Archives
2013
February

Questions Asked on February 17, 2013

Verify the identity algebraically.TAN X + COT Y/TAN X COT Y= TAN Y + COT X
1. 1 answer
2. asked by AwesomeGuy
3. 5,311 views
during a triathlon, Sharon swims 1/4 of the total route and cycles 3/5 of the remaining route. she runs the rest of the route.
1. 3 answers
2. asked by Shohanur
3. 4,461 views
An airline reports that if has been experiencing a 15% rate of no-shows on advanced reservations. Among 150 advanced
1. 1 answer
2. asked by Karen
3. 4,374 views
A recent survey found that 70% of all adults over 50 wear glasses for driving. You randomly select 30 adults over 50, and ask if
1. 1 answer
2. asked by Karen
3. 4,029 views
A tire 0.500 m in radius rotates at a constant rate of 200 rev/min. Find the speed and acceleration of a small stone lodged in
1. 3 answers
2. asked by Sammie
3. 4,012 views
In a group of 100 people 40 own a cat, 25 own a dog and 15 own a cat and a dog.Find the probability that a person selected at
1. 1 answer
2. asked by sabir
3. 3,572 views
Y varies direct proportion with x.if x=5 then y=12,thus find the value of y when x=7.5
1. 8 answers
2. asked by Maths.department
3. 3,105 views
A science student is riding on a flatcar of a train travelling along a straight horizontal track at a constant speed of 10.0
1. 3 answers
2. asked by Sammie
3. 2,745 views
State the quadrant in which θ lies.1.) CSC θ is greater than 0 and TAN θ is less than 0. 2.) SEC θ is greater than 0 and SIN
1. 1 answer
2. asked by AwesomeGuy
3. 2,421 views
Read the following poem and answer questions that follow:Life, death,-death, life; the words have lead for ages Our thought and
1. 3 answers
2. asked by Gazala
3. 2,388 views
At time t=0,a 1kg ball is thrown up from the top of a tall tower with velocity Vo=18i+24j(m/s).a:calculate the components of th
1. 3 answers
2. asked by Bessy
3. 2,330 views
. Four identical metal spheres have charges of qA = –8.0 µC, qB =–2.0 µC, qC = +5.0µ C, and qD = +12.0µ C.(a) Two of the
1. 1 answer
2. asked by Saif
3. 2,300 views
solve the simultaneous equations;log x base 2-log y base 4=4, log (x-2y)base 2=5
1. 2 answers
2. asked by jessica
3. 1,917 views
A 10.0 kg cart and a 15 kg cart are locked together with a compressed spring between them. They are then released so that the
1. 1 answer
2. asked by joseph
3. 1,887 views
A sphere with radius 3 is inscribed in a conical frustum of slant height 10. (The sphere is tangent to both bases and the side
1. 4 answers
2. asked by Knights
3. 1,871 views
1) A chemistry teacher requires 250 milligrams of a chemical for an experiment. He has 30 grams of the chemical. How many times
1. 3 answers
2. asked by paper
3. 1,867 views
Cyclopropane rearranges to form propene:CH2CH2CH2 --> CH2=CHCH3 by first-order kinetics. The rate constant is k = 2.74 x 10-3
1. 1 answer
2. asked by Marcus
3. 1,808 views
At equilibrium, the concentrations in this system were found to be [N2]=[O2]=0.100 M and [NO]=0.400 M.N2 (g) + O2 (g) --> 2NO
1. 2 answers
2. asked by Jefferson
3. 1,780 views
H2S(aq) + NiSO4(aq) →
1. 1 answer
2. asked by Anonymous
3. 1,647 views
A rowboat passenger uses an oar to push the boat off the dock by exerting a force of 40.0 N for 3.0 s. What impulse acts on the
1. 2 answers
2. asked by Chad
3. 1,626 views
Integrate ( x^2cosx)/(1+sinx)^2 dxwith limits from 0 to pi/4
1. 2 answers
2. asked by Anonymous
3. 1,612 views
a rectangular garden 9ft by 12 ft includes a uniform border of wood chips around a rectangular bed of flowers. If flowers take
