Archives
2014
July

Questions Asked on July 15, 2014

graph a line with the indicated slope and y-intercept. slope=-6 y-intercept=(0,7)
1. 1 answer
2. asked by sharon
3. 523 views
1. My mind and body were so (oppressed, heeded) by the stifling heat that afternoon that I couldn't do anything at allans.
1. 1 answer
2. asked by need help
3. 583 views
1. A solution is prepared such that it is 0.45 M in formic acid and 0.35 M in sodium formate.a) Where is this mixture located on
1. 2 answers
2. asked by Arthur T
3. 887 views
1. I am learning another language.2. I am learning one more language. 3. I am learning a different language. ----------------
1. 1 answer
2. asked by rfvv
3. 358 views
1. Some people said yes and others said no, and the others said nothing.2. Some people said yes and others said no, and the
1. 1 answer
2. asked by rfvv
3. 554 views
1. Look at the scared boy.2. Look at the scary monster. 3. Look at the scaring boy. 4. Look at the scaring monster. 5. Look at
1. 1 answer
2. asked by rfvv
3. 461 views
Einstein sought to discover a unified field theory that would explain the behaviour of all fields. What evidence have you seen
1. 0 answers
2. asked by Liz
3. 468 views
1. hearth is to heat asa. lamp is to light b. sink is to kitchen c. door is to lock d. bed is to blanket ans. a 2. Basket
1. 1 answer
2. asked by need help
3. 458 views
1. Barren is to produce asa. inhumane is to abuse b. timid is to fear c poised is to enjoy d ignorant is to know Ans d 2. resume
1. 2 answers
2. asked by need help
3. 1,721 views
The editor's comments about the novel's "____" narrative ____ the writer.a. gruesome.. marred b. notable... frustrated c.
1. 1 answer
2. asked by need help
3. 523 views
find a equation for the line containing the given points. Let x represent the number of years after 2000 and y the number of
1. 1 answer
2. asked by sharon
3. 490 views
given the point-slope equation y+8=-5(x-6), state the indicated point of the graph
1. 1 answer
2. asked by sharon
3. 481 views
The smile of joy she gave me when she received the award was ample (recompense, incentive) for all the time and effort I had
1. 1 answer
2. asked by need help
3. 467 views
If a circle has a radius length of 2x units, what is the circle’s circumference?
1. 2 answers
2. asked by Dyamond
3. 1,528 views
Each of the Spanish sentences below is incorrect in either grammar or meaning. Rewrite eachsentence correctly. 1. El rey que
1. 1 answer
2. asked by rudy
3. 1,293 views
You are walking away from home at a constant velocity of 5 km per hour. The first landmark you see is your favorite fountain
1. 2 answers
2. asked by Jennifer
3. 728 views
F13Q1_1: COMPOSITE BAR UNDER DISTRIBUTED LOADINGThe composite bar AB has length L and is fixed at A(x=0). The bar has a constant
1. 2 answers
2. asked by Michael
3. 689 views
Calculate the volume of a graduated cyclinder that has a radius of 10 mm and a height of 120 mm.
1. 1 answer
2. asked by Ben
3. 469 views
A particle with a charge of -4.0x10^-5 C, a mass of 2.0x10^-7 kg and a velocity of 6.0x10^4 m/s [W] is travelling
1. 0 answers
2. asked by Liz
3. 448 views
A charge with a value of 3.0 x 10^-5 C is located 3.0 cm from a charge with a value of 6.0 x 10^-5 C. Determine the distance
1. 0 answers
2. asked by Liz
3. 509 views
Using an aggregate demand and supply diagram, explain how each of the following scenarios affects the equilibrium price level
1. 0 answers
2. asked by Mandy
3. 707 views
Benzene reacts with hot concentrated nitric acid dissolved in sulfuric acid to give chiefly nitrobenzene, C6H5NO2. A by-product
1. 1 answer
2. asked by Luke
3. 933 views
A saturated solution is made by dissolving 0.252 g of a polypeptide (a substance formed by joining together in a chainlike
1. 1 answer
2. asked by Luke
3. 1,329 views
A sinusoidal wave on a string is described by the equation y = (0.191 m) sin (0.745 x - 42.9 t), where x and y are in meters and
1. 1 answer
2. asked by Lema
3. 571 views
Why was the Quasi-war called the undeclared war with France?
