Archives
2010
December

Questions Asked on December 2, 2010

Calculate the molarity and the molality of an NH3 solution made up of 30 g of NH3 in 70 g of water. The density of the solution
1. 6 answers
2. asked by Sara
3. 6,562 views
2. A 350 mL buffer solution containing 0.15 M HF and 0.150 M NaF is reacted with sodium hydroxide. What mass of NaOH can this
1. 3 answers
2. asked by help
3. 6,561 views
The 2 pulleys in the figure have radii of 15 cm and 8 cm, respectively. The larger pulley rotates 25 times in 36 seconds find
1. 2 answers
2. asked by confused
3. 5,442 views
the bond between which pair of elements is the least ionic in character ?(1) H-F (2)H-Cl (3) H-I (4) H-O please help
1. 1 answer
2. asked by Anonymous
3. 4,599 views
a 1.00-L solution saturated at 25°C with calcium oxalate (CaC2O4) contains 0.0061 g of CaC2O4. The solubility constant (Ksp)
1. 3 answers
2. asked by Shanice
3. 4,270 views
2. Which bond is polar covalent?a) H2 b) Cl2 c) HCl d) O2
1. 3 answers
2. asked by Lisa
3. 3,866 views
A survey is being planned to determine the mean amount of time corporation executives watch television. A pilot survey indicated
1. 10 answers
2. asked by Shyra
3. 3,823 views
A 3.2 kg block is hanging stationary from the end of a vertical spring that is attached to the ceiling. The elastic potential
1. 1 answer
2. asked by tom
3. 3,814 views
which atom has the least attraction for the electrons in a bond between that atom and an atom of hydrogen?(1) carbon (2)nitrogen
1. 4 answers
2. asked by Anonymous
3. 3,184 views
There is a triangle inside of a circle. I have to find area of the shaded region which is the circle. So i would have to
1. 2 answers
2. asked by MK
3. 3,156 views
a student needs to prepare an aqueous solution of sucrose at a temperature of 20 degrees c with a vapor pressure of 15. 0 mm Hg.
1. 3 answers
2. asked by meghan
3. 3,077 views
A parallelogram has a 70 degree angle and sides 6 cm and 10 cm long. How long are its diagonals?
1. 1 answer
2. asked by lelelelel
3. 3,030 views
From the following information, determine ΔH°f of malonic acid, CH2(COOH)2(s).CH2(COOH)2(s) + 2O2(g) → 3CO2(g) + 2H2O(l);
1. 1 answer
2. asked by Jake
3. 3,003 views
What force is required to accelerate an object having a mass of 3 kg at 5 m/s2?
1. 3 answers
2. asked by Erica
3. 2,923 views
A skater spinning with angular speed of 1.5 rad/s draws in her outstretched arms thereby reducing her moment of inertia by a
1. 2 answers
2. asked by Tarren
3. 2,853 views
kristyn is 4 yrs younger than mario.three years from now she will be two thirds as old as mario. find the present age
1. 1 answer
2. asked by ronie
3. 2,762 views
Is hydrogen bonding strongest between molecules of H20 H2S H2Se or H2Te?
1. 3 answers
2. asked by Anonymous
3. 2,726 views
If a sample of 23.0 L of NH3 gas at 10 degrees C is heated at constant pressure until it fills a volume of 50.0 L. What is the
1. 3 answers
2. asked by Nana
3. 2,575 views
The tides at cape Capstan, New Brunswick, change the depth of the water in the harbour. On one day in october, the tides have a
1. 1 answer
2. asked by Anonymous
3. 2,564 views
The total electrical resistance R of two resistors connected in parallel with resistances R1 and R2 is given by 1/R=1/R1+1/R2.
1. 3 answers
2. asked by Linda
3. 2,341 views
A covalent bond forms when(1)two nuclei share electrons in order to achieve a complete octet of electrons (2) atoms form ions
1. 1 answer
2. asked by Jazmin
3. 2,317 views
What is the bond order of the C-O bond in acetone?a). 4 b). 1.5 c). 0.5 d). 1 e). 2
1. 2 answers
2. asked by gopi
3. 2,249 views
Draw the resonance structures for SeS2 and SiS2. There are 2 for SeS2 and 3 for SiS2. I really need help with this. If it can be
1. 1 answer
2. asked by Alexis
3. 2,124 views
Consider the following metals.Metal Specific Heat copper 0.385 J/(g · °C) magnesium 1.02 J/(g · °C) mercury 0.138 J/(g ·
1. 2 answers
2. asked by Jake
3. 2,094 views
The solubility of CO2 in water at 25 degrees C and 1 atm is 0.034 mol/L. What is its solubility under atmospheric conditions?