1. 2 answers
2. asked by SEAN
3. 1,562 views
Is this right?:Energy is absorbed in order to break bonds because bond breaking requires energy. Or are these two statements
1. 7 answers
2. asked by a Canadian
3. 1,390 views
Natalie earns $2.50 for each CD she sells and $3.50 for each DVD she sells. Natalie sold 45 DVDs last year. She earned a total
1. 1 answer
2. asked by Sylvie
3. 1,368 views
AS Leo explained a failed business deal that had once_____e(d) him,he______(e)d into the even more interesting tale of his
1. 8 answers
2. asked by sam
3. 1,349 views
25ml of a solution of na2c03 having a sepcific gravity of 1.25g solution of hcl containing 109.5g of the acid per litre for
1. 2 answers
2. asked by Fai
3. 1,297 views
a hiker walk due east at 4km per hour and a second hiker starting from the same point walks 55 degree north-east at the rate of
1. 1 answer
2. asked by annny
3. 1,291 views
What volume of a 0.22mol/L hydrochloric acid solution is needed to cause the pH of 25.00mL of a 0.15mol/L lithium hydroxide
1. 1 answer
2. asked by Amy
3. 1,286 views
Lauryl alcohol is obtained from coconut oil and is used to make detergents. A solution of 5.00 g of lauryl alcohol in 100.0 g of
1. 1 answer
2. asked by m
3. 1,251 views
a) A tennis racket a 450 N force on a 0.05 kg tennis ball over a 0.006 s time period. What is the impulse applied to the ball?b)
1. 1 answer
2. asked by Isis
3. 1,248 views
Why does the current not flow to the gyre's center but instead flows in a clockwise circular path about a gyre in the the
1. 0 answers
2. asked by shela
3. 1,185 views
A force of 60N used to push a chair across a room does 300J of work in half a minute. How far does a chair move?
1. 1 answer
2. asked by ME
3. 1,169 views
A small object of mass 2.60 g and charge -17 µC "floats" in a uniform electric field. What is the magnitude and direction of
1. 2 answers
2. asked by Phil
3. 1,142 views
A heat exchanger is used to warm apple cider using steam as the heat source. The cider is heated from an initial temperature of
1. 2 answers
2. asked by Paul
3. 1,142 views
The formula for rust can be represented by Fe2O3. How many moles of Fe are present in 21.3g of the compound? Please help. I am
1. 1 answer
2. asked by Anna
3. 1,114 views
How long will it take $800 to earn $18 at 6% simple interest?
1. 1 answer
2. asked by Matt
3. 1,095 views
Determine the direction of the following reaction from the relative strengths of acids and bases:H2S(aq) + C2H3O2-(aq) yields
1. 2 answers
2. asked by Robby
3. 1,095 views
The decomposition of N2O5(g) --> NO2(g) + NO3(g) proceeds as a first order reaction with a half-life of 30.0 seconds at a
1. 1 answer
2. asked by Marcus
3. 1,093 views
WHat are the symbols in Tuck Everlasting?
1. 1 answer
2. asked by Josh
3. 1,043 views
Find the margin of error for c,s, and n.C= 0.90, s=2.3, n=36? Please help asap....
1. 3 answers
2. asked by Mandi D
3. 1,038 views
I'm not sure how to do this.Determine the actual ratio of 18O:16O for the following substances. a) Snow falling in Greenland at
1. 0 answers
2. asked by Dion
3. 1,023 views
Answer the following question in Spanish..que pides muchas veces como Plato principal
1. 2 answers
2. asked by Andrew
3. 1,003 views
25ml of a solution of na2c03 having a specific gravity of 1.25g ml required 32.9ml of a solution of hcl containing 109.5g of the
1. 1 answer
2. asked by Fai
3. 984 views
name the three different systems of media ownership that can be found worldwide.name a country where each system can be found.
