Archives
2009
April

Questions Asked on April 23, 2009

A sample of 7.80L of NH3 (ammonia) gas at 22 degrees and 735mmHg is bubbled into a 0.350L solution of 0.400M HCL(hydrochloric
1. 1 answer
2. asked by tomi
3. 3,829 views
1. A gas initially at 10 C must be changed to _____ C to triple the pressure.2. When a student plotted ln [vapor pressure of a
1. 3 answers
2. asked by Joan
3. 3,071 views
This question goes with the essay:Describe the reactions of Juliet's father and mother when Pais proposes marriage to their
1. 5 answers
2. asked by Hugs n kisses
3. 2,964 views
Question: A certain sample of phosphate rock contains 26.26% P2O5. A .5428 gram sample is analyzed by percipitating
1. 1 answer
2. asked by Eliz
3. 2,845 views
if a piece of aluminum with mass 3.99g and a temperature of 100C are dropped into 10cm^3 of water at 21C, what will be the final
1. 1 answer
2. asked by garrick
3. 1,928 views
Is Pat Mora the speaker in her poem "A Voice"?
1. 3 answers
2. asked by john smith
3. 1,824 views
The numerator of a certain fraction is four times the denominator. If 6 is added to both the numerator and the denominator, the
1. 2 answers
2. asked by Jayy
3. 1,740 views
A solution is prepared by dissolving 0.20 mol of acetic acid and 0.20 mol of ammonium chloride in enough water to make 1.0 L of
1. 1 answer
2. asked by Anonymous
3. 1,684 views
let the random variable x denote the number of girls in a five-child family. if the probability of a female birth is .5find the
1. 1 answer
2. asked by miranda
3. 1,520 views
Two conductors are made of the same material and have the same length. They each have circular cross sectional areas. The ratio
1. 1 answer
2. asked by bobby
3. 1,457 views
teresa and julia are among 10 students who have applied for a trip to washington DC. Two students from the group will be
1. 1 answer
2. asked by carl
3. 1,456 views
A package contains 9 candy canes, 6 of which are cracked. If 2 are selected, find the probability of getting no cracked candy
1. 2 answers
2. asked by yorkie16
3. 1,431 views
How do you balance this redox rxn?Al + HNO3 ----> Al(NO3)3 + NH4NO3 +H2O
1. 1 answer
2. asked by aj
3. 1,322 views
What is the definition of mental illness? Can mental illness be as clearly defined as a physical illness such as diabetes? Can
1. 4 answers
2. asked by Anonymous
3. 1,322 views
This refers to Sir Gawain and the Green KnightGawain's actions at the castle reveal that the knight's moral code values: a.
1. 4 answers
2. asked by sophie
3. 1,248 views
A wheel spins on a horizontal axis, with an angular spped of 140rad/s and with its angular velocity pointing east. Determine the
1. 1 answer
2. asked by Malcom
3. 1,221 views
What do these mean in English?Tu habites dans le centre-ville? Qu'est-ce qu'il y a dans ton village? Qu'est-ce qu'on peut faire
1. 2 answers
2. asked by Nabiha
3. 1,215 views
Estimate the area under the graph of f(x)= x^2 + 2 x from x=4 to x=10 using 3 approximating rectangles and left endpoints.
1. 1 answer
2. asked by Perry
3. 1,183 views
Hinduism,Historical figures and events,Central beliefs Nature of God, Texts, Ritual and practice (sacred elements & their
1. 2 answers
2. asked by jason
3. 1,178 views
all of the following are life functions of animals except?a. obtaining energy from food b. responding to changes in the
1. 4 answers
2. asked by Angie
3. 1,174 views
earth scienceWhich ancient device for measuring time is similar to decorative garden sundails used today a.the shadow stick of
1. 1 answer
2. asked by queeneka
3. 1,166 views
Is the Age of Exploration a social event or a cultural event?
1. 1 answer
2. asked by Amanda
3. 1,143 views
2) Which of the following, if true, would best explain the material presented in the table?A) The total value of property owned
1. 2 answers
2. asked by candy
3. 1,114 views
The portion of the nervous system that controls involuntary activities is a subdivision ofthe _______ nervous system. A.
