Archives
2012
April

Questions Asked on April 3, 2012

A bowling ball rolls without slipping up a ramp that slopes upward at an angle (beta) to the horizontal. Treat the ball as a
1. 1 answer
2. asked by Joe
3. 7,829 views
In lab you submerge 100 g of 41 degree Celcius iron nails in 100 g of 25 degree Celcius water (the specific heat of iron is 0.12
1. 1 answer
2. asked by christy
3. 6,593 views
A 5450-m^3 blimp circles Fenway Park duing the World Series, suspended in the earth's 1.21-kg/m^3 atmosphere. The density of the
1. 1 answer
2. asked by HELP PLEASE
3. 4,995 views
Which two things does a budget compare?A.Saving and interest B.Income and expenses C.Income and investments D.Expenses and
1. 6 answers
2. asked by Rezu
3. 4,920 views
What are the skeleton equations forDicarbon hexahydride gas + oxygen gas --> carbon dioxide gas + gaseous water And Solid barium
1. 3 answers
2. asked by me
3. 4,591 views
A street light is at the top of a 19 foot tall pole. A 6 foot tall woman walks away from the pole with a speed of 7 ft/sec along
1. 1 answer
2. asked by Joe
3. 4,360 views
A certain type of combination lock has3 dials: the first 2 dials each have settings for all the digits 0 through 9 and the third
1. 4 answers
2. asked by noorie
3. 3,460 views
Every governor has certain judicial powers. Which is a judicial power that allows a governor to release a prisoner before his or
1. 5 answers
2. asked by Charlette
3. 3,338 views
Allegra's favorite ride at the Barrel-O-Fun Amusement Park is the Flying Umbrella, which is lifted by a hydraulic jack. The
1. 5 answers
2. asked by DAN
3. 2,959 views
Consider the reaction: N2O4(g) <--> 2NO2(g)delta H^o =58.576kJ; Keq =0.87 at 55degrees celsius What is the effect of each of
1. 2 answers
2. asked by Danielle
3. 2,756 views
What is the pH of 1.0M Na2SO3 (aq)solution at 25C?a) 3.40 b) 6.03 c) 10.60 d) 7.96 e) 10.40 How can I get ph from only the
1. 1 answer
2. asked by Mohamed
3. 2,488 views
The densities of four different woods are shown below.Wood Sample Densities Type of wood: African Teakwood Density(g/cm3) 0.98
1. 2 answers
2. asked by Lana Grib
3. 2,327 views
The area of a regular octagon is 35 cm². What is the area of a regular octagon with sides three times as long?
1. 5 answers
2. asked by Samuel
3. 2,263 views
A 3-ft vertical post casts a 24-in shadow at the same time a pine tree casts a 30-ft shadow. How tall is the pine tree?
1. 2 answers
2. asked by Cassie
3. 2,168 views
In the presence of an alkali, Cl2 reacts to form Cl- and ClO3- , as follows:3 Cl2(g) + 6 OH−(aq) → 5 Cl−(aq) + ClO3−(aq)
1. 4 answers
2. asked by anabel
3. 2,100 views
In what way is a kid's budget similar to an adult's budget?A.The goal for both is to have less money going out than coming in.
1. 4 answers
2. asked by Rezu
3. 2,098 views
What is the frequency of the photons emitted by hydrogen atoms when they undergo transition from n=5 to n=3?
1. 2 answers
2. asked by Tiffany
3. 1,999 views
Use linear approximation, i.e. the tangent line, to approximate (1/0.504) as follows: Find the equation of the tangent line to
1. 1 answer
2. asked by Joe
3. 1,967 views
A grindstone of radius 4.0m is initially spinning with an angular speed of 8.0 rad/s. The angular speed is then increased to 12
1. 1 answer
2. asked by Natasha
3. 1,865 views
10. An aqueous solution is prepared by diluting 3.30 mL acetone, CH3COCH3, (d=0.789 g/mL) with water to a final volumeof 75.0
1. 1 answer
2. asked by Anonymous
3. 1,793 views
you have $ 1.55 in dimes and quarters. find all the possible combinations of coins that you might havei got; 1) 1 quarters 13
1. 2 answers
2. asked by marko
3. 1,729 views
How many moles of calcium chloride hexahydrate will be produced from 4.00 mol calcium carbonate?
