Archives
2014
June

Questions Asked on June 5, 2014

A person is initially 8 m from a point sound source which emits energy uniformly in all direction at a constant rate. If the
1. 4 answers
2. asked by Ariana
3. 1,995 views
The sum of the degrees of the interior angles of a triangle is_____ degrees What is the sum of the interior angles of a
1. 1 answer
2. asked by Mackenzie
3. 1,759 views
1. permutation or combination: how many schedules are possible if you need to choose 5 events out of 20 for a vacation?Is it
1. 5 answers
2. asked by Anonymous
3. 589 views
A 250g wood block firmly attached to a horizontal spring slides along a table with a coefficient of friction of 0.40. A force of
1. 1 answer
2. asked by Joey
3. 568 views
A polygon is a __ dimensional figure with ___ or more sides.A regular polygon has equal ____ lengths and equal ____ measures
1. 1 answer
2. asked by Anonymous
3. 603 views
Assume that it costs Apple approximatelyC(x) = 36,100 + 100x + 0.01x^2 dollars to manufacture x 30-gigabyte video iPods in a
1. 2 answers
2. asked by Jerry
3. 1,680 views
The act requiring mortgage lenders to give borrowers HUD booklets and good faith estimates of the closing costs is called the
1. 1 answer
2. asked by tota
3. 704 views
A football player punts the ball at a 45.0oangle. Without an effect from the wind, the ball would travel 60.0 m horizontally.
1. 2 answers
2. asked by Anonymous
3. 4,646 views
A collision in Phystown is being analyzed by the O.P.P. accident analysis team. A 1000 kg Toyota known to be moving at 65 km/h
1. 2 answers
2. asked by grey
3. 888 views
I'm really confused on this question so if someone could show the steps and how to get the answer, that would be great. I
1. 2 answers
2. asked by Serena
3. 598 views
What impact have the following conflicts had upon the US?(WWII, Korea, Vietnam, the Wars in Gulf, Iraq, and Afghanistan.) I have
1. 5 answers
2. asked by Emma
3. 504 views
Student credit cards typically require that one be enrolled in a 2- or 4-year college/university and
1. 1 answer
2. asked by tota
3. 826 views
Appropriate reasons to use credit include for __________.
1. 1 answer
2. asked by tota
3. 628 views
A 1.0 kg puck sliding at 15 m/s along some horizontal frictionless ice strikes and compresses a horizontal spring attached to
1. 4 answers
2. asked by grey
3. 1,142 views
During the Olympic ice competition, Boris (m = 75 kg) glides at 1.8 m/s to a stationary Juliette (52 kg) and hangs on. How far
1. 1 answer
2. asked by grey
3. 892 views
A charge of -2.68 ✕ 10-9 C is at the origin of a coordinate system, and a charge of 7.77 ✕ 10-9 C is on the x-axis at 2.00
1. 0 answers
2. asked by kaila
3. 743 views
A room is a square with integer dimensions. it is made 3 feet wider and 2 feet deeper. the increase in area is 46 square feed.
1. 1 answer
2. asked by Liz
3. 542 views
a pole 10m long rests slantly against a vertical wall ab making 60 degrees with the horizontal (ground). find how faris the foot
1. 3 answers
2. asked by aakaash
3. 715 views
1. Scanf 5 names of you and your friends2. Printf hi to all of them. 3. Ask all of them for their ages. 4. Printf the
1. 0 answers
2. asked by AIRA
3. 493 views
. If the maximum loan-to-value ratio that a lender will accept on a $100,000 loan is 90 percent, then the borrower must make
1. 2 answers
2. asked by tota
3. 926 views
Last Problem of the Week this year! Having a bit of trouble with it: In how many ways can seven basketball players of different
1. 6 answers
2. asked by Rosa
3. 575 views
The heat capacity of aluminum is 24.4 J/mol times degrees C. How much energy is released when 5.00 g Al is cooled from 50
1. 2 answers
2. asked by Serena
3. 742 views
The exhaust temperature of a heat engine is 250∘C .What must be the high temperature if the Carnot efficiency is to be 35% ?
