Archives
2012
April

Questions Asked on April 3, 2012

Which type of colony did strict governors anger the colonists?
1. 3 answers
2. asked by aaron
3. 812 views
If you are looking at a flame burning in a pit, what are the physical and chemical process/changes?Thanks
1. 0 answers
2. asked by Sandy
3. 317 views
Below are parenthetical citations for an encyclopedia article. Select the one that is completely correct.("Hannibal" 16-17)
1. 5 answers
2. asked by Anonymous
3. 1,698 views
2.5E-5 = (x)^2/1.75So to solve for x i know I have to take the sqrt of both sides but first do I have to move the 1.75 to the
1. 3 answers
2. asked by Hannah
3. 333 views
Find the pH of 1.0M Na2SO3(aq) solution at 25 degrees Celsius.I am not sure how to start this problem. I started off by doing
1. 4 answers
2. asked by Hannah
3. 520 views
calculate how much of 10% aqueous sodium carbonate would be required to neutralize the solution (This is during the preparation
1. 1 answer
2. asked by Emma
3. 504 views
a math teacher is randomly distributing 15 rulers with centimeters labels and 10 rulers without centimeter labels. What si the
1. 1 answer
2. asked by Juliet
3. 1,250 views
Assume that you’ve worked for the last five years as anadministrative assistant for the Human Resources Department of
1. 1 answer
2. asked by danny
3. 676 views
What can health care providers do to help promote physical activity initiatives?A. Absolutely nothing, they do enough B. Advise
1. 2 answers
2. asked by Destini
3. 1,245 views
Rewrite the expression so that it involves the sum or difference of only constants and sines and cosine to the 1st power(sinx)^4
1. 1 answer
2. asked by lina
3. 721 views
How much heat is needed to melt a sample of ice if the temperature of 150 g of water in the calorimeter is lowered from 23.0 C
1. 1 answer
2. asked by Malise
3. 804 views
The equivalence point of a titration is reached when 35.50 mL of 0.40 M HBr is added to a 25.00 mL sample of LiOH. The original
1. 1 answer
2. asked by help asap
3. 1,243 views
One of the 79.0 -long strings of an ordinary guitar is tuned to produce the note (frequency 245 ) when vibrating in its
1. 0 answers
2. asked by Kelly
3. 590 views
i expect a friend to be both honest and a loyal person is this using correct parallel structure
1. 3 answers
2. asked by tyler
3. 1,035 views
Draw the line bond structure of the following compounds:(HO)3C(CH2)2N(CH2CHO)CH(CH2CH3)2 (All numbers are subscripts) Could
1. 1 answer
2. asked by Anonymous
3. 1,338 views
What will be the effect on a chromatogram of two well separated peaks if: (this is for a gas chromatography)a) the carrier gas
1. 0 answers
2. asked by Ella
3. 496 views
Emily ordered paper sleeves for the sugar cones at her ice cream parlor.If the diameter of each sleeve is 47 Millimeters and the
1. 1 answer
2. asked by Anonymous
3. 410 views
examine the latent and manifest functions ( of the US response to 9/11. Consider how the emerging structures of society are
1. 0 answers
2. asked by denis
3. 542 views
I need a check on my answers1) prompt a user to enter an employee name, employee id, and hours worked until a value of "-1" is
1. 1 answer
2. asked by Paul
3. 686 views
If older adults are at risk of falling, they should do exercises that maintain or improve ________.A. Flexibility B. Muscle
1. 6 answers
2. asked by Destini
3. 1,086 views
Use synthetic division to find the quotient and remainder: (2x^5-7x^3-5x^2+1)/(x-2)This is what I got: Quotient:
1. 1 answer
2. asked by Anonymous
3. 770 views
Could you please check these sentences, Writeacher?1) We were in /on a talent show which lot of people watch. We didn't win
1. 1 answer
2. asked by Matthew
3. 481 views
What is the hybridization of both carbons in:C=CH2 ?