1. 1 answer
2. asked by Anonymous
3. 474 views
what were some causes of the panic of 1819?
1. 1 answer
2. asked by Anonymous
3. 435 views
Revise the following sentences so that the subject and verb of each sentence identify key actors and actions:• The dedication
1. 8 answers
2. asked by Susan
3. 2,375 views
The square of the sum of 2x and 3y is equal to the sum of the square of y and the square root of x. Which of the following
1. 1 answer
2. asked by Anne
3. 406 views
Was Washington's farewell address printed in newspapers? or was it verbally said?
1. 1 answer
2. asked by Anonymous
3. 520 views
In the year 1950, the total quantity of rice produced in India was two crore five lakh eighty thousand tonnes. In the year 2001,
1. 1 answer
2. asked by angela
3. 463 views
Consider the given statements.1. Every prime number is odd. 2. There are 8 prime numbers between 10 and 40. 3. There are 11
1. 2 answers
2. asked by angela
3. 589 views
Three hundred thirty six students of school A and four hundred thirty two students of school B were to participate in a parade.
1. 1 answer
2. asked by angela
3. 685 views
A pattern is given as:1 = (1 × 2) ÷ 2 1 + 2 = (2 × 3) ÷ 2 1 + 2 + 3 = (3 × 4) ÷ 2 1 + 2 + 3 + 4 = (4 × 5) ÷ 2 1 + 2 + 3
1. 1 answer
2. asked by angela
3. 464 views
Fitness is a result of which of the following factors?A. Overproduction B. Adaptation C. Variability D. Homology I think it is
1. 1 answer
2. asked by Dulce
3. 713 views
Consider the given statements.1. Every prime number is odd. 2. There are 8 prime numbers between 10 and 40. 3. There are 11
1. 1 answer
2. asked by angela
3. 582 views
275 ml of active ingredient is added to 725 ml of an alcohol based solution. What is the final strength (v/v)
1. 2 answers
2. asked by Kill
3. 498 views
A toy plane p starts flying from point A along a straight horizontal line 20 m above ground level starting with zero initial
1. 5 answers
2. asked by karan
3. 5,606 views
In the year 1950, the total quantity of rice produced in India was two crore five lakh eighty thousand tonnes. In the year 2001,
1. 1 answer
2. asked by angela
3. 415 views
A few pieces of cloth, each of length 4 m 25 cm, are cut from a 170 m long cloth piece such that no cloth is left.How many
1. 2 answers
2. asked by angela
3. 624 views
A hypothesis is what an investigator uses to:duplicate research findings of other scientists. frame his/her research question.
1. 3 answers
2. asked by Mary
3. 987 views
A researcher collects high-resolution photographs of the Earth taken from outer space at annual intervals for the last decade.
1. 3 answers
2. asked by Dulce
3. 1,519 views
Experiments cannot validate hypotheses, only falsify them. The statement above can be restated in which of the following ways?A.
1. 2 answers
2. asked by Dulce
3. 989 views
Determine the pH of the following solutions:a) A 250.0 mL solution that contains 0.125 M benzoic acid and 0.147 M sodium
1. 1 answer
2. asked by Arthur T
3. 838 views
Are there some merge points where some drivers are entering while other drivers are exiting in close proximity? I was trying to
1. 1 answer
2. asked by Pablo
3. 438 views
One way to test for the validity of research methods is to?A. Compare children's answers to different halves of the same test B.
