Archives
2014
April

Questions Asked on April 27, 2014

1. In a citation within a Works Cited page, which of the following should NOT be in italics?A. the title of a book B. the title
1. 47 answers
2. asked by Cassie
3. 32,286 views
A wheel starts from rest and has an angular acceleration of 4.0 rad/s^(2). When it has made 10 rev its angular velocity is:
1. 4 answers
2. asked by jay
3. 5,702 views
Iodine 131 is a radioactive isotope. After 4.00 days, 70.8% of a sample of 131I remains.What is the half life of 131I?
1. 2 answers
2. asked by Natalie
3. 4,798 views
At 3:00 PM a man 146 cm tall casts a shadow 136 cm long. At the same time, a tall building nearby casts a shadow 177 m long. How
1. 1 answer
2. asked by laurens
3. 4,406 views
sWhich of the following would be the best example of a total institution? A. A mental hospital B. A private university C. A
1. 2 answers
2. asked by Angela
3. 4,195 views
Mattie is a new sociology professor at the local college. During her first lecture, she noticed that some students were yawning.
1. 4 answers
2. asked by Angela
3. 3,717 views
An exponential function with a base of 3 has been vertically stretched by a factor of 1.5 and reflected in the y-axis. Its
1. 2 answers
2. asked by Han
3. 3,278 views
The average cost per night of a hotel room in New York City is $273 (SmartMoney, March 2009). Assume this estimate is based on a
1. 2 answers
2. asked by Mia
3. 3,224 views
The number of diagonals, d, in a polygon of n sides is given by the formula d=n^2-3n/2. If a polygon has 90 diagonals, how many
1. 3 answers
2. asked by thomas
3. 3,200 views
The compound M2X3 has a molar solubility of 0.0190 M. What is the value of Ksp for M2X3?Here are the choices: 1. 3.52 × 10^-6
1. 1 answer
2. asked by Sara
3. 2,811 views
A cyclist rides her bike at a speed of kilometers per hour. What is this speed in kilometers per minute? How many kilometers
1. 3 answers
2. asked by David
3. 2,575 views
The bases of trapezoid ABCD are \overline{AB} and \overline{CD}. Let P be the intersection of diagonals \overline{AC} and
1. 4 answers
2. asked by Anonymous
3. 2,549 views
In the diagram, a building casts a 35-ft shadow and a flagpole casts an 8-ft shadow. If the flagpole is 18 ft tall, how tall is
1. 2 answers
2. asked by Okay
3. 2,282 views
A solution formed by dissolving an antacid tablet has a pH of 9.18. Calculate [H+].
1. 4 answers
2. asked by Anonymous
3. 2,118 views
Can you please check my work and help me with the parts that I don't understand?For each event, choose the most appropriate term
1. 3 answers
2. asked by Caroline
3. 2,073 views
For the formation of ammonia, the equilibrium constant is known to be 5.2 × 10^−5 at 25◦C. After analysis, it is determined
1. 2 answers
2. asked by Sara
3. 2,012 views
Three green balls and two yellow balls are placed in a hat. Two balls are randomly drawnwithout replacement. Let X be the number
1. 2 answers
2. asked by Naina
3. 2,009 views
if 20g of steam at 100 c is mixed into 80 g of water at 20 c what is the final temperature if no heat lost
1. 1 answer
2. asked by sara
3. 1,878 views
For which of the following would it be most appropriate to use an ANOVA to analyze the data?A. A researcher is interested in
1. 3 answers
2. asked by April
3. 1,851 views
A 1900 kg Oldsmobile traveling south on Abbott Road at 13.6 m/s is unable to stop on the ice covered intersection for a red
1. 2 answers
2. asked by JAY Z
3. 1,826 views
How many grams of coffee must evaporate from 350 g of coffee in a100-g glass cup to cool the coffee from 95.0ºC to 45.0ºC ?
1. 2 answers
2. asked by Mohanad
3. 1,825 views
Will you please check my work? :)Choose ALL (if any) applicable terms for the events described, then calculate the probability
1. 2 answers
2. asked by Caroline
3. 1,804 views
One mole of pentanol (C5H11OH) contains how many hydrogen (H) atoms?
1. 1 answer
2. asked by jay
3. 1,659 views
The Sneed Corporation issues 10,000 shares of $50 par value preferred stock for cash at $75 per share. The entry to record the
1. 2 answers
2. asked by zel
3. 1,632 views
A small cylinder of helium gas used for filling balloons has a volume of 2.85L and a pressure of 13300kPa at 25 ∘C.How many
1. 1 answer
2. asked by Tyler
3. 1,603 views
Tony is five years of age. He loves to dress up like the Lone Ranger and pretend to help people in need. According to Mead's
1. 1 answer
2. asked by Angela
3. 1,600 views
If 22.5 L of Oxygen reacted with excess hydrogen, how many liters of water vapor could be produced?
