Archives
2013
March

Questions Asked on March 13, 2013

1) Find the surface area for a sphere with a radius of 10 feet. Round to the nearest whole number.a. 1,256 ft2 b. 4,189 ft2 c.
1. 63 answers
2. asked by Alexa
3. 33,850 views
1. What is the simplified form of squared root 140?A.) 4 to the square root of 35 B.) 10 to the square root of 14 C.) 2 to the
1. 45 answers
2. asked by Jim
3. 22,594 views
What are the mean, variance, and standard deviation of these values? Round to the nearest 10th.92, 97, 53, 90, 95, 98
1. 13 answers
2. asked by Lea
3. 10,910 views
Which expression would you use to figure out the number of ways you can arrange the letters in the word equation? (1 point)8!
1. 42 answers
2. asked by Student
3. 9,791 views
Which radical expression is in simplified form?a.11y/sq rt 3 b.sq rt 6/5y c. sq rt 17/sq rt 4 d.sq rt 25/81 I think it might be
1. 11 answers
2. asked by Cassie
3. 9,132 views
What is the simplified form of square root 48n^9?I think the answer is: 3n square root 4n^8. Thank You
1. 37 answers
2. asked by Jim
3. 7,653 views
volume of cone varies jointly as square of its radius and its height if volume of a cone is 27pie cubic inches when radius is 3
1. 1 answer
2. asked by leslie
3. 6,135 views
Can you help me with the ten words to fill in each blank on Improving Vocabulary Skills Chapter 13, 14, 15, 16, 17 for the Final
1. 15 answers
2. asked by Divine0324
3. 5,925 views
A sample of nitrogen containing 1.5x10^23 molecules has the same number of molecules as a sample containingA. 1.0 mole of H2 B.
1. 2 answers
2. asked by Brandi
3. 4,488 views
The forensic technician at a crime scene has just prepared a luminol stock solution by adding 15.0g of luminol into a total
1. 3 answers
2. asked by Chris
3. 4,214 views
Sam ate 1/4 of the pizza. If the pizza has 8 slices, how many slices are left?
1. 4 answers
2. asked by Kim
3. 3,866 views
Given f(x) = x^4 + 6x^3 - 15x + 7, evaluate \displaystyle \lim_{h \to 0} \frac{f(1+h) - f(1-h)}{h}.
1. 1 answer
2. asked by John
3. 3,375 views
An aluminum ring of radius 5.00 cm and resistance 2.00 10-4 Ω is placed around the top of a long air-core solenoid with 997
1. 1 answer
2. asked by Kyle
3. 3,324 views
What is the momentum of a 1.5 × 103 kilogram van that is moving at a velocity of 32 meters/second?A. 46.9 kilogram
1. 2 answers
2. asked by fredrick
3. 2,839 views
In an atom, electrons ____.a.are located in the nucleus b.are paired with neutrons c. travel outside the nucleus d. are always
1. 5 answers
2. asked by Gia
3. 2,677 views
Which radical expression is in simplified form?A.) 11y/3 square root *B.) square root of 6/5y C.) square root of 17/square root
1. 5 answers
2. asked by Jim
3. 2,505 views
A gardener is mowing a 20 by 40 yard rectangular pasture using a diagonal pattern. He mows from one corner of the pasture to the
1. 10 answers
2. asked by Cassie
3. 2,440 views
A student who is performing this experiment pours an 8.50mL sample of saturated borax solution into a 10mL graduated cylinder
1. 3 answers
2. asked by ConfusedStudent
3. 2,352 views
rewrite the following sentences :Marco polo made many discoveries.The discoveries were amazing. Begin with:Marco polo...........
1. 2 answers
2. asked by ramesh reddy
3. 2,243 views
Given: segment BD bisects angle ABC; AB=BC. Prove: triangle ABD congruent to triangle CBD
1. 1 answer
2. asked by Constance
3. 2,242 views
how does the water cycle ensure that we have water.
1. 6 answers
2. asked by nyamka
3. 2,178 views
A mass spectrometer is used to examine the isotopes of uranium. Ions emerge from the velocity selector at a speed of 3.00 x 10^5
1. 1 answer
2. asked by John
3. 2,121 views
Consider a solution that contains both C6H5NH2 and C6H5NH3+. Calculate the ratio [C6H5NH2]/[C6H5NH3+] if the solution has the
1. 1 answer
2. asked by Margaret
3. 2,088 views
N2 + 3H2 --> 2NH3how many grams of ammonia is produced in the reaction?
