Archives
2011
September

Questions Asked on September 27, 2011

A 0.28-kg stone is held 1.5 m above the top edge of a water well and then dropped into it. The well has a depth of 4.8 m.(a)
1. 2 answers
2. asked by Anonymous
3. 13,432 views
give me examples of physical features?
1. 22 answers
2. asked by jennifer white
3. 11,032 views
There are 12 questions on an examination, and each student must answer 8 questions including at least 4 of the first 5
1. 2 answers
2. asked by Rebecca
3. 6,625 views
measure of angle ABC=4x-12measure of angle ABX=24 BX bisects ABC solve for X and find the measure of angle ABC **page 48 # 11 of
1. 5 answers
2. asked by Terry
3. 5,508 views
The riddle of my paper is asking "What Do the Fans Sing at University of California Football Games? Please help me out.The page
1. 11 answers
2. asked by Anonymous
3. 4,844 views
Complete and balance the following equation.MnO4^‾ (aq) + CH3OH(aq) �¨ Mn^2+(aq) + HCO2H(aq) (acidic solution) I KNOW ITS a
1. 1 answer
2. asked by komal
3. 4,213 views
A vector has an x-component of −21.0units and a y-component of 36.5 units. Find the magnitude and direction of the vector.
1. 2 answers
2. asked by Imani
3. 4,036 views
Find a cofunction with the same value as sin 19 degrees
1. 2 answers
2. asked by Jessica
3. 3,121 views
A ball rolls down a hill with a constant acceleration of 2.0 m/s2. If the ball starts from rest, (a) what is its velocity and
1. 2 answers
2. asked by Me
3. 3,114 views
give one word/term for each of the following descriptions. 1.A substance that donates electrons in chemical reaction. 2.The
1. 5 answers
2. asked by marcia
3. 2,868 views
There are 52 blades of grass in 2 square inches of lawn. there are 580 blades of grass in 8 square inches of the same lawn. what
1. 1 answer
2. asked by Hollie
3. 2,623 views
17. In the Mass in Motion lab, you rolled a ball down a ramp to see how far it moved a cup. What did this experiment
1. 1 answer
2. asked by Maddie J.
3. 2,591 views
Please check my answers I really need to do my homeowrk!;This are polar coordinates we're studying-I'm almost positive the first
1. 1 answer
2. asked by Jonathan
3. 2,491 views
Reasonableness Sun-Yi estimated 270+146 and got 300. Is her estimate resonable? Explain.
1. 11 answers
2. asked by boss
3. 2,252 views
A 70.0-kg runner has a speed of 5.90 m/s at one instant during a long-distance event.What is the runner's kinetic energy at this
1. 1 answer
2. asked by Anonymous
3. 2,119 views
In order to study whether IQ level is related to birth order, data were collected from a sample of 540 students on their birth
1. 2 answers
2. asked by Lauren
3. 2,014 views
A person pushes on a 62-kg refrigerator with a horizontal force of -256 N; the minus sign indicates that the force points in the
1. 1 answer
2. asked by Natalie
3. 1,883 views
When a 3.00-kg object is hung vertically on a certain light spring described by Hooke's law, the spring stretches 3.07 cm.(a)
1. 1 answer
2. asked by Allie
3. 1,863 views
Hard water contains Ca ,Mg ,Fe and , which interfere with the action of soap and leave an insoluble coating on the insides of
1. 5 answers
2. asked by Brennan
3. 1,739 views
a two digit number has more ones than tens.what could the number be?how do you know your number is correct?how many number can
1. 3 answers
2. asked by rabia
3. 1,713 views
show25broken key is 5 show in 3 ways
1. 5 answers
2. asked by tanisha
3. 1,619 views
What are the capitals of the two states that border both the Mississippi and Ohio Rivers?