1. 3 answers
2. asked by Addy
3. 1,585 views
Can you please check my work?A city planning committee surveys 100 people waiting at a bus stop about the expansion of the
1. 4 answers
2. asked by Caroline
3. 1,572 views
Health issues due to being overweight affect all age groups. of children and adolescents 6-11 years of age,18.8% are found to be
1. 3 answers
2. asked by Mark
3. 1,364 views
How do I write an equivalent expression to the expression below (17x 93) / (17x 97)
1. 3 answers
2. asked by Pinks
3. 1,327 views
A coin is dropped from the Leaning Tower of Pisa. It starts from rest and falls freely. Neglecting air resistance, compute the
1. 1 answer
2. asked by amiel
3. 1,318 views
In a arcade game, the "monster" is the shaded sector of a circle of radius 3 cm, as shown in the figure. The missing piece (the
1. 1 answer
2. asked by PLEASE HELP
3. 1,294 views
Indigenous people sometimes cook in watertight baskets by placinghot rocks into water to bring it to a boil. What mass of 500ºC
1. 3 answers
2. asked by Mohanad
3. 1,267 views
As children, boys usually receive trucks, sporting equipment, and action toys. Girls receive stuffed animals and gifts that are
1. 1 answer
2. asked by Angela
3. 1,266 views
If you pour 0.0100 kg of 20.0ºC water onto a 1.20-kg block of ice(which is initially at −15.0ºC ), what is the final
1. 1 answer
2. asked by Mohanad
3. 1,265 views
SOLVE X/2+2Y/3=-1 AND X-Y/3=3USING SUBSTITUTION AND ELIMINATION METHOD
1. 1 answer
2. asked by ANOSHA
3. 1,248 views
a) Estimate the area under the graph of f(x)=7+4x^2 from x=-1 to x=2 using three rectangles and right endpoints.R3= ??? Then
1. 1 answer
2. asked by Anonymous
3. 1,162 views
write an equivalent expression to the expression below.(17*93)(17*97)
1. 7 answers
2. asked by Nicole
3. 1,143 views
Harry buys American cheese at the deli. He buys 1/4 pound at the cost of x dollars per pound. If he pays $12.25 for 2.5 pounds
1. 3 answers
2. asked by Sarah
3. 1,111 views
A 37.0 g mass of a metal was heated to 100°C and then plunged into 74 g of water at 24.0°C. The temperature of the resulting
1. 1 answer
2. asked by Kelsey
3. 1,100 views
After the accounts are adjusted and closed at the end of the fiscal year, Accounts Receivable has a balance of $673,400, and
1. 0 answers
2. asked by diane
3. 1,093 views
Gemeinschaft is to "intimate community" as Gesellschaft is to:A. the dawn of civilization. B. impersonal association. C.
1. 1 answer
2. asked by Angela
3. 1,070 views
A dielectric-filled parallel-plate capacitor has plate area A = 10.0cm2 , plate separation d = 7.00mm and dielectric constant k
1. 0 answers
2. asked by asasa
3. 1,067 views
The oil burner in a certain house is used to heat the house and to heat the hot water.During the seven cold months when the
1. 4 answers
2. asked by thomas
3. 1,055 views
When nitroglycerin (C3H5N3O9) explodes, it decomposes into the following gases: CO2, N2, NO, and H2O. If 239g of nitroglycerin
1. 2 answers
2. asked by Suzanne
3. 1,025 views
A 0.250-kg aluminum bowl holding 0.800 kg of soup at 25.0ºC isplaced in a freezer. What is the final temperature if 377 kJ of
1. 0 answers
2. asked by Mohanad
3. 988 views
Which statement best describes the difference between how Westerners and Easterners perceive the world and think about it?A.
1. 2 answers
2. asked by Angela
3. 988 views
Based on the Nielsen ratings, the local CBS affiliate claims its 11 p.m. newscast reaches 41% of the viewing audience in the
1. 1 answer
2. asked by Ryan
3. 960 views
In another study, the smoking habits of 34,445 male physicians were obtained by mailed questionnaires. Deaths among these
1. 0 answers
2. asked by Tracy
3. 922 views
A pond 100 feet in diameter is surrounded by a circular grass walk which is 2 feet wide .The number of square feet of grass on
1. 2 answers
2. asked by thomas
3. 881 views
list and discuss any four factors that could threaten or limit the core functionsof the media.