1. 1 answer
2. asked by daniela
3. 537 views
_________ allows States to split their electoral votes to mirror the popular vote within the particular State.A) Direct Popular
1. 5 answers
2. asked by Casey
3. 2,505 views
-------- allows the voters to directly elect the president. A)The District Plan B) Direct Popular Election C) The Proportional
1. 3 answers
2. asked by Casey
3. 951 views
select 2 word that are most nearly opposite in meaning1. a. humdrum b. leisurely c. grueling d. miscellaneous ans b & c 2. a.
1. 1 answer
2. asked by need help
3. 665 views
homogenized milk is composed of microscopic globules of fat suspended in a watery medium. is homogenized milk a true solution?
1. 1 answer
2. asked by duane
3. 563 views
The instructions are to choose the best answer for the statements. I'd like to know if I answered correctly or if I should
1. 2 answers
2. asked by Eri
3. 757 views
How would polyethylene have the VSEPR shape of tetrahedral?
1. 1 answer
2. asked by Liz
3. 590 views
find all real numbers that satisfy the equation: sinx= -\sqrt3/ 2
1. 1 answer
2. asked by Anonymous
3. 659 views
If A and B work together,they can finish a task in 2 hours. If they do the task separately, B can finish 3 hours earlier than A
1. 1 answer
2. asked by boh
3. 556 views
Got 10/10Question 1.1. The trajectory of cases from Marbury v. Madison demonstrate that the Supreme Court (Points : 1) ✓ A-
1. 1 answer
2. asked by HK
3. 622 views
assuming that you wished to have the highest possible score on an exam relative to ht e other scores, would you rather have a
1. 1 answer
2. asked by nick
3. 1,060 views
A 38.9 g piece of iron at 84.6oC is placed in a beaker containing 179.7 g of 20.7oC water. What is the final temperature (oC)of
1. 1 answer
2. asked by Mike
3. 328 views
Solve and Check√x-6=√3-√x
1. 1 answer
2. asked by Alyanna
3. 347 views
Two different radioactive isotopes decay to 10% of their respective original amounts. Isotope A does this is 33 days, while
1. 3 answers
2. asked by Junior
3. 4,265 views
it is a sequence. what do you tjink is the next ? and how does it happens /1,11,21,1211,11121 . . .
1. 1 answer
2. asked by Alyanna
3. 359 views
why should you not attempt to take a picture of fluorine?
1. 0 answers
2. asked by duane
3. 462 views
Hello. I am creating a resume. Under one of my bullet points, I want to say that I write inspirational blogs. How would I say
1. 1 answer
2. asked by Tom
3. 484 views
A population of insects increases at a rate of 1.5% per day. About how long will it take the population to double?2.5 days 5.0
1. 4 answers
2. asked by Junior
3. 4,253 views
element 118 was reportedly synthesized in 1999, but the claim was later retracted. as a consequence of that experiment, element
1. 1 answer
2. asked by duane
3. 959 views
In a class of 34 students, how many of them will have a z-score above 1.0?
1. 0 answers
2. asked by Shawna
3. 425 views
Why was the policy of containment unsuccessful in Vietnam/Asia?
1. 1 answer
2. asked by Tina
3. 473 views
Find the Exact Value of the Compositioncos(arcsin(1/4))
1. 1 answer
2. asked by Anne
3. 479 views
(x^2+1)dx+x^2y^2dy=0need help:)..thanks.
1. 1 answer
2. asked by Alyanna
3. 293 views
Two different cars each depreciate to 60% of their respective original values. The first car depreciates at an annual rate of
1. 2 answers
2. asked by Junior
3. 2,703 views
How much 9% solution can you make by diluting 350ml of a 15% solution?
1. 1 answer
2. asked by Ki
3. 567 views
Billing office is trying to figure out the amount of 0.75 hour overtime for a worker who is paid $32.48 for A regular hourly
1. 1 answer
2. asked by Monique
3. 694 views
What can you infer about the poet’s attitude about humanity from these lines in “Song of Myself”?These are really the
1. 5 answers
2. asked by Emi
3. 1,294 views
When do you fertilize shrub roses?
1. 1 answer
2. asked by Dulce
3. 1,545 views
What is the equation of the line that passes through (-2, 2) and (1, -4)?