1. 3 answers
2. asked by Anonymous
3. 852 views
A- a water soluble salt forms a precipitant during Group 3 analysis. An acidic solution of this precipitant and NaBiO3 yields a
1. 1 answer
2. asked by Mima
3. 865 views
What are the skeleton equations forDicarbon hexahydride gas + oxygen gas --> carbon dioxide gas + gaseous water And Solid barium
1. 3 answers
2. asked by me
3. 4,572 views
Need a response to all 3 statements 1.The US Supreme Court has ruled that the death penalty does not violate the 8th Amendment
1. 0 answers
2. asked by Blaeten
3. 533 views
what mass of H2(g) is produced from the reaction of 5.2g Fe(s) with excess hydrochloric acid?
1. 2 answers
2. asked by Susan
3. 1,692 views
climate- online content3 distinctive climates in France, describe them. Three types of climate may be found within France:
1. 5 answers
2. asked by i♥zee
3. 360 views
A Japanese bullet train leaves the station tra traveling west at 164 mph. A pigeon which was resting on the train is startled
1. 1 answer
2. asked by DestinyLashea
3. 892 views
What is the equilibrium constant for the reaction of ammonium ion with formate ion?I know that the ionization constant for
1. 0 answers
2. asked by Mohamed
3. 451 views
carbon 14 has a hlf life of 5700 years. scientists use this fact to determine the age of things made up of organic material.
1. 2 answers
2. asked by Anonymous
3. 901 views
At a certain location, the solar power per unit area reaching Earth's surface is 200 W/m^2, averaged over a 24-hour day.If the
1. 0 answers
2. asked by christy
3. 1,123 views
In lab you submerge 100 g of 41 degree Celcius iron nails in 100 g of 25 degree Celcius water (the specific heat of iron is 0.12
1. 1 answer
2. asked by christy
3. 6,571 views
a railroad handcar is moving along striaght, fricionless tracks. In each of the following cases the car initially has a total
1. 3 answers
2. asked by taylor
3. 1,672 views
Ice hockey star Wayne gretzky is skatin at 13.0 m/s^1 towards a defender, who is in turn skating at 5.0 m/s^-1 toward
1. 0 answers
2. asked by taylor
3. 613 views
What is the pH of 1.0M Na2SO3 (aq)solution at 25C?a) 3.40 b) 6.03 c) 10.60 d) 7.96 e) 10.40 How can I get ph from only the
1. 1 answer
2. asked by Mohamed
3. 2,477 views
which of the following is not true about the po river valley?a. the region is the country's most productive agriculture area b.
1. 4 answers
2. asked by i♥zee
3. 651 views
Give the boundaries of 47.4 miles
1. 1 answer
2. asked by Ambra
3. 419 views
use a sum or difference formula to find the exact of the trigonometric functioncos(-13pi/12)
1. 1 answer
2. asked by lina
3. 844 views
Factor the polynomial P(x)=x^3-2x^2-13x-10. Then solve the equation P(x)=0.This is what I got: P(x)=(x+1)(x^2-3x-10)
1. 1 answer
2. asked by Anonymous
3. 696 views
Add. (9x^2+5x-4)+(-8x^2+9x-9)
1. 1 answer
2. asked by sherry
3. 299 views
Rewrite the expression so that it involves the sum or difference of only constants and sines and cosine to the 1st power(cos
1. 0 answers
2. asked by lina
3. 452 views
Allegra's favorite ride at the Barrel-O-Fun Amusement Park is the Flying Umbrella, which is lifted by a hydraulic jack. The
1. 0 answers
2. asked by HELP PLEASE
3. 607 views
find all values of x in (o, Pi) that satify the given equationcos x/3=1/2
1. 3 answers
2. asked by lina
3. 311 views
Does the filament of a bulb have constant resistance, constant voltage or constant current?I would think it's constant current.
1. 2 answers
2. asked by Gina
3. 381 views
Using the foil method,multiply....(2/5t-1)(3/5+1)
1. 1 answer
2. asked by sherry
3. 397 views
How do you structure a policy essay? Like I have an economic problem (welfare) and my thesis is a solution to is. I have to
1. 5 answers
2. asked by Labz
3. 446 views
Which of the following conditions requires an employer to use the electronic deposit requirement?A. Employer made more than
1. 0 answers
2. asked by Andy
3. 1,138 views
1.what is the standard deviation of these valuesfirst 7:57,61,57,57,58,57,61 and second 7:61,52,69,64,46,54,47 2. compare the
1. 1 answer
2. asked by favor
3. 937 views
1. A datd set consists of a set of numerical values. which, if any, of the following statements could be correct? Thanks.
