Archives
2013
February

Questions Asked on February 17, 2013

In a group of 100 people 40 own a cat, 25 own a dog and 15 own a cat and a dog.Find the probability that a person selected at
1. 1 answer
2. asked by sabir
3. 3,553 views
A sphere with radius 3 is inscribed in a conical frustum of slant height 10. (The sphere is tangent to both bases and the side
1. 4 answers
2. asked by Knights
3. 1,843 views
How much impulse is given to a 25 kg train car that is accelerated from rest to 12 m/s in 4 sec?
1. 1 answer
2. asked by JenniferG
3. 526 views
40+40x0+1please help me answer this problem
1. 2 answers
2. asked by Melea
3. 607 views
Had a recent mix-up when I re-read my chemistry notes, and trying to clear things up properly; is this right?:When bonds form,
1. 1 answer
2. asked by a Canadian
3. 570 views
a rectangular garden 9ft by 12 ft includes a uniform border of wood chips around a rectangular bed of flowers. If flowers take
1. 2 answers
2. asked by SEAN
3. 1,547 views
A rowboat passenger uses an oar to push the boat off the dock by exerting a force of 40.0 N for 3.0 s. What impulse acts on the
1. 2 answers
2. asked by Chad
3. 1,616 views
What is the PROCUREMENT cost of this system?Cost Types Cost (in millions) Research/Development $400 Procurement of Prime mission
1. 0 answers
2. asked by SHAWN
3. 555 views
A 10.0 kg cart and a 15 kg cart are locked together with a compressed spring between them. They are then released so that the
1. 1 answer
2. asked by joseph
3. 1,875 views
32% of women consider themselves fans of professional baseball. You randomly select six women and ask each if she considers
1. 1 answer
2. asked by Jim
3. 661 views
An airline reports that if has been experiencing a 15% rate of no-shows on advanced reservations. Among 150 advanced
1. 1 answer
2. asked by Karen
3. 4,359 views
which word would be the best word to use in this sentence...My aunt has only______success in quitting smoking.Every few
1. 1 answer
2. asked by sam
3. 370 views
A recent survey found that 70% of all adults over 50 wear glasses for driving. You randomly select 30 adults over 50, and ask if
1. 1 answer
2. asked by Karen
3. 4,015 views
sodium-24 has a half life of 15 hours,how much of a 50 gram sample will be left after 60 hours
1. 1 answer
2. asked by sue moore
3. 655 views
AS Leo explained a failed business deal that had once_____e(d) him,he______(e)d into the even more interesting tale of his
1. 8 answers
2. asked by sam
3. 1,338 views
25ml of a solution of na2c03 having a specific gravity of 1.25g ml required 32.9ml of a solution of hcl containing 109.5g of the
1. 1 answer
2. asked by Fai
3. 975 views
What volume of a 0.22mol/L hydrochloric acid solution is needed to cause the pH of 25.00mL of a 0.15mol/L lithium hydroxide
1. 1 answer
2. asked by Amy
3. 1,276 views
The formula for rust can be represented by Fe2O3. How many moles of Fe are present in 21.3g of the compound? Please help. I am
1. 1 answer
2. asked by Anna
3. 1,103 views
A 100kg steel beam falls from rest from a height of 20m, Find its impact speed.
1. 0 answers
2. asked by Kim
3. 411 views
lWhat is the PROCUREMENT cost of the below systems?Cost Types Cost (in millions) Research/Development $400 Procurement of Prime
1. 0 answers
2. asked by Willaim
3. 463 views
Natalie earns $2.50 for each CD she sells and $3.50 for each DVD she sells. Natalie sold 45 DVDs last year. She earned a total
1. 1 answer
2. asked by Sylvie
3. 1,354 views
Nick contends that a share repurchase will increase the company’s ROA, ROE, and P/E ratio. Do you agree? How will a share
1. 0 answers
2. asked by Sharron
3. 458 views
a) what is the momentum of a 4.6 kg baseball moving at 1.4 m/s?b) a child is running with a velocity of 4.5 m/s and has a
1. 1 answer
2. asked by Isis
3. 691 views
1.This term refers to the scale model of a larger piece. (1 point) marquis miniature maquette mock-up 2. This Swedish artist
1. 5 answers
2. asked by Anonymous
3. 567 views
a) A tennis racket a 450 N force on a 0.05 kg tennis ball over a 0.006 s time period. What is the impulse applied to the ball?b)
1. 1 answer
2. asked by Isis
3. 1,237 views
A rectangle is bounded by the x-axis and the semicircle Y= SQ RT of 4-x^2. Write the area A of the rectangle as a function of x
1. 1 answer
2. asked by Kristi
3. 903 views
32% of women consider themselves fans of professional baseball. You randomly select six women and ask each if she considers
1. 1 answer
2. asked by Jim
3. 750 views
What are some changes and continuities in the demography of North America from 600-1750?