1. 1 answer
2. asked by Jamaica
3. 1,727 views
What is one consequence of going into bankruptcy?A.Losing the ability to make a budget. B.Losing your job C.Having some of your
1. 8 answers
2. asked by Rezu
3. 1,709 views
Below are parenthetical citations for an encyclopedia article. Select the one that is completely correct.("Hannibal" 16-17)
1. 5 answers
2. asked by Anonymous
3. 1,708 views
what mass of H2(g) is produced from the reaction of 5.2g Fe(s) with excess hydrochloric acid?
1. 2 answers
2. asked by Susan
3. 1,706 views
as the weight held by a spring increases, the length of the spring increases proportionally. Suppose a 2-lb weight stretches a
1. 5 answers
2. asked by LD
3. 1,696 views
a railroad handcar is moving along striaght, fricionless tracks. In each of the following cases the car initially has a total
1. 3 answers
2. asked by taylor
3. 1,695 views
Kepler's third law of planetary motion relates P, the period of a planet's orbit, to R, the planet's mean distance from the sun,
1. 1 answer
2. asked by Labz
3. 1,681 views
What happens to the concentration ofSO2(g) when the total pressure on the equilibrium reaction 2 SO2(g) + O2(g) <---> 2 SO3(g)
1. 3 answers
2. asked by luke
3. 1,674 views
Can someone please check my work?Which of the following is Not a good idea for choosing a subject for a persuasive speech?
1. 4 answers
2. asked by kevin
3. 1,633 views
Posson Catering uses two measures of activity, jobs and meals, in the cost formulas in its budgets and performance reports. The
1. 1 answer
2. asked by Deborah
3. 1,550 views
Find two geometric means between 7 and 875
1. 3 answers
2. asked by vanessa
3. 1,452 views
what is the Gerund phrase and Noun function in these sentences?1)Writing a research paper sounds difficult. 2)He must like
1. 7 answers
2. asked by jason
3. 1,435 views
Need help.... calculate the theorectical yield of the compounds to be prepared in the experiment. The metal ion in both cases is
1. 1 answer
2. asked by Debbie
3. 1,429 views
Which of the following tactics did many States once use to disenfranchise African American voters?A. "motor voter" laws B. age
1. 7 answers
2. asked by Austin
3. 1,404 views
Draw the line bond structure of the following compounds:(HO)3C(CH2)2N(CH2CHO)CH(CH2CH3)2 (All numbers are subscripts) Could
1. 1 answer
2. asked by Anonymous
3. 1,353 views
On a perfect fall day, you are hovering at low altitude in a hot-air balloon, accelerated neither upward nor downward. The total
1. 2 answers
2. asked by christy
3. 1,346 views
to complete tasks quickly and efficiently a operating system has many special components that are known as?(a)routines
1. 1 answer
2. asked by susue
3. 1,334 views
Tris is an abbreviation for tris (hydroxymethyl) aminomethane, which is a weak base. Calculate how many grams of tris
1. 3 answers
2. asked by Cassandra
3. 1,311 views
please help me with writing why is it important to write your goals and formulate it.I started off by saying it is important
1. 2 answers
2. asked by Maryann
3. 1,310 views
For the triangle shown, find the length AD. (Assume u = 18, v = 18, x = 10°, and y = 10°. Round your answer to two decimal
1. 0 answers
2. asked by Mike
3. 1,296 views
In class, I did an experiment with water and iodine solution in a beaker and also starch in a dialysis tube tied and placed in
1. 0 answers
2. asked by CrissyXD
3. 1,285 views
What can health care providers do to help promote physical activity initiatives?A. Absolutely nothing, they do enough B. Advise
1. 2 answers
2. asked by Destini
3. 1,262 views
a math teacher is randomly distributing 15 rulers with centimeters labels and 10 rulers without centimeter labels. What si the
1. 1 answer
2. asked by Juliet
3. 1,260 views
The equivalence point of a titration is reached when 35.50 mL of 0.40 M HBr is added to a 25.00 mL sample of LiOH. The original
1. 1 answer
2. asked by help asap
3. 1,258 views
What would the IUPAC name of the molecule:H2C=C=CH2 be? is 1,2-propene right?
1. 3 answers
2. asked by Anonymous
3. 1,255 views
Identify each statement as true or false. If false, indicate how to correct the statement.1. Depreciation is a process of asset
1. 1 answer
2. asked by Casey
3. 1,254 views
I could not draw the full picture of diagram belowi need to explain the relationship between the measure of <abd and measures of
1. 0 answers
2. asked by marko
3. 1,239 views
A skate boarder starts down the left side of a ramp with an initial speed of 5.4 m/s. Ignoring any non-conservative forces such
1. 1 answer
2. asked by Anonymous
3. 1,199 views
How much heat in kilojoules is evolved in converting 1.50moles of steam at 150 degrees celcius to ice at -60.0 degrees celcius?