1. 3 answers
2. asked by Christie
3. 2,025 views
I have the sentence...When I get home from school,I'm going to take a nap.I am supposed to underline the subjects and verbs. I
1. 2 answers
2. asked by Brandi
3. 2,020 views
ou are given the following data.S(s) + 3/2 O2(g) → SO3(g) ΔH = -395.2 kJ 2 SO2(g) + O2(g) → 2 SO3(g) ΔH = -198.2 kJ
1. 1 answer
2. asked by Jen
3. 2,020 views
Before a collision, the x-momentum of an object is 8.0 × 103 kilogram meters/second, and its y-momentum is 1.2 × 104 kilogram
1. 1 answer
2. asked by fredrick
3. 1,928 views
1) Nova, whose mass is 50.0 kg, stays out skiing for too long and her body temperature drops by 2.00 degree celsius . What is
1. 1 answer
2. asked by Isis
3. 1,794 views
Direct mail advertisers send solicitations (a.k.a. "junk mail") to thousands of potential customers in the hope that some will
1. 1 answer
2. asked by MeSue
3. 1,755 views
Newton's first law of motion states that an object remains at rest unless a ___force acts on it.A.balanced B.frictional
1. 3 answers
2. asked by Cassie
3. 1,736 views
A 22 μF capacitor and a 5.20 mH inductor are connected in series with an open switch. The capacitor is initially charged to
1. 2 answers
2. asked by Anonymous
3. 1,718 views
What difference is there between the downward velocities of the skydiver who jumped out of the helicopter (with no forward
1. 1 answer
2. asked by cianaa
3. 1,697 views
cos è = 0.9659 A = ? H = 20
1. 1 answer
2. asked by ben
3. 1,656 views
1. A force of 720 N stretches a certain spring a distance of 15 cm. What is its force constant? If a 60-kg mass is hang on it,
1. 1 answer
2. asked by 4a
3. 1,619 views
if 150 grams of water is heated from 20 degrees C to 30 degrees C, the number of joules of heat energy aborbed is?
1. 2 answers
2. asked by Anonymous
3. 1,611 views
A ball with a mass of 0.50 kilograms is moving at a speed of 1.8 meters/second along the positive x-axis. It collides with
1. 1 answer
2. asked by fredrick
3. 1,594 views
The length of a rectangle is 5cm more than twice the width. The perimeter of the rectangle is 34 cm. Find the dimensions of the
1. 4 answers
2. asked by steph
3. 1,548 views
what is the simplified form of3sq rt 5c * sq rt 15c^3? A.15c^2 sq rt 3 B.6c^2 sq rt 5 c.5c^2 sq rt 3 d.12c^4sq rt 5 I think it
1. 1 answer
2. asked by Cassie
3. 1,514 views
Mason lifts a box off the ground and places it in a car that is 0.50 meters high. If he applies a force of 8.0 newtons to lift
1. 1 answer
2. asked by fredrick
3. 1,468 views
Susan keeps track of the number of tickets sold for each play presented at the community theater. Within how many standard
1. 2 answers
2. asked by Lea
3. 1,421 views
Review Conceptual Example 2 as an aid in understanding this problem. A velocity selector has an electric field of magnitude 2607
1. 1 answer
2. asked by picm
3. 1,404 views
A certain coaxial cable consists of a copper wire, radius a , surrounded by a concentric copper tube of inner radius c . The
1. 1 answer
2. asked by P
3. 1,354 views
onvert the following to scientific notation:(i) the distance to the sun, 149 500 000 000 m (ii) the wavelength of yellow sodium
1. 1 answer
2. asked by Kate
3. 1,353 views
How do I factor out the greatest common monomial factor?1) 9m^7 - 3m^2 2) 12a^5 + 8a 3) I need to describe and correct the error
1. 1 answer
2. asked by Scott
3. 1,346 views
An observer on top of a building 66 metres high,finds the angle of elevation to the top of a taller building to be 34
1. 3 answers
2. asked by Shane
3. 1,344 views
Lisa needs to empty 18 gallons of water from a tub into jugs that hold 0.5 gallons of water - how many jugs does Lisa need
1. 1 answer
2. asked by Slim
3. 1,307 views
The cost C in dollars of producing n yearbooks is represented by the equationC=1000+5n How much would it cost to produce 75n
1. 3 answers
2. asked by Emily
3. 1,288 views
1) Find the surface area for a sphere with a radius of 10 feet. Round to the nearest whole number.a. 1,256 ft2 b. 4,189 ft2 c.
