Archives
2010
May

Questions Asked on May 27, 2010

Howm many moles of chromate ions must have been in K2CrO4?
1. 0 answers
2. asked by Ashley
3. 375 views
How many moles of potassium chromate were in 15 mL of K2CrO4?
1. 0 answers
2. asked by Ashley
3. 447 views
How many grams of potassium chromate are in K2CrO4?
1. 1 answer
2. asked by Ashley
3. 473 views
What was the molarity of K2CrO4? M = moles/liter
1. 0 answers
2. asked by Ashley
3. 477 views
Find and show work the final pH when 35mL of 0.200 mol/l sulfuric acid are titrated with 18mL of 0.030 mol/L sodium hydroxide?
1. 0 answers
2. asked by S.S
3. 498 views
Suggest a test chemical that can be added to a water sample to percipitate the lead(II) ions. show a chemical equation for the
1. 0 answers
2. asked by Penny
3. 1,060 views
Could someone tell me if these are the only things that I need to know for the Preterite?- the time expressions -the ar and
1. 1 answer
2. asked by Amy~
3. 671 views
Any one heard of the short story "The Father" by Hugh Garner?
1. 4 answers
2. asked by Anonymous
3. 822 views
What is the point of view of the followng quote from the story Journey"you turn onto this road, which winds among the foothills
1. 1 answer
2. asked by Abigail
3. 487 views
In 1991, the life expectancy of males in a certain company was 68.2 years. In 1997, it was 70.7 years. Let E represent the life
1. 1 answer
2. asked by HELP
3. 470 views
Solve by the substitution method.5x + 8y=0 x=2 2y Type ordered pair if there is a solution, or indicate no solution
1. 1 answer
2. asked by Michelle F
3. 466 views
Evaluate a company that has personal issues that must be resolved. Read the following scenario to evaluate Taylor Inc.
1. 5 answers
2. asked by ana
3. 651 views
p(x)=x ^2 - 2x +9What is the domain of p?
1. 1 answer
2. asked by John B
3. 329 views
differences between local, state, and federal roles in public elementary and secondary education. Bullet points are acceptable
1. 1 answer
2. asked by Anonymous
3. 405 views
How do I simplify the cubed root of 27,000?
1. 2 answers
2. asked by anonymous
3. 470 views
4000. invested at a APR of 6% for 8 years compounded anually, what is the amount of money after 8 years
1. 1 answer
2. asked by Debra
3. 1,132 views
4y-5=(6-2)y-25I come up with 0 Can anyone help?
1. 5 answers
2. asked by Darwin
3. 214 views
Find the components of the vector with length = 1.00 and angle 30.0 as shown.
1. 1 answer
2. asked by Anonymous
3. 898 views
Hi.for a square root equation with variables such as x or y, when do u need the absolute value sign? Im kinda confused and my
1. 1 answer
2. asked by Skye
3. 561 views
CAN I GET HELP ON NEGATIVE AND POSITIVE NUMBERS 8NEGATIVE 5 TIMES 8NEGATIVE3?
1. 2 answers
2. asked by CIARA
3. 393 views
Ms. Sue I have to create a plot for my A-Z story :The Ugly Duckling. Could you please check to see if I have gotten everthing
1. 3 answers
2. asked by Sara
3. 483 views
Do you use is in this sentance or are There are more beaches and physical activity or There is more beaches and physical
1. 1 answer
2. asked by Max
3. 411 views
Prove tanAsin2A=2sin^2a
1. 1 answer
2. asked by Sarah
3. 433 views
prove 1-cosB divided by 1+cosB= tan^2B/2
1. 0 answers
2. asked by Sarah
3. 814 views
if A+B+C=180degrees, prove that 2sin(B+C)sinA=1-cos2A
1. 3 answers
2. asked by Sarah
3. 556 views
Prove that sin(A+B+C+)cos(B+C)-cos(A+B+C)sin(B+C)=sinA
1. 1 answer
2. asked by Mike
3. 371 views
descibe and explain 4 fates of a star ( after they die)?this is my 2nd last question to finish my worksheet and it is for marks
1. 1 answer
2. asked by anu
3. 424 views
y=x^2-8x
1. 1 answer
2. asked by estela
3. 672 views
underline complete subject and complete pedicate to my sentences. The boys and girls studied different kinds of measures.