1. 1 answer
2. asked by Candice
3. 1,197 views
Starting out with 50 mL of 0.20 M NaHCO3, calculate how many mL of 0.50 M NaOH solution to add to make 100 mL of approximately
1. 0 answers
2. asked by Lucy
3. 1,156 views
Which of the following conditions requires an employer to use the electronic deposit requirement?A. Employer made more than
1. 0 answers
2. asked by Andy
3. 1,149 views
a restaurant uses a cable for the servers to slide orders down to the kitchen. the end where the servers place the order is 5
1. 1 answer
2. asked by ceci
3. 1,139 views
At a certain location, the solar power per unit area reaching Earth's surface is 200 W/m^2, averaged over a 24-hour day.If the
1. 0 answers
2. asked by christy
3. 1,137 views
The image produced by a concave mirror is located 27 cm in front of the mirror. The focal length of the mirror is 13 cm. How far
1. 1 answer
2. asked by linds
3. 1,122 views
Below are parenthetical citations for an encyclopedia article. Select the one that is completely correct.("Hannibal" 16-17)
1. 3 answers
2. asked by Anonymous
3. 1,121 views
What was stated in the english bill of rights?
1. 6 answers
2. asked by aaron
3. 1,119 views
I think the answer to this one is C but im not sure help please.Which term is used to describe businesses owned by a single
1. 2 answers
2. asked by Charlette
3. 1,117 views
What do you think Great Britain could, or should have done to make the partition of India more efficient and less violent?
1. 3 answers
2. asked by Alissa
3. 1,115 views
What will be the effect on a chromatogram of two well separated peaks if: (this is for a gas chromatography)a) the carrier gas
1. 0 answers
2. asked by Ella
3. 1,100 views
If older adults are at risk of falling, they should do exercises that maintain or improve ________.A. Flexibility B. Muscle
1. 6 answers
2. asked by Destini
3. 1,099 views
Suppose lighthouse A is located at the origin and lighthouse B is located at coordinates (0,6). The captain of a ship has
1. 1 answer
2. asked by Tiffany
3. 1,096 views
Two colourless solutions are mixed in a stoppered flask. as the reaction proceeds, the resulting solution turns red, and a
1. 2 answers
2. asked by Danielle
3. 1,072 views
i expect a friend to be both honest and a loyal person is this using correct parallel structure
1. 3 answers
2. asked by tyler
3. 1,043 views
One of the 79.0 -long strings of an ordinary guitar is tuned to produce the note (frequency 245 ) when vibrating in its
1. 2 answers
2. asked by Kelly
3. 1,025 views
I have some questions related to diabetes. Im just wondering if someone's fasting glucose level could be different if they have
1. 0 answers
2. asked by kayla
3. 1,008 views
The demand function for a certain commodity is approximated by: p = 100e-q/2where "q" is the number of units demanded at a price
1. 3 answers
2. asked by tanya
3. 982 views
1.what is the standard deviation of these valuesfirst 7:57,61,57,57,58,57,61 and second 7:61,52,69,64,46,54,47 2. compare the
1. 1 answer
2. asked by favor
3. 955 views
Which of the following statments about standing committees is true?A. They exist in the house but not in the senate. B. They all
1. 4 answers
2. asked by Anonymous
3. 953 views
Consider the combustion of glucose:C6H12O6(s) + 6O2(g) <---> 6CO2(g) + 6H2O(g) H = −3 kJ/mol Which condition I) Adding more
1. 3 answers
2. asked by luke
3. 950 views
Could someone check my work? Ms. Sue thank you for checking for me!!A commercial critizing oil drilling shows images of
1. 5 answers
2. asked by kevin
3. 949 views
carbon 14 has a hlf life of 5700 years. scientists use this fact to determine the age of things made up of organic material.
