Archives
2012
February

Questions Asked on February 7, 2012

Carbon dioxide gas has a solubility of 0.0972 g/100 g H2O at 40 degrees celsius. Expressed in parts per million, this
1. 5 answers
2. asked by Bob
3. 6,042 views
Find the points on the curve below at which the tangent is horizontal. Use n as an arbitrary integer. (Enter your answers as a
1. 1 answer
2. asked by holly
3. 5,929 views
When the following molecular equation is balanced using the smallest possible integer coefficients, the values of these
1. 4 answers
2. asked by Eliazbeth
3. 5,852 views
A ladder 42 feet long is place so that it will reach a window 30 feet high (first building) on one side of a street; if it is
1. 6 answers
2. asked by Alianne
3. 5,425 views
A scientist wants to make a solution of tribasic sodium phosphate,Na3PO4 , for a laboratory experiment. How many grams of Na3PO4
1. 3 answers
2. asked by ASh
3. 5,247 views
At ordinary body temperature (37 C) the solubility of N2 in water in contact with air at ordinary atmospheric pressure (1.0 atm)
1. 3 answers
2. asked by Jeremy
3. 4,372 views
Determine a formula for the change in surface area of a uniform solid sphere of radius r if its coefficient of linear expansion
1. 1 answer
2. asked by noah
3. 3,895 views
How much heat is required in order to change 5 g of ice at -15 degree to steam at 150 degree?
1. 1 answer
2. asked by joan
3. 3,885 views
For the reaction I2(g) + Br2(g) 2 IBr(g), Kc = 280. at 150.°C. Suppose that 0.590 mol IBr in a 2.50-L flask is allowed to reach
1. 6 answers
2. asked by Stan3000
3. 3,613 views
A 75 kg skydiver in free fall is subjected to a crosswind exerting a force of60 N and to a vertical air resistance force of 100
1. 1 answer
2. asked by alex
3. 3,556 views
At 80.°C, Kc = 1.87 10-3 for the reaction.PH3BCl3(s) PH3(g) + BCl3(g) (a) Calculate the equilibrium concentrations of PH3 and
1. 4 answers
2. asked by Stan3000
3. 3,069 views
Calculate the mass of a quart (946 mL) of mercury. The density of mercury us 13.6 g/mL?
1. 3 answers
2. asked by Mike
3. 2,906 views
A man weighing 700 N lifts a 50.0 N object 2.0 m high. He uses a lever and with a force of 10.0 N. What is the resistance force
1. 2 answers
2. asked by Pat
3. 2,898 views
the largest watermelon ever grown had a mass of 118 kg. suppose this watermelon were exhibited on a platform 5 m above the
1. 1 answer
2. asked by bob
3. 2,816 views
a 20 kg rock is on the edge of a 100 m cliff . the rock falls from the cliff , what is its kinetic energy just before it hits
1. 3 answers
2. asked by bob
3. 2,678 views
A rescue plane wants to drop supplies to isolated mountain climbers on a rocky ridge H = 231 m below. If the plane is traveling
1. 1 answer
2. asked by Kim
3. 2,644 views
Julie is going to the mall. She has 15 coins in her pocket that nadd up to $2.18. She has the same number of pennies as she does
1. 6 answers
2. asked by tj
3. 2,574 views
Please check these thanks.1. In a titration, 33.21 mL 0.3020M rubidium hydroxide solution is required to exactly neutralize
1. 3 answers
2. asked by missy
3. 2,442 views
1. Study the following sentence, then select the answer thatbest describes it. THE COW JUMPS OVER THE MOON! A. Italic serifed
1. 1 answer
2. asked by Samantha
3. 2,404 views
find the exact value of sin(-15pi/6) and cot(-7pi/6)
1. 2 answers
2. asked by Purplechick4
3. 2,323 views
A stuntman sitting on a tree limb wishes to drop vertically onto a horse galloping under the tree. The constant speed of the
1. 1 answer
2. asked by Christina
3. 2,147 views
a large chunk of ice with mass 15 kg falls from a roof 8 m above the ground . find the kinetic energy of the ice when it reaches
1. 1 answer
2. asked by lala
3. 2,085 views
A ball is tossed from an upper-story window of a building. The ball is given an initial velocity of 8.15 m/s at an angle of
1. 1 answer
2. asked by Chloe
3. 1,905 views
Two identical thermometers made of pyrex glass contain,respectively identical volumes of mercury and methyl alcohol.If the
1. 1 answer
2. asked by noah
3. 1,905 views
I really need help on this problem.A sector has area of 15 in^2 and central angle of 0.2 radians. Find the radius of the circle
1. 1 answer
2. asked by missy
3. 1,805 views