1. 8 answers
2. asked by Destiny
3. 1,275 views
For numbers 1–3, find the indicated measurement of the figure described. Use 3.14 for (pi) and round to the nearest whole
1. 4 answers
2. asked by Selena
3. 1,270 views
Stacy has a spinner (1-4) and a number cube (1-6). After spinning and rolling the number cube, she will add the two numbers.What
1. 1 answer
2. asked by Cassidy
3. 1,270 views
You launch a model rocket up into the sky. Right after launch the rocket is accelerating upwards at 10~m/s^2. What is the
1. 1 answer
2. asked by John
3. 1,259 views
ABC is a non-degenerate triangle such that 2\sin \angle B \cdot \cos \angle C + \sin \angle C = \sin \angle A + \sin \angle B,
1. 0 answers
2. asked by John
3. 1,218 views
The line “Where water is not thirsty” is an example of which type of figurative language? (1 point)a. symbol b. metaphor c.
1. 1 answer
2. asked by Gia
3. 1,170 views
H3BO3 -> H+ + H2BO3-Why doesn't H3BO3 break down to something with H3O+ because it is a weak acid? I know many weak acids break
1. 1 answer
2. asked by Anon
3. 1,170 views
A ball is dropped from a height of 20m. When it bounces, it rebounds with a speed that is one half of the speed at which it hits
1. 2 answers
2. asked by Kit
3. 1,162 views
Use intermediate value theorem to show there is a root to 2x^3 + x^2 - 2 = 0 on [0,1]
1. 1 answer
2. asked by Kyle
3. 1,155 views
how many ways can you line up 11 people for a picture?
1. 0 answers
2. asked by Regina
3. 1,149 views
Problem 2Build-Rite construction has received favorable publicity from guest appearances on a public TV home improvement
1. 1 answer
2. asked by Anonymous
3. 1,140 views
The length of a rectangle is 5 ft greater than 4 times its width. The area is 369 sq ft . What is the length?
1. 1 answer
2. asked by Joana
3. 1,129 views
Three parallel plate capacitors (C1,C2 and C3 ) are in series with a battery of 100 V. C1=2500 micro Farad; C2=2C1 , C3=3C1 .(a)
1. 2 answers
2. asked by P
3. 1,097 views
An oil-drilling company knows that it costs $25,000 to sink a test well. If oil is hit, the income for the drilling company will
1. 1 answer
2. asked by luis
3. 1,093 views
2AgNO3 + BaCl2 --> 2AgCl + Ba(NO3)2How many grams of sliver chloride are produced from 5.0g of sliver nitrate reacting with an
1. 2 answers
2. asked by Christie
3. 1,093 views
1. Which of the following is a specific goal?A. I will pass as many of my courses as possible. B. I will finish my college
1. 1 answer
2. asked by Amy
3. 1,091 views
raven found 30 coins. 1/6 of them were pennies, 1/5 of them weere nickels, 1/3 of them were dimes, and the rest were quarters.
1. 2 answers
2. asked by Taylor Shelly
3. 1,081 views
what, according to the Basic condition of employment Act applies with regard to the contraventions that you've identified?
1. 1 answer
2. asked by Gladness
3. 1,080 views
Consider the Linear demand function Q = 20 - 0.5Pc- Using calculus, find the level of output, Qrmax, where total revenue reaches
1. 2 answers
2. asked by alejandro guzman
3. 1,068 views
If two objects weighing 5 kg and 7 kg are dropped from a height of 64 m and 36 m, respectively. What will be the ratio of times
1. 1 answer
2. asked by Samuel
3. 1,068 views
A ball is dropped from a height of 20m. When it bounces, it rebounds with a speed that is one half of the speed at which it hits
1. 0 answers
2. asked by Sam
3. 1,060 views
2H2O --> 2H2 + O2if 30 mL of hydrogen in the above reaction, how many milliliters of oxygen are produced?
1. 1 answer
2. asked by Christie
3. 1,045 views
Dimensions of a Box A box is made from a rectangular piece of metal with length 50 inches and width 40 inches by cutting out
1. 1 answer
2. asked by Shay
3. 1,040 views
Calculate activities of Ca2+ and F- and the solubility of fluorite (CaF2) in pure water at 25C without regard to possible
1. 2 answers
2. asked by Ren
3. 1,040 views
A man jumps from a great height and falls freely to the Earth. Another man jumps from the same height 1 s later. How much are
1. 3 answers
2. asked by Samuel
3. 1,039 views
Let \phi(n) be the Euler Phi Function. If 1 \leq n \leq 1000, what is the smallest integer value of n that minimizes
1. 1 answer
2. asked by John
3. 1,017 views
Which test should be used one samples t test, independent samples t test or dependent samples t test. What do you set the
1. 4 answers
2. asked by Anonymous
3. 1,013 views
A force is applied to a door at an angle of 56.8° and 0.34 m from the hinge.a) What force produces a torque with a magnitude of
1. 1 answer
2. asked by Mike
3. 1,012 views
Art to inspire hope is called A.spiritual art.B.watercolor art. C.celebration art. D.western art. I can't decide between A and
1. 3 answers
2. asked by Cassie
3. 1,006 views
I need to ask some opinion about this question.determine whether the description refers to solo proprietorship, partnership or
1. 0 answers
2. asked by ifi
3. 1,006 views
I split this sentence into 2 parts is the colon use correct between football and There's?I love college football: There’s
1. 2 answers
2. asked by Bernie
3. 1,003 views
A sample of nitrogen containing 1.5x10^23 molecules has the same number of molecules as a sample containingA. 1.0 mole of H2 B.
