Archives
2010
November

Questions Asked on November 19, 2010

Nitrosyl bromide decomposes according to the following equation.2NOBr (g)(equilibrium arrow) 2NO (g) + Br2 (g) A sample of NOBr
1. 1 answer
2. asked by jessie
3. 11,908 views
In lab, you use a special balloon that is permeable to water but not sucrose to make an "artificial cell". The balloon is filled
1. 1 answer
2. asked by Tracee
3. 5,717 views
Use a linear approximation (or differentials) to estimate the given number.(32.06)^4/5
1. 2 answers
2. asked by Amy
3. 3,844 views
find exact value using sum or differnce equations. tan(19pi/12)
1. 1 answer
2. asked by chris
3. 3,815 views
What is the entropy change for the vaporization of 2.6 mol H2O(§¤) at 100◦C and 1 atm? dH= 40700 J/molAnswer in units of J/K
1. 1 answer
2. asked by Samantha
3. 3,210 views
Three children are trying to balance on a seesaw, which consists of a fulcrum rock, acting as a pivot at the center, and a very
1. 2 answers
2. asked by Kyla
3. 3,151 views
The table below shows the measured dimensions of a prism, and the maximum and minimum possible values based on the greatest
1. 2 answers
2. asked by Stephen
3. 3,114 views
Manufacturing of Freon (CCl2F2):2 HF(g) + CCl4(I) --> CCl2F2(g) + 2 HCl(g) Supplies on hand: 1.0kg HF and 1.0 kg CCl4. After the
1. 2 answers
2. asked by Kathy
3. 2,589 views
Calculate the vapor pressure of a solution of 0.39 mol of cholesterol in 5.4 mol of toluene at 32oC. Pure toluene has a vapor
1. 2 answers
2. asked by Molly
3. 2,176 views
what is the momentum of a 57 kg cheetah running north at 27 m/s?
1. 2 answers
2. asked by ada
3. 2,070 views
7. The Sandusky Little League uses a baseball throwing machine to help train 10-year old players to catch high pop-ups. It
1. 3 answers
2. asked by Anonymous
3. 2,021 views
Consider the following reaction at equilibrium:2NH3 (g)<-> N2 (g) + 3H2 (g) ΔH° = +92.4 kJ Le Cha ^ telier's principle
1. 1 answer
2. asked by richy
3. 1,983 views
A 0.38-kg mass attached to a spring undergoes simple harmonic motion with a period of 0.63 s. What is the force constant of the
1. 2 answers
2. asked by aok
3. 1,895 views
Evaluate the integral by interpreting it in terms of areas.int_(0)^(9) (7/2x - 21)dx can someone please help me with this
1. 2 answers
2. asked by eddy
3. 1,754 views
The position of a mass oscillating on a spring is given by x = (5.6 cm) cos [2πt / (2.03 s)].(a) What is the period of this
1. 1 answer
2. asked by aok
3. 1,626 views
A cone of radius r centimeters and height h centimeters is lowered point first in at a rate of 1 cm/s into a tall cylinder of
1. 1 answer
2. asked by Dan
3. 1,624 views
We are studying mutual bond funds for the purpose of investing in several funds. For thisparticular study, we want to focus on
1. 1 answer
2. asked by Anonymous
3. 1,547 views
How many moles of a gas at 100 degrees celciuos does it take to fill a 1.00 flask to a pressure of 1.50 atm?
1. 2 answers
2. asked by Natalia
3. 1,543 views
A ball is thrown straight upward and returns to the thrower's hand after 2.20 s in the air. A second ball is thrown at an angle
1. 2 answers
2. asked by jennifer
3. 1,519 views
A 0.580-kg rock is tied to the end of a string and is swung in a circle with a radius of 0.500 meters. The velocity of the rock
1. 2 answers
2. asked by Jon
3. 1,469 views
A mole of methane reacts with 64g of oxygen at 1 atm, 425 K. There are two ways in which methane can react with oxygen. It can
1. 0 answers
2. asked by Natalie
3. 1,406 views
Child weighs 29 kg on a swing supported by two chains. Another child pulls swing back to the chains to make 30 degree angle with
1. 1 answer
2. asked by anonymous
3. 1,395 views
Complete the indirect proof.Given: Rectangle JKLM has an area of 36 square centimeters. Side JK is at least 4 centimeters long.
1. 1 answer
2. asked by chica
3. 1,388 views
Need help with these 3:19. "¿Por qué te gusta estudiar?" "Pues, _______ me gusta la clase. a. por b. porque c. por qué d.