1. 3 answers
2. asked by chuene
3. 981 views
What is the gravitational force between two 5.00 kg masses that are 10.0 cm apart from center to center? (G = 6.67 × 10-11 N
1. 1 answer
2. asked by Amy
3. 971 views
a scientist found a fossilized bison. using Carbon-14 dating, she found that the fossil was about 45,840 years old. Carbon-14
1. 2 answers
2. asked by sue moore
3. 971 views
gaseous hydrogen and fluorine combine in the reaction above to form hydrogen fluoride with an enthalpy change of -540kJ. What is
1. 0 answers
2. asked by Sarah
3. 948 views
The life spans of three randomly selected tires are 31,950 miles, 36,050 miles, 34,000 miles. Using the empirical rule, find the
1. 1 answer
2. asked by Amari
3. 938 views
the ends of a light string are tied to two hooks A and Bin are ceiling which 100 cm apart horizontally,so that the length of
1. 1 answer
2. asked by Anonymous
3. 936 views
A cannon is mounted on a truck that moves forward at a speed of 5 m/s. The operator wants to launch a ball from a cannon so the
1. 0 answers
2. asked by Brian
3. 929 views
2A + B2 + C --> A2B + BCRun # Initial Rate (M-1s-1) (A)o (B)o (C)o 1 1.6 x 106 1.2 M 1. x 10-2 M 1.0 M 2 1.6 x 106 2.4 M 1. x
1. 1 answer
2. asked by Marcus
3. 923 views
Verify the identities.1.) √1-COSθ/1+COSθ= 1+SINθ/SINθ 2.) SEC X SIN(π/2-X)= 1 3.) CSC X(CSC X-SIN X)+SIN X-COS X/SIN X +
1. 1 answer
2. asked by AwesomeGuy
3. 920 views
A rectangle is bounded by the x-axis and the semicircle Y= SQ RT of 4-x^2. Write the area A of the rectangle as a function of x
1. 1 answer
2. asked by Kristi
3. 915 views
An elevator's cable can handle a tension of 95,500N. Assuming the car has a mass of 2950 kg and it is carrying a full load of
1. 1 answer
2. asked by Amy
3. 908 views
during a triathlon, Sharon swims 1/4 of the total route and cycles 3/5 of the remaining route. she runs the rest of the route.
1. 7 answers
2. asked by Shohanur
3. 860 views
Natalie earns $2.50 for each CD she sells and $3.50 for each DVD she sells. Natalie sold 45 DVDs last year. She earned a total
1. 1 answer
2. asked by Amy
3. 770 views
32% of women consider themselves fans of professional baseball. You randomly select six women and ask each if she considers
1. 1 answer
2. asked by Jim
3. 764 views
Proving identities:1) 1+ 1/tan^2x = 1/sin^2x 2) 2sin^2 x-1 = sin^2x - cos^2x 3) 1/cosx - cosx = sin x tan x 4) sin x + tan x
1. 3 answers
2. asked by Deepa
3. 762 views
If (a, b) is a point on the unit circle that corresponds to the angle t, then tan(t) equals:
1. 1 answer
2. asked by bri
3. 756 views
A simple pendulum of length 1 metre has a bob of mass 100 grams.It is displaced through an angle 60 degree and then
1. 0 answers
2. asked by Surajit Sanyal
3. 754 views
The area of a rhombus is 84 sqm.,if its perimeter is 40 m. ,then find its altitude.
1. 3 answers
2. asked by Rashi
3. 735 views
Pt, (H2) 1atm | CH3COOH 0.1 M, CH3COONa 0.15M || NaBr 0.1M, AgBr(S) | Agwrite the cathodic, anodic and final reactions.
1. 0 answers
2. asked by Emmanuel
3. 730 views
The life span of three randomly selected tires are 34,700 miles, 43,000 miles, 39,000 miles. Using the empirical rule, find the
1. 1 answer
2. asked by Quala
3. 726 views
A ski jumper launches from a ski jump that is oriented parallel to a hill. The jump has a vertical drop of 50 m and the
1. 1 answer
2. asked by raj
3. 703 views
a) what is the momentum of a 4.6 kg baseball moving at 1.4 m/s?b) a child is running with a velocity of 4.5 m/s and has a
1. 1 answer
2. asked by Isis
3. 702 views
A simple pendulum of length 1 metre has a bob of mass 100 grams.It is displaced through an angle 60 degree and then
1. 0 answers
2. asked by Surajit Sanyal
3. 695 views
Please i need help... is this article biased or not biased and why? thank you very much:)i am very confused..OTTAWA — Nearly
1. 7 answers
2. asked by zackary
3. 695 views
I have to write a paper for english, i keep getting bad grades and i use the paper rater sight always to make sure i do my best.
1. 1 answer
2. asked by Stephanie
3. 689 views
58% Ca3 (PO4) 2 how many phosphorus are in 10 kg bones?Ca3(po4)2+SiO2+C=CaSiO3+P4
1. 1 answer
2. asked by Diana
3. 688 views
HOw has the definition of computer literacy changed over time?I don't know any thing about computers
1. 1 answer
2. asked by Gia
3. 687 views
A solution contains 0.02755 g of a protein in 25.0 mL of solution. The osmotic pressure is 3.22 torr at 298 K. What is the
1. 2 answers
2. asked by m
3. 679 views
A hospital performs 3 types of operations. The first type takes 30 minutes, and they charge $1000 for it. The second type takes
1. 0 answers
2. asked by Camille
3. 675 views
32% of women consider themselves fans of professional baseball. You randomly select six women and ask each if she considers
1. 1 answer
2. asked by Jim
3. 668 views
In a given 1st order reaction A ---> products, the initial concentration of A is 0.40 M. What will be the concentration of A
1. 1 answer
2. asked by Marcus
3. 664 views
sodium-24 has a half life of 15 hours,how much of a 50 gram sample will be left after 60 hours
1. 1 answer
2. asked by sue moore
3. 661 views
Explain the physical significance of van der waals,parameters ?