1. 3 answers
2. asked by Brandi
3. 993 views
In distinct odd-town, the inhabitants want to number their houses with 3-digit positive integers that are odd, which have all
1. 1 answer
2. asked by John
3. 980 views
A boy walked for 4 hours and cycled for 3 hours,covering a total distance of 74 kilometers,later he walked for 2 hours and
1. 1 answer
2. asked by 007
3. 973 views
Displacement is given by x=2+3t+4t². Find the value of instantaneous acceleration.
1. 1 answer
2. asked by Samuel
3. 962 views
What volumes of 0.47 M HF and 0.47 M NaF must be mixed to prepare 1.00 L of a solution buffered at pH = 3.50?HF NaF
1. 0 answers
2. asked by Margaret
3. 959 views
4x-y-3z=82x+2y-z=3 6x+y-3z=2 help me solve matrices
1. 1 answer
2. asked by jenny
3. 952 views
in a triangle, the measure of the first angle is twice the measure of the second.the measure of a third triangle is 64 degrees
1. 1 answer
2. asked by brittany
3. 899 views
A toroidal solenoid has a mean radius of 8.00cm and a cross-sectional area of 4.80cm^2 and is wound uniformly with 90.0 turns. A
1. 1 answer
2. asked by Anonymous
3. 897 views
The most important reason why teachers and teacher aides should be strong leaders in the classroom is because ita)helps students
1. 3 answers
2. asked by Cyndi
3. 896 views
Consider the titration of 100.0 mL of 0.260 M propanoic acid (Ka = 1.310−5) with 0.130 M KOH. Calculate the pH of the
1. 0 answers
2. asked by Margaret
3. 891 views
The micelle and the liposome are two structures formed by phospholipids in an aqueous environment. They are represented here in
1. 0 answers
2. asked by selly
3. 889 views
Suppose the minimum wage is above the equilibrium wage in the market for unskilled labour. Using a demand and supply diagram of
1. 0 answers
2. asked by ann
3. 887 views
An electric force moves a charge of +1.85 10-4 C from point A to point B and performs 6.70 10-3 J of work on the charge.(a) What
1. 1 answer
2. asked by Anonymous
3. 866 views
An insurance company is offering a new policy to its customers. Typically, the policy is bought by a parent or grandparent for a
1. 0 answers
2. asked by Anonymous
3. 864 views
A capacitor consists of two concentric spherical shells. The outer radius of the inner shell is a=0.43 mm and the inner radius
1. 1 answer
2. asked by P
3. 864 views
Problem 1Adele Weiss manages the campus flower shop. Flowers must be ordered three days in advance from her supplier in Mexico.
1. 0 answers
2. asked by Anonymous
3. 856 views
Homework Help: EnglishPosted by rfvv on Tuesday, March 12, 2013 at 6:29pm. Posted by rfvv on Tuesday, March 12, 2013 at 5:35pm.
1. 1 answer
2. asked by rfvv
3. 850 views
A rod made from a particular alloy is heated from 22.0°C to the boiling point of water. Its length increases by 8.15 10-4m. The
1. 1 answer
2. asked by Anna
3. 846 views
The value of(secpi/7)+(sec3pi/7)+(sec5pi/7) is
1. 1 answer
2. asked by anoynomous
3. 829 views
A manufacturer produces bolts of fabric with a fixed width. The quantity q of this fabric (measured in yards) that is sold is a
1. 0 answers
2. asked by Travis
3. 829 views
Use activity coefficients to find the concentration of hydrogen ions in a solution of 65.0 mM butanoic acid and 0.01 M NaCl. The
1. 1 answer
2. asked by Jessica
3. 816 views
Let S = \{ 1, 2, 3, \ldots 12\} and T_1, T_2, \ldots T_a be subsets of S such that T_i \not \subset T_j \, \forall i \neq j .
1. 0 answers
2. asked by John
3. 810 views

Back to March 2013

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025