Questions Asked on April 16, 2009

Three spheres, each with a negative chrge of 4.0x10^6C, are fixed at the vertices of an equilateral triangle whose sides are
1. 6 answers
2. asked by Susan
3. 5,450 views
A tennis ball is thrown vertically upward wih an initial velocity of 8.0m/s.A) What will its speed be wheen it returns to its
1. 2 answers
2. asked by Taylor
3. 2,970 views
2cr(s) + SnCL4(aq) -->can this reaction occur if so write the balanced equation if it doesnt explain why
1. 2 answers
2. asked by mel
3. 2,641 views
Why is the reaction rate of a given metal with a stronger acid is faster than with weaker acid?Which one required more volume to
1. 6 answers
2. asked by Anonymous
3. 2,635 views
An electron is accelerated by a 4.7 kV potential difference. How strong a magnetic field must be experienced by the electron if
1. 1 answer
2. asked by Mara
3. 2,607 views
Explain whether the photons emitted by a bright light bulb are more energetic than those emitted by a dim light bulb of the same
1. 1 answer
2. asked by Jenny
3. 2,396 views
Please help me with my paper algebra with Pizzazz! Page 76, objective 3-a.Name of paper is Why are babies like hinges?
1. 8 answers
2. asked by Jon
3. 1,949 views
Calculate [H3O] in the following solutions.5.15x10-2M HCl and 7.62x10-2M NaC2H3O2 Responses HCl + NaC2H3O2. It appears there is
1. 4 answers
2. asked by tomi
3. 1,881 views
The suspense that occurs in the highwaymanWhen the soldier come to the inn tie Bess up with a gun at her chest. what do you
1. 5 answers
2. asked by john
3. 1,794 views
Suppose that P dollars are invested in a savings account at interest rate I, compounded annually, for 2 years. The amount A in
1. 3 answers
2. asked by Cassie
3. 1,414 views
I HAVE A DIAMOND BRACELET THAT HAS THE MARKINGS OF JAFA STAMPED ON THE INSIDE OF IT ABOVE 05TW MEANING THE TOTAL WEIGHT. WHAT
1. 1 answer
2. asked by JOY
3. 1,408 views
What type of lever does a pizza cutter have?
1. 2 answers
2. asked by Anonymous
3. 1,405 views
I need some help with answering these questions: What are some types of agency problems do health care organizations in
1. 4 answers
2. asked by Nikia walker
3. 1,404 views
Three spheres, each with a negative chrge of 4.0x10^6C, are fixed at the vertices of an equilateral triangle whose sides are
1. 2 answers
2. asked by Susan
3. 1,367 views
Write the standard form of the equation of a circle that passes through the points at (0,8) (8,0) and (16,8). Then identify the
1. 2 answers
2. asked by Anonymous
3. 1,241 views
Question: A 0.400 g sample of propionic acid was dissolved in water to give 50.00 mL of solution. This solution was titrated
1. 1 answer
2. asked by Eliz
3. 1,231 views
Al completed the job in 20 minutes. Al and Pam completed the job together in 12 minutes. How long does it take Pam to complete
1. 2 answers
2. asked by Brian
3. 1,213 views
1. Do you have a scissors?2. Do you have a pair of scissors? 3. Do you have scissors? (Which ones are correct? Is #1 correct?)
1. 1 answer
2. asked by John
3. 1,185 views
water vapor and nitrogen dioxide gas NO2 are cimbined to manufacture ammonia. a by product of this reaction is oxygen gas. write
1. 1 answer
2. asked by mel
3. 1,159 views
how Reagan’s policies reflected conservative politics and contributed to stimulation of the economy.
1. 1 answer
2. asked by Sandi
3. 1,132 views
Im working on poetry at school and I'm suppose to make a limerick. The rhyme scheme is aabba. I'm now just having trouble on the
1. 2 answers
2. asked by Sam
3. 1,121 views
A McLeod gauge measures low gas pressures by compressing a known volume of the gas at constant temperature. If 315 cm^3 of gas
1. 1 answer
2. asked by Anonymous
3. 1,116 views
adonde vas los sabados por la tarde?