1. 1 answer
2. asked by shshi ranjan
3. 652 views
40+40x0+1please help me answer this problem
1. 2 answers
2. asked by Melea
3. 617 views
find the present value using the present value formula. Achieve $ 225,500 at 8,95% compounded continuously for 8 years, 135
1. 1 answer
2. asked by Andrew
3. 607 views
Had a recent mix-up when I re-read my chemistry notes, and trying to clear things up properly; is this right?:When bonds form,
1. 1 answer
2. asked by a Canadian
3. 586 views
1.This term refers to the scale model of a larger piece. (1 point) marquis miniature maquette mock-up 2. This Swedish artist
1. 5 answers
2. asked by Anonymous
3. 577 views
25ml of a solution of na2c03 having a specific gravity of 1.25g ml required 32.9ml of a solution of hcl containing 109.5g of the
1. 1 answer
2. asked by Fai
3. 574 views
What is the PROCUREMENT cost of this system?Cost Types Cost (in millions) Research/Development $400 Procurement of Prime mission
1. 0 answers
2. asked by SHAWN
3. 572 views
The lengths of the three sides of a triangle are in the ratio 4:5:3. Find the length of each side if the perimetre of the
1. 1 answer
2. asked by help here
3. 567 views
A stone is thrown horizontally at 30.0 m/s from the top of a very tall cliff. (a) Calculate its horizontal position and vertical
1. 1 answer
2. asked by samantha
3. 561 views
A company separates iron, zinc, and kryptonite from ore by the floatation separation process, which has three steps: oiling,
1. 0 answers
2. asked by Abby
3. 558 views
A block of mass 3 kg is at rest on an incline. The coefficient of state friction between the block and incline is 0.34. What is
1. 1 answer
2. asked by Amy
3. 555 views
the perspective on rosa parks, the bus driver, or another passenger (black,or white} i have to write a sentnce that would ,make
1. 15 answers
2. asked by naomi
3. 554 views
Describe the life/behaviour and explain 5 factors that contribute to hiv/aids
1. 2 answers
2. asked by Lethabo
3. 541 views
How much impulse is given to a 25 kg train car that is accelerated from rest to 12 m/s in 4 sec?
1. 1 answer
2. asked by JenniferG
3. 533 views
If a man requires a mirror of 0.9m as to see the whole of himself in the mirror when he is standing 2m away from the mirror. How
1. 1 answer
2. asked by Any
3. 532 views
A spring, (spring constant of 400 N/m) is displaced .75 m from its equilibrium position. An 8-kg mass is connected to the spring
1. 1 answer
2. asked by Anonymous
3. 530 views
Effect of temperature on surface tension an viscosity ?
1. 1 answer
2. asked by shashi ranjan
3. 526 views
what are the pros and cons of graphing
1. 1 answer
2. asked by University of Phoenix
3. 524 views
Under Andrew Jackson's presidency who got the most power and from whom?
1. 4 answers
2. asked by Darcy
3. 523 views
the perspective on rosa parks, the bus driver, or another passenger (black,or white} i have to write a beginning hook also known
1. 1 answer
2. asked by naomi
3. 519 views
Explain why a mixture formed by mixing 100 mL of 0.1 M acetic acid and 50 mL of 0.1 M sodium hydroxide will act as buffer
1. 1 answer
2. asked by Thea
3. 517 views
Romeo takes a uniform 13.7-m ladder and leans it against the smooth (frictionless) wall of the Capulet residence. The ladder's
1. 0 answers
2. asked by Nick
3. 514 views
what conclusion can you make from the ratio of moles of copper to moles of iron in this reactionfe+cucl2---> fecl2+ cu
1. 2 answers
2. asked by azi
3. 511 views
If Wilma borrows $5,000 from her brother (at 5% interest per year) and the loan matures in 10 years, how much will she have to
1. 1 answer
2. asked by Jordan
3. 511 views
How do I do a limiting reactant equation? The questions my teacher gave me are confusing and nothing we ever learned in class.
1. 0 answers
2. asked by Emmy
3. 511 views

Back to February 2013

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025