1. 2 answers
2. asked by mysterychicken
3. 1,299 views
When the three blocks in the figure below are released from rest, they accelerate with a magnitude of 0.370 m/s2. Block 1 has
1. 0 answers
2. asked by Will
3. 1,254 views
Write an indirect proof that an obtuse triangle does not have a right angle.Given: Triangle RST is an obtuse triangle. Prove:
1. 0 answers
2. asked by chica
3. 1,219 views
I think that paragraph 3 is more effective than paragraph 1 because it is structured in a better manner and has better rhythm
1. 1 answer
2. asked by rene
3. 1,205 views
Coroners estimate time of death using the rule of thumb that a body cools about 2 degrees F during the first hour after death
1. 0 answers
2. asked by bob
3. 1,199 views
How many liters of O2 gas, measured at 772 mmHg and 20 degrees C, are required to completely react with 2.4 mol of Al?
1. 1 answer
2. asked by Kelsey
3. 1,198 views
find exact value cos(13pi/15)cos(-pi/5)-sin(13pi/15)sin(-pi/5)
1. 1 answer
2. asked by chris
3. 1,195 views
Why can maintaining homeostasis be particularly challenging formulticellular organisms?
1. 4 answers
2. asked by justin
3. 1,194 views
How would you go about listing all of the integer ratios? I would like to have the integers listed in ascending order by the
1. 0 answers
2. asked by Gray
3. 1,190 views
walnuts that sell for $3 a pound and macadamia nuts that sell for $4 per pound are mixed to create 50 pounds of mixture that
1. 1 answer
2. asked by ryan
3. 1,189 views
Can you explain why these types of organizations have specific organizational cultures? Why does a high risk organization have a
1. 1 answer
2. asked by Anonymous
3. 1,176 views
Estimate the are under the curve f(x)=x^2-4x+5 on [1,3]. Darw the graph and the midpoint rectangles using 8 partitions. Show how
1. 0 answers
2. asked by Jesse
3. 1,135 views
1. The reaction,CO(CH2COOH)2 CO(CH3)2 + 2CO2, follows first-order kinetics and has an activation energy of 96.6 kJ mol-1. At 293
1. 0 answers
2. asked by Kyo
3. 1,133 views
find the meausre of each exterior angle for a regular nonagon
1. 1 answer
2. asked by amanda
3. 1,129 views
If helium added to the mixture increases the pressure to 1.90 {\rm atm}, what is the partial pressure ({\rm atm}) of the helium?
1. 1 answer
2. asked by Anonymous
3. 1,123 views
When a 0.30-kg mass is attached to a vertical spring, the spring stretches by 15 cm. How much mass (total) must be attached to
1. 2 answers
2. asked by aok
3. 1,104 views
The earth orbits the sun once a year (3.16 107 s) in a nearly circular orbit radius 1.50 1011 m. With respect to the sun,
1. 1 answer
2. asked by john
3. 1,092 views
A circular gear turns 60 per hour. Through how many radians does it turn in a 24-hour day?
1. 2 answers
2. asked by De'Steven
3. 1,091 views
A 33 N force acting at 90° and a 44 N force at 60° are appliedconcurrently at a point P. What is the magnitude and direction
1. 1 answer
2. asked by nic
3. 1,085 views
1)El hijo de tu madre y tu padrastro?........... 2)la hija de tu madrastra o tu padrastro?....... can you help me answer these
1. 1 answer
2. asked by joy
3. 1,081 views
a 17 kg car travels in a flat circle . At a certain instant the velocity of the car is 18m/s west and the total acceleration of
1. 1 answer
2. asked by maira
3. 1,073 views
A rectangular animal pen will be built using 200 meters of fencing. If one side of the rectangle is meters, find the area of
1. 2 answers
2. asked by Shauna
3. 1,056 views
A uniform plank of length 4.5 m and weight 233 N rests horizontally on two supports, with 1.1 m of the plank hanging over the
1. 1 answer
2. asked by jason
3. 1,050 views
A sample of octane in equilibrium with its vapor in a closed 1.0 L container has a vapor pressure of 50 torr at 45oC. The
1. 1 answer
2. asked by Mollie
3. 1,046 views
Use the Second law of thermodynamics to explain why an ice cube cools off your warm soda.