1. 1 answer
2. asked by dery
3. 1,115 views
determine wheter each of the following reactions occur.2Ni(s) + MgSO4(aq)---> if it doesnt occur explain why
1. 0 answers
2. asked by bebe
3. 1,075 views
1. He felt it hard to solve the problem.2. He felt that he should get up early. 3. He felt like a philosopher. 4. The fish
1. 1 answer
2. asked by John
3. 993 views
In the poem "God's Grandeur," we find the words reck and rod. By analysis we can determine that the word rod probably comes from
1. 4 answers
2. asked by YAHMIA
3. 924 views
would richard nixon be the best president if it weren't for the watergate scandal?
1. 4 answers
2. asked by bob
3. 916 views
Does a pizza cutter have a second class or third class lever?
1. 1 answer
2. asked by Anonymous
3. 893 views
If the density of ice is 0.92 g/cm^3, what percent of an ice cube’s (or iceberg’s) mass is above water.
1. 1 answer
2. asked by Kim
3. 885 views
1. He is using the computer.2. He is working on the computer. 3. He is working at the computer. (Which one is correct? What is
1. 2 answers
2. asked by John
3. 885 views
in african-violet plants,purple flowers are dominate to white flowers. You purchase an African- violet plant with white flowers.
1. 2 answers
2. asked by codi
3. 861 views
A sample of 7.80L of NH3(ammonia) gas at 22 degrees Celsius and 735torr is bubbled into a 0.350L solution of 0.400M HCl
1. 2 answers
2. asked by tomi
3. 855 views
A club has 50 members. If there is a 10% absentee rate per meeting, find mean and standard deviation: How do you do the problem
1. 1 answer
2. asked by ce
3. 850 views
determine wheter each of the following reactions occur.2Ni(s) + MgSO4(aq)---> if it doesnt occur explain why
1. 2 answers
2. asked by roy
3. 832 views
queston: the pH of a white vinegar solution is 2.45. this vinager is an aquous solution of acetic acid with a density of
1. 1 answer
2. asked by Anonymous
3. 826 views
A 0.108 M sample of a weak acid is 4.16% ionized in solution. what is the hydroxide concentration of this solution?I know that i
1. 1 answer
2. asked by Anonymous
3. 823 views
1. There were two seeds.The first seed was negative, but the second seed was positive. 2. There were two seeds. One seed was
1. 1 answer
2. asked by John
3. 807 views
Latitude lines measure distance in degrees north and south of this?is it equator?
1. 3 answers
2. asked by luke
3. 795 views
jose can complete the job in a hours, and Maria can complete the job in b hours. How long does it take them to complete the job
1. 1 answer
2. asked by Brian
3. 786 views
Find the length and width of a rectangular lot with a perimeter of 70 meters if the length is 5 meters more than the width
1. 1 answer
2. asked by tonya
3. 768 views
Summarize the effects of one type of sexual dysfunction that can affect both men and women. What are some factors that may cause
1. 2 answers
2. asked by Brittney
3. 757 views
The bond enthalpy of N2(g) is 418.0 kJ/mol. Calculate ÄH°f for N(g).I figured that if it gave the enthalpy for N2, then the
1. 0 answers
2. asked by han
3. 755 views
Suppose that P dollars is invested in a savings account at interest rate I, compounded semiannually, for one year. The amount A
1. 0 answers
2. asked by Cassie
3. 749 views
If the density of ice is 0.92 g/cm^3, what percent of an ice cube’s (or iceberg’s) mass is above water.
1. 1 answer
2. asked by Albert
3. 742 views
Answer in m/s.The speed of a moving bullet can be determined by allowing the bullet to pass through two rotating paper disks
1. 1 answer
2. asked by Amanda
3. 726 views
Determine whether the graphs of lines with the given Equations are Parallel,Perpendicular or neither. Eq#1 2X + 3Y = 4 and Eq#2
1. 1 answer
2. asked by mark
3. 717 views
A material has 32 atoms in all; 24 decayed and the rest undecayed. If the half-life of the radioactive material is 1000 years,
1. 4 answers
2. asked by Angie
3. 711 views
Suppose that P dollars is invested in a savings account at interest rate I, compounded semiannually, for one year. The amount A
1. 1 answer
2. asked by Cassie
3. 701 views
Indirectly affected person 1 or group 1 when mountain climbing unpreparedplease help and thank you person 1 or group 1 means
1. 2 answers
2. asked by Growler
3. 697 views
managing time wisely
1. 3 answers
2. asked by pennet
3. 697 views
What does the sentence victoria numerum servorum non augebit translate to? I got-the victory did not add to the many servant.