1. 2 answers
2. asked by favor
3. 392 views
which african nation lies to the south of Spain, across the Strait of Gibraltar?ghana. nigeria, morocco, egypt which of the
1. 3 answers
2. asked by i♥zee
3. 449 views
Which two things does a budget compare?A.Saving and interest B.Income and expenses C.Income and investments D.Expenses and
1. 6 answers
2. asked by Rezu
3. 4,904 views
A paperweight in the shape of a triangular prism has a height of 3 inches. its volume is 18 cubic inches. what is the area of
1. 1 answer
2. asked by Nataly
3. 801 views
I really need help matching these places to these descriptions:Japan, Taiwan, China, North Korea, Cambodia, Burma -This
1. 3 answers
2. asked by mysterychicken
3. 780 views
Create a (simplified) rational function that has the following asymptotes.(show work) y=0, x=-3, x=0, and x=2
1. 2 answers
2. asked by Anonymous
3. 406 views
In what way is a kid's budget similar to an adult's budget?A.The goal for both is to have less money going out than coming in.
1. 4 answers
2. asked by Rezu
3. 2,082 views
One of the 79.0 -long strings of an ordinary guitar is tuned to produce the note (frequency 245 ) when vibrating in its
1. 2 answers
2. asked by Kelly
3. 1,007 views
A MONKEY CLIMBED TO THE TOP OF A TREE. THE TREE IS 40 METERS HIGH AND THE MONKEY WEIGHS 6 KG. HOW MUCH POTENTIAL ENERGY DOES THE
1. 2 answers
2. asked by GHG
3. 509 views
What happens to the concentration ofNO(g) when the total pressure on the equilibrium reaction 3NO2(g) + H2O <---> 2HNO3(aq) +
1. 2 answers
2. asked by luke
3. 690 views
I'm having a lot of trouble with graphing trig functions.Can anyone tell me how to graph this equation on a graphing calculator?
1. 1 answer
2. asked by Peter pan
3. 629 views
is the area of a paperback book cover closer to 28 square inches or 28 square centimeters
1. 2 answers
2. asked by daniella
3. 439 views
Given the equation 2C8H18 + 25O2 = 16 CO2 + 18H2O: The combustion of octane produces carbon dioxide and water. If you start with
1. 1 answer
2. asked by Brittany
3. 872 views
The densities of four different woods are shown below.Wood Sample Densities Type of wood: African Teakwood Density(g/cm3) 0.98
1. 2 answers
2. asked by Lana Grib
3. 2,307 views
What rhetorical devices were used in Seom on the mount
1. 1 answer
2. asked by Bre
3. 377 views
what is the Gerund phrase and Noun function in these sentences?1)Writing a research paper sounds difficult. 2)He must like
1. 2 answers
2. asked by cody
3. 896 views
what is the function of the italicized infinitive phrase in these sentences?1)May I have permission to use the car tonight? 2)He
1. 2 answers
2. asked by cody
3. 525 views
what is the adverb in the sentence: kevin seemed unusually excited at the party.
1. 1 answer
2. asked by bobby
3. 383 views
Who makes up the Council of Economic Advisers?
1. 3 answers
2. asked by Anonymous
3. 375 views
Stacey drew a triangle on a coordinate plane. She wrote down the ordered pair for each vertex. How many ordered pairs did she
1. 2 answers
2. asked by Anan
3. 489 views
Which of the following statments about standing committees is true?A. They exist in the house but not in the senate. B. They all
1. 4 answers
2. asked by Anonymous
3. 944 views
Allegra's favorite ride at the Barrel-O-Fun Amusement Park is the Flying Umbrella, which is lifted by a hydraulic jack. The
1. 5 answers
2. asked by DAN
3. 2,940 views
write a road race program for the event 5k Run and Walk Road Race using data structures
1. 0 answers
2. asked by scot
3. 388 views
I'm trying to put this parabola in standard form which is: (y-k)^2=4p(x-h)The equation is x=(1/12)(y-2)^2 +6 Here is what i have
1. 1 answer
2. asked by Lala
3. 544 views
find all values of 2sin theta-3csc theta=-5
1. 1 answer
2. asked by mattie
3. 422 views
Why is the necessary and proper clause important?