1. 1 answer
2. asked by Anonymous
3. 400 views
A ski jumper launches from a ski jump that is oriented parallel to a hill. The jump has a vertical drop of 50 m and the
1. 1 answer
2. asked by raj
3. 689 views
Describe the life/behaviour and explain 5 factors that contribute to hiv/aids
1. 2 answers
2. asked by Lethabo
3. 527 views
Verify the identity algebraically.TAN X + COT Y/TAN X COT Y= TAN Y + COT X
1. 1 answer
2. asked by AwesomeGuy
3. 5,298 views
Please i need help... is this article biased or not biased and why? thank you very much:)OTTAWA — Nearly 15 years after a
1. 5 answers
2. asked by zackary
3. 410 views
Given a very concentrated glycercol solution. Dilute it to 7.5 fold dilution. How do I do this ?
1. 1 answer
2. asked by Adams
3. 459 views
Define the function f(x)=2x/1−x^2. Find the number of distinct real solutions of the equation f^(5)(x)=x.Details and
1. 0 answers
2. asked by Anonymous
3. 364 views
H2S(aq) + NiSO4(aq) →
1. 1 answer
2. asked by Anonymous
3. 1,639 views
Verify the identities.1.) √1-COSθ/1+COSθ= 1+SINθ/SINθ 2.) SEC X SIN(π/2-X)= 1 3.) CSC X(CSC X-SIN X)+SIN X-COS X/SIN X +
1. 1 answer
2. asked by AwesomeGuy
3. 900 views
State the quadrant in which θ lies.1.) CSC θ is greater than 0 and TAN θ is less than 0. 2.) SEC θ is greater than 0 and SIN
1. 1 answer
2. asked by AwesomeGuy
3. 2,411 views
Verify the identity algebraically. This problem is very intriguing and awesome at the same time. It's wonderfully amazing!1.)
1. 1 answer
2. asked by AwesomeGuy
3. 460 views
Let |ϕ⟩=a|0⟩+b|1⟩ where a and b are nonnegative real numbers. We know that if we measure |ϕ⟩ in the standard basis,
1. 0 answers
2. asked by ramesh
3. 411 views
Lauryl alcohol is obtained from coconut oil and is used to make detergents. A solution of 5.00 g of lauryl alcohol in 100.0 g of
1. 1 answer
2. asked by m
3. 1,242 views
A solution contains 0.02755 g of a protein in 25.0 mL of solution. The osmotic pressure is 3.22 torr at 298 K. What is the
1. 2 answers
2. asked by m
3. 667 views
Express the non linear equation in its linear form;y=nx^(1/2)+kx
1. 0 answers
2. asked by azmeerahim
3. 312 views
A simple pendulum of length 1 metre has a bob of mass 100 grams.It is displaced through an angle 60 degree and then
1. 0 answers
2. asked by Surajit Sanyal
3. 744 views
what conclusion can you make from the ratio of moles of copper to moles of iron in this reactionfe+cucl2---> fecl2+ cu
1. 2 answers
2. asked by azi
3. 500 views
Read the following poem and answer questions that follow:Life, death,-death, life; the words have lead for ages Our thought and
1. 3 answers
2. asked by Gazala
3. 2,370 views
A simple pendulum of length 1 metre has a bob of mass 100 grams.It is displaced through an angle 60 degree and then
1. 0 answers
2. asked by Surajit Sanyal
3. 679 views
If a man requires a mirror of 0.9m as to see the whole of himself in the mirror when he is standing 2m away from the mirror. How
1. 1 answer
2. asked by Any
3. 524 views
If a+b+c=0 then prove that a^4+b^4+c^4=2(a^2b^2+b^2c^2+c^2a^2)
1. 1 answer
2. asked by Anonymous
3. 310 views
Integrate ( x^2cosx)/(1+sinx)^2 dxwith limits from 0 to pi/4
1. 2 answers
2. asked by Anonymous
3. 1,603 views
Three circles are placed on a plane in such a way that each circle just touches the other two , each having a radius of 10
1. 1 answer
2. asked by Anonymous
3. 475 views
Pt, (H2) 1atm | CH3COOH 0.1 M, CH3COONa 0.15M || NaBr 0.1M, AgBr(S) | Agwrite the cathodic, anodic and final reactions.