1. 22 answers
2. asked by samitan
3. 877 views
1)a number less than 35 is chosen.2)A prime number is chosen. 3) A multiple of 4 is chosen. 4)A perfect cube is chosen. Please
1. 1 answer
2. asked by Sasha
3. 856 views
The bases of trapezoid ABCD are \overline{AB} and \overline{CD}. Let P be the intersection of diagonals \overline{AC} and
1. 5 answers
2. asked by RhUaNg
3. 848 views
how many gram of ice at 0 c can be melted by the heat released when one gram of steam condense to water at 100 ccheck my answer
1. 3 answers
2. asked by Mohanad
3. 813 views
2H2(g) + S2(g) ¡ê 2H2S(g)Analysis of the contents of a 15.0L flask reveals that there are 4.4 moles of hydrogen gas, 2.0 moles
1. 18 answers
2. asked by HELP! PLZ
3. 809 views
In another study, the smoking habits of 34,445 male physicians were obtained by mailed questionnaires. Deaths among these
1. 0 answers
2. asked by Tracy
3. 778 views
A highway is made of concrete slabs that are 14.0 m long at 20° C.(a) If the temperature range at the location of the highway
1. 0 answers
2. asked by Steve
3. 748 views
Nene buys a bowling ball that weighs 10 pounds 13 ounces at a sporting goods store.What is the total weight of the bowling ball
1. 2 answers
2. asked by Pinks
3. 747 views
Sets A,B and C are subsets of U.U= positive integers less than 16 A= prime numbers B= factors of 36 C= multiples of 4 (A
1. 1 answer
2. asked by Anonymous
3. 736 views
A basketball scout randomly selected 144 players and timed how long each player took to perform a certain drill. The times in
1. 1 answer
2. asked by Mark
3. 736 views
An architecture provides a framework within which to identify, design, codeand test the components or subsystems required for
1. 0 answers
2. asked by Olumide Adesiyan
3. 732 views
Mary wants to find the area of a rectangle 1/6 by 5/6 .How many unit squares with side length 1/6 yard would mary be able to use
1. 4 answers
2. asked by Pinks
3. 732 views
1. A vibrating point on a spring travels 60 mm during three cycles. What is the amplitude of the vibration?my answer: I got 10
1. 0 answers
2. asked by Liz
3. 728 views
In "The Metamorphosis" Part 1, Gregor stated that if it wasn't for his parents' debt, he would have given his notice at work
1. 1 answer
2. asked by Isabella
3. 727 views
If upon retirement in 20 years Greg plans to invest 800,000 in a fund that earns 4 percent, What is the maximum annual
1. 1 answer
2. asked by Anonymous
3. 715 views
George Herbert Mead indicate a child must learn to take multiple roles in the __________ stage of development.A. sensorimotor B.
1. 2 answers
2. asked by Angela
3. 714 views
Martin rides to Cambridge 30 miles away from home at the average rate of 10 miles per hour.He returns on a better road that is
1. 1 answer
2. asked by thomas
3. 711 views
One survey by the American Medical Association showed that among 785 randomly selected people who completed four years of
1. 7 answers
2. asked by Allison
3. 700 views
Steve earned scores of 96 and 87 on his first two exams. What will his average grade be if he gets a 72 on his third exam?