1. 3 answers
2. asked by Amanda
3. 1,102 views
Lubricating oil, with a relative density of 0.79, flows around a 90¨¬ bend. The pipe diameter is 0.45m, and the oil has a
1. 1 answer
2. asked by Henri
3. 1,097 views
The Sorry State Lottery requires you to select 7 different numbers from 0 through 55. (Order is not important.) You are a Big
1. 1 answer
2. asked by Sabrina
3. 1,093 views
A solution is prepared by dissolving 0.20 mol of acetic acid and 0.20 mol of ammonium chloride in enough water to make 1.0 L of
1. 1 answer
2. asked by Anonymous
3. 1,086 views
Find the coordinates of the point whose polar coordinates are (20,140degrees).r=20 0=140 x=r cos (o) y=r sin (o) x=20 cos (140)
1. 2 answers
2. asked by Jon
3. 1,070 views
What does Ecuador plan to do on Infectious Diseases and what the United Nations plan to do>?
1. 0 answers
2. asked by jaz
3. 1,014 views
Question: a sample is to be analyzed for its chloride content by the precipitation and weighing of silver chloride. what mass of
1. 1 answer
2. asked by Anonymous
3. 1,010 views
story promblesRiders of the scorpion must be at least 48 inches tall.Last summer Zack was 3 feet tall.He has grown 5 inches,but
1. 2 answers
2. asked by queeneka
3. 1,009 views
A team is chosen to design an orbiting space station that is shaped like a wheel 5o meters in diameter with is mass of 4*10^5 kg
1. 1 answer
2. asked by Malcom
3. 1,005 views
* I have a project to do for William Shakespeare, Were i have to make some sort of amusement park and i need help thinking of
1. 1 answer
2. asked by Shaz
3. 1,003 views
Why does Juliet's parents believe that she was grieving for Tybalt's death too immoderatley?I really need help on this one.
1. 1 answer
2. asked by Hugs n kisses
3. 999 views
What is Lord Capulet's reaction to Paris's proposal to marry juliet. And what is Lady Capulet's reaction to Paris's proposal to
1. 1 answer
2. asked by Hugs n kisses
3. 997 views
Could you please check these thanks god bless.Directions: Match each word in the left hand column with it's opposite in the
1. 1 answer
2. asked by Muffin
3. 964 views
why gupta period called the golden age of indian culture.write down your remarks about it in brief?
1. 2 answers
2. asked by tushar das
3. 953 views
Suppose a whale is stranded on a beach. It is 15 meters from the sea. He weighs 1.5 x 10 to the power of 6, and the force a few
1. 1 answer
2. asked by Borjan
3. 939 views
I know what the 5-questions are, but what I do not understand is in what circumstances would the 5-question approach to
1. 1 answer
2. asked by AW
3. 915 views
Discuss some of the advantages to having a cycle that partially replenishes itself. In the Calvin cycle, what would happen to
1. 1 answer
2. asked by joey
3. 894 views
What is the job of a frog's pancreas?
1. 0 answers
2. asked by ~{HAPPY FACE}~
3. 893 views
1. Planet X orbits the sun with a mean orbital radius that is 6200 times that of earth. Its diameter is twice that of earth, and
1. 1 answer
2. asked by Sandhya
3. 893 views
A 75.0mL sample of 1.56×10−2M Na2SO4(aq) is added to 75.0mL of 1.22×10−2M of Ca(NO3)2(aq).What percentage of the Ca+
1. 2 answers
2. asked by tomi
3. 892 views
What are areas of compressiona and rarefraction?Thanks
1. 1 answer
2. asked by ilovedance.
3. 891 views
you have to buy 100 animals. roosters cost 5.00, hens cost 1.00 and chicks cost .05cents. how many of each animal can I buy?
1. 4 answers
2. asked by carol
3. 889 views
Three solid cylinder rods roll down a hill with the same linear speed. Rod R1 has a 1inch diamter, Rod R2 has a 2inch diameter,
1. 0 answers
2. asked by Sandy
3. 837 views
Suppose you buy flour and cornmeal in bulk to make flour tortillas and corn tortillas. Flour costs $1.50/lb. Cornmeal costs
1. 2 answers
2. asked by Angie
3. 832 views
What is the relationship between codon and gene.