1. 2 answers
2. asked by Anonymous
3. 923 views
A boat is pulled into a dock by means of a rope attached to a pulley on the dock. The rope is attached to the front of the boat,
1. 0 answers
2. asked by Joe
3. 920 views
what is the Gerund phrase and Noun function in these sentences?1)Writing a research paper sounds difficult. 2)He must like
1. 2 answers
2. asked by cody
3. 912 views
A Japanese bullet train leaves the station tra traveling west at 164 mph. A pigeon which was resting on the train is startled
1. 1 answer
2. asked by DestinyLashea
3. 907 views
Steel expands 11 parts in a million for each 1 degree C change. Consider a 40,000 km steel pipe that forms a ring to fit snugly
1. 2 answers
2. asked by christy
3. 905 views
John ties the leash of his dog to the corner of the doghouse. The dimensions of the dog house are 8ft x 8ft, and the leash is
1. 1 answer
2. asked by nicole a
3. 891 views
Given the equation 2C8H18 + 25O2 = 16 CO2 + 18H2O: The combustion of octane produces carbon dioxide and water. If you start with
1. 1 answer
2. asked by Brittany
3. 883 views
A- a water soluble salt forms a precipitant during Group 3 analysis. An acidic solution of this precipitant and NaBiO3 yields a
1. 1 answer
2. asked by Mima
3. 882 views
fountains are designed so that the height and distance the water travels is dependent on θ, the angle at which the water is
1. 1 answer
2. asked by ceci
3. 876 views
systems of linear equations in 3 variables1/3x-2/3y+z=0 1/2x-3/4y+z=1/4 -2x-y+z=1 every time i do it is wrong and i cannot
1. 1 answer
2. asked by ashley
3. 875 views
A market in which buyers and sellers are free to buy and sell as they wish is known as aA. global market. B. common market. C.
1. 2 answers
2. asked by Charlette
3. 865 views
What is the hybridization of both carbons in:C=CH2 ?
1. 3 answers
2. asked by Anonymous
3. 860 views
use a sum or difference formula to find the exact of the trigonometric functioncos(-13pi/12)
1. 1 answer
2. asked by lina
3. 852 views
Find k so that x+2 is a factor of 2x^3-2kx^2-11x+5k.I don't know to solve for k. please help and thank you
1. 2 answers
2. asked by Anonymous
3. 841 views
A quiz had only 3-point questions and four-point questions. The best possible score is 100, and there are 29 questions. How many
1. 2 answers
2. asked by Anonymous
3. 840 views
Which branch of the law regulates wrongful acts involving injury to one's person, property, or reputation in a situation not
1. 6 answers
2. asked by Charlette
3. 830 views
Which type of colony did strict governors anger the colonists?
1. 3 answers
2. asked by aaron
3. 827 views
A researcher wishes to estimate the mean weekly wage of the several hundreds of workers employedby a certain firm within
1. 1 answer
2. asked by katie
3. 818 views
How much heat is needed to melt a sample of ice if the temperature of 150 g of water in the calorimeter is lowered from 23.0 C
1. 1 answer
2. asked by Malise
3. 814 views
A paperweight in the shape of a triangular prism has a height of 3 inches. its volume is 18 cubic inches. what is the area of
1. 1 answer
2. asked by Nataly
3. 813 views
ordr these fractions from least to greatest 1/3,2/4,3/5,2/7,4/9
1. 2 answers
2. asked by kamryn
3. 804 views
Please check my homeworkI have to read each statement and determine if it's federalist or Democratic Republican 1. F - The role
1. 10 answers
2. asked by Laruen
3. 802 views
Which type of city government was first formed when Galveston, Texas, was devastated by a hurricane?A. the council-manager form
1. 1 answer
2. asked by Charlette
3. 795 views
ON THE WINWARD SIDE OF THE MOUNTAIN SHOULD THE RELATIVE HUMIDITY OF THE PARCEL CHANGE AS IT RISES FROM 200 M TO 400 M
1. 0 answers
2. asked by Anonymous
3. 794 views
If I missed 24 problems out of 40, what is my grade?
1. 3 answers
2. asked by Mattie
3. 792 views
I really need help matching these places to these descriptions:Japan, Taiwan, China, North Korea, Cambodia, Burma -This
1. 3 answers
2. asked by mysterychicken
3. 792 views
Use synthetic division to find the quotient and remainder: (2x^5-7x^3-5x^2+1)/(x-2)This is what I got: Quotient:
1. 1 answer
2. asked by Anonymous
3. 786 views
what is the function of the italicized infinitive phrase in these sentences?1)May I have permission to use the car tonight? 2)He
1. 8 answers
2. asked by jason
3. 775 views
ms. sue for story yesterday i hve these other questionswhy does author end with "eyes" because she experience everything with
1. 16 answers
2. asked by Mohammad
3. 770 views

Back to April 2012

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025