1. 1 answer
2. asked by Sara
3. 2,040 views
You are evaluating a proposed expansion of an existing subsidiary located in Switzerland. The cost of the expansion would be SF
1. 1 answer
2. asked by James
3. 2,038 views
A 5.0-g Sample of KBr at 25.0 degrees celsius dissolves in 25.0 degrees celsius 25.0 mL of water also at 25.0 degrees celsius.
1. 2 answers
2. asked by Sally
3. 2,019 views
find v for the following question..the tip of the airplane propeller 3m long, rotating 500 times per minute (hint r=1.5m)
1. 1 answer
2. asked by confused
3. 1,982 views
Which items are described by the geographic theme of place?a.Australia's climate is varied; it ranges from arid to tropical.
1. 4 answers
2. asked by ...
3. 1,839 views
what happened when the crossword puzzle champion died
1. 3 answers
2. asked by keana
3. 1,833 views
A circular saw blade rotating at 3600 rpm is braked to a stop in 6 seconds. What is the angular acceleration? How many
1. 1 answer
2. asked by Anthony
3. 1,828 views
Which substance is a conductor of electricity ?(1)NaCl(s) (2)NaCl (l) (3)C6H12O6(s) (4) C6H12O6 (l) thanks for any help !
1. 2 answers
2. asked by Anonymous
3. 1,738 views
An atom has a valence shell configuration of ns2p5. To which group of elements in the periodic table does it belong?transition
1. 1 answer
2. asked by Kristy
3. 1,731 views
Which compound contains both ionic and covalent bonds?(1)HBr (2)CBr4 (3)NaBr (4)NaOH
1. 1 answer
2. asked by Anonymous
3. 1,722 views
A 1 kg ball moving at 3 m/s strikes a 2 kg ball and stops. If the 2kg ball was initially at rest, find its top speed after the
1. 11 answers
2. asked by tressie
3. 1,676 views
balance molecular formula, total ionic formula and net ionic formula of Sr(NO3)2 + Al2(SO4)3. Thank you
1. 1 answer
2. asked by Ivy
3. 1,666 views
5yd 1ft 4in - 2yd 2ft 8in
1. 1 answer
2. asked by M.P.L
3. 1,654 views
Find the circle circumference and circle area with a circles radius 10 inchesI think the circles are is 314 but don't know the
1. 5 answers
2. asked by Nat
3. 1,637 views
Of the sixth-grade students surveyed, 12% bring their lunches to school. Suppose 24 sixth-graders do this? How many sixth-grade
1. 12 answers
2. asked by Anonymous
3. 1,605 views
Find two possible numbers that differ by 8 and whose reciprocals differ by 1/6.
1. 1 answer
2. asked by Keith
3. 1,603 views
For each of the following solutions, calculate the initial pH and the final pH after adding 0.010 molof HCℓ. a) 500.0 mL of
1. 1 answer
2. asked by help
3. 1,600 views
Write a balanced chemical equation for the reaction for propane C3H8 burning in oxygen to for carbon dioxide and water vapor
1. 1 answer
2. asked by abby
3. 1,580 views
Hydrogen bonding is strongest between molecules of(1)H2S (2)H20 (3)H2Se (4)H2Te
1. 2 answers
2. asked by tina
3. 1,544 views
identify the graph of the solution set of 8.5>6.1+0.6y
1. 1 answer
2. asked by Anonymous
3. 1,544 views
A 105-N suitcase sits on a rubber ramp at an airport carousel at a 25 degree angle . The weight vector can be broken into two
1. 1 answer
2. asked by Anonymous
3. 1,499 views
Find the standard form of the equation of the ellipse with the following characteristics.foci: (+/-5, 0) major axis of length:
1. 1 answer
2. asked by barb
3. 1,486 views
A bicycle wheel of radius .7m is rolling without slipping on a horizontal surface with an angular speed of 2 rev/s when the
1. 1 answer
2. asked by Kevin
3. 1,418 views
Write the word equations below as chemical equations and balance.copper + sulfuric acid yield copper(II) sulfate+ water + sulfur
1. 1 answer
2. asked by Pedro
3. 1,352 views
A 85.0 N grocery cart is pushed 13.0 m along an aisle by a shopper who exerts a constant horizontal force of 40.0 N. If all
1. 2 answers
2. asked by Bailey
3. 1,346 views
She’s liked him since six months.When you start work? I’ve been knowing her for three months i)What the mistake is. ii) Why
1. 1 answer
2. asked by rahila
3. 1,311 views
Explain why CH2ClBr and CH2Cl2 do not have optical, geometric, or structural isomers?