1. 1 answer
2. asked by Jamie
3. 820 views
When a student plotted ln [vapor pressure of a gas] vs. inverse Kelvin temperature, she obtained a straight line with a slope
1. 2 answers
2. asked by Linda
3. 816 views
y intercept:3x^2+18x 0=3x^2+18x from here im lost
1. 5 answers
2. asked by kirs
3. 799 views
You are asked to bring the pH of 0.500L of 0.450M NH4Cl to 7.00.a) Which of the following solutions would you use: 10.0M HCl or
1. 3 answers
2. asked by tomi
3. 792 views
A wheel spins on a horizontal axis, with an angular spped of 140rad/s and with its angular velocity pointing east. Determine the
1. 3 answers
2. asked by Malcom
3. 761 views
how does sodium thiosulfate neutralize chlorine
1. 1 answer
2. asked by Steve
3. 760 views
how is chlorine neutralized using a compound containing sodium thiosulfate,what is the complete balanced equation for all
1. 1 answer
2. asked by Steve
3. 728 views
how to fid g(4), g'(4) and g''(4) when graph of the function f shown above consist of six line segments. Let g be the function
1. 2 answers
2. asked by Hugo
3. 727 views
Evalute the definite integral (cosx)/(3 sin(x)+15)dx= +C
1. 1 answer
2. asked by Manny
3. 716 views
Write a 200- to 300-word response explaining the impact terrorism and cyber crimes have on interpreting the Fourth Amendment.
1. 0 answers
2. asked by Wendy
3. 713 views
A man is shot in the head, and the bullet stops just outside the dura mater. What isthe innermost layer that the bullet has
1. 3 answers
2. asked by Amanda
3. 705 views
A wheel spins on a horizontal axis, with an angular spped of 140rad/s and with its angular velocity pointing east. Determine the
1. 0 answers
2. asked by David
3. 697 views
Could you please check these thanks god bless.Directions: Give your favorite color( mine) for the following items. Note that
1. 3 answers
2. asked by Muffin
3. 697 views
Given the oft-cited statistic that 66.7% of the American public is overweight or obese, you are interested in comparing college
1. 2 answers
2. asked by HLR
3. 694 views
a metal spoon becomes hot after being left in a pan of boiling water. this is an ex. of? A)convectionB)conduction C)radiation
1. 1 answer
2. asked by john
3. 686 views
Writing Guidelines:Answer every question carefully use proper citation in either APA or MLA Style. Be specific and limit your
1. 4 answers
2. asked by Anonymous
3. 685 views
Deliverable Length: 4-6 slides with in-depth speaker notesToday, many organizations and managers face new challenges everyday.
1. 3 answers
2. asked by val
3. 678 views
You have the most potential energy at the top of a hill. Where would you have the most kinetic energy?- I was thinking right
1. 1 answer
2. asked by Lena
3. 677 views
i just got home from rehersal and i have a spanisg collage due tomorrow i need to get ten oics about what i am doing in the next
1. 0 answers
2. asked by sam
3. 648 views
Occupational Outlook Handbook and search the handbook for various mental health service professions. Select two professions
1. 1 answer
2. asked by Anonymous
3. 648 views
A young man happens to spot an ex-girlfriend he’s trying to avoid. Why does his mouthbecome dry? Where could I find
1. 1 answer
2. asked by Tyra
3. 647 views
round to the nearest ten dollars, then estimate the answer/$73.88=---dollars +29.04----dollars ------------------
1. 3 answers
2. asked by kim
3. 640 views
Post a 200- to 300-word response to the following: Provide a brief summary differentiating conservation and preservation. Do you
1. 1 answer
2. asked by Anonymous
3. 637 views
i just started spanish II , i want these questions checked to see if i'm on the right track:1. Que tienes en el bolso? a. tengo
1. 2 answers
2. asked by spanish
3. 637 views
I need help finding the mesurment in a ruler the little bitty mark could you pull up a ruler for me with all the marks .
1. 4 answers
2. asked by kim
3. 635 views
Identify the thesis statement in the article A Nation Apart. What strategies does the author use to formulate his argument? What
1. 1 answer
2. asked by Anonymous
3. 627 views
Most children are familiar with Dr. Seuss and "Green Eggs and Ham." You could use some of the catchy phrases there.Here are some
1. 0 answers
2. asked by SraJMcGin
3. 627 views
tell whether the ordered pair is a solution of the equation y=-4x+31. (-2, -5) 2. (3, -9) 3. (1/2, 1) my answers: 1. no, 2. no,
1. 2 answers
2. asked by xxx
3. 627 views
I have a question. Are teacher wanted us to write our entire paper first before we found the research. Now we have to go back
1. 5 answers
2. asked by Kara
3. 624 views
Explain the role of the U.S. in the emerging global community?This is what I have so far, need to know if I'm on the right
1. 1 answer
2. asked by Betzy
3. 620 views
The choroid and the auricle are similar because,one collects light and the other collects sound?