1. 2 answers
2. asked by Nicki
3. 695 views
I have homework and i don't understand what to do help please.Plan for a job search by considering how you would manage the
1. 1 answer
2. asked by lisa
3. 691 views
Find two binomials whose product is x^2 - 6x + 9 and explain how you decided on those two binomials.Thank you! :-)
1. 1 answer
2. asked by Cassie
3. 690 views
the specific heat capacity of mercury is 0.033 cal/(g))degrees Celsius)How many grams of Hg could be raised to 50 degrees
1. 1 answer
2. asked by marcus
3. 683 views
Can anyone give more advise on this subject about doing a day to day plan to use a a job aide for an employment search?
1. 2 answers
2. asked by Heather
3. 678 views
How are flowers related to the sale of illegal drugs?Are they related because they stopped charging tariffs on the drugs and
1. 0 answers
2. asked by Minnie
3. 677 views
MaineCellular offers a phone plan that costs $12 per month plus 10 cents per minute. Portland Wireless offers a plan that costs
1. 1 answer
2. asked by melissa
3. 676 views
I am having the following problem: I need to calculate 2 Keq values based on the experiment that I conducted.I reacted 0.082
1. 0 answers
2. asked by Sara
3. 673 views
My problem is as follows "A 3 kg brick is dropped from a height of 1.0 m onto a nail which is vertically stuck in a plank of
1. 2 answers
2. asked by Brigid
3. 671 views
I'm applying to the local Chamber of Commerce for a scholarship open to high school juniors to become ambassadors for our town,
1. 2 answers
2. asked by Katie
3. 665 views
Can you tell me where does suspense occur and why ? In The "cremation of sam McGee", and "the highwayman"please help
1. 2 answers
2. asked by john
3. 664 views
How does the apparent weight loss of the an object compare with the weight of the water displaced by the object?
1. 1 answer
2. asked by Albert
3. 659 views
1)exam #00779100 of penn foster i need help with the exam
1. 2 answers
2. asked by Anonymous
3. 655 views
If an economy has elements of more than one economic system. it is a ________.
1. 1 answer
2. asked by Claudia
3. 651 views
The following is my thesis for my essay:In “The Unknown Citizen,” it is evident that Auden was concerned with modern society
1. 2 answers
2. asked by Kara
3. 649 views
Mrs. Sue below with the true/false question I posted earlier do you thinkSraJMcGin meant that the answer was true or the answer
1. 4 answers
2. asked by Terrie
3. 646 views
1. The second seed came out of the earth.2. The second seed came out of the Earth. (Which one is correct? Do I have to use
1. 1 answer
2. asked by John
3. 639 views
hi! I am doing tomorrow a chant (body parts) with young learners of english as a foreign language.They need to sing and show the
1. 3 answers
2. asked by laxy
3. 635 views
1. it is by far the best dictionary.2. It is far and away the best dictionary. 3. it is far the best dictionary. 4. it is a lot
1. 2 answers
2. asked by John
3. 633 views
Y2 = 289the 2 is to the second power a. Y = 289 b. Y = 144.5 c. Y = 18 d. Y= -17 and +17
1. 2 answers
2. asked by sandy
3. 628 views
Find the principle root (-64)1/6. Express the result in the form a+bi.(2i)^6= -64 = (-64)1/6= 0+2i I got it wrong, please help.
1. 2 answers
2. asked by Anonymous
3. 628 views
what information is on a felxible budget?*** is this correct*** The flexible budget report consists of two sections: (1)
1. 1 answer
2. asked by scooby9132002
3. 625 views
With the question that you replied true to on the post below did you mean that the answer is true or is the answer false.
1. 2 answers
2. asked by Terrie
3. 617 views
After synthesizing your alkyl halide, Which layer will be the organic layer?