1. 3 answers
2. asked by Anonymous
3. 1,015 views
a banana with a temperature of 17 degrees C (specific heat of banana= 3520j/kgK) and a a mass of 250g is placed in a bowl of
1. 0 answers
2. asked by Brittany
3. 1,013 views
The figure below shows an initially stationary block of mass m on a floor. A force of magnitude F = 0.570·mg is then applied at
1. 0 answers
2. asked by Will
3. 997 views
At 298K, Go = -141.8 kJ for the reaction2 SO2 + O2 in equilibrium with 2 SO3 Calculate the change in Gibbs free energy (in kJ)
1. 1 answer
2. asked by tyson
3. 996 views
A girls sits on a tire that is attached to an overhanging tree limb by a rope. The girl's father pushes her so that her
1. 2 answers
2. asked by Devon
3. 991 views
By the end of the eighteenth century, the British public preferred the high moral ground embraced by dramatists to the more
1. 1 answer
2. asked by danny
3. 987 views
The discriminant of an equation is 73. How many times will the graph of this equation touch the x–axis?
1. 1 answer
2. asked by Preston
3. 978 views
20 copies of the school yearbook together weigh 50 lb. What is the weight of each book?How do I set this up?
1. 3 answers
2. asked by Rose
3. 975 views
What didgit is in the thousands place1,234.5678 would it be 1 or 7
1. 3 answers
2. asked by Heather
3. 967 views
1. Write an essay that compares and contrasts the ways in which China and Japan responded to the West and describes how each
1. 2 answers
2. asked by danya
3. 963 views
Why did public opinion and our government's policies on immigration in general change in the early 1900s?
1. 1 answer
2. asked by Liberty
3. 960 views
14. Victor ______ siempre comemos a las seis.a. y tú b. y yo c. y ella d. y él Can't decide between A and B... 16. Yo ______.
1. 4 answers
2. asked by mysterychicken
3. 939 views
How many mL of concentrated ammonia (14M) should be diluted to 250 mL to make a 0.75 M NH3 solution?
1. 2 answers
2. asked by Lisa
3. 929 views
What life is like within the ecosystem that the cyanobacterium lives as well as the volcanic island as a whole. Words required
1. 4 answers
2. asked by Hailey
3. 928 views
There's a circle with that has a dot in the middle with two line going to the left and right that's is 16 m. I have to find the
1. 1 answer
2. asked by Alex
3. 924 views
in a titration, 0.0400 mol of solid NaOH is required to neutralize 10.0 mL of H2SO4(aq). From these data, the [H2SO4] is:
1. 1 answer
2. asked by jj re
3. 924 views
which word did not originate from military language?1 pioneer 2 phrase 3 salary 4 trophy
1. 1 answer
2. asked by carl
3. 914 views
18.0 grams of oxygen is reacted with nitrogen to make 56.0 grams of nitrogen dioxide according to the following reaction:2O2 +
1. 1 answer
2. asked by SAMM
3. 911 views
An admissions director wants to estimate the mean age of all students enrolled at a college. The estimate must be within one
1. 0 answers
2. asked by badel
3. 906 views
Nitrosyl bromide decomposes according to the following equation.2NOBr (g)(equilibrium arrow) 2NO (g) + Br2 (g) A sample of NOBr
1. 1 answer
2. asked by jessie
3. 893 views
Circla all numbers in which the ones digit is twice the hundreds digit.842 824 482 284 248 933 977 337 379
1. 1 answer
2. asked by Rick
3. 873 views
The thermodynamic equilibrium constant for the following reaction is 0.15 at 1227°C.2 SO2(g) + O2(g) 2 SO3(g) Which is true?
1. 1 answer
2. asked by carla
3. 871 views
who, if anyone, is at fault when a 21 year old injuries his finger and request that an orthopedic doctor perform the surgery.
1. 0 answers
2. asked by lida
3. 859 views
Block B in the figure below weighs 713 N. The coefficient of static friction between block and table is 0.20. Assume that the
1. 5 answers
2. asked by Will
3. 857 views
The earth orbits the sun once a year (3.16 10^7 s) in a nearly circular orbit radius 1.50 10^11 m. With respect to the sun,
1. 1 answer
2. asked by john
3. 852 views
An electric circular saw is designed to reach its final angular speed, starting from rest, in 1.16 s. Its average angular
1. 3 answers
2. asked by harry
3. 845 views
1. solve 3-w/6-w = 3/w-62. Find the LCM of (8+9z), (64-81z^2), and (8-9z) 3. Multiply and simplify: 7z^8/10r^2 * 100r^4/49z 4.
1. 1 answer
2. asked by Anonymous
3. 838 views
She also makes a very important remark that explains Samsara, “You have a good soul, but it’s like you waited your whole
1. 1 answer
2. asked by sanjeevan
3. 837 views
What volume of O2 at 912 mmHg and 33 degrees C is required to synthesize 11.0 mol of NO?