1. 1 answer
2. asked by Anonymous
3. 971 views
alculate the final speed of a 1500 kg roller coaster if it has an initial speed of 16 m/s but reduces its elevation by 8.6 m by
1. 3 answers
2. asked by grey
3. 1,093 views
A certain power plant puts out 520MW of electric power.Estimate the heat discharged per second, assuming that the plant has an
1. 2 answers
2. asked by Anonymous
3. 1,932 views
A 0.50 kg cue ball makes a glancing blow to a stationary 0.50 kg billiard ball. After the collision the cue ball deflects with a
1. 1 answer
2. asked by grey
3. 894 views
A bullet of mass 45 g is fired at a speed of 220 m/s into a 5.0 kg sandbag hanging from a string from the ceiling. The sandbag
1. 2 answers
2. asked by grey
3. 1,076 views
An automobile cooling system holds 16 L of water. The specific heat of water is 4186 J/kg⋅C∘.How much heat does it absorb if
1. 1 answer
2. asked by Anonymous
3. 1,606 views
The value of specific heat for copper is 390 J/kg⋅C∘, for aluminun is 900 J/kg⋅C∘, and for water is 4186
1. 0 answers
2. asked by Anonymous
3. 990 views
When a 310-g piece of iron at 180∘C is placed in a 95-g aluminum calorimeter cup containing 250 g of liquid at 10∘C, the
1. 0 answers
2. asked by Anonymous
3. 1,128 views
A 49-g bullet traveling at 290m/s penetrates a block of ice at 0∘C and comes to rest within the ice.Assuming that the
1. 1 answer
2. asked by Anonymous
3. 1,189 views
Question: 89 of 111Leave Questionnaire You need to hire a part-time associate to work 30 hours a week in your store. You have
1. 2 answers
2. asked by craig
3. 641 views
The density of water is the greatest at a temperature ofA. 0 Kelvin B. 277 Kelvin C. 273 Kelvin D. 4 Kelvin
1. 3 answers
2. asked by Unmei
3. 793 views
Except 15 all others are oranges, except 20 all others are mangoes, except 25 all others are bananas , what is the total number
1. 1 answer
2. asked by devi
3. 2,090 views
A 0.50 kg cue ball makes a glancing blow to a stationary 0.50 kg billiard ball. After the collision the cue ball deflects with a
1. 2 answers
2. asked by grey
3. 3,072 views
suppose you roll two number cubes and pick a letter of the alphabet at random. find the probability you will roll two odd
1. 1 answer
2. asked by logan
3. 877 views
The displacement, force, velocity, and acceleration vectors’ components are given. Calculate the magnitude and direction of
1. 1 answer
2. asked by Grant
3. 527 views
the density of mercury is 13.5g/cc what volume of mermury would have a mass of 100g?
1. 1 answer
2. asked by wanda
3. 527 views
Adam has a cylindrical container. He is going to pour water into the container from a cube that has a side length of 1.5 inches.
1. 2 answers
2. asked by Dea
3. 1,273 views
Suppose that inflation is 3% per year. This means that the cost of an item increases by 3% each year. Suppose a jacket cost $150
1. 1 answer
2. asked by tom
3. 1,134 views
1. With night coming on, we started for home.2. Because night came on, we started for home. 3. Night came on, and we started for
1. 1 answer
2. asked by rfvv
3. 1,273 views
What are the personal, societal, and scientific implications of alpha-1 antitrypsin deficiency?I googled, but couldn't find any
1. 1 answer
2. asked by Anonymous
3. 553 views
UNSCRAMBLERDOCRROUTINEDEVELOPMENT to make 2 words having to do with the reproductive system
1. 0 answers
2. asked by molly
3. 443 views
Question: Calculate the solubility (g/L) of CuBr at 25 degrees celsius in 0.0110 M CoBr2. Ksp of CuBr = 5.3*10^-9.I am capable
1. 6 answers
2. asked by John Eris
3. 3,496 views
Given that the ratios of the perimeter of two similar shapes is 3/5, what is the ratio of their perimeters.
