Archives
2010
April

Questions Asked on April 29, 2010

in right triangle ABC, the altitude CD is drawn to hypotynuse AB. The length of DB is 5 units longer than AD.a) If AD = x,
1. 0 answers
2. asked by Anonymous
3. 839 views
health Identify and describe three causes for the increasing costs of health care
1. 1 answer
2. asked by kalaya
3. 628 views
How many acetone molecules are present in a bottle of acetone with a volume of 325ml and density of acetone .788g/cm
1. 1 answer
2. asked by Anonymous
3. 2,214 views
the last week of a month a car dealership sold 12 cars.A new sale promotion came out the first week of the month and sold 19
1. 2 answers
2. asked by Ricardo
3. 1,052 views
cosxcscx-2cosx=cscx-2
1. 0 answers
2. asked by john doe
3. 333 views
cos(x+B)=cosxcosB-sinxsinB
1. 0 answers
2. asked by john doe
3. 429 views
How would I compose a full sentence outline on same sex marrige using this thesis: The controversy around same sex marriage is
1. 1 answer
2. asked by Anna
3. 537 views
Please correct the sentence below, adding punctuation and changing words as needed. We found the play was quite intriguing
1. 1 answer
2. asked by Christopher
3. 451 views
What percentage of sodium-24 with a half life of 15.0 hr would remain after 60hours?
1. 1 answer
2. asked by Sarah
3. 807 views
Please correct the sentence below, adding punctuation and changing words as needed. The snow was falling fast and was so pretty
1. 5 answers
2. asked by Christopher
3. 792 views
Solve 5=6x+9 Used ASCII
1. 2 answers
2. asked by Rose Kendrick
3. 493 views
5=6x=9 Used the equation editor6x=5-9 6X=-4 X=-2/3
1. 0 answers
2. asked by Rose Kendrick
3. 329 views
What is the target organs for Luteinizing Hormone and the Follicle Stimulating Hormone?
1. 1 answer
2. asked by Melanie
3. 1,892 views
find the bolume of the solid generated by revolving the region bounded by the graphs of y=sqrt x , y=0, and x=4 about the x axis
1. 0 answers
2. asked by denise
3. 443 views
6x=5-96x=-4 x=-2/3 Used ASCII
1. 0 answers
2. asked by Rose Kendrick
3. 440 views
I am going to post the Arcadia work sheet so you will have a better understanding for my question:Arcadia Hospital Income
1. 3 answers
2. asked by Lauri
3. 486 views
Evaluate 6!/3!
1. 1 answer
2. asked by Rashonda
3. 310 views
How do you make a 100mL solution of 1.50 M of NaCl.
1. 2 answers
2. asked by Matt
3. 389 views
Simplify 5-3[2(3x-4)+3]
1. 0 answers
2. asked by zach
3. 339 views
discuss the psychosocial challenges facing retirees?
1. 4 answers
2. asked by zurah
3. 535 views
The public transport system is aware that one person in twenty does not buy a ticket for their trip. The manager decides to
1. 0 answers
2. asked by Anonymous
3. 424 views
Compound A is recrystallized from n-propanol. Given are the following solubilities (in 100 mL of solvent): 160 g/100 °C, 100
1. 1 answer
2. asked by Maria
3. 485 views
Which purpose does recrystallization serve?(Select all correct answers.) It is used to purify liquids. To separate unreacted
1. 0 answers
2. asked by Maria
3. 541 views
I used 10mL of unknown NaCl-NaBr mixture titrate with 0.10M silver nitrate solution.10.15mL of silver nitrate solution is used.