What is the value of the rate constant at 17 degrees celsius?The Ea = 122 kJ/mol I know I have to use ln k = ln A - Ea/RT.. but
1. 8 answers
2. asked by Vicky
3. 1,789 views
. A rock thrown horizontally at a large bell 57.0 m away is heard to hit the bell 4.10 s later. If the speed of sound is 330
1. 1 answer
2. asked by Nicole
3. 1,741 views
The base of a regular pyramid is a square whose sides have a length 8 cm. If a lateral edge of this pyramid has length 20 cm,
1. 3 answers
2. asked by Fustrated
3. 1,741 views
Cyclopropane, C3H6, is converted to its isomer propylene, CH2=CHCH3, when heated. The rate law is first order in cyclopropane,
1. 1 answer
2. asked by Keigan
3. 1,689 views
How many GRAMS of sulfur are present in 1.53 moles of sulfur dichloride ?grams. 2. How many MOLES of chlorine are present in
1. 2 answers
2. asked by love
3. 1,684 views
Mrs. Klein made some tarts. She sold three fifths of them in the morning and one fourth the remainder in the afternoon. If she
1. 1 answer
2. asked by Valerie
3. 1,682 views
How many grams of mercury are formed from 47.0 of HgO?How many grams of oxygen are formed from 47.0 of HgO? How many grams of
1. 1 answer
2. asked by ASh
3. 1,676 views
A stuntman sitting on a tree limb wishes to drop vertically onto a horse galloping under the tree. The constant speed of the
1. 2 answers
2. asked by Haroula
3. 1,637 views
to produce 4.00 mole if c6h12 from the following how many grams of c6h6 must you combine78.12 g/mol c6h6 + 2.02 g/mol h2 = 84.18
1. 1 answer
2. asked by Amber
3. 1,588 views
You drop a ball from a window on an upper floor of a building and it is caught by a friend on the ground when the ball is moving
1. 1 answer
2. asked by Haroula
3. 1,558 views
1.29g H2 is allowed to react with 10.3g N2 , producing 1.86g NH3.What is the theoretical yield for this reaction under the given
1. 1 answer
2. asked by ASh
3. 1,553 views
in a triangle XYZ,the measure of angle Y is 40 more than the measure of angle X.the measure of angle Z is 10 less than three
1. 1 answer
2. asked by tanya
3. 1,545 views
Two athletes are pulling on a ring. One athlete pulls with a force of 150 N ina northerly direction. The second athlete pulls
1. 1 answer
2. asked by alex
3. 1,525 views
A building is 1ft from an 11ft fence that surrounds the property. A worker wants to wash a awindow in the building 14ft from the
1. 2 answers
2. asked by Kenna Mask
3. 1,524 views
Evaluate limit squareroot of (x^4 - 16)/(x^3 - 8) as x approaches 2
1. 1 answer
2. asked by victor.m
3. 1,507 views
A dilute aqueous solution of an organic compound soluble in water is formed by dissolving 2.35 g of the compound in water to
1. 2 answers
2. asked by Jeremy
3. 1,478 views
A hunter at a distance dx from a coconut tree points the nuzzle of his gun directly at a monkey sitting on the tree at a height
1. 1 answer
2. asked by erwin
3. 1,463 views
An athlete swings a 3.46 kg ball horizontallyon the end of a rope. The ball moves in a circle of radius 0.55 m at an angular
1. 2 answers
2. asked by Holly
3. 1,462 views
What mass of oxygen is needed for the complete combustion of 2.50×10−3 of methane?
1. 2 answers
2. asked by ASh
3. 1,461 views
in 1989 michel menin of france walked on a tightrope suspended under a balloon nearly at an altitude of 3150 m above the ground
1. 2 answers
2. asked by bob
3. 1,448 views
Danny sails a boat downstream. The wind pushes the boat along at 21 km/hr. The current runs downstream at 15 km/hr. What is the
1. 2 answers
2. asked by linds
3. 1,436 views
Given: G = 6.67259 × 10−11 Nm2/kg2The acceleration of gravity on the surface of a planet of radius R = 3430 km is 4.43
1. 1 answer
2. asked by anonymous
3. 1,357 views
Hi! I have recently completed a bunsen burner lab and need help with a few conclusion questions:1) What kind(s) of energy is
1. 1 answer
2. asked by Cicilia
3. 1,352 views
What is the molality of KBr in a solution made by dissolving 2.21 g of KBr in 897g of water
1. 2 answers
2. asked by Tyra
3. 1,314 views
A parallel plate capacitor with plate separation d is connected to a battery. The capacitor is fully charged to Q Coulombs and a
1. 0 answers
2. asked by Jeff
3. 1,314 views
What mass of water is produced from the complete combustion of 2.50×10−3 of methane?