1. 2 answers
2. asked by Anonymous
3. 618 views
Identify the graph of the equation 4x^2-25y^2=100. Then write the equation of the translated graph for T(5,-2) in general form.M
1. 0 answers
2. asked by Jon
3. 617 views
Identify the graph of the equation 4x^2-25y^2=100. Then write the equation of the translated graph for T(5,-2) in general form.M
1. 1 answer
2. asked by Jon
3. 611 views
I'm having a little trouble of figuring out what two jobs that might fit me. The two colors down below represent me. I been
1. 4 answers
2. asked by Tony
3. 610 views
What are your favorite school subjects?Quelles matières sont tes favorites (Shouldn't this be favoris or préférée)? What are
1. 1 answer
2. asked by Larry
3. 609 views
Consider the following numerical version of the IS-LM model:C = 60 + 0.6Yd I = 150 – 10i YD = Y – T T = 200 G = 250 Real
1. 4 answers
2. asked by ismail
3. 608 views
i fixed my narrative poem this time and i made it all rhyme. so can you check if its got sound this time? im sure it will be
1. 3 answers
2. asked by john
3. 590 views
Could you please check these thanks god bless.Directions: Describe your favorite outfit, including each item of clothing and its
1. 1 answer
2. asked by Muffin
3. 590 views
find the lcd for 4 over 5 and 3 over 9
1. 1 answer
2. asked by mia
3. 583 views
If some substance has a ph of 8, is it a base or is it neutral?I know that a ph of 7 is neutral, so is 8 also neutral since it's
1. 1 answer
2. asked by Me!
3. 583 views
* I have a project to do for William Shakespeare, Were i have to make some sort of amusement park and i need help thinking of
1. 0 answers
2. asked by Shaz
3. 582 views
in the the theories of aggression what is something you could take and use with the people in your life who have problems with
1. 3 answers
2. asked by Bryan
3. 581 views
Force F causes displacement d of a 20-Kg object starting from rest along a frictionless path. F= 10 N i + 50 N j + 15 N k and d=
1. 1 answer
2. asked by Sandhya
3. 580 views
Can someone help me find the average punishment for forcible in the United States?I know most of it is based on a state level,
1. 1 answer
2. asked by K
3. 579 views
I need to know the country of origin of: Hinduism, Buddhism, Confucianism, and Daoism.For each of these religions I need some
1. 1 answer
2. asked by paul
3. 577 views
the original problem was:Solve: sin(3x)-sin(x)=cos(2x) so far i've gotten to: sin(x)(2sin(x)cos(x)-1)=cos^2(x)-sin^2(x) Where
1. 1 answer
2. asked by Katie
3. 576 views
A patient complains of constantly desiring food and water, then having to urinatefrequently. Tests show normal ADH levels. These
1. 0 answers
2. asked by Tyra
3. 564 views
At a faculty costume party, each teacher from transylvania Middle School came dressed as his or her favorite creepy creature.
1. 6 answers
2. asked by Teresa Joseph
3. 556 views
Cindy has two fourths of a circle and three tenths of a circle. What does she need to make a whole circle?
1. 5 answers
2. asked by Brooke
3. 555 views
Consider the following numerical version of the IS-LM model:C = 60 + 0.6Yd I = 150 – 10i YD = Y – T T = 200 G = 250 Real
1. 0 answers
2. asked by ismail
3. 553 views
the original problem was:Solve: sin(3x)-sin(x)=cos(2x) so far i've gooten to: sin(x)(2sin(x)cos(x)-1)=cos^2(x)-sin^2(x) Where
1. 0 answers
2. asked by Katie
3. 553 views
hi im doing my assignment in child care level 3 and i need to answer this question ,(describe ways that parents may participate
1. 2 answers
2. asked by ella
3. 551 views
the average american use about 80gallons of watereach day how many people are in your family use this number to figure out about
1. 6 answers
2. asked by tia
3. 544 views

Back to April 2009

Ask a New Question

Archives
Contact Us
Newest
Privacy Policy
Terms of Use
© 2025