1. 1 answer
2. asked by dj
3. 917 views
Which one would be correct:La semana pasada ellos me DIERON dinero. Or La semana pasada ellos me DI dinero. There's me so i
1. 2 answers
2. asked by Amy~
3. 588 views
solve the equation tan^2 (theta) + tan (theta)=0 for the interval 0 is less than or equal to (theta) is less than 2 pie.
1. 0 answers
2. asked by Please Answer :)
3. 427 views
PLEASE I NEED TO FINISH BY TODAY
1. 2 answers
2. asked by anu
3. 427 views
6x - 5y= 20 and 5y - 6x= -20Is there a solution, infinity, A point Consistent or inconsistent dependent or independent
1. 0 answers
2. asked by Susan
3. 410 views
Ms. Sue I just realized that I missed out the climax:-( Now I am confused. What would the climax be?
1. 6 answers
2. asked by Sara
3. 1,043 views
i need a haiku poem.please do not post websites.
1. 1 answer
2. asked by kathy
3. 410 views
i know what 4 fates of the star areblack dwarf supernova neutron star black holes but i don't know how they end up ( die)
1. 2 answers
2. asked by anu
3. 476 views
1. What would you think of a company's ethics if ti changed accounting methods every year?2. What accounting principle would
1. 1 answer
2. asked by Dee
3. 786 views
if sin A= the square root of eleven over 7, find the value of cos 2A.
1. 1 answer
2. asked by Please Answer :)
3. 364 views
if sec x=the square root of 5/2 with angle x in quadrant IV and than y= -(1/3) with angle in quadrant II, find the value of sin
1. 1 answer
2. asked by Please Answer :)
3. 871 views
A and B are positive acute angles. If sin A=(3/5) and cosB= (12/13) find the value of sin (A+B)
1. 4 answers
2. asked by Please Answer :)
3. 646 views
The mean height of 5 students is 59.4. If one of the students leaves, the mean height becomes 61. What is the height of the
1. 1 answer
2. asked by Michelle
3. 727 views
Please help me with this, I am confused!!!Multiply 3x+4/13 * 8/9x+12
1. 1 answer
2. asked by Mw95
3. 397 views
atleast tell me that you don't kmow
1. 2 answers
2. asked by anu
3. 341 views
How many kinds of sentences are there?
1. 4 answers
2. asked by Ty
3. 249 views
A company is taking a survey to find outwhether people like its product. Their last survey indicated that 70% of the population
1. 1 answer
2. asked by Anonymous
3. 649 views
name the physical quantity that corresponds to the rate of change of velocity?
1. 0 answers
2. asked by shubhangi
3. 461 views
i need a blank verse poem.