1. 1 answer
2. asked by ASh
3. 1,312 views
4. The temperature is falling 3 degrees per hour. How many degrees has it fallen altogether from 12 noon to 12 midnight?
1. 3 answers
2. asked by Randy
3. 1,297 views
keenan corp. is comparing two different capital structure.plan 1: would result in 7000 shares of stock and $160,000 in debt.
1. 1 answer
2. asked by chaterine
3. 1,294 views
at 12 noon ship A is 65 km due north of a second ship B. Ship A sails south at a rate of 14km/hr, and ship B sails west at a
1. 1 answer
2. asked by Keya
3. 1,241 views
What are the three major forms of printmaking that were developed after the printing press was invented? Name the artist
1. 0 answers
2. asked by Jacqueline
3. 1,238 views
Amistad starts selling tickets to basketball games. They sell 292 tickets to the last game of the season. An adult ticket costs
1. 1 answer
2. asked by Anonymous
3. 1,199 views
what is the genre of the poem: tonight i can write by pablo neruda?
1. 1 answer
2. asked by sara
3. 1,161 views
if (0,-7) lies on the terminal side of angle theta in standard position, find each value sec(theta) , cot(theta) and sin(theta)
1. 1 answer
2. asked by Purplechick4
3. 1,152 views
the ratio of mango juice to guava juice in Paradise Punch is 5 to 3. Leilani has 32 fl oz of mango juice. How much guave juice
1. 1 answer
2. asked by Anonymous
3. 1,147 views
Two point charges each of magnitude 2.14 µC are located on the x axis. One is at x = 1.00 m and the other is at x = -1.00 m.(a)
1. 1 answer
2. asked by Anonymous
3. 1,127 views
a soccer ball is kicked from the ground with an initial speed of 19.5 meter per second at upward of 45 degrees. a player 55
1. 2 answers
2. asked by xai
3. 1,127 views
A projectile is fired in such a way that its horizontal range is equal to 2.6 times its maximum height, what is the angle of
1. 1 answer
2. asked by Buster
3. 1,109 views
I've got another question. it's similar to this but this time with Kp. Here's the question:For the equilibrium 2IBr(g) <-> I2(g)
1. 2 answers
2. asked by Stan3000
3. 1,101 views
You pick up a board of length 2.60 m and mass 13.00 kg. To do this, you exert a force upward with your left hand a distance
1. 1 answer
2. asked by Anonymous
3. 1,078 views
if (0,-7) lies on the terminal side of angle theta in standard position, find each value sec(theta) , cot(theta) and sin(theta)
1. 1 answer
2. asked by Laura
3. 1,070 views
a rope 60m long and 5cm in diameter is coiled tightly. Estimate, correct to one significant figure, the radius of the 'circle'
1. 2 answers
2. asked by joe
3. 1,057 views
An electron orbits a 3.0 cm diameter metal ball 5.0 mm above the surface. The orbital period of the electron is l2.0 micro
1. 0 answers
2. asked by Collin
3. 1,057 views
For the following reaction, 0.390 moles of nitrogen gas are mixed with 0.139 moles of oxygen gas.nitrogen (g) + oxygen (g)
1. 2 answers
2. asked by Eliazbeth
3. 1,057 views
You pick up a board of length 2.60 m and mass 13.00 kg. To do this, you exert a force upward with your left hand a distance
1. 1 answer
2. asked by Anonymous
3. 1,047 views
Cedric cashed a $125 check at the bank. The teller gave Cedric his money in $5 and $10 bills only. If the teller gave Cedric
1. 1 answer
2. asked by Rose
3. 1,040 views
The demand curve for haircuts at Terry’s Hair Design is P=20-0.20QWhere Q is the number of cuts per week and P is the price of
1. 0 answers
2. asked by Anonymous
3. 1,039 views
solve using multiplication method: 8x-9y=-15 -4x=19+y
1. 1 answer
2. asked by guy
3. 1,016 views
An enemy ship is on the western side of a mountain island. The enemy ship can maneuver to within 2520 m of the 1850 m high
1. 2 answers
2. asked by Jeremy
3. 1,004 views
Calculate the density of a metal object that has a dull surface and an irregular shape. It has a mass of 321 grams and a volume
1. 3 answers
2. asked by Tia
3. 988 views
The base of a regular pyramid is a hexagon whose sides have length 5 ft. If a lateral edge of this pyramid has length 9 ft, what
1. 2 answers
2. asked by Fustrated
3. 981 views
A mole of air (80% Nitrogen, and 20% Oxygen by volume) at 298.15K is brought into contact with liquid water which has a vapor
1. 0 answers
2. asked by Nate
3. 967 views
8. Determine which, if any, of the three statements are equivalent. Give a reason for your conclusion. Show complete work.I.) If
1. 0 answers
2. asked by cody
3. 955 views
If A + B + C = 180° prove thatSin2A + sin2B – sin2C = 4cosAcosBsinC
1. 1 answer
2. asked by Kewal
3. 955 views
What is concluded about one of Mendel's short pea plants?A. It has one dominant and one recessive gene B. It has a pair of
1. 0 answers
2. asked by Andrew
3. 952 views
The sum of three consecutive integers is -96. What is the largest integer?