1. 1 answer
2. asked by Hola
3. 610 views
Answer in m/s.The speed of a moving bullet can be determined by allowing the bullet to pass through two rotating paper disks
1. 1 answer
2. asked by Amanda
3. 607 views
i have to finished this cross word , and i need help on the last two . So thank you if you can solve it :)A substance that micro
1. 0 answers
2. asked by Saffron.
3. 607 views
Where can I look at the videos or beroadcasting about stock? Pleasse let me know the website addresses.
1. 1 answer
2. asked by Business
3. 605 views
What are the distinguishing characteristics between the two catagories of igneous rocks? I know two are texture and color. But
1. 1 answer
2. asked by AMW
3. 603 views
In the process of starting up the car plant, a turbine accelerates from rest at 0.49 rad/s^2 .How long does it take to reach its
1. 1 answer
2. asked by Sandy
3. 596 views
In need of assistance pleasetake two integers between -12 and +12 write two equations that have the two intergers selected as
1. 1 answer
2. asked by yorkie16
3. 593 views
If a .3kg arrow is fired at 120m/s at a 30degree angle with the horizontal, how high is it at the top of its arc? I'm confused.
1. 3 answers
2. asked by Brigid
3. 591 views
Does this sound right for the following scenario?The mayor of a small seaside town faces a tough decision. A prominent developer
1. 1 answer
2. asked by AW
3. 590 views
A firm is a monopolist in the production of a fuel sensor system. It faces monthly market demand that varies according to the
1. 1 answer
2. asked by John
3. 589 views
An object in the shape of a cube has a mass of 375 grams and a side that measure 5.0 cm. Will this object float in water? Prove
1. 1 answer
2. asked by Kim
3. 587 views
Could I please get some further assistance on a question I posted earlier? I'm not getting the correct answer and I'm not sure
1. 1 answer
2. asked by Susan
3. 587 views
What are the factors that have contributed to this society's perspective of the deviant behavior? Why does this society consider
1. 5 answers
2. asked by anonymous
3. 578 views
I would appreciate any help thanksselect two intergers between -12 and +12 write two equations that have the two intergers as
1. 1 answer
2. asked by yorkie16
3. 572 views
The true/false question from yesterday was Atp does not play a role in energy transfer in living things.You said did i mean stp.
1. 4 answers
2. asked by Terrie
3. 565 views
Can anyone get me started on this?A country has 2 regions, the North and South, which are identical in all respects except for
1. 3 answers
2. asked by anonymous
3. 562 views
plz i need helpIf the density of ice is 0.92 g/cm^3, what percent of an ice cube’s (or iceberg’s) mass is above water.
1. 1 answer
2. asked by Albert Kim
3. 557 views
Find an equation of the tangent line to the parabola at the given point, and find the x-intercept of the line.17) x^2=2y ,
1. 1 answer
2. asked by Mike
3. 557 views
How can masculine and feminine traits be described using the contimuum masculinity-femininity?
1. 1 answer
2. asked by Julie
3. 557 views
Which of the following are inverse functions?1. Arcsin x and sin x 2. cos^-1 x and cos x 3. csc x and sin x 4. e^x and ln x 5.
1. 0 answers
2. asked by Anonymous
3. 557 views
Can you please proofread:Aging is something that everyone will experience. Having the opportunity to explore four different
1. 1 answer
2. asked by Lily
3. 556 views
grandma (me) trying to help 2nd graderwith pyramids, triangles, rectangular prisms and cylinders. how many cylindeers are needed
1. 3 answers
2. asked by marie
3. 556 views
to assure childrens safety in a child care setting, teachers must provide continuous what ?
1. 2 answers
2. asked by marcella
3. 553 views
When soldiers are in battle they have to operate as a unit, not as individuals. How does that take away their freedom? I posted
1. 1 answer
2. asked by Kara
3. 547 views
What is customer service in today's business environment?
1. 1 answer
2. asked by China
3. 546 views
What is an introductary word?thank you
1. 4 answers
2. asked by Joe
3. 533 views
provide the iupac name,ch3ch(c3h7)ch2ch2ch2ch2ch(c4h8)ch2ch(ch3)ch3
1. 0 answers
2. asked by shakirudeen
3. 529 views

Back to April 2009