Archives
2010
July

Questions Asked on July 9, 2010

The motion of a piston in an automobile engine is nearly simple harmonic. If the 1-kg piston travels back and forth over a total
1. 2 answers
2. asked by Katie
3. 8,317 views
While running, a person dissipates about 0.6 J of mechanical energy per step per kilogram of body mass. If a 60-kg person runs
1. 3 answers
2. asked by Deanna
3. 5,425 views
A hydrometer consists of a spherical bulb and a cylindrical stem with a cross-sectional area of 0.400 cm^2. The total volume of
1. 3 answers
2. asked by Deanna
3. 4,568 views
Market research has revealed the following information about the market for chocolate bars. The demand schedule can be
1. 2 answers
2. asked by chris
3. 4,297 views
On a winter day the temperature drops from -5 degree C to -15 degree C overnight. If a pan sitting outside contains 0.40kg of
1. 1 answer
2. asked by Mary
3. 2,968 views
while a patient is having surgery,his doctor notices a small mole.The doctor doesn't think the mole is anthing to worry
1. 3 answers
2. asked by ELLA
3. 2,659 views
A large calorie (Cal) is the amount of heat needed to change the temperature of one __________ of water by one degree Celsius.
1. 1 answer
2. asked by Mary
3. 2,480 views
A child throws a snowball with horizontal velocity of 18m/s directly toward a tree, from a distance of 9.0m and a height above
1. 1 answer
2. asked by sofi
3. 1,894 views
When a circular hole is drilled into an aluminum sheet, does the diameter of the hole become larger or smaller when the sheet is
1. 1 answer
2. asked by Mary
3. 1,891 views
The perimeter of a rectangular picture is 240 inches. the length is twice the width. Find the length and the width
1. 4 answers
2. asked by gordon
3. 1,878 views
The major difference between transverse and longitudinal waves is the (a)direction of the wave motion (b)direction of the
1. 1 answer
2. asked by Mary
3. 1,815 views
calculate the pressure exerted by 2.50 moles of CO2 confined in a volume of 5.00 L at 450K. Compare the pressure with that
1. 2 answers
2. asked by david
3. 1,731 views
What is the wavelength in meters of radio waves produced by a radio station with a frequency of 1400 kHz?Is it 214.3 m?
1. 1 answer
2. asked by Mary
3. 1,707 views
A rigid ball that contained 25.0 liters of air at 22°C and 6.25 atm pressure was placed in an oven at a temperature of What was
1. 1 answer
2. asked by Anonymous
3. 1,693 views
the twenty fifth amendment describes the sequence of events that would install the vice president as acting president against
1. 1 answer
2. asked by kelly
3. 1,593 views
How much heat is necessary to change 20g of ice at 0 degree C into water at 0 degree C? (Lf = 80kcal/kg)is it 1.60kcal?
1. 2 answers
2. asked by Mary
3. 1,432 views
A box with a square base and no top is to be made from a square piece of carboard by cutting 7 in. squares from each corner and
1. 2 answers
2. asked by Sara
3. 1,398 views
A stone is thrown from a cliff top with an upward velocity of 20 m/s. It takes 7 seconds for the stone to hit the ground at the
1. 3 answers
2. asked by Elisabeth
3. 1,353 views
How many grams of chlorine gas are present in a 150.0 liter cylinder of chlorine held at a pressure of 1.00 atm and
1. 1 answer
2. asked by Anonymous
3. 1,280 views
A German U2 rocket from the Second World War had a range of 300 km, reaching a maximum height of 100 km. Determine the rocket's
1. 3 answers
2. asked by Riss
3. 1,250 views
write the mixed number as an improper fraction 6 2/3
1. 2 answers
2. asked by ruby hall
3. 1,215 views
Food and Drug Administration (FDA) recommendsthat adults ingest less than 2.4 g of sodium per day. How many liters of softened
1. 1 answer
2. asked by anthony
3. 1,075 views
One possible method to begin an essay isA. to paraphrase B. to meditate C. to ask a question B, right? Thanks.
