Archives
2013
November

Questions Asked on November 27, 2013

I am not sure how to calculate this on the calculator:1225000 = (1 - 6.53%) * amount raised
1. 1 answer
2. asked by Serenity1
3. 303 views
How did Enlightenment ideas challenge the authority of kings and emperors?
1. 1 answer
2. asked by Anonymous
3. 382 views
Control of the bureaucracy through legislative oversight is a matter of
1. 2 answers
2. asked by MDog
3. 481 views
Can you please show me the steps on how to write each decimal as a mixed number in simplest form?1. 8.9 2. 42.96
1. 5 answers
2. asked by Stephanie
3. 335 views
You are the buyer for The Shoe Outlet. You are looking for a line of men’s shoes to retail for $79.95. If your objective is a
1. 2 answers
2. asked by Jennifer
3. 454 views
The equilibrium constant Kp is 5.00×10^17 at 25◦C for the reaction C2H4(g) + H2(g)<->C2H6(g). From this information,
1. 1 answer
2. asked by Gabriella
3. 1,912 views
Analysis of a reaction mixture showed that it had the composition 0.43 mol/L N2, 0.541 mol/L H2, and 0.124 mol/L NH3 at 800 K,
1. 4 answers
2. asked by Gabriella
3. 1,178 views
Ms.Hernandez has 17 tomato plants that she wants to plant in rows.She will put 2 plants in some rows and 1 plant in the
1. 8 answers
2. asked by leisa
3. 4,457 views
In this problem you will use Rolle's theorem to determine whether it is possible for the functionf(x) = 8 x^{7} + 7 x - 13 to
1. 2 answers
2. asked by sheks
3. 1,838 views
The equilibrium constant for thermal dissociation of F2F2(g)<->2F(g) is 0.300. If initially 1.00 mol F2 is placed in a 1.00 L
1. 1 answer
2. asked by Gabriella
3. 1,204 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.The steak was
1. 1 answer
2. asked by Ben Dosley
3. 533 views
What are the individual orders of the reactants involved in the oxidation of methylene blue by ascorbic acid?Rate of reaction=
1. 0 answers
2. asked by Liam
3. 374 views
Wharton charges DEI spreads of 9 percent on new common stock issues, 7 percent on new preferred stock issues, and 5 percent on
1. 0 answers
2. asked by Serenity1
3. 465 views
The road grew wilder and 'drearier'.broader darker muddier older My guess is darker, but I have a feeling it is broader. Can
1. 9 answers
2. asked by Cassidy
3. 6,070 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the patio
1. 9 answers
2. asked by John Dosley
3. 633 views
Can someone please tell me where to find this: What was the "Era of Good Feeling" In Germany? All I can find is in the U.S but I
1. 0 answers
2. asked by Sue
3. 368 views
If I have two transition words, do I need commas for both of them?Example: Apparently now, they are friends. Do I need a comma
1. 1 answer
2. asked by Anonymous
3. 527 views
solve the equation:log base 10 of x - log base 10 of (7-4x)=2 Please help i have been stuck on this for awhile!
1. 4 answers
2. asked by Alison
3. 493 views
A chemist studying the equilibrium N2O4(g)<----->2NO2(g) controls the temperature so that keq ( equilibrium constant)= 0.028. At
1. 1 answer
2. asked by Anonymous
3. 1,005 views
(This is from Young Goodman Brown)What can be inferred about the companion's character in lines 8 and 9? "Faith kept me back
1. 16 answers
2. asked by Cassidy
3. 7,920 views
A small mass m swings in a horizontal circle of radius r at the end of a string of length Li andnegligible mass, which makes an
1. 1 answer
2. asked by Anonymous
3. 949 views
You have just graduated from the MBA program and to reward yourself you have decided to purchase a 2012 BMW 650 sports car. You
1. 1 answer
2. asked by Cally
3. 497 views
Vector V1 is 6N along the negative axis. Vector V2 is 4.5 N and point 45 degrees north of the x axis. Find the x and y
1. 1 answer
2. asked by Maddie
3. 430 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the women
1. 3 answers
2. asked by John Dosley
3. 571 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the private
1. 1 answer
2. asked by John Dosley
3. 528 views
A compact car, mass 755 kg, is moving at 1.00 ✕ 102 km/h toward the east. The driver of the compact car suddenly applies the
1. 1 answer
2. asked by Anonymous
3. 799 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the men
1. 3 answers
2. asked by Ben Dosley
3. 713 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.during times
1. 3 answers
2. asked by Ben Dosley
3. 504 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the men
1. 1 answer
2. asked by Bob Backman
3. 595 views
A flagpole has a height of 10 yards. It will be supported by three cables, each of which is attached to the flagpole at a point
1. 1 answer
2. asked by Betty
3. 812 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.during times
1. 3 answers
2. asked by Anonymous
3. 522 views
What role did Paul Revere play in the Boston Tea Party?