1. 7 answers
2. asked by Anonymous
3. 520 views
Posson Catering uses two measures of activity, jobs and meals, in the cost formulas in its budgets and performance reports. The
1. 1 answer
2. asked by Deborah
3. 1,533 views
"The measure of an angle is 6 more than 3 times the measure of its compliment. i know the quation is X+3x+6 but how do i solve
1. 1 answer
2. asked by Danielle
3. 522 views
(2x^5y3)^4*3xy^2
1. 1 answer
2. asked by max
3. 409 views
(2x^5y3)^4*3xy^2
1. 1 answer
2. asked by max
3. 290 views
what is the function of the italicized infinitive phrase in these sentences?1)May I have permission to use the car tonight? 2)He
1. 8 answers
2. asked by jason
3. 767 views
What do you think Great Britain could, or should have done to make the partition of India more efficient and less violent?
1. 3 answers
2. asked by Alissa
3. 1,105 views
Which is the best way to measure public opinion?A.) the media B.) opinion polls C.) interest groups D.) elected officials I'm
1. 3 answers
2. asked by Anonymous
3. 676 views
A bowling ball rolls without slipping up a ramp that slopes upward at an angle (beta) to the horizontal. Treat the ball as a
1. 1 answer
2. asked by Joe
3. 7,800 views
Find the value of x and y in a right triangle. The hypotenuse has a length of 12 and 6. Y is on the leg and x is in the inside
1. 2 answers
2. asked by Cassie
3. 444 views
I have some questions related to diabetes. Im just wondering if someone's fasting glucose level could be different if they have
1. 0 answers
2. asked by kayla
3. 991 views
what is the Gerund phrase and Noun function in these sentences?1)Writing a research paper sounds difficult. 2)He must like
1. 7 answers
2. asked by jason
3. 1,421 views
You are required to design and write an application that will analyze an input file (InputFile.txt); the file contains a date on
1. 2 answers
2. asked by Anonymous
3. 618 views
ms. sue for story yesterday i hve these other questionswhy does author end with "eyes" because she experience everything with
1. 16 answers
2. asked by Mohammad
3. 758 views
Determine whether each system of linear equations has a)one and only one solution, b)infinitely many solutions, or c) no
1. 1 answer
2. asked by bob
3. 553 views
The demand function for a certain commodity is approximated by: p = 100e-q/2where "q" is the number of units demanded at a price
1. 3 answers
2. asked by tanya
3. 965 views
John ties the leash of his dog to the corner of the doghouse. The dimensions of the dog house are 8ft x 8ft, and the leash is
1. 1 answer
2. asked by nicole a
3. 882 views
A water tank is shaped like an inverted right circular cone with a base radius of 14 feet and a height of 25 feet high. If water
1. 0 answers
2. asked by Joe
3. 726 views
A boat is pulled into a dock by means of a rope attached to a pulley on the dock. The rope is attached to the front of the boat,
1. 0 answers
2. asked by Joe
3. 906 views
John ties the leash of his dog to the corner of the doghouse. The dimensions of the dog house are 8ft x 8ft, and the leash is
1. 1 answer
2. asked by nicole a
3. 497 views
A spherical snowball is melting so that its diameter is decreasing at rate of 0.1 cm/min. At what is the rate is the volume of
1. 1 answer
2. asked by Joe
3. 688 views
What is one consequence of going into bankruptcy?A.Losing the ability to make a budget. B.Losing your job C.Having some of your
1. 8 answers
2. asked by Rezu
3. 1,689 views
A street light is at the top of a 19 foot tall pole. A 6 foot tall woman walks away from the pole with a speed of 7 ft/sec along
1. 1 answer
2. asked by Joe
3. 4,347 views
Which of the following tactics did many States once use to disenfranchise African American voters?A. "motor voter" laws B. age
1. 7 answers
2. asked by Austin
3. 1,394 views
Why do Muslims make a pilgrimage to Mecca?
1. 1 answer
2. asked by i dont want to say
3. 471 views
Find the solution of the given system by the method of addition that was used in Examples 4 and 5. If there is no solution or
1. 1 answer
2. asked by tanya
3. 360 views

Back to April 2012

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024