1. 5 answers
2. asked by Zack
3. 1,040 views
1) A small dense object is suspended from the rear view mirror in a car by a lightweight fiber. As the car is accelerating at
1. 2 answers
2. asked by Anonymous
3. 929 views
elimination method really confuses me.solve by elimination method 5r -3s = 17 3r + 5s =17 A. solution is ______ (ordered pair,
1. 4 answers
2. asked by Lorri
3. 907 views
Wave amplitude is related to what?(a) wave velocity (b) frequency (c) energy (d) wavelength
1. 1 answer
2. asked by Mary
3. 859 views
A bus starts from rest and accelerates uniformly for 20 seconds to a speed of 18 km/h. It then moves with a uniform velocity and
1. 4 answers
2. asked by Akash
3. 841 views
Beach front resorts have an inelastic supply and automobiles have an elastic supply. Suppose that a rise in population doubles
1. 1 answer
2. asked by chris
3. 809 views
calculate the pressure exerted by 1.00 moles of CO2 confined in a volume of 5.00 L at 450. K. Compare the pressure with that
1. 2 answers
2. asked by david
3. 777 views
jet stream which is flowing at a rate of 80 miles per hour. It travels with the jet stream for 5 hours and then reduces its
1. 1 answer
2. asked by Anonymous
3. 765 views
When it says, " Draw a Lewis diagram for each of the following. "a)One atom of each of the elements in the second period. Is it
1. 4 answers
2. asked by Derrick
3. 738 views
Part III: RevisionIn this section of the final, revise the sentences provided to correct the grammar errors indicated. (In many
1. 2 answers
2. asked by leigh
3. 728 views
Cos(21)cos(9)-sin(21)sin(9)
1. 1 answer
2. asked by Anonymous
3. 727 views
you are building a ramp that will be in the shape of a perfect right-angled triangle. The vertical height of th ramp will be 10
1. 1 answer
2. asked by melissa
3. 722 views
Hi, need a bit of help on this one.A straight line passes through the points (4,3) and (10,0), I need to write down the equation
1. 2 answers
2. asked by Del
3. 695 views
ABCD is similar to WXYZ ad equals 6, dc equals 3, and wz equals 59 find YZ
1. 1 answer
2. asked by som
3. 645 views
1. For the following exercise, complete the following by using the data sets below that provides the ages of the first seven
1. 1 answer
2. asked by Anonymous
3. 626 views
Has the content in this course allowed you to think of math as a useful tool? If so, how? What concepts investigated in this
1. 2 answers
2. asked by Sequoiao9
3. 618 views
Explain how to divide a polynomial by a binomial using an example. (Please refer to the post “How to post equations” in the
1. 0 answers
2. asked by lovelife
3. 603 views
Wave velocity is inversely proportional to what?
1. 1 answer
2. asked by Mary
3. 600 views
Modeling with differential equations.If a bacteria culture doubles every 10 minutes and the original culture has 300 cells
1. 2 answers
2. asked by Marianne
3. 595 views
Which of the following is the bst example of a citation reference for a work by one author?a. Marks 1999 B. (Marks, Bill.1999)
1. 2 answers
2. asked by Zack
3. 579 views
Show that x^2+y^2-6x+4y+2=0 and x^2+y^2+8x+2y-22=0 are orthogonal.
1. 2 answers
2. asked by dan
3. 578 views
Solve the following system of equationsx + 4y=6 x= 4-4y A. The solution is an ordered pair ( , ) B. No Solution
1. 2 answers
2. asked by christy
3. 572 views
I have seen examples of this but the examples are not helping me solve it or set it up as a y=mx +bThe equation y= -1777x +
1. 2 answers
2. asked by Lorri
3. 559 views
A box with a square base and no top is to be made from a square piece of carboard by cutting 3 in. squares from each corner and
1. 1 answer
2. asked by Sara
3. 545 views
solve-7 x + 2 -- ---- 24 = 12 x over 3 = 224 over 720
1. 2 answers
2. asked by Thomas
3. 544 views
First 7: 57 61 57 57 58 57 61Second 7: 61 52 69 64 46 54 47 2. Any given data set consists of a set of numerical values. Please
1. 1 answer
2. asked by Anonymous
3. 528 views
Which of the following choices is a run-on sentence?A. Take public transportation, it saves gas B. Join the army and see the
1. 6 answers
2. asked by Ace.