1. 1 answer
2. asked by Anonymous
3. 445 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the surgeon
1. 4 answers
2. asked by Anonymous
3. 555 views
The value of 4C2 is______________.
1. 3 answers
2. asked by Anonymous
3. 563 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the court was
1. 5 answers
2. asked by John Dosley
3. 701 views
one word in each sentence does not fit the context. Underline that word and write a word that does fit the context.the
1. 5 answers
2. asked by John Dosley
3. 665 views
one word in each sentence does not fit the context. underline that word and write a word that does fit in the blank providedthe
1. 6 answers
2. asked by John Dosley
3. 616 views
one word in each sentence does not fit the context. underline that word and write a word that does fit in the blank providedthe
1. 6 answers
2. asked by John Dosley
3. 511 views
A rocket is launch from the top of an 40 foot cliff with an initial velocity of 140 feet per second, the height h of the rocket
1. 1 answer
2. asked by Wes
3. 2,096 views
A standard solution is prepared for the analysis of fluoxymesterone (C20H29FO3), an anabolic steroid. A stock solution is first
1. 1 answer
2. asked by quincy
3. 709 views
Name these:a) CH2=CH-CH=CH2 b) CH3-CH=CH-C(TRIPLE BOND)CH c) CH3-CH2-CH2-CH(Cl)-CH(Br)-CH3
1. 1 answer
2. asked by michelle
3. 910 views
Could someone please help me with the following q's I'm having some trouble:1.) cot θ (theta) = 0.791, find sec θ and tan θ
1. 2 answers
2. asked by Kevin
3. 430 views
In April, 935 people went to the top of the Sears Tower in Chicago. In may, 1,027 people went to the top . How many more people
1. 1 answer
2. asked by Joi
3. 412 views
Multiply 6,7, and 81/A touchdown in football is worth 6 points. How many points are 9 points worth? Answer,, 6*9=54 2/Dante
1. 1 answer
2. asked by Nawaf
3. 449 views
An object weighing 90 N has a volume of 45 mL and a mass of 9.0 g. What is its density?A. 0.10 g/mL B. 0.20 g/mL C. 5.0 g/mL d.
1. 16 answers
2. asked by Help Scienee
3. 2,950 views
Write the words in alphabetical order between the guide words.(Leap,lean , layer, less, lady) Answer,, Lady ,layer, lean , leap
1. 3 answers
2. asked by Nawaf
3. 856 views
An elastic cord vibrates with a frequency of 3.5Hz when a mass of 0.62kg is hung from it.What is its frequency if only 0.40kg
1. 0 answers
2. asked by Daniela
3. 628 views
An object with mass 2.0kg is attached to a spring with spring stiffness constant 240N/m and is executing simple harmonic motion.
