. Mrs. Smith uses a
1. 68 answers
2. asked by HELP!:)
3. 6,030 views
You owe $3,450.00. Which credit limit gives you an acceptable debt ratio? $4,000.00$2,000.00 $7,000.00 $5,500.00 helping my
1. 7 answers
2. asked by Anonymous
3. 5,706 views
A pistol is fired horizontally toward a target 120 m away but at the same height. The bullet's velocity is 200 m/s. How long
1. 5 answers
2. asked by Mark
3. 4,818 views
Gabriella went skiing. She paid $35 to rent skis and $15 an our to ski. If she paid a total of $95, how many hours did she ski?
1. 26 answers
2. asked by MusicLover14
3. 3,449 views
the hundred thousands digit of a six-digit even number is 3 more than the thousands digit,which is twice the ones digit.give at
1. 3 answers
2. asked by Sheela
3. 2,933 views
There are four cars entered into a pinewood derby race. In how many different orders can they cross the finish line?
1. 2 answers
2. asked by Anonymous
3. 2,786 views
about 35% of a population has blue eyes if four different people are randomly selected what is the probability that they all
1. 1 answer
2. asked by Anonymous
3. 2,662 views
A roulette wheel has 38 slots, numbered 0,00,and 1 to 36. the slots 0 and 00 are colored green, 18 of the others are red and 18
1. 1 answer
2. asked by Lianna
3. 2,175 views
A bank offers two interest account plans. Plan A gives you 6% interest compound annually. Plan B gives you 13% annual simple
1. 13 answers
2. asked by Tay
3. 1,776 views
how many solution are there to the equation below?3x-10(x+2)=13-7x A.1 B.0 C.Infinitely many
1. 1 answer
2. asked by Karla
3. 1,627 views
Find a rectangular equation for the plane curve defined by the parametric equations.x = sin(theta) y = 3cos(theta)
1. 1 answer
2. asked by Heather
3. 1,603 views
The height (in meters) of a projectile shot vertically upward from a point 3 m above ground level with an initial velocity of
1. 1 answer
2. asked by Laurel
3. 1,320 views
which of the following events most directly lead to American military involvement in world war 2?A: the Japanese attack on pearl
1. 4 answers
2. asked by (ASAP)HelpPLZ
3. 1,283 views
two charges q1=-2uc and q2=3uc are placed at a distance of 6cm from each other. if rubber (Er=2.94) is placed between charges,
1. 0 answers
2. asked by zeeshan
3. 1,281 views
In a federal system in government (also known as federation) the local and state governments share power with the central
1. 7 answers
2. asked by Help(aSAP)plz
3. 1,272 views
One of the most common commercial methods for the production of pure silicon that is to be used for the manufacture of
1. 0 answers
2. asked by Tyla
3. 1,269 views
Which sentence needs a possessive apostrophe?A. When the cats away, the mice will play. B. Back in 68, we though the world was
1. 2 answers
2. asked by ziko
3. 1,111 views
A marble is flicked horizontally off a desk with a speed of 3.1 m/s. If it takes the marble 0.8 seconds to hit the ground, how
1. 3 answers
2. asked by Jojo
3. 1,110 views
Fifty percent of students enrolled in calculus class have previously taken pre-calculus. Thirty percent of these students
1. 4 answers
2. asked by Nikole
3. 1,078 views
I am asked to solve the absolute value equation of|1/2x +1| =x+1 graphically. I can solve this algebraically and consider two
1. 2 answers
2. asked by george
3. 1,065 views
Which statement is false?A. Parentheticals aren’t crucial to the meaning of a sentence. B. Parentheticals are like asides. C.
1. 2 answers
2. asked by ziko
3. 1,060 views
The sales tax is $0.065 per dollar where Ray lives. What percent of a dollar is the sales tax?? Please help!!
1. 3 answers
2. asked by Linda h
3. 1,051 views
what is the present value of $2500 per year for 9 years discounted back to the present at 11 percent?