1. 1 answer
2. asked by Rachel
3. 1,297 views
A manufacturer sells two products, one at a price of $3000 a unit and the other at a price of $12000 a unit. A quantity q1 of
1. 0 answers
2. asked by Billy
3. 1,296 views
A drug is eliminated from the body through urine. Suppose that for an initial dose of 10 milligrams, the amount A (t) in the
1. 0 answers
2. asked by Ann
3. 1,283 views
FIGURE:h t t p : / / g o o . g l / a 7 j C F The figure is a PV diagram for a reversible heat engine in which 1.0 mol of argon,
1. 1 answer
2. asked by Schnitzel
3. 1,279 views
Choose the geographic theme represented below.Paraguay is a landlocked nation. It is bordered by Bolivia, Brazil, and Argentina.
1. 6 answers
2. asked by ...
3. 1,278 views
The population size, P,of owls (predators) in a certain region can be modelled by the function P(t) = 1000 + 100 sin (3.14t/12),
1. 3 answers
2. asked by Molly
3. 1,277 views
when a calcium atom loses its valence electrons, the ion formed has an electron configuration that is the same as an atom of(1)
1. 1 answer
2. asked by Anonymous
3. 1,275 views
Find the area of each figure with the given dimensionsTrapeziod: b1 = 6,b2=10, h=5 Trapeziod: b1= 4.5, b2= 8, h=6.7 I wasn't in
1. 3 answers
2. asked by Danielle
3. 1,268 views
Nitrogen dioxide, NO2, decomposes upon heating to form nitric oxide and oxygen according to the following equation:
1. 0 answers
2. asked by Irina
3. 1,250 views
A farmer has 100 yards of fencing to form two identical rectangular pens and a third pen that is twice as long as the other two
1. 1 answer
2. asked by Richard Steele
3. 1,235 views
. Margaret is planning to invest up to $22,000 in certificates of deposit at City Bank and People’s Bank. She wants to invest
1. 1 answer
2. asked by Bruce
3. 1,220 views
A stone is dropped from the upper observation deck (the space deck) of the CN Tower, 450m above the ground.(a) How long does it
1. 0 answers
2. asked by beatriz
3. 1,215 views
Posted by rfvv on Tuesday, November 30, 2010 at 6:05am.1. I cannot be an actor. 2. I am not an actor at all. 3. I cannot become
1. 1 answer
2. asked by rfvv
3. 1,202 views
A particel is moving with the given data. Find the position of the particle.v(t)= sin t - cos t , s(0)= 0
1. 1 answer
2. asked by beatriz
3. 1,165 views
SolveX=8(mod 11), X=9(mod 12), X=10(mod 13)
1. 1 answer
2. asked by Morris
3. 1,160 views
Suppose that either of two instruments might be used for making a certain measurement. Instrument 1 yields a measurement whose
1. 0 answers
2. asked by Salman
3. 1,157 views
My denominator is 6 more than my numerator. My simplest form is 2/5 What fraction am I?_______
1. 1 answer
2. asked by Alex
3. 1,152 views
A projectile is ejected from a 25-m high tower with a velocity of 40 m/s at an angle of 30 degrees to the horizontal first on
1. 1 answer
2. asked by mK
3. 1,150 views
Hello agein, a biger question this time.Height difference H 180 meters Flow T 3000 tons / second Delivery 4.2 GW P a) How large
1. 1 answer
2. asked by Oddbjørn
3. 1,145 views
1.Agba fed milk and honey to the newborn colt.2.Sometimes the playful colt bit Agba's fingers. Identify the direct objects
1. 4 answers
2. asked by Tracy
3. 1,141 views
Angle elevation of sun is 25 degrees. Find the length the shadow cast by a tree 41 feet tall.
1. 1 answer
2. asked by Ro
3. 1,140 views
A 73 kg crate is dragged across a floor by pulling on a rope attached to the crate and inclined 15° above the horizontal.(a) If
1. 1 answer
2. asked by vm
3. 1,111 views
The F-14 Tomcat lands on aircraft carriers at a speed of 145 mph. The carriers capture system stops the aircraft within 2
1. 1 answer
2. asked by Rose
3. 1,108 views
An 70.0 N box of clothes is pulled 24.0 m up a 30.0° ramp by a force of 115 N that points along the ramp. If the coefficient of
1. 1 answer
2. asked by Bailey
3. 1,102 views
why the formula for the area of a trapezoid this A=1/2 x h x(a+b)
1. 1 answer
2. asked by kate
3. 1,082 views
1. She thinks reading books.2. She thinks of reading books. 3. She thinks about reading books. 4. She thinks that she is reading
1. 1 answer
2. asked by rfvv
3. 1,081 views
whom should to see at the bank if you need to borrow money?