1. 7 answers
2. asked by Sean
3. 1,614 views
The sum of two forces, one having a magnitude of 8 N acting due west and other having a magnitude of 6 N acting due north is
1. 1 answer
2. asked by Dee
3. 1,595 views
An unknown element reacts with bromine to give bromide, MBr3. If 2.809g of the unknown element gives 27.765grams of MBr3, what
1. 2 answers
2. asked by Smarth
3. 1,546 views
i need to find the outlier of each set of data. and I need to describe how the outlier affects the mean?1) 75 72 74 46 77 70 80
1. 7 answers
2. asked by Marko
3. 1,500 views
Which statement is not a benefit of increased development?1)improved access to health care 2)increased wealth 3)more even
1. 2 answers
2. asked by Wyatt
3. 1,499 views
Why is it important to read the title of a reading passage first and think about the information to come?A. It help up your
1. 3 answers
2. asked by ciara
3. 1,488 views
Isaac newtons theory of universal gravitation states that the equation F=G m^1m^2/r^2 can be used to calculate the amount of
1. 1 answer
2. asked by Austin
3. 1,459 views
A person throws a ball upward into the air with an initial velocity of 15.0 m/s.Calculate the following: a.) how high it goes.
1. 1 answer
2. asked by Phil
3. 1,457 views
concentrated sulfuric acid has a density of 1.84 g/ml. calculate the mass in grams of 1.00 liter of this acid
1. 1 answer
2. asked by grace
3. 1,456 views
IF A RUNNER RUNS THE 100 METER DASH IN APPROXIMATELY 9.7 SEC, WHAT IS THE AVERAGE SPEED OF THE RUNNER IN MPH?
1. 2 answers
2. asked by MANN
3. 1,440 views
how can finding 4x3=12 help you find the product of 8x3?
1. 4 answers
2. asked by symone
3. 1,399 views
An automobile and train move together alongparallel paths at 39.1 m/s. The automobile then undergoes a uniform acceleration of
1. 1 answer
2. asked by Swag
3. 1,368 views
How many silver coins (weighing 26g each) would it take to provide 5 moles of silver(Ag).
1. 1 answer
2. asked by Anonymous
3. 1,359 views
1. Which of the following will result in a chemical change?A. Melting ice to obtain water B. Evaporating alcohol into vapor C.
1. 3 answers
2. asked by Anonymous
3. 1,347 views
Ramon planted 3 rows of seeds. He put 8 seeds in each row. Each row of seeds was 42 inches long. How far apart did Ramon plant
1. 5 answers
2. asked by Tyler
3. 1,340 views
Suppose we want to charge a flask with 4.0 g of sugar. We put the empty flask on a balance and it is determined to weigh 190 g.
1. 4 answers
2. asked by haley
3. 1,321 views
If I threw a ball vertically at an initial speed of 34.5 m/s, how many seconds would it take to reach its maximum height?
1. 1 answer
2. asked by Anonymous
3. 1,303 views
The lengths of two sides of a triangle are 6cm and 4cm and the angle between them is 130degree. What is its area?
1. 1 answer
2. asked by Haseena
3. 1,291 views
suppose ua penguin eats about 5 pounds of akrill aday.about what number of krill does the penguin eat in 100 days (hint :1pound
1. 2 answers
2. asked by mily
3. 1,264 views
A person throws a ball upward into the air with an initial velocity of 15.0 m/s.Calculate the following: a.) how high it goes.
1. 1 answer
2. asked by Jane
3. 1,255 views
at a certain college, there were 700 science majors,100 engineering majors and 500 business majors. if one student was selected
1. 1 answer
2. asked by carol
3. 1,245 views
Write a declarations and input statements necessary to read each of the following sets of data values into variables of the
1. 3 answers
2. asked by Marilyn
3. 1,234 views
How did Henry the Navigator help more people explore??
1. 1 answer
2. asked by Mary
3. 1,206 views
an isosceles triangle is such that each of the base angles is twice the vertical angle. Find the angles of the triangle
1. 1 answer
2. asked by ferjam
3. 1,179 views
A bus that is traveling at 31.0 km/h, speeds up at a constant rate of 3.7 m/s2. What velocity does it reach 6.8 s later?
1. 0 answers
2. asked by Anonymous
3. 1,176 views
Four darts are thrown at a dart board with four rings, each ring has a different value, If all four darts hit the board, how
1. 2 answers
2. asked by dennis
3. 1,170 views
A person walks 15.0° north of east for 3.70 km. How far due north and how far due east would she have to walk to arrive at the
1. 1 answer
2. asked by Imani
3. 1,159 views
The identities cos(a-b)=cos(a)cos(b)sin(a)sin(b) and sin(a-b)=sin(a)cos(b)-cos(a)sin(b) are occasionally useful. Justify them.