1. 1 answer
2. asked by kathy
3. 361 views
Use the first five terms of the exponential series and a calculator to approximate each value to the nearest hundredth.e^3.5 I
1. 1 answer
2. asked by Kim
3. 957 views
What is the simplest solution to the Brachistochrone problem and the Tautochrone problem involving calculus? (I know that the
1. 2 answers
2. asked by Sam
3. 1,002 views
Can someone please explain this to me, I know the answer but can not figure out how to get it?(15)(.8)^4(1-.8)^2+(6)(.8)^5(1-.8)
1. 2 answers
2. asked by Amanda
3. 854 views
An image of a candle is produced by a convex lens 14 cm away. If the focal length of the lens is 7 cm, how far from the lens is
1. 1 answer
2. asked by Emily
3. 1,244 views
calculate the concentration of sodium benzoate that must be present in a 2.0M solution of benzoic acid (C6H5COOH) to produce a
1. 0 answers
2. asked by Lucinda
3. 821 views
the perimeter of a parallelogram is 48 inches and the ratio of the lengths of the sides is 3:5. what are the lengths of the
1. 1 answer
2. asked by kevina
3. 1,385 views
the incomes of trainees at a local mill are normally distributed with a mean of $1100 and a standard deviation of 150. what
1. 1 answer
2. asked by shasha
3. 994 views
I don't understand what William Wordsworth's poem, The Prelude, is about. Can anyone tell me what the main themes and ideas are
1. 0 answers
2. asked by Mike X
3. 556 views
Could someone please check over my answers, and let me know if any of them are wrong. If they are wrong could you please give me
1. 4 answers
2. asked by Kelsey
3. 638 views
1 molar solution of Pb(NO3)2 you want 3mL of 0.5 Molar Pb(NO3)2 how much of the one molar solution do you mix with H2O to reach
1. 0 answers
2. asked by bob
3. 461 views
A student added solid K2O to a 750.0 mL volumetric flask. The solid was dissolved in water and then the flask filled with water
1. 1 answer
2. asked by Sara
3. 640 views
TWO series capacitors ( one 1 microFarad, the other of unknown value ) are charged from a 12 Voltage source. The 1 microFarad
1. 2 answers
2. asked by UNKNOWN
3. 1,370 views
What is the pH of a 2.62 x 10 -1 M HCN solution ? NB the pKa for HCN = 9.212.4.90 9.21 0.58 11.32 13.42
1. 2 answers
2. asked by Lucinda
3. 936 views
An acid HA has Ka = 2.28 x 10 -4. The % ionisation of this acid in a 0.170 M solution of the acid in water is closest to3.662 %
1. 0 answers
2. asked by Lucinda
3. 498 views
1. In a biology class, your final grade is based on several things: a lab score, scores on two major tests and your score on the
1. 2 answers
2. asked by elsa
3. 1,100 views
Calculate the pOH, pH, and percent protonation of solute in the following aqueous solution.0.043 M quinine, given that the pKa
1. 1 answer
2. asked by Sara
3. 575 views
how do i do a proffesional business budget
1. 0 answers
2. asked by daniell
3. 427 views
what are the choices of career in home economicsinfluence of orientation in home economics
1. 4 answers
2. asked by emmanuel
3. 932 views
What is the pH for the solution made from 11.10 mL of 0.278 M HCl solution mixed with 70.90 mL of 0.1300 M ammonia solution ?
1. 2 answers
2. asked by Lucinda
3. 748 views
whats the formular to find molarity and how do you do conversions? :)
1. 2 answers
2. asked by Irena
3. 461 views
What is the pH for the solution made from 11.10 mL of 0.278 M HCl solution mixed with 70.90 mL of 0.1300 M ammonia solution ?
1. 1 answer
2. asked by Lucinda
3. 1,025 views
In the analysis of food, the nitrogen from the protein is sometimes converted into ammonia which is titrated against a strong
1. 1 answer
2. asked by Lucinda
3. 532 views
Assuming that a typical popular music CD comprises 12 songs each of 8500 KB, what would the effective transmission speed need to
1. 1 answer
2. asked by DezQ
3. 491 views
I do not understand what they want:Describe the figure or polygon produced by interpreting the symbol {5/3} a. Triangle b. star
1. 4 answers
2. asked by bwb
3. 533 views
I am not sure I understand especially the part where it says "the value".If the surface area of a sphere decreases, will the
1. 1 answer
2. asked by bart
3. 541 views
what is the solution set {c/c<}A metal stays solid at Fahrenheit temperatures below 1532.9o. Determine ( in terms of an
1. 1 answer
2. asked by Denise
3. 532 views
a shipping crate contains 567 boxes of cereal. you open the top and count 12 across the front and 6 along the side. How many
1. 2 answers
2. asked by Nicole
3. 293 views
2/3x- 9 =6x
1. 1 answer
2. asked by Lars
3. 276 views
8x to the third power + 27=0. solve
1. 1 answer
2. asked by Anonymous
3. 324 views
8x to the third power + 27=0. solve
1. 1 answer
2. asked by Anonymous
3. 351 views
Suppose that x and y vary inversely and that y=1/6 when x = 3. Write a function that models the inverse variation and find y
1. 1 answer
2. asked by Skye
3. 1,537 views
In a sample of 138 teenagers, 38 have never been to a live concert. Find the sample proportion for those who have never been to
1. 1 answer
2. asked by Skye
3. 707 views
Triangle ABC is an equilateral triangle.AD=10 What is the length of CD? Give your answer to the nearest whole number.