1. 0 answers
2. asked by Emmanuel
3. 719 views
2A + B2 + C --> A2B + BCRun # Initial Rate (M-1s-1) (A)o (B)o (C)o 1 1.6 x 106 1.2 M 1. x 10-2 M 1.0 M 2 1.6 x 106 2.4 M 1. x
1. 1 answer
2. asked by Marcus
3. 910 views
In a given 1st order reaction A ---> products, the initial concentration of A is 0.40 M. What will be the concentration of A
1. 1 answer
2. asked by Marcus
3. 649 views
The decomposition of N2O5(g) --> NO2(g) + NO3(g) proceeds as a first order reaction with a half-life of 30.0 seconds at a
1. 1 answer
2. asked by Marcus
3. 1,076 views
Cyclopropane rearranges to form propene:CH2CH2CH2 --> CH2=CHCH3 by first-order kinetics. The rate constant is k = 2.74 x 10-3
1. 1 answer
2. asked by Marcus
3. 1,787 views
A pendulum bob of mass 50g hangs in a steady state by athread from the roof of a car as it accelerates horizontally.the angle
1. 1 answer
2. asked by Safiah
3. 473 views
A pendulum bob of mass 50g hangs in a steady state by athread from the roof of a car as it accelerates horizontally.the angle
1. 1 answer
2. asked by Safiah
3. 392 views
which product experience a larger change in price?
1. 1 answer
2. asked by jim
3. 484 views
A tire 0.500 m in radius rotates at a constant rate of 200 rev/min. Find the speed and acceleration of a small stone lodged in
1. 3 answers
2. asked by Sammie
3. 3,999 views
Which two labour laws protect the employee against discrimination in the work place?
1. 2 answers
2. asked by Sello
3. 418 views
A science student is riding on a flatcar of a train travelling along a straight horizontal track at a constant speed of 10.0
1. 3 answers
2. asked by Sammie
3. 2,730 views
At time t=0,a 1kg ball is thrown up from the top of a tall tower with velocity Vo=18i+24j(m/s).a:calculate the components of th
1. 0 answers
2. asked by Bessy
3. 402 views
At time t=0,a 1kg ball is thrown up from the top of a tall tower with velocity Vo=18i+24j(m/s).a:calculate the components of th
1. 3 answers
2. asked by Bessy
3. 2,314 views
Explain why a mixture formed by mixing 100 mL of 0.1 M acetic acid and 50 mL of 0.1 M sodium hydroxide will act as buffer
1. 1 answer
2. asked by Thea
3. 510 views
I need help with soving this problem.G(u) =4-3u-u^2; Find G(-2u)
1. 1 answer
2. asked by Jackie
3. 278 views
Consider the general quadratic eqaution in standard form, ax^2 + bx + c = 0. Let a = 1 and the roots be r1 and r2. Expand (x -
1. 1 answer
2. asked by Moyer
3. 383 views
The area of a rhombus is 84 sqm.,if its perimeter is 40 m. ,then find its altitude.
1. 3 answers
2. asked by Rashi
3. 717 views
What according to the BCEA Act applies with regard to the contravention that you've identified
1. 2 answers
2. asked by Adorn mnisi
3. 474 views
Would anyone be able to help me out please?You buy 100 shares of XYZ at $40per share.XYZ pays an annual dividend of $2 and
1. 0 answers
2. asked by Sara
3. 421 views
The lengths of the three sides of a triangle are in the ratio 4:5:3. Find the length of each side if the perimetre of the
1. 1 answer
2. asked by help here
3. 460 views
The lengths of the three sides of a triangle are in the ratio 4:5:3. Find the length of each side if the perimetre of the
1. 1 answer
2. asked by help here
3. 553 views
two slabs of thickness 10cm and 2ocm are made of rteel and copper respectively.they are in thermal contact with each oth.the far
1. 1 answer
2. asked by pulie
3. 379 views
two slabs of thickness 10cm and 2ocm are made of rteel and copper respectively.they are in thermal contact with each oth.the far
1. 1 answer
2. asked by pulie
3. 425 views
two slabs of thickness 10cm and 2ocm are made of rteel and copper respectively.they are in thermal contact with each oth.the far
1. 1 answer
2. asked by pulie
3. 429 views
In 10-15 lines critically discuss 5ways in which the human or environmental problem impacts on the community.provide relevant
1. 1 answer
2. asked by Octavia muhammed
3. 366 views
Explain the physical significance of van der waals,parameters ?