1. 6 answers
2. asked by mercedes
3. 1,077 views
An amount of $5000 is invested at an interest rate of 7% per year, compounded quarterly.Find the value A(t) of the investment
1. 1 answer
2. asked by Iyeisha
3. 1,075 views
Please finish these questions so I can check my answers. All my answers are at the bottom.Adding and subtracting mixed numbers.
1. 10 answers
2. asked by Pratigya
3. 1,016 views
A 100-g aluminum calorimeter contains a mixture of 40 g of ice and 200 g of water at equilibrium. A copper cylinder of mass 300
1. 3 answers
2. asked by Calvin
3. 1,004 views
Select the options below that are correct for diamagnetism and paramagnetism.A) Most elements and some compounds are
1. 3 answers
2. asked by Kay
3. 1,002 views
One reaction of iron with hydrochloric acid is represented by the following thermochemical equation.Fe(s) + 2HCl(aq) →
1. 1 answer
2. asked by Julia
3. 993 views
You ask a neighbor to water a sickly plant while you are on vacation. Without water the plant will die with probability 0.7.
1. 0 answers
2. asked by cmb
3. 988 views
Let h represent the number of hours Shaunda spent on homework last week.1.Zach spent half as much time on his homework as
1. 1 answer
2. asked by ursula
3. 986 views
one number is two less than a second number. If you take one-half of the first number and increase it by the second number,the
1. 1 answer
2. asked by Anonymous
3. 981 views
Write the orbital diagrams for the following atoms/ions. Label the orbitals. You can use gas notation for Sr2+, Zn and Se2-.Sr2+
1. 1 answer
2. asked by Riley
3. 978 views
An atom has a valence shell configuration of ns2p5. To which group of elements in the periodic table does it belong?transition
1. 2 answers
2. asked by Alexa
3. 951 views
What does this quote mean?“Why should the Indian be expected to plant corn, fence lands, build houses, or do anything but get
1. 1 answer
2. asked by patrick
3. 940 views
A 10kg particle undergoes simple harmonic motion with an amplitude of 2.0mm, a maximum acceleration of 8.0x10^3 m/s^2, and an
1. 2 answers
2. asked by Greg
3. 926 views
I need 10 sens. translated to french..1. how are you today 2. very well how about you 3. i love you 4. nice to meet you 5. i am
1. 2 answers
2. asked by Bailee
3. 925 views
1. The amount of pyridoxine (in grams) per multiple vitamin is normally distributed with = 110 grams and = 25 grams. A sample of
1. 1 answer
2. asked by Anonymous
3. 923 views
so I have this problem and I don't know what numbers to multiple and whatnot. Can someone help me?This is the problem: 4000 g
1. 3 answers
2. asked by Jessi
3. 894 views
Latent heat question:Your car's windshield is covered with a .58 cm thick layer of ice. The ice has an area of 1.6m^2. If the
1. 1 answer
2. asked by Anonymous
3. 884 views
a percentage bar graph is sometimes used like a circle graph. If the bar is 8 cm, how long is each piece?
1. 1 answer
2. asked by Brian
3. 875 views
Suppose that either of two instruments might be used for making a certain measurement. Instrument 1 yields a measurement whose
1. 1 answer
2. asked by Salman
3. 872 views
How to find average speed with a given initial speed, theta, and delta x?I know average speed= total distance/total time, but I
1. 1 answer
2. asked by Amm
3. 860 views
write two paragraph explaining the changes that you would make to revise the paper.
1. 1 answer
2. asked by susan
3. 858 views
17. A shell having a mass of 25kg is fired horizontally eastward from a cannon with a velcoity of 500m/s. If the mass of the
1. 1 answer
2. asked by James Caulfield
3. 838 views
Find the area (in square centimeters) of a triangular piece of cloth with a 14-centimeter base and an 18-centimeter height.
1. 1 answer
2. asked by Myung
3. 816 views
Can you help me check these sentences,please? Thank you.1)Briefly outline the main features of Wordsworth's poetry as stated in
1. 1 answer
2. asked by Franco
3. 809 views

Back to December 2010

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025