1. 1 answer
2. asked by Dani
3. 640 views
A load cell consists of a solid cylinder of steel 40 mm diameter with four strain gauges bondedto it and connected into the four
1. 1 answer
2. asked by Sarsi
3. 1,160 views
A violin string vibrates at 298 Hz when unfingered. At what frequency will it vibrate if it is fingered one sixth of the way
1. 1 answer
2. asked by Dani
3. 980 views
1. Find the altitude of an isocles triangle having base 184.2 cm if the angle opposite the base is 68deg 44'2. A 13.5m fire
1. 1 answer
2. asked by McKenna Louise
3. 1,364 views
1. Given that points S and R on opposite sides of a lake, triangle SRT is formed. To find the distance RS across the lake, a
1. 1 answer
2. asked by McKenna Louise
3. 823 views
Black hole in X-Ray Binary.An X-ray binary consists of 2 stars with masses (the accreting compact object) and (the donor). The
1. 2 answers
2. asked by Greco
3. 542 views
When molecules of water vapor in the air come into contact with a cold can of soft drink, they lose energy, slow down, and form
1. 7 answers
2. asked by S.O.S Ms. Sue
3. 3,131 views
A statistics professor plans her classes so carefully that the lengths of her class are uniformly distributed between 46.0 and
1. 1 answer
2. asked by Jamie
3. 788 views
caco3 + kno3 =0.301gresalt soild 0.197g co2:o2 ?
1. 0 answers
2. asked by sangeetha
3. 333 views
6. Explain how you would prepare this solution from powdered reagents and whatever glassware you needed: 3.0 L of 1.3 M NaOH
1. 0 answers
2. asked by Gregory
3. 442 views
S=Integral xdx/sqrt(x-1). I have proceeded thus-Put sqrt(x-1)=u then x=u^2+1 and dx/sqrt(x-1)=2du. S=(u^2+1)2du/u
1. 1 answer
2. asked by MS
3. 398 views
If a varies inversely as b, and b is increased by 50%, what is the percentage of change in a?
1. 1 answer
2. asked by McKenna Louise
3. 539 views
How many moles in 0.7g of SO2 ..and how would you do this! Thanks
1. 1 answer
2. asked by Laura
3. 372 views
What is 0.7g of SO2 ..and how would you do this equation? Thanks,
1. 1 answer
2. asked by Laura
3. 295 views
1. Ann commanded/ordered that he (should) go there.2. Ann suggested/proposed that he should join the club. 3. Ann insisted that
1. 1 answer
2. asked by rfvv
3. 586 views
the term universal in the canda health act means thata.all canadiands must pay into the system b.all residents of a given
1. 1 answer
2. asked by susue
3. 724 views
the view that a patient is an independent actor is known asa.social justice b.autonomy c.the subject standard d.the objective
1. 2 answers
2. asked by susue
3. 882 views
a new technology that will change the role of the transcriptionist isa.speech recognition b.desktop transcription systems
1. 1 answer
2. asked by susue
3. 690 views
Posted by rfvv on Tuesday, November 26, 2013 at 6:56am.a statement about what will happen in the future (What is the part of
1. 1 answer
2. asked by rfvv
3. 772 views
Look at the pattern that follows. Which expression represents this pattern algebraically?8, 17, 26, 35, 44, …
1. 2 answers
2. asked by mark
3. 794 views
the ratio of the number of desktop computers sold to the number of laptops sold by a dealer is 5 to 9 if 20 desktop computers
1. 2 answers
2. asked by John Dosley
3. 917 views
what physical components do the sun and earth have in common ?a) core and mantle b) core and atmosphere c) crust and atmosphere
1. 4 answers
2. asked by victoria
3. 1,119 views
what outer planet is known for having visible clouds in its atmosphere ?a)Uranus b)Neptune c)Saturn d)Jupiter
1. 1 answer
2. asked by victoria
3. 444 views
What would 64x6^4 equal in simplest form?
1. 2 answers
2. asked by Nicole
3. 341 views
A man invested $15,000. Part of the investment was put into an account that gave 7%, and part in an account that paid 6.5%. The
1. 1 answer
2. asked by Paul
3. 484 views
A company ships computer components in boxes that contain 20 items. Assume that the probability of a defective computer
1. 2 answers
2. asked by GIBSON
3. 2,845 views
how do I make a presentation?
1. 1 answer
2. asked by Ronald
3. 369 views
How do I show a presentation on Unipolar and Bipolar Depression?