1. 1 answer
2. asked by Jorge
3. 708 views
Hercules Films is deciding on the price of the video release of its film Bride of the Son of Frankenstein. Marketing estimates
1. 2 answers
2. asked by Gabby
3. 3,072 views
a scuba driver is using eanx32, an enhanced nitrox gas mixture. this mixture contains 32% oxygen with 68% nitrogen. if the
1. 2 answers
2. asked by julie
3. 681 views
Help on these few questions please? :( I'm so confused. No need for a direct answer if you don't wanna give it but I just need
1. 1 answer
2. asked by EIllie
3. 970 views
I'm in grade 12 I want an advice about the subj that I chose maths lit,geography,life scinces,so which job I can take next year
1. 1 answer
2. asked by roland
3. 597 views
Give reasons why the reaction between benzoylchloride and methanol do not attack carbon from the ring
1. 0 answers
2. asked by Destiny
3. 535 views
An unsecured astronaut is floating in deep space. He switches on a hand held drill. The drill bit begins rotating clockwise with
1. 1 answer
2. asked by Luke
3. 651 views
Jane ran around the perimeter of a rectangular park at a constant rate of 10 feet per second. The park has an area of 67,500
1. 3 answers
2. asked by Anonymous
3. 689 views
find the mole fraction of sodium in 25% by massof sodium amalgum
1. 0 answers
2. asked by sonu
3. 440 views
1)Answer 3.2rad/sec2)Answer 2.2rad/sec
1. 1 answer
2. asked by bonventure
3. 382 views
how many moles of oxygen are needed to react with 3.5 moles of isopropyl alcohol, C3H7OH
1. 1 answer
2. asked by Steven
3. 879 views
I don't know if this one is right or not. I've been stuck on this question for 15 mins and my grade counts on this.20. “In
1. 3 answers
2. asked by Amber
3. 783 views
What do I put in my enterprise security plan proposal? I need to cover the ten domains of Information Security Common Body of
1. 0 answers
2. asked by Jessica
3. 578 views
in triangle ABC, a = 2, b = the square root of 3, and m,angle C = 30 degrees. What is the value of c?a= 1 b= 2 c= 2square root
1. 1 answer
2. asked by jonni
3. 764 views
Show that the following points are collinear:A (5,2) B (-3,-2) C (9,4)
1. 1 answer
2. asked by Tsunayoshi
3. 601 views
What are welfare payments or consumer subsidies?
1. 0 answers
2. asked by Mthokozisi kofana
3. 477 views
In a large lot of electric light bulbs,5% of the bulbs are defective.calculate the probability that a random sample of 20 will
1. 0 answers
2. asked by Destiny
3. 576 views
Explain why this reaction is not feasible:CH3CHO^-Na^+ + CH3C(CH3)2Cl=CH3CH2O(CH3)2OCH3. ;->Becos of ion charge of Oxygen and Na
1. 1 answer
2. asked by Destiny
3. 445 views
two resistor 6 ohm and 8 ohm are connected in parallael across 36v power supply
1. 1 answer
2. asked by shiyan
3. 447 views
Divide. Show all work. Make sure to simplify. Assume no denominator equals zero x^2-144/x^2+7x-60 divided by 3x-36/9x-45I'm
1. 2 answers
2. asked by Emily
3. 816 views
if+all+nitrogen+atoms+from+.1+mole+No2+and+.2+N2o4+are+removed+then+how+many+moles+of+n2+can+be+prepared+from+it
1. 1 answer
2. asked by sonu
3. 521 views
I'm in the eighth grade and mine is 64 percent am I passing?
1. 2 answers
2. asked by nonononono
3. 579 views
if all the sulphur atoms from 9.8 kgh2so4 are removed and converted to s8 than how many moles of s8 can be prepared?
1. 1 answer
2. asked by sonu
3. 439 views
what is the weight in kg of 3*10 22 molecules of NaOH
1. 1 answer
2. asked by tanvir
3. 424 views
how many carbon atoms are present in a drop of ink which falls on the paper having a wave point 0.1 mg
1. 2 answers
2. asked by tanvir
3. 381 views
if all the oxygen from 1.8 gram glucose and 9.8 H2So4 are removed and converted to o2 how many moles are prepared?
1. 1 answer
2. asked by tanvir
3. 410 views
Suppose that you are in a class of 29 students and it is assumed that approximately 16% of the population is left-handed. (Give
1. 1 answer
2. asked by BJ
3. 1,157 views
IF ALL NITROGEN ATOMS FROM .1 MOLE nO2 AND .2 MOLE N2O4 ARE REMOVED THEN HOW2 MANY MOLES OF N2 CAN BE PREPARED FROM IT?
1. 1 answer
2. asked by tanvir
3. 492 views
Find the number of decibels for the power of the sound given. Round to the nearest decibel.A rocket engine, 2.37 cross 10−5 (
1. 1 answer
2. asked by elise
3. 493 views
If I have 20 apples and I give away 7%, how many apples do I have left?