1. 1 answer
2. asked by hannah
3. 336 views
Mrs bautista accelerates her bicycle uniformly along a straight path from 10.5 m/s to rest in 5.2s.A. What is her acceleration?
1. 2 answers
2. asked by Alyssa ponce
3. 383 views
Glauber's salt undergoes a phase transition according to the following equation:Na2SO4*10H2O(s)--> Na2SO4*10H2O(l) ∆H = 74.4
1. 4 answers
2. asked by Mike
3. 611 views
Climate change studies suggest the worst impacts will be felt by the wealthiest people. TRUE OR FALSE
1. 3 answers
2. asked by Anonymous
3. 508 views
A solution of acetic acid was prepared by mixing glacial acetic acid with water.The solution was 25% of acetic acid by
1. 1 answer
2. asked by Syam
3. 651 views
How much ethanol must be used to prepared 150 mL 10% by volume?
1. 1 answer
2. asked by Syam
3. 422 views
If Zulfiqar fold this colored paper as shown in the image, which cube will he get?A C B D
1. 7 answers
2. asked by zain
3. 446 views
The editor's comments about the novel's "____" narrative ____ the writer.a. gruesome.. marred b. notable... frustrated c.
1. 1 answer
2. asked by need help
3. 708 views
The concentration of vinegar was obtained by titration. 20 ml of vinegar required 43.2 ml of 0.350 M sodium hydroxide. Find the
1. 2 answers
2. asked by luther
3. 861 views
An inverted right cone, half filled with water. I've only the volume of the entire cone to go from.So the volume of the cone =
1. 1 answer
2. asked by Eef
3. 683 views
1. I will finish it by tomorrow evening.2. I will have finished it by tomorrow evening. ---------------- Which one is
1. 1 answer
2. asked by rfvv
3. 674 views
A square pyramid has sides of 8 m. Each face is an equilateral triangle.What is the lateral area of the pyramid?
1. 2 answers
2. asked by hannah
3. 1,778 views
Determine the percent composition of sodium hydrogen carbonate.Na H C O3 1*22.999 1*1.008 1*12.011 3*15.999 22.999 1.008 12.011
1. 0 answers
2. asked by duane
3. 580 views
An 800 kg police boat slows down uniformly from 50 km/h [E] to 20 km/h [E] as it enters a harbour. If the boat slows down over a
1. 3 answers
2. asked by alisha
3. 993 views
A certain sample of gas has a volume of 500 ml. at a pressure of 1.5 atmosphere.What will be its volume if the gas is submerged
1. 1 answer
2. asked by cherryl
3. 930 views
1. I have ten balls. Some are red, others are blue, and the other is green.2. I have ten balls. One is green, some are red, and
1. 1 answer
2. asked by rfvv
3. 514 views
1. I saw two movies: one was a scary movie and the other was a comedy.2. I saw two movies: one was a scary movie and the other
1. 0 answers
2. asked by rfvv
3. 495 views
Compare the similarities and differences of the principles of communication you learned in Week One with the major components of
1. 1 answer
2. asked by Caleb
3. 596 views
1. Cats are various colors.2. Cats are of various colors. (Which one is correct?) 3. This paper is not clean. Give me another
1. 1 answer
2. asked by rfvv
3. 449 views
1. The two men were handcuffed together.2. The two men were handcuffed by the police officer. --------------------- Does #1 mean
1. 1 answer
2. asked by rfvv
3. 492 views
The young woman looked at the two men. Then with a lovely smile, she held out her hand and said,"Hello, Mr. Easton......In the
1. 1 answer
2. asked by rfvv
3. 377 views
1. She was very beautiful.2. She was beauty itself. 3. She was all beauty. 4. She was a beauty. -------- Are they grammatical
1. 1 answer
2. asked by rfvv
3. 672 views
The speed of a boat in still water is 8km/h. It travels upstream for a distance of 1.5km and returns(downstream) to the starting
1. 2 answers
2. asked by yeung
3. 621 views

Back to July 2014

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024