1. 1 answer
2. asked by sha
3. 693 views
Sketch the graph (Do this on paper. Your teacher may ask you to turn in this graph.) and find the area of the region bounded
1. 2 answers
2. asked by Mia
3. 692 views
what is the balanced equation for ozone gas reacts with 2,3,4,5-tetramethylheptane, CH3-CH(CH3)-CH(CH3)-CH(CH3)-CH(CH3)-CH2-CH3
1. 0 answers
2. asked by Kasia
3. 685 views
AOD is a diameter of circle O. The coordinates of points A and D are (-11,-5)and (-3,-5)Find the area of circle O.a. 9 pi b. 16
1. 2 answers
2. asked by thomas
3. 680 views
What is the net ionic equations for:1. Arsenic(III) iodide + Sodium sulfide 2. Lead(II) nitrate + Ammonium oxalate 3. Magnesium
1. 1 answer
2. asked by Collin
3. 677 views
Two groups of climbers (team A and Team B) attempt to climb Mount everest using different routes. The probability of Team A
1. 1 answer
2. asked by Mark
3. 676 views
The gene encoding for body color in zombie flies is "X-linked". Gray bodies are the wild-type trait and blue bodies are caused
1. 1 answer
2. asked by Sarah
3. 675 views
what is the research problem discussed in the article: UNDER SURVEILLANCE: AN EMPIRICAL TEST OF THE EFFECTIVENESS AND
1. 5 answers
2. asked by jo
3. 672 views
Evidence of an increased risk of lung cancer associated with cigarette smoking was sought by Doll and Hill. In one study, 649
1. 0 answers
2. asked by Tracy
3. 669 views
***Sorry i forgot to add the actual questionThe Great Pyramid at Giza has a sqaure base with sides of length 230 meters and a
1. 1 answer
2. asked by PLEASE HELP
3. 658 views
A plane is flying at a height of 1000 feet. A passenger on the plane sees a tree and realizes the angle of depression to the top
1. 1 answer
2. asked by Caleb
3. 652 views
ok so the question is The Great Pyramid at Giza has a sqaure base with sides if length 230 meters and a height of 146.7 meters
1. 1 answer
2. asked by PLEASE HELP
3. 641 views
I know I posted this question already ,but I posted the wrong one....Sets A,B and C are subsets of U. U= positive integers less
1. 1 answer
2. asked by Anonymous
3. 640 views
Consider for every real number a the linear system of equations:{ x +( a + 1 )y + a^2 z = a^3 { ( 1 - a )x +( 1 - 2a )y = a^3 {
1. 2 answers
2. asked by Elissa
3. 638 views
A ammeter is to be constructed using a galvanometer that has a 2.00 mA full-scale deflection and internal resistance of 50.0
1. 1 answer
2. asked by Anonymous
3. 633 views
calculate the PH of a mixture containing 30 mL, 0.10M HC2H3O2? (Ka=1.8x10^-8 of HC2H3O2)
1. 3 answers
2. asked by Cris H.
3. 629 views
At the end of spring training a football coach discharged 1/5 of his squad and asked the remaining 32 boysw to report on Labor
1. 3 answers
2. asked by thomas
3. 628 views
What happened to the immigrants while they were at Ellis Island?
1. 1 answer
2. asked by kathy
3. 626 views
Given the following reaction:CaC2 + 2 H2O C2H2 + Ca(OH)2 How many moles of Ca(OH)2 will be produced if 5.800 g of CaC2 are
1. 0 answers
2. asked by jay
3. 623 views
If upon retirement in 20 years Greg plans to invest 800,000 in a fund that earns 4 percent, What is the maximum annual
1. 0 answers
2. asked by milton
3. 620 views
A cue ball collides with two other snooker balls and comes to a complete stop. Theangles between the centres at the point of
1. 0 answers
2. asked by Olumide Adesiyan
3. 618 views
how do you see the answers to these stupid questions on this stupid website??????
1. 1 answer
2. asked by Shonni
3. 615 views
At 25C, an equilibrium mixture of gases con- tains 0.00680 mol/L PCl3, 0.0290 mol/L Cl2, and 0.00500 mol/L PCl5.PCl5(g) ⇀ ↽
1. 2 answers
2. asked by Sara
3. 614 views
Punnett Square Help1) Set up a Di-hybrid cross for these two traits (pod color and shape) Note:Green pods are dominate over
1. 0 answers
2. asked by Sarah
3. 607 views
The average daily high temperature for the month of may in ocaia Florida is appromaimated by thee function. F(n)=0.2n+80. Where
1. 0 answers
2. asked by Anonymous
3. 602 views
__________ is credited with being the place where the Industrial Revolution began in 1765.A. The United States B. Great Britain
1. 1 answer
2. asked by Angela
3. 600 views
For this problem I drew a Venn diagram..Sets A,B and C are subsets of U. U= positive integers less than 16 A= prime numbers B=
1. 1 answer
2. asked by Anonymous
3. 598 views
estimate the mass of BaSO4 that will be produced when a 100ml of a 2M solution of Ba(NO3)2 in water is added toa 100ml of a 2M
1. 1 answer
2. asked by Alex
3. 598 views
A 12 cm by 12 cm ice cube tray is in the shape of a cuboid with twelve hemispheres inset. The depth of each hemispheres is 1 cm.
1. 0 answers
2. asked by Lucas
3. 594 views
train a moving at 30km/hr passes station at 08:00.A train B travelling the same way at 45km/hr passes this station at 08:30, at
1. 1 answer
2. asked by wan
3. 592 views
Provide examples of an application most suited for circuit switching and packet switching
1. 0 answers
2. asked by Olumide Adesiyan
3. 591 views
One survey by the American Medical Association showed that among 785 randomly selected people who completed four years of
1. 1 answer
2. asked by Parker
3. 590 views

Back to April 2014

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025