1. 1 answer
2. asked by Apple
3. 492 views
Find the number of decibels for the power of the sound given. Round to the nearest decibel.A rocket engine, 2.37 cross 10−5
1. 1 answer
2. asked by neal
3. 553 views
Write the quadratic function in standard form (if necessary) and sketch its graph.Identify the vertex h(x)=x^2-9
1. 1 answer
2. asked by Anonymous
3. 547 views
"please help me" posted this earlier:If m angle sign 1=37 degrees what is m angle sign 4 My answer: 43 degrees which is wrong.
1. 3 answers
2. asked by Writeacher
3. 2,740 views
A gas has a volume of 590 mL at a temperature of –55.0 C. What volume will the gas occupy at 30.0 C?V1T1 = V2T2 (590
1. 1 answer
2. asked by Angela
3. 2,139 views
A gas occupies a volume of 140 mL at 35.0 C and 97 kPa. What is the volume of the gas at STP?N = ( P )( V ) / ( R ) ( T ) N = (
1. 1 answer
2. asked by Angela
3. 2,310 views
If a 1lıtre can of paınt ıs enough to cover 5m of wall area,and then can cost R26,00 how much wıll ıt cost to buy the
1. 1 answer
2. asked by zımkhıtha
3. 485 views
What would you predict the price of product x in volume of 150 to be approximately. What would you predict the price of product
1. 1 answer
2. asked by Erma
3. 480 views
At a certain temperature, Keq is 4.13 x 10^-5 for the equilibrium:2IBr(g) ↔ I2(g) + Br2(g) Assume that the equilibrium is
1. 1 answer
2. asked by Ryan
3. 1,140 views
How many servıngs of 30g can one get from the packet?
1. 1 answer
2. asked by zımkhıtha
3. 482 views
Gıve another name for dıetary fıbre and state two reasons why ıt ıs ımportant ın human nutrıtıon.
1. 1 answer
2. asked by zımkhıtha
3. 613 views
Does skım mılk contaın dıetary fıbre?
1. 1 answer
2. asked by zımkhıtha
3. 578 views
Why ıs ıt healthıer to use skım mılk,ınstead of normal mılk,wıth your cereal?
1. 1 answer
2. asked by zımkhıtha
3. 499 views
How much proteın ıs found ın 100 ml of skım mılk?
1. 0 answers
2. asked by zımkhıtha
3. 495 views
/how do i solve this?The probability of winning a game is 15%. If you play 20 times,how many times should you expect to win? A.5
1. 9 answers
2. asked by matt
3. 2,799 views
Gıve two reasons why sodıum ıs ımportant ın normal dıet.
1. 1 answer
2. asked by zımkhıtha
3. 518 views
Assume the car can be purchased for 0% down for 60 months (in lieu of rebate).A car with a sticker price of $42,650 with factory
1. 0 answers
2. asked by monia
3. 551 views
A hungry teenager has three servıngs of cereal and mılk.what mass of sodıum dıd he take ın?
1. 5 answers
2. asked by zımkhıtha
3. 1,731 views
At equilibrium, what is the hydrogen-ion concentration if the acid dissociation constant is 0.000 001 and the acid concentration
1. 2 answers
2. asked by Angela
3. 983 views
Hello! I try to do my homework to the best of my ability. I want to make sure that my answers are correct. My answers will be
1. 11 answers
2. asked by TazKiyah
3. 1,201 views
In 1986 an earthquake measuring 5.0 on the Richter scale hit northeast Ohio. This earthquake is _______ times as intense as a
1. 2 answers
2. asked by Alexis
3. 1,055 views
why is it there?
1. 1 answer
2. asked by Eric Cartman
3. 297 views
Relations and functionsy=-3/4x+4 and y=2(x) state weather each equation is a function state shape and location on the graph
1. 1 answer
2. asked by tbell
3. 513 views
Which words nearly opposite meanings? A.finished, responded<----B.indifferent, excited C.lingering, invited D.sorry, available
1. 2 answers
2. asked by Anonymous
3. 520 views
im not so sure on this but i think its A.Which of the following is an example of independent events? A.rolling two number cubes
1. 2 answers
2. asked by matt
3. 623 views
The function rule C=10n +26 relates the number of people n who attend a small concert to the cost in dollars c of the concert..
1. 1 answer
2. asked by Jamanonymous
3. 814 views
Which line from the poem contains an example of onomatopoeia? (1 point)A. The Sea murmurs sleepily in the cool morning
1. 1 answer
2. asked by Anonymous
3. 767 views

Back to June 2014

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024