1. 3 answers
2. asked by it's me
3. 1,131 views
Which of the following selections contains a run-on? If none of the selections contains a run-on, select "Correct." (Points: 5)E
1. 2 answers
2. asked by Anonymous
3. 515 views
Identify the complete sentence that is correctly punctuated.Most people support the sex offender registry, I worry that this
1. 4 answers
2. asked by Anonymous
3. 755 views
Class - what do I mean when I use the word tonality? How is the tonality defined by the harmony and melody?
1. 3 answers
2. asked by crystal
3. 542 views
Differentiate between general deterrence, specific deterrence, and situational crime prevention.
1. 0 answers
2. asked by Sade
3. 512 views
Air pollution normally increases along with population growth. This is a big problem for many cities
1. 2 answers
2. asked by John
3. 447 views
Together, Jared's age and his granther's age total 100. But Jared's grandfather is 70 yrs. older than him. How old is Jared's
1. 1 answer
2. asked by raeler
3. 493 views
Can someone please help me with this Algebra problem.The equation y= -1777x + 27,153 can be used to predict the number of y of
1. 0 answers
2. asked by Susan
3. 496 views
Is there any relation to Observational Learning, Defense Mechanisms and General Adaptation Syndrome, if so how ...if not please
1. 0 answers
2. asked by John Henry
3. 482 views
1. It is five stops from here.(What does 'it' refer to? Is 'for' missing before 'five stops'?) 2. That makes two of us. (What is
1. 2 answers
2. asked by rfvv
3. 497 views
information about the monuments visited such as konark temple,temples of kajuraho ,kailashnath temple,bhuddist
1. 0 answers
2. asked by sathvik
3. 575 views
Find the domain of the functiong(x)= 1/6-5x I know that x is a real number but I need the domain please.
1. 0 answers
2. asked by Matt
3. 860 views
Find the domain of the functionp(x)=2(pie2) -2x+9 What is the domain of p?
1. 0 answers
2. asked by Matt
3. 402 views
6x -5y =20 and 5y - 6x = -20A) No Solution B) Infinity C) A Point Consistant or Inconsistant Depdendant or Independant
1. 1 answer
2. asked by Susie
3. 1,047 views
Soybean meal is 18% protein, cornmeal is 9% protein. How many pounds of each should be mixed together in order to get a 360-lb
1. 0 answers
2. asked by Raj
3. 473 views
7x+4y= -4Is (3, -8) the solution to the equation?
1. 1 answer
2. asked by M.E.
3. 907 views
How would I make z the subject of the formulae:x=y(z-y)/z
1. 1 answer
2. asked by Vince
3. 826 views
Rules of Evidence and Hearsay:1. How do the Federal Rules of Evidence address the originality of computer data in relation to
1. 2 answers
2. asked by paula
3. 735 views
Kelly-Frye and Daubert Decisions:Compare and contrast the elements of the Kelly_Frye and Daubert decisions. What do you think
1. 1 answer
2. asked by paula
3. 595 views
choose a state and research the rules for admissibility of scientific evidence. Has it maintained Frye, adopted Daubert, or
1. 1 answer
2. asked by paula
3. 466 views
1. It is for two blocks from here.2. It is for two stops from here. 3. It is for two miles from here. 4. It is for two
1. 1 answer
2. asked by rfvv
3. 410 views

Back to May 2010

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024