1. 2 answers
2. asked by April
3. 1,028 views
If f and g are functions defined for all real numbers, and f is an odd function,then f ∘ g is also an odd function. Justify. I
1. 2 answers
2. asked by Alex
3. 936 views
I have the question what is the equation of the function in the form f(x) = 1/x-c for the function with a vertical asymptote at
1. 1 answer
2. asked by george
3. 935 views
Okay so the question is: what would be the molarity of a saturated aqueous solution of NaI prepared at 25 C, assuming that the
1. 1 answer
2. asked by Unknown
3. 931 views
, a ball is thrown vertically upward from the top of the tower at 4.9 metres per second it strikes the pond near the base of the
1. 1 answer
2. asked by Genius
3. 900 views
a biologist has three salt solutions: some 5% solution, some 15% solution, and some 25% solution. She needs to mix some of each
1. 1 answer
2. asked by Jaden
3. 889 views
Chen is covering a 12-in. by 10-in. board with 1-inch-square tiles. He uses gray tiles to make six 2-in. by 2-in. squares. He
1. 3 answers
2. asked by Anonymous
3. 877 views
Factor quadratic expressions:2x^2 + 9x + 4 10x^2 + 70x + 100 Solve quadratic equations by factoring: 2x^2 + 9x + 4 = 0 Solve by
1. 2 answers
2. asked by Casey
3. 874 views
I have the question y=-|x^2 -9|I am asked for the piecewise function. I have written y={-x^2 +9 if x less than equal to -3} {
1. 1 answer
2. asked by george
3. 858 views
A piece of copper 12 cm long, 8.5 cm wide, and .50 cm thick has a mass of 457 grams. What is its density?D = m/v D = 457 g /
1. 2 answers
2. asked by T
3. 854 views
A coin dealer offers to sell you an ancient nickel coin that is 3.1 cm in diameter and 4.65 mm in thickness.A) The density of
1. 10 answers
2. asked by Abe
3. 848 views
A race car travels on a flat circular track at the maximum possible speed without slipping. If the radius of the track is 39m
1. 1 answer
2. asked by Alex
3. 844 views
How many solutions are there to the equation below?145=10x-8x
1. 1 answer
2. asked by Karla
3. 827 views
If cos 20=m determine the values of the following in terms of m. (a) cos(-200) (b)sin 250 (c)sin 20 thanks
1. 1 answer
2. asked by jenni
3. 822 views
A chord PQ of a circle with radius r subtends an angle B at the center. Show that the area of the minor segment
1. 1 answer
2. asked by Age
3. 818 views
A converging lens has a virtual object located a finite distance away. Which of the following must be true? (Select all that
1. 0 answers
2. asked by Anna
3. 775 views
Two velocity each 5 ms/s are inclined to each other at 60degree. Find their resultant
1. 3 answers
2. asked by Animesh
3. 750 views
In The Wealth of Nations, Adam Smith mentions that very good grapes could be grown in Scotland. However, growing high quality
1. 1 answer
2. asked by (ASAP)HelpPLZ
3. 725 views
Using a rope, a child pulls a box across a rough floor at a constant speed. The tension in the rope is 105 N and the rope makes
1. 1 answer
2. asked by tara
3. 723 views
There is a large bag with marbles in it. There are 23 red ones, 16 black ones, 5 blue ones, 17 orange ones, 4 white ones, and 15
1. 1 answer
2. asked by Anonymous
3. 721 views
How much heat would be absorbed by 55 grams of copper when heated from 24 degrees Celsius to 40 degrees Celsius? The specific
1. 1 answer
2. asked by H
3. 713 views
What is the written form of the number 98?The grocery bill came to 98 dollars and thirty cents. A. ninety eight B. ninety-eight
1. 8 answers
2. asked by flaca
3. 712 views
You roll a number cube twice. Find P (even, then not 2). Write the probability as a fraction in simplest form. I'm fully
1. 3 answers
2. asked by MusicLover14
3. 710 views
In which of the following sentences is the word compliment used correctly
1. 2 answers
2. asked by June
3. 708 views
What volume of hydrogen gas at standard temperature and pressure can be collected from the electrolysis of water using a current
1. 2 answers
2. asked by Anon
3. 695 views
If the building absorbed so much heat that it turned into a liquid, then it would have undergone a phase change known as
1. 1 answer
2. asked by neel
3. 693 views
Air molecules and dust particles in the atmosphere will scatter sunlight. From a consideration of the position of the sun,
1. 1 answer
2. asked by Nick
3. 684 views
You have been hired as a consultant for a company that would like to start a new marketing campaign to increase their online
1. 0 answers
2. asked by KEGY
3. 673 views
Why does Neiterkob’s daughter most likely tell the myth “The Beginnings of the Maasai”?
1. 2 answers
2. asked by nino
3. 662 views
1.Analyze the occurrences of collocation used in the below articlePuffin Therapy The Atlantic puffin simply vanishes for months
1. 1 answer
2. asked by Sophia
3. 648 views
How many solutions are there to the equation below?220=2x-12x a.1 b. Infinitely many c.2
1. 1 answer
2. asked by Karla
3. 629 views
Approximate the real root of cosx+x=2 to four decimal place. (Using Newton's method)I need help with this! Thank you
1. 2 answers
2. asked by karen
3. 615 views
1. What are pretzels like?- They are big and soft. 2. What do pretzels look like? - They are big and soft. =================
1. 6 answers
2. asked by rfvv
3. 606 views
What is the written form of the fraction ?Becky added 1/8 cup of brown sugar to the cookie batter. A. one-eighth B. one eighth
1. 4 answers
2. asked by flaca
3. 598 views
Design a PowerPoint presentation (6-8 slides) in which you define public health.Provide an overview of Healthy People 2020 and
1. 1 answer
2. asked by Dee
3. 593 views
what equation deccribe the condition for observing the fourth dark fringe in a interference pattern correctly
1. 1 answer
2. asked by mikhail
3. 581 views
How much 35.6 M H2SO4 is needed to make a 1 L solution that is .007 ppm? Not sure how to convert from M to ppm-is there a
1. 1 answer
2. asked by Nat
3. 576 views
A sample of a plane geometric surface is theA. surface of a sphere. B. side of a cylinder. C. side of a box. D. side of a cone.