3. 523 views
F) Why is (3x + 5) (x - 2) + (2x - 3) (x - 2) not in factored form? What is the correct final factored form? What is this
1. 1 answer
2. asked by Devon
3. 522 views
How do you find the answers to questions (research) using your computer? Provide an example.
1. 1 answer
2. asked by Jodan
3. 517 views
Now that you have developed an in-text citation for a summary, paraphrase, and a direct quote, and created a reference of your
1. 1 answer
2. asked by Anonymous
3. 511 views
I sat proudly on Joe, my pinto, as we marched around the ring in the pony competition at the fairgrounds. I had worked nights
1. 1 answer
2. asked by Zack
3. 472 views
I am burned out on math or just confused.3x + 7y=10 x= 2-2y A. Solution is an ordered pair B. No solution
1. 1 answer
2. asked by Lorri
3. 454 views
Which of the following choices is not necessary information for a works cited list?A. the publisher's name B. The number of
1. 3 answers
2. asked by Zack
3. 446 views
Wavw velocity is inversely proportional to what? (a) period (b) wavelength (c) amplitude (d) All of these
1. 1 answer
2. asked by Mary
3. 442 views
Hi,how do I find both solutions of the equation cos0 = 0.35 between degrees 0 and 360?Many thanks
1. 3 answers
2. asked by Nev
3. 420 views
Solve for t:√(t-108) - √(t+186) = 66
1. 3 answers
2. asked by Sara
3. 416 views
Cos(21)cos(9)-sin(21)sin(9)
1. 1 answer
2. asked by Anonymous
3. 414 views
In the novel when Leo offers him to try out painting himself, what would be the significance of that?Once, when I was there, the
1. 0 answers
2. asked by Laura
3. 413 views
how are principle of art related to elements of desing
1. 0 answers
2. asked by beatrice
3. 397 views
When doing a research, a current source is a useful one. T or F?I think it's T as a current one would give more accurate
1. 1 answer
2. asked by Zack
3. 393 views
Which of the following choices is a strategy that can help speed up reading?A. external distractions B. Using a penor pencial as
1. 1 answer
2. asked by Zack
3. 391 views
calculate the unit price $1.80 for 1.2 liters of juice
1. 1 answer
2. asked by terry
3. 382 views
8x - (6x + 8) =6The solution is x =
1. 2 answers
2. asked by christy
3. 381 views
In basketball is it ethical to keep scoring when the differential is 100 points? Why or why not?
1. 1 answer
2. asked by Diva
3. 379 views
5/8x + 1/6x = 11/16 + xthe solution is x= enter solution as integer or simplified fraction.
1. 1 answer
2. asked by Lorri
3. 373 views
Solve for t:√(t-108) - √(t+186) = 66
1. 1 answer
2. asked by Sara
3. 365 views
Why is cost recognized as an expense at the time of a sale?
1. 2 answers
2. asked by debbie
3. 361 views
Wave amplitude is related to what?
1. 1 answer
2. asked by Mary
3. 359 views
Solve for t:√(t-108) - √(t+186) = 66
1. 1 answer
2. asked by Sara
3. 352 views
Solve for t:√(t-108) - √(t+186) = 66
1. 1 answer
2. asked by Sara
3. 340 views
why is it so important for employees to go through orientation
1. 5 answers
2. asked by mehelle
3. 331 views
You have 32 coins. Some are nickels and otheres are dimes. How many coins are dimes? How many are dimes?
1. 3 answers
2. asked by Katelyn
3. 233 views
How many lines can exist that are perpendicular to a given line and pass through a specific point?
1. 0 answers
2. asked by Ebony
3. 126 views

Back to July 2010

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025