1. 2 answers
2. asked by Elle
3. 1,155 views
i need to draw a fraction strip showing that the two fractions 2/5 and 6/15 are equivalent. i forgot how to do this
1. 1 answer
2. asked by ari
3. 1,143 views
1. On final examination in Business Law, the mean was 68 and the standard deviation was 12. Determine the standard scores of
1. 2 answers
2. asked by niki
3. 1,113 views
A baseball pitcher can throw a baseball at a velocity of 44.5 m/s. If the mass of the ball is 0.12 kg and the pitcher has it in
1. 0 answers
2. asked by Please Help!!!
3. 1,108 views
GIVE AN EXAMPLE OF THE SUM OF 2 BINOMIALS THAT IS A BINOMIAL
1. 1 answer
2. asked by hoover
3. 1,106 views
11. The physical changes that prepare your body to respond quickly and appropriately to stressors are medical alert responses.a.
1. 1 answer
2. asked by mysterychicken
3. 1,099 views
Indicate the alternative that both correctly evaluates the following sentence and correctly explains the reason for the
1. 3 answers
2. asked by Kasey
3. 1,093 views
Six hundred pennies are placed in a row. If every other penny is replaced by a nickel and every third coin is replaced by a
1. 1 answer
2. asked by mel
3. 1,072 views
Suppose that the point P is the point on the unit circle that is associated by the wrapping function with the number 31. In
1. 1 answer
2. asked by zack
3. 1,070 views
Each of the following exercises shows the original source, and then a student’s sentence and/or citation about that source.
1. 5 answers
2. asked by Anonymous
3. 1,066 views
A chemical plant uses electrical energy to decompose aqueous solutions of NaCl to give Cl2,H2, and NaOH:2NaCl(aq)+2H2O(l)-->2NaO
1. 0 answers
2. asked by Brennan
3. 1,062 views
Is the subject line "Improving Customer Service" appropriate in a message to superiors?a. Yes, because it focuses on solving the
1. 4 answers
2. asked by Kasey
3. 1,060 views
Which of the following activities would best be suited for scanning?A. finding answers to the chapter review in history. B.
1. 8 answers
2. asked by ciara
3. 1,058 views
NEED NOW!!!!!!!!!!!!!! how many groups are there in the periodic table? and how many periods are there in the periodic table?
1. 4 answers
2. asked by sammie doodles :-)
3. 1,050 views
Please check my answers;1.Which of the folowing is another representation of (-3,pi)? (3,120degree) (3,0 degree)I think it is
1. 0 answers
2. asked by Jonathan
3. 1,037 views
find two functions f and g such that (f+g)(x) = 5 and domain of f + g is [0, infinity)
1. 1 answer
2. asked by m
3. 1,034 views
Which of the following statements explains why threats are NOT effective for motivating people?a. Threats reduce tension. b.
1. 2 answers
2. asked by Kasey
3. 1,033 views
The speed of light in clear plastic is 1.866 ×10^8 m/s. A ray of light enters the plastic at an angle of 29.3 degrees.At what
1. 0 answers
2. asked by Ari
3. 1,009 views
an arrow is shot from a cliff at an angle of 0 degrees with respect to the vertical at a speed of 30m/sec. It takes 4 seconds
1. 0 answers
2. asked by gen
3. 995 views
Which of the following is an example of active readiing?A.skimming over information and taking notes. B.reviewing a chapter,
1. 5 answers
2. asked by ciara
3. 989 views
how many periods are there in the main body of the periodic table?
1. 3 answers
2. asked by sammie doodles :-)
3. 964 views
Jen spends half his money on lunch and then spends $1.50 for a magazine. He uses one third of what he has left to pay for the
1. 0 answers
2. asked by Sitara
3. 964 views
what compound would form if acetyl salicylic and sodium hydroxide are reacted?