1. 4 answers
2. asked by Anonymous
3. 570 views
what single word means the same thing as representative democracy
1. 2 answers
2. asked by michelle
3. 558 views
many solutions are there to the equations below?8x+47=8(x+5)
1. 1 answer
2. asked by karla
3. 557 views
A box slides along a rough floor with initial kinetic energy of 7 J. A person pushes on the box, in the same direction as its
1. 1 answer
2. asked by James
3. 550 views
What is the solution to this equation?4(x-8)+10=-10
1. 3 answers
2. asked by Karla
3. 549 views
how many solutions are there to the equation below?6x+30+4x=10(x+3) I want to know how to do this problems Please and Thank you
1. 1 answer
2. asked by Karla
3. 546 views
solve using substitution method:x=-5 y=2 z=0 x+3y-z=1 -4x-2y+5z=16 7x+10y+6z=-15
1. 1 answer
2. asked by Emily
3. 523 views
are there any welfare or subsidy payment that should be reviewd or added
1. 2 answers
2. asked by lesego
3. 521 views
how do you do acids/bases, oxidation, buffers, and Boyle's Law.what are the rules for each, can u give me an example for each
1. 5 answers
2. asked by reina bonilla
3. 521 views
Simplify cos180*sin225*cos80/sin170*tan135
1. 1 answer
2. asked by kem
3. 520 views
If the sum of first n term is 1600,and thecommon different is 2 while the 1st term is 1.find n?
1. 1 answer
2. asked by Noel
3. 510 views
i need help. I do not know what caused the world war II. Can you guys help me?
1. 3 answers
2. asked by Sofia
3. 504 views
I am just about the processes of writing a short story and I am looking for a word/phrase that can properly describe a
1. 2 answers
2. asked by Anna
3. 498 views
In a beg with 8 red balls and 11 blues balls howmany 5 balls boxes can be chosen those have 4 blue balls?
1. 2 answers
2. asked by Harish kumar
3. 497 views
Select the approximate values of x that are solutions to f(x)=0,where f(x)=-9x^2+7x+2A.{-0.22,1.00} B.{-9,7} C.{-0.78,-0.22}
1. 1 answer
2. asked by liza
3. 489 views
How would you use a piece of Polaroid to look at the bottom of a pond if reflections are a problem? Would it be any different if
1. 1 answer
2. asked by Nick
3. 488 views
If a 0.688 mole sample of silver at 19.6°C absorbs 1.162 kJ of heat, what is the final temperature in C?
1. 1 answer
2. asked by Josh
3. 467 views
Hi, I have 3 problems here need to be solved, help me please1.Evaluate ∫ sin2x sec^5(2x)dx 2. If f(x)=√x and P is a
1. 2 answers
2. asked by karen
3. 465 views
I have f(x) + 1/ x-c this is the question and I am told for the function with a vertical asymptote at x=1Mr. Reimy was kind
1. 1 answer
2. asked by george
3. 462 views
Prove that 2sin150*cos315*cos(90-x)/sin(360-x)cos(-240)sin135
1. 1 answer
2. asked by ivy
3. 455 views
Prove the following identity tan x cos x/sin x=1/sin x cos x
1. 3 answers
2. asked by lewis
3. 454 views
Thinking maps are visual learning tools. Each map is based on fundamental thinking process, such as a quantity, sequencing,
1. 1 answer
2. asked by Yee Leng
3. 447 views
An object 4.2 feet tall casts a shadow that is 12.6 feet long. How long in feet would the shadow be for an object which is 20.4
1. 3 answers
2. asked by liza
3. 447 views
Write an equation of the line that passes through (-3,4) and is perpendicular to the line y=2x-5.Answer: y-y1=2(x-x1) y-4=2(x+3)
1. 1 answer
2. asked by Amy
3. 442 views
Find the point on the graph of y = x^2 where the tangent line is parallel to the line -5x+3y=5
1. 0 answers
2. asked by Trent
3. 434 views
There are two types of miscarriage of justice and after 2003, there was emphasis the conviction of guilty.
1. 3 answers
2. asked by Tori
3. 418 views
1. Evaluate ∫(0-4) x/√x^2+9 dx2. Given F(x)= ∫(0-x) t√t^2+4 dt, find F'(x)
1. 1 answer
2. asked by Yumin
3. 405 views
Find the number of atoms in 138 grams of nickel.I'm not sure where to start. Can anyone help me?
1. 1 answer
2. asked by A
3. 371 views
does anyone know of any reference of gluttony in literature?thanks!
1. 7 answers
2. asked by sara
3. 369 views
why is the answer to this problem?5/3 -5/6
1. 2 answers
2. asked by bobby
3. 307 views

Back to June 2015

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025