1. 1 answer
2. asked by albee
3. 1,166 views
6x=5-9 (used ASCII)6x=-4 x=-2/3
1. 0 answers
2. asked by Rose Kendrick
3. 407 views
Used the Equation Edition5=6x+9 6x=5-9 6x=-4 x=-2/3
1. 0 answers
2. asked by Rose Kendrick
3. 255 views
Question 1 This step in planning a Web project involves learning about HTML text editors, the original tools for creating Web
1. 0 answers
2. asked by Christopher
3. 1,130 views
Dr. Bob's computerized records have been compromised by a hacker, resulting in damages to patients. Which of the following is
1. 0 answers
2. asked by Anonymous
3. 543 views
Assuming you have a mixture of 2-nitrophenol and 4-nitrophenol, which solvent would be most suitable for recrystallization if
1. 0 answers
2. asked by Maria
3. 1,074 views
Consider the first order reaction A --> products where 25% of A disappears in 24 seconds. What is the half life of this
1. 1 answer
2. asked by omar
3. 4,486 views
I used 10mL of unknown NaCl-NaBr mixture titrate with 0.10M silver nitrate solution.10.15mL of silver nitrate solution is used.
1. 1 answer
2. asked by albee
3. 660 views
Which statements are FALSE about selecting a solvent for recrystallization?(Select all correct answers.) Any solvent can be used
1. 1 answer
2. asked by Maria
3. 716 views
the last week of the month a car dealership sold 12 cars.A new sale promotion came out the first week of the month and sold 19
1. 1 answer
2. asked by Ricardo
3. 1,197 views
Referring to solvent mixtures, which statements are TRUE ?(Select all correct answers.) The solvents of the solvent mixture
1. 0 answers
2. asked by Nataly
3. 673 views
Which of the following statements are correct?(Select all correct answers.) Breaking the bonds between the solute molecules is
1. 1 answer
2. asked by Larry
3. 839 views
What are proper techniques to induce crystallization from a saturated solution?(Select all correct answers.) Allowing the
1. 1 answer
2. asked by Joanna
3. 943 views
evaluate the indefinite integralintegral sign [8/(x ln(1x))] dx = ?????+c
1. 0 answers
2. asked by michael
3. 401 views
What is the oxidation number of Ga in Ga(NO2)3? is it O?
1. 1 answer
2. asked by Sarah
3. 499 views
How would I determine when isomeric dimethylbenzene yields 1 ,2 or 3 mononitro derivatives when treate with HNO3/H2SO4Thanks in
1. 0 answers
2. asked by chloe
3. 288 views
I need helpUsed ASCII 6x=5-9 6x=-4 x=-2/3 6x
1. 1 answer
2. asked by Rose Kendrick
3. 322 views
If you drink 1 can of soda each day, about how many milliliters would you drink in one year? (A can of soda is 354mL. Round your
1. 1 answer
2. asked by Nia
3. 477 views
Which pair of numbers, whose sum is 35, have the largest product?
1. 1 answer
2. asked by Mia
3. 608 views
We are doing Aldol condensation, and are asked to find the concentration of the UV-Vis Spectrum. However, I am not sure how to
1. 1 answer
2. asked by Markus
3. 380 views
Please help meUsed the equation Editor (or 9 MsEquation 3.0, found in "insert" then "object) 5=6x+9 6x=5-9 6x=-4 x=-2/3
1. 0 answers
2. asked by Rose Kendrick
3. 328 views
Based on sustainable development, 5 ways in which the human or enviromental problem impacts on the community?
1. 4 answers
2. asked by Sibongile
3. 477 views
A steel ball has a mass of 4.0 kg and rolls along a smooth, level surface at 62m/s. What is its kinetic energy. At first the
1. 1 answer
2. asked by Kasmira
3. 1,384 views
Simplify: 5-3[2(3x-4)+3]
1. 2 answers
2. asked by zach
3. 342 views
Could you check these thanks:Directions: Chose the one that best matches. A. Mais elle a une roue de secours dans le coffre. B.
1. 2 answers
2. asked by Lisa
3. 656 views
A sample of 12 measurements has a mean of 34 and a standard deviation of 4.5. Suppose that the sample is enlarged to 14
1. 3 answers
2. asked by Jen
3. 1,328 views
. In this problem, we will analyze the profit found for sales of a certain product. A demand equation (sometimes called a demand
1. 0 answers
2. asked by Anonymous
3. 619 views
How many mL of 0.75M HCl are needed to neutralize 20.0 grams of NaOH?