1. 1 answer
2. asked by Ronald
3. 444 views
18x-6=13x+9
1. 1 answer
2. asked by Anonymous
3. 426 views
Could you help me answer these questions using William Cullen Bryant's poem, "The Prairies?" Thank you so much! I've attached a
1. 1 answer
2. asked by Bob
3. 1,081 views
How Does Public Capital Affect a Nations Curve?
1. 1 answer
2. asked by Whosay
3. 631 views
10.a)Solve the inequality x^3-5x^2+2x+8<0 byi) using intervals ii) considering all cases I did this but my teacher said that
1. 2 answers
2. asked by kavi
3. 755 views
The third set of differences of a function is constant and negative. Identify the type of function, its domain, range and key
1. 1 answer
2. asked by Miss K
3. 460 views
How many compounds are in potassium sulfide (K2S)?
1. 0 answers
2. asked by Talha
3. 410 views
Do metalloids have a complete outermost shell?
1. 0 answers
2. asked by Talha
3. 315 views
a) Complete the chart below to compare y=-3(x+4)^2-2 to y=a[k(x-d)]n +c.b) Describe the effects of a, k, d and c on the original
1. 1 answer
2. asked by Miss K
3. 620 views
Consider the function f(x)= 3------. x^2-25 a) Determine any restrictions on x. b) State the domain and range. c) State
1. 1 answer
2. asked by karthi
3. 692 views
in which sentence is the underlined infinitive or infinitive phrase function as a direct object?c. After all that exercise, the
1. 3 answers
2. asked by Ke$ha
3. 876 views
4x-3y=5Solve { 5y+7=3x using the method of elimination.
1. 2 answers
2. asked by Jeff
3. 535 views
5. Read the following passage from “The Snake Chief”:Now in that part of Africa it was unheard of for a bride to go to her
1. 1 answer
2. asked by Anonymous
3. 624 views
What does diverge mean in the following sentence?After traveling approximately 3.5 miles, the old highway will diverge. Stay in
1. 3 answers
2. asked by Anonymous
3. 664 views
Describe these words using only Three
1. 1 answer
2. asked by Kina
3. 476 views
Identify simple subject and simple predicate in each1 The elderly patient's deep venous thrombosis was treated with Coumadin. 2
1. 1 answer
2. asked by Fran
3. 809 views
Which of the following is greater than 0.366? Put 0.367, 36.5%, and nine over twenty-five in order from least to greatest.
1. 4 answers
2. asked by Miley23
3. 2,631 views
A metal meter stick made of steel rotates about its midpoint. The angular speed is slowly increased. At what value of the
1. 3 answers
2. asked by Anonymous
3. 484 views
A stick of length l = 65.0 cm rests against a wall. The coefficient of static friction between stick and the wall and between
1. 1 answer
2. asked by Anonymous
3. 617 views
Three smooth balls of iron of mass m and radius R are placed inside a tube of diameter 3R (see Figure). Find the magnitude of
1. 5 answers
2. asked by Anonymous
3. 414 views
A long rod hangs straight down from one end. How long (in meters) can the rod be before its weight causes it to break off at the
1. 1 answer
2. asked by Anonymous
3. 473 views
calculate:V = 227000 * 1090 + 8500000 * 70.70 + 447000 * 80.70 = ?
1. 2 answers
2. asked by Serenity1
3. 348 views
1. “An individual who breaks a law that conscience tells him is unjust, and who willingly accepts the penalty of imprisonment
1. 3 answers
2. asked by mary ann
3. 2,085 views
I need help solving these:A) 8500000 * 70.70 / 884452900 B) 447000 * 80.70 / 884452900 C) 227000 * 1090 / 884452900
1. 1 answer
2. asked by Serenity1
3. 328 views
a person standing 100ft. from the base of the tree looks up to the top of the tree with an angle of elevation of 52. assuming
1. 2 answers
2. asked by maria
3. 2,574 views
If the bill is 26.14 and there is a 3% discount what is the answer after 6% sales tax is added?
1. 1 answer
2. asked by coder5
3. 353 views

Back to November 2013

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024