1. 0 answers
2. asked by Kelsey
3. 831 views
Estimate the area under the curve f(x)=x^2-4x+5 on [1,3]. Darw the graph and the midpoint rectangles using 8 partitions. Show
1. 1 answer
2. asked by Jesse
3. 831 views
Balanced Chemical Equation:1 N204(l) + 2 N2H4(l) --> 3 N2(g) + 4 H20(g) If you start with: 5.0 x 10^4g hydrazine (N2H4) "in the
1. 1 answer
2. asked by Roger
3. 823 views
The 1.4 kg, 40-cm-diameter disk in the figure below is spinning at 260 rpm. How much friction force must the brake apply to the
1. 1 answer
2. asked by sara
3. 820 views
In Fig. 6-25, blocks A and B have weights of 49 N and 21 N, respectively.(a) Determine the minimum weight of block C to keep A
1. 1 answer
2. asked by Robert
3. 808 views
1 5/8 inches represents about how many miles on the scale bar on the political map legend?3.8 centimeters represents about how
1. 1 answer
2. asked by tatiana
3. 791 views
Find the heat necessary to change 2.5kg of water (ice) at -2 degrees C to steam at 105 degrees C.specific heat ice= 2060
1. 1 answer
2. asked by Brittany
3. 781 views
The following reaction has an equilibrium constant of 0.50 at a given temperature.HCHO(g) CO(g) + H2(g) If you have 0.55 moles
1. 1 answer
2. asked by Adrianne
3. 775 views
If a diploid organism has 4 chromosomes, how many pairs of homologous chromosomes would you expect to see during early prophase
1. 0 answers
2. asked by bella
3. 764 views
Balanced Chemical Equation:1 N204(l) + 2 N2H4(l) --> 3 N2(g) + 4 H20(g) If you start with: 5.0 x 10^4g hydrazine (N2H4) "in the
1. 4 answers
2. asked by Roger
3. 762 views
Evaluate.int_(pi)^(pi) (sin(x))^(3) (cos(x))^(3) dx
1. 5 answers
2. asked by sam
3. 757 views
A 2 kg mass on a horizontal friction-free air track is accelerated by a string attached to a 115 kg mass hanging vertically from
1. 1 answer
2. asked by justin
3. 751 views
A rectangular rug covers the floor in a living room. One of the walls in the same living room is pained blue. Are the rug and
1. 1 answer
2. asked by Mike
3. 743 views
When graphing y< -6 should the region below linie y= -6 be shaded or should the region above the line y= -6 be shaded?
1. 1 answer
2. asked by Olinda
3. 742 views
How much ice can be melted at 0oC by the condensation of 1.0 kg of steam at 100.oC?(ΔHfus of ice = 6.01 kJ/mol; ΔHvap of water
1. 1 answer
2. asked by Molly
3. 727 views
I don't understand how to work out this problem, non the less where to begin with any calculations. Help!!Three of the strongest
1. 1 answer
2. asked by Very Confused :(
3. 717 views
A 1240 N uniform beam is attached to a vertical wall at one end and is supported by a cable at the other end. A W = 1970 N crate
1. 1 answer
2. asked by peter
3. 716 views
The post-war years witnessed a "freedom explosion" across the globe, especially in Asia and Africa. Why did several of these new
1. 1 answer
2. asked by i dont know how to
3. 704 views
The force in newtons needed to stretch a certain spring x centimeters from its resting position is given by the function
1. 3 answers
2. asked by Donovan Henry
3. 702 views
23. "¿_______ necesitas ayudar en casa?""Porque mi madre está enferma hoy." a. Qué b. Porque c. Quién d. Por qué D? 24.
1. 3 answers
2. asked by mysterychicken
3. 698 views
Iron metal CANT reduce Fe3+ to Fe2+. Why?
1. 0 answers
2. asked by Jenny
3. 697 views
Give examples of both discrete and continuous data? What makes them different? Is the measurement of money continuous or
1. 0 answers
2. asked by sue
3. 679 views
Given:90m skid mark .50 coefficient of friction between the tires and skid mark How fast is the car moving when the brakes
1. 0 answers
2. asked by JC
3. 676 views
Which of the following compounds would theoretically have the highest melting point?Answer H2O FeO CO2 C6H12O6
1. 1 answer
2. asked by barbra
3. 667 views
2. Nunca como allí porque la comida es ______.a. buena b. horrible c. sabrosa d. malo D? 7. Me gustan los sandwiches de jamón
1. 3 answers
2. asked by mysterychicken
3. 667 views

Back to November 2010

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025