1. 1 answer
2. asked by Rachel
3. 604 views
what does escribir un cheque mean
1. 1 answer
2. asked by courtney
3. 338 views
How many mL of 0.75M HCl are needed to neutralize 20.0 grams of NaOH?
1. 1 answer
2. asked by Rachel
3. 624 views
(a)Comparison of GPA for randomly chosen college juniors and seniors:xbar= 3.05, s1 = .20, n1 = 15, xbar2= 3.25, s2 = .30, n2 =
1. 2 answers
2. asked by peter
3. 1,018 views
Identify the molecule that has polar bonds but is non-polar (net dipole moment is 0)a. CHCl3 b. NH3 c. BCl3 d. SCl2 e. H2S
1. 5 answers
2. asked by Mary
3. 3,184 views
..... Amy finished 6/12 of the problems on her timed test. Jackson finished 4/6 ... the timed test. Did they finish the same
1. 1 answer
2. asked by Angel
3. 475 views
Can some one please help me come up with an full sentence outline on same sex marriage (opposing it)
1. 1 answer
2. asked by Tom
3. 355 views
after WWII, what did Americans invest in?
1. 0 answers
2. asked by skinnie
3. 304 views
Why is this statement true or falsethe magnitude of vector a + b is greater than and equal to vector a
1. 1 answer
2. asked by Faustaus Legrand
3. 368 views
an adult has about 5 quarts of blood. when he donates a pint for a sick friend, what fraction of his blood does he give away
1. 2 answers
2. asked by Anonymous
3. 524 views
What You Call A Person That doesn't give you your Salary???
1. 3 answers
2. asked by Alisha
3. 418 views
Regarding previous post: I don't understand what I'm doing. My book says the answer is .50 M Ba(NO3)2 but I'm not getting that.
1. 4 answers
2. asked by Ana
3. 447 views
I have to identify 5 ways in which governments (Canadian, to be exact) prevent the spread of communicable diseases.
1. 0 answers
2. asked by AL 87
3. 468 views
ship is to trip as shout is to
1. 2 answers
2. asked by Matt
3. 405 views
I can figure out the rule for this tableINPUT 0 3 6 9 12 OUTPUT 600 540 480 420 360
1. 2 answers
2. asked by Javonna
3. 446 views
The charges of two identical aluminum speheres are -24uC and +4.0uC. The spheres are brought together so they simultaneously
1. 1 answer
2. asked by leah
3. 759 views
in a certain chemical reaction, two reactants undergo change to form two products why cant you determine what type of reaction
1. 1 answer
2. asked by lady t
3. 617 views
The gases in a mixture have the following partial pressures at the same volume and temperature: 1,013,000 Pa nitrogen, 700 mm
1. 2 answers
2. asked by tete
3. 812 views
my daughter in 2nd grade need help with her music homework. her rhythms are ta, too, four, and titi. The words are welcome,
1. 0 answers
2. asked by amy
3. 568 views
A 0.400 kg block of wood hangs from the ceiling by a string, and a 0.0700 kg wad of putty is thrown straight upward, striking
1. 2 answers
2. asked by Physics
3. 1,306 views
An 8 in. by 10 in. photo is reduced by dividing the length and width by 2. what is the new peritmeter?
1. 1 answer
2. asked by betty
3. 312 views
Instead of being the solution to larger issues like low self-esteem and depression, cosmetic surgery has become the issue." This
1. 0 answers
2. asked by Goldie
3. 487 views
Suppose a bullet of mass m = 6.96 g is fired into a ballistic pendulum whose bob has a mass of M = 0.677 kg.(a) If the bob rises
1. 0 answers
2. asked by Robert
3. 671 views
How do i explain the change of evolution of financial markets over the past 2 years?i feel like what i have now is just a simple
1. 0 answers
2. asked by Kevin
3. 425 views
A long horizontal hose of diameter 4.6 cm is connected to a faucet. At the other end, there is a nozzle of diameter 1 cm. Water
1. 1 answer
2. asked by kris
3. 1,022 views
explain the value of wetland to human societiesPlease help!!