1. 2 answers
2. asked by tonya
3. 962 views
A 1200 kg car on a horizontal surface starts from rest and accelerates uniformly to 72 km/h in 20.0 s. Friction exets an average
1. 1 answer
2. asked by janeae
3. 951 views
a piece of (density= 10.5 g/ml)dropped into water displaces 21.56 ml of water. what is the mass (in grams) of this piece of
1. 1 answer
2. asked by jj
3. 934 views
Find all values of x in the interval [0, 2π] that satisfy the equation.6 sin2(x) = 3
1. 1 answer
2. asked by christopher
3. 896 views
From data below, calculate the total heat (J) needed to convert 0.757 mol of gaseous ethanol (C2H6O) at 151°C and 1 atm to
1. 1 answer
2. asked by Madison
3. 891 views
When you are writing subject lines for negative messages to peers and subordinates:a. put the topic, but not your action on it,
1. 3 answers
2. asked by Kasey
3. 890 views
Objects of masses m1 = 4.00 kg and m2 = 9.00 kg are connected by a light string that passes over a frictionless pulley as in the
1. 1 answer
2. asked by trey
3. 887 views
1. Find the indefinite integral.Indefinite integral tan^3(pix/7)sec^2(pix/7)dx 2. Find the indefinite integral by making the
1. 1 answer
2. asked by Zooey
3. 872 views
In a hypochlorite oxidation reaction, cyclohexanol plus NaOCL & aq HOAc results in cyclohexanone. The intermediate in this
1. 2 answers
2. asked by Anonymous
3. 871 views
A 0.38-kg particle has a speed of 2.0 m/s at point A and kinetic energy of 7.5 J at point B.(a) What is its kinetic energy at A?
1. 1 answer
2. asked by Anonymous
3. 867 views
Use the supply and demand model to explain what happens to the equilibrium price and the equilibrium quantity for frozen yogurt
1. 1 answer
2. asked by allie
3. 864 views
A ball rolls down a hill with a constant acceleration of 2.0 m/s2. If the ball starts from rest, (a) what is its velocity and
1. 1 answer
2. asked by Me
3. 857 views
ok so i was learning about cell theory and i am really stuck on this questionThe text describes one of the scientific theories
1. 1 answer
2. asked by Anonymous
3. 850 views
a shoe box measures 12.0 inches by 5.5 inches by 3.5 inches. calculate its volume in cubic centimeters.
1. 1 answer
2. asked by robert
3. 850 views
Objects of masses m1 = 4.00 kg and m2 = 9.00 kg are connected by a light string that passes over a frictionless pulley as in the
1. 0 answers
2. asked by trey
3. 844 views
A circus performer is juggling clubs while standing on stilts. He released a club from a point 8 feet above the ground with an
1. 2 answers
2. asked by xxxTaraKhanxxx
3. 843 views
Which sentence presents an alternative in appropriate way?a. "The 11 a.m. flight is completely sold out, so I booked you on the
1. 4 answers
2. asked by Kasey
3. 838 views
A store's dressing room policy has a limit of 10 garments per customer. If Carol has at least 3 garments below the limit, how
1. 1 answer
2. asked by Alam
3. 823 views
translate 38 less than q to algebraic expression
1. 2 answers
2. asked by Kiana
3. 820 views
I got a 85 on my exam that's good yay!i could of got higher but still good
1. 5 answers
2. asked by ciara
3. 817 views
As a professor at State University, you have been asked to write a letter of recommendation for one of your advisees who is
1. 7 answers
2. asked by Kasey
3. 812 views
Identify the political, social, and economic aspects of Reconstruction?
1. 1 answer
2. asked by dale
3. 809 views
a population of n = 100 score has u = 30 and standard deviation =4 what is the population variance
1. 1 answer
2. asked by mary
3. 803 views
If you cannot recall what you have just read, it is most likely because:A. you did not ask questions while reading. B. You were
1. 3 answers
2. asked by ciara
3. 799 views
If an equation of motion of a particle is given by s(t)= Acos(ùt + ä), the particle is said to undergo simple harmonic motion.
1. 1 answer
2. asked by Belinda
3. 792 views
Which of the following is an example of active readiing?A.skimming over information and taking notes. B.reviewing a chapter,
1. 3 answers
2. asked by ciara
3. 790 views
Hey could you please check this.It is supposed to be an illustrated essay. Is it illustrated enough? _______________
1. 1 answer
2. asked by HM
3. 785 views
A ball of mass 1.76 kg is tied to a string of length 4.19 m as shown in Figure P6.50. The ball is initially hanging vertically
1. 0 answers
2. asked by Kaylee
3. 778 views
the measure of an angle is 7 less than 10 times its supplement
1. 2 answers
2. asked by Ethan
3. 770 views
The electric motor of a model train accelerates the train from rest to 0.580 m/s in 33.0 ms. The total mass of the train is 565
1. 1 answer
2. asked by Anonymous
3. 763 views

Back to September 2011

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025