1. 1 answer
2. asked by bob
3. 949 views
You currently have $7,500 to invest. You can invest the full amount now for a periodof 9 years at which time you want to have
1. 2 answers
2. asked by lay lay
3. 949 views
uu) lim ln(1-x) as x->1-yy) lim (√(6-x)-2)/(√(3-x)-1) as x-> 2 zz) lim (1-(1/2)arctanx) as x->-∞ bbb) lim ln|1-x| as x->1
1. 2 answers
2. asked by Emily
3. 946 views
A three-digit number increases by 9 if we exchange the second and third digits. The same three-digit number increases by 90 if
1. 1 answer
2. asked by Please Help
3. 944 views
The students in the Art Club are tiling a wall at the entrance to room 111 that is 8 ft by 16 ft. They are using tiles that are
1. 2 answers
2. asked by itza
3. 934 views
The vapor pressure of the liquid HF is measured at different temperatures. The following vapor pressure data are obtained.Temper
1. 4 answers
2. asked by Hannah
3. 934 views
What is the volume of 4.00 grams of air if the density of air at the time of the measurement is 1.19 g/l?
1. 1 answer
2. asked by Lisa
3. 912 views
A kayak moves at a rate of 10 mph in still water. If the river's current flows at a rate of 2 mph, how long does it take the
1. 1 answer
2. asked by Andy
3. 899 views
what are the errors in the measured values g=9.910 m/s^2 amd 9.805? true value 9.797 for 9.910 i got 0.113 and for 9.805 i got
1. 1 answer
2. asked by lou
3. 891 views
A regular hexagon has side lengths 15 in. The perimeter of the hexagon is 90 in. A second hexagon has side lengths 18.75 in.
1. 2 answers
2. asked by bob
3. 888 views
The freezing-point depression is -0.930 Celsius degree. Determine the molality of the solution of an unknown nonelectrolyte in
1. 1 answer
2. asked by vivian
3. 884 views
What mass of carbon dioxide is produced from the complete combustion of 2.50×10−3 of methane?
1. 1 answer
2. asked by ASh
3. 881 views
When the plebeians demanded an assembly, what did the Senate do to satisfy their demands and how did it turn out for Rome? Can
1. 2 answers
2. asked by running.from.myself
3. 881 views
the sum of the 3rd and the 4th term is 44 and the sum of the 10th and the 15th term is 203. what is the sum up to the 20th term?
1. 1 answer
2. asked by linda
3. 880 views
I urgenlty need you to check these sentences, too. I need to be extremely convincing but also determined.1) We also agreed to
1. 1 answer
2. asked by Henry2
3. 864 views
A disc jockey has 10 songs to play. Seven are slow songs, and three are fast songs. Each song is to be played only once. In how
1. 1 answer
2. asked by dave
3. 859 views
what is volume of hydrogen at STP of hydrogen collected over water at 10 degrees and 105.5 kPa
1. 0 answers
2. asked by Anonymous
3. 859 views
I just wanted to add a few more things. I urgently need to express them.1) We keep emailing each other (two people involved) in
1. 1 answer
2. asked by Henry2
3. 857 views
At 20 degrees celsius ,if the equation is C7H6O3(s)+C4H6O3(l)=C9H8O4+HC2H3O2(l), then how many liters of acetic acid, HC2H3O2 ,
1. 1 answer
2. asked by Rene'
3. 841 views
A parallel plate capacitor with plate separation d is connected to a battery. The capacitor is fully charged to Q Coulombs and a
1. 1 answer
2. asked by archi
3. 837 views
At what tempature will .0100 moles of argon gas have a volume of 275mL at 100 kPa? please this is due tommorrow really need som
1. 2 answers
2. asked by Noble Hauck
3. 829 views

Back to February 2012

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025