1. 1 answer
2. asked by shshi ranjan
3. 641 views
what is molality ?
1. 1 answer
2. asked by shashi ranjan
3. 293 views
what is molality ?
1. 1 answer
2. asked by shashi ranjan
3. 363 views
Proving identities:1) 1+ 1/tan^2x = 1/sin^2x 2) 2sin^2 x-1 = sin^2x - cos^2x 3) 1/cosx - cosx = sin x tan x 4) sin x + tan x
1. 3 answers
2. asked by Deepa
3. 739 views
58% Ca3 (PO4) 2 how many phosphorus are in 10 kg bones?Ca3(po4)2+SiO2+C=CaSiO3+P4
1. 1 answer
2. asked by Diana
3. 678 views
Effect of temperature on surface tension an viscosity ?
1. 1 answer
2. asked by shashi ranjan
3. 514 views
what is real gas ?
1. 1 answer
2. asked by shashi ranjan
3. 300 views
under what condition del(h) becomes del(u)
1. 1 answer
2. asked by shashi ranjan
3. 405 views
find the shortest distance between y= X+10 and Y=6√X
1. 1 answer
2. asked by Bhavana
3. 390 views
Calculate the net charge on a substance consisting of a combination of 7.5 multiplied by 1013 protons and 3.5 multiplied by 1013
1. 1 answer
2. asked by Phil
3. 454 views
Can someone tell me what this question means: Which of these rivers flows entirely within the Northern Hemisphere? Amazon -
1. 3 answers
2. asked by Sue
3. 462 views
Please i need help... is this article biased or not biased and why? thank you very much:)i am very confused..OTTAWA — Nearly
1. 7 answers
2. asked by zackary
3. 680 views
A small object of mass 2.60 g and charge -17 µC "floats" in a uniform electric field. What is the magnitude and direction of
1. 2 answers
2. asked by Phil
3. 1,122 views
from the perspective on the black passenger what possible beginning hooks (or sentence that would make people want to read the
1. 1 answer
2. asked by naomi
3. 335 views
a hiker walk due east at 4km per hour and a second hiker starting from the same point walks 55 degree north-east at the rate of
1. 1 answer
2. asked by annny
3. 1,275 views
the perspective on rosa parks, the bus driver, or another passenger (black,or white} i have to write a beginning hook also known
1. 1 answer
2. asked by naomi
3. 506 views
name the three different systems of media ownership that can be found worldwide.name a country where each system can be found.
1. 3 answers
2. asked by chuene
3. 969 views
Name three problems that can arise when data becomes mixed up.
1. 0 answers
2. asked by Sasha
3. 334 views
What is the error in the sentence? Try and find a suitable replacement for the discontinued model.
1. 1 answer
2. asked by shelly
3. 478 views
solve the simultaneous equations;log x base 2-log y base 4=4, log (x-2y)base 2=5
1. 2 answers
2. asked by jessica
3. 1,906 views
A heat exchanger is used to warm apple cider using steam as the heat source. The cider is heated from an initial temperature of
1. 2 answers
2. asked by Paul
3. 1,127 views
A stone is thrown horizontally at 30.0 m/s from the top of a very tall cliff. (a) Calculate its horizontal position and vertical
1. 1 answer
2. asked by samantha
3. 555 views
est qui si la balla tu qu ci du basket ball.du imagrtion la fanes
1. 1 answer
2. asked by angel
3. 285 views
Suppose that the length of a rectangle is 21 inches and the width is 4 more than one third of the length?
1. 1 answer
2. asked by Lady roc
3. 426 views
the perspective on rosa parks, the bus driver, or another passenger (black,or white} i have to write a sentnce that would ,make
1. 15 answers
2. asked by naomi
3. 541 views

Back to February 2013

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024