1. 0 answers
2. asked by Anonymous
3. 409 views
what environmental factors make high levels of biodiversity possible in most costal waters?Please help!!!
1. 0 answers
2. asked by Anonymous
3. 499 views
two number have a sum equal to 50. their difference is 16. to figure out what the number are, you must first identify the
1. 5 answers
2. asked by ami
3. 382 views
A boarding kennel can hold 50 more cats than dogs. It can hold 200 dogs and cats. How many cats can it hold?a) 50 b) 125 c) 150
1. 1 answer
2. asked by kim
3. 442 views
Sara and her sister Emily both collect charms for the their charm bracelets. Together they have 42 charms. Emily has 2 more
1. 1 answer
2. asked by kim
3. 611 views
Do you think the changes in the 1920s gave Americans more control over their lives? Explain
1. 1 answer
2. asked by emily
3. 404 views
You are holding a shopping basket at the grocery store with two 0.51 kg cartons of cereal at the left end of the basket. The
1. 1 answer
2. asked by Carden
3. 1,073 views
I don't understand how to do this problem.You mix 1.00 L of 2.00 M BaCl2 with 1.00 L of 2.00 M AgNO3. What compounds remain in
1. 5 answers
2. asked by Ana
3. 575 views
advantages of conflict
1. 1 answer
2. asked by Anonymous
3. 268 views
explain why and how a canadian goose migrates?
1. 1 answer
2. asked by michael
3. 172 views
What is the freezing point of each solution?a)1.40mol Na2SO4 in 1750 g H2O Are these the right steps? 1.40mol Na2SO4 / 1.75kg =
1. 1 answer
2. asked by Jack
3. 3,017 views
find all solutions of the equation 4cos^2x-4cosx+1=0
1. 1 answer
2. asked by Brielle
3. 1,816 views
E11-9 The following stockholders’ equity accounts, arranged alphabetically, are in theledger of Marvel Corporation at December
1. 0 answers
2. asked by Anonymous
3. 569 views
A child sits in a wagon with a pile of 0.60 kg rocks. If she can throw each rock with a speed of 10 m/s relative to the ground,
1. 1 answer
2. asked by Carden
3. 1,130 views
Can you pleas check if the following sentences are correct? Thank you very much for your help.1) He has been (or is?)
1. 1 answer
2. asked by Franco
3. 478 views
2.3n-8=1.2n+3
1. 1 answer
2. asked by kin
3. 261 views
Steri-strips cost $4.95 per box, there are 100 per box. If an orthopedic surgical group uses 200 Steri-strips a month, how much
1. 1 answer
2. asked by debbie
3. 700 views
If your first 3 exams are worth 60% you get a 70, 68, and 60. Your 4th exam is worth 30% and your attendance is worth 10% you
1. 1 answer
2. asked by brittany
3. 537 views
OK- my daughter got this question for math homework "Buses leave boston for reno 2X a day, every day. Buses leave reno 2X a day
1. 7 answers
2. asked by victorie
3. 352 views
Mr. Adams has a box containing 14 coins. The coins are either quarters, nickels, or dimes. In the box are 4 quarters. There are
1. 2 answers
2. asked by guitarman
3. 518 views
90Sr is one of the harmful radionuclides resulting from nuclear fission explosions. It decays by a first-order process with a
1. 2 answers
2. asked by omar
3. 791 views
How do you see your reflection in a plane mirror?
1. 1 answer
2. asked by Emily
3. 352 views
At October 31, Nathan Company made an accrued expense adjusting entry of $1,400for salaries.
1. 1 answer
2. asked by Anonymous
3. 512 views
I have quite a few fill in the balnk questions regarding Russian history luckily i have social studies in 7th period so i could
1. 0 answers
2. asked by Anonymous
3. 508 views
During a rescue operation, a 5350 kg helicopter hovers above a fixed point. The helicopter blades send air downward with a speed
1. 1 answer
2. asked by Robert
3. 568 views

Back to April 2010

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2024