Questions Asked on April 16, 2009

managing time wisely
1. 3 answers
2. asked by pennet
3. 666 views
An object in the shape of a cube has a mass of 375 grams and a side that measure 5.0 cm. Will this object float in water? Prove
1. 1 answer
2. asked by Kim
3. 538 views
Three spheres, each with a negative chrge of 4.0x10^6C, are fixed at the vertices of an equilateral triangle whose sides are
1. 6 answers
2. asked by Susan
3. 5,394 views
MaineCellular offers a phone plan that costs $12 per month plus 10 cents per minute. Portland Wireless offers a plan that costs
1. 1 answer
2. asked by melissa
3. 608 views
Latitude lines measure distance in degrees north and south of this?is it equator?
1. 3 answers
2. asked by luke
3. 750 views
how Reagan’s policies reflected conservative politics and contributed to stimulation of the economy.
1. 1 answer
2. asked by Sandi
3. 1,075 views
An electron is accelerated by a 4.7 kV potential difference. How strong a magnetic field must be experienced by the electron if
1. 1 answer
2. asked by Mara
3. 2,543 views
How does the apparent weight loss of the an object compare with the weight of the water displaced by the object?
1. 1 answer
2. asked by Albert
3. 618 views
If the density of ice is 0.92 g/cm^3, what percent of an ice cube’s (or iceberg’s) mass is above water.
1. 1 answer
2. asked by Albert
3. 676 views
What is an appositive?What is a direct address? Thank you so much.
1. 3 answers
2. asked by Joe
3. 421 views
Why is the reaction rate of a given metal with a stronger acid is faster than with weaker acid?Which one required more volume to
1. 6 answers
2. asked by Anonymous
3. 2,559 views
What does the sentence victoria numerum servorum non augebit translate to? I got-the victory did not add to the many servant.
1. 2 answers
2. asked by Nicki
3. 641 views
plz i need helpIf the density of ice is 0.92 g/cm^3, what percent of an ice cube’s (or iceberg’s) mass is above water.
1. 1 answer
2. asked by Albert Kim
3. 507 views
1. Do you have a scissors?2. Do you have a pair of scissors? 3. Do you have scissors? (Which ones are correct? Is #1 correct?)
1. 1 answer
2. asked by John
3. 1,142 views
Company sells 100,000 wrenches for $12.00 a unit. Fixed cost are $300,000.00 and net income is $200,000. What should be reported
1. 0 answers
2. asked by ciera
3. 462 views
The bond enthalpy of N2(g) is 418.0 kJ/mol. Calculate ÄH°f for N(g).I figured that if it gave the enthalpy for N2, then the
1. 0 answers
2. asked by han
3. 690 views
Answer in m/s.The speed of a moving bullet can be determined by allowing the bullet to pass through two rotating paper disks
1. 1 answer
2. asked by Amanda
3. 517 views
Answer in m/s.The speed of a moving bullet can be determined by allowing the bullet to pass through two rotating paper disks
1. 1 answer
2. asked by Amanda
3. 640 views
Immediately affected person or group when mountain climbing unpreparedplease help and thank you
1. 2 answers
2. asked by Growler
3. 464 views
What is an introductary word?thank you
1. 4 answers
2. asked by Joe
3. 500 views
Hi!!Is a plant a resource, or not? Please Help!! Thank You!!
1. 3 answers
2. asked by ~{Happy Face}~
3. 360 views
I have homework and i don't understand what to do help please.Plan for a job search by considering how you would manage the
1. 1 answer
2. asked by lisa
3. 621 views
If the density of ice is 0.92 g/cm^3, what percent of an ice cube’s (or iceberg’s) mass is above water.
1. 1 answer
2. asked by Kim
3. 813 views
I need some help with answering these questions: What are some types of agency problems do health care organizations in
1. 4 answers
2. asked by Nikia walker
3. 1,343 views
Person 2 or group 2 immediately affected when mountain climbing unpreparedplease help and thank you
1. 1 answer
2. asked by Growler
3. 442 views
Indirectly affected person 1 or group 1 when mountain climbing unpreparedplease help and thank you person 1 or group 1 means
1. 1 answer
2. asked by Growler
3. 478 views
Could I please get some further assistance on a question I posted earlier? I'm not getting the correct answer and I'm not sure
1. 1 answer
2. asked by Susan
3. 510 views
Person 2 or Group 2 indirectly affected when mountain climbing unpreparedplease help and thank you last and final question
1. 0 answers
2. asked by Growler
3. 483 views
Question: A 0.400 g sample of propionic acid was dissolved in water to give 50.00 mL of solution. This solution was titrated
1. 1 answer
2. asked by Eliz
3. 1,173 views
What's the difference between a landfilland a dump?
1. 5 answers
2. asked by Chelsea
3. 265 views
Explain what is meant by the "dual nature" of light
1. 1 answer
2. asked by Jenny
3. 364 views
A 0.108 M sample of a weak acid is 4.16% ionized in solution. what is the hydroxide concentration of this solution?I know that i
1. 1 answer
2. asked by Anonymous
3. 759 views
Explain whether the photons emitted by a bright light bulb are more energetic than those emitted by a dim light bulb of the same
1. 1 answer
2. asked by Jenny
3. 2,262 views
queston: the pH of a white vinegar solution is 2.45. this vinager is an aquous solution of acetic acid with a density of
1. 1 answer
2. asked by Anonymous
3. 764 views
in african-violet plants,purple flowers are dominate to white flowers. You purchase an African- violet plant with white flowers.
1. 2 answers
2. asked by codi
3. 798 views
Indirectly affected person 1 or group 1 when mountain climbing unpreparedplease help and thank you person 1 or group 1 means
1. 2 answers
2. asked by Growler
3. 651 views
Why would someone choose to propagate a particular plant for commercial purposes by using vegetative structures instead of
1. 4 answers
2. asked by Anonymous
3. 451 views
Can you please proofread:Aging is something that everyone will experience. Having the opportunity to explore four different
1. 1 answer
2. asked by Lily
3. 503 views
What information is found on a flexible budget report?
1. 0 answers
2. asked by scooby9132002
3. 468 views
Can you tell me where does suspense occur and why ? In The "cremation of sam McGee", and "the highwayman"please help
1. 2 answers
2. asked by john
3. 596 views
who is indirect affect when mountain climbing unpreparedplease help and thank you
1. 2 answers
2. asked by Growler
3. 452 views
Find an equation of the tangent line to the parabola at the given point, and find the x-intercept of the line.17) x^2=2y ,
1. 1 answer
2. asked by Mike
3. 514 views
When soldiers are in battle they have to operate as a unit, not as individuals. How does that take away their freedom? I posted
1. 1 answer
2. asked by Kara
3. 502 views
Three spheres, each with a negative chrge of 4.0x10^6C, are fixed at the vertices of an equilateral triangle whose sides are
1. 2 answers
2. asked by Susan
3. 1,317 views
A material has 32 atoms in all; 24 decayed and the rest undecayed. If the half-life of the radioactive material is 1000 years,
1. 4 answers
2. asked by Angie
3. 632 views
After synthesizing your alkyl halide, Which layer will be the organic layer?
1. 1 answer
2. asked by Hola
3. 553 views
A McLeod gauge measures low gas pressures by compressing a known volume of the gas at constant temperature. If 315 cm^3 of gas
1. 1 answer
2. asked by Anonymous
3. 1,074 views
Can anyone get me started on this?A country has 2 regions, the North and South, which are identical in all respects except for
1. 3 answers
2. asked by anonymous
3. 512 views
8x^3 -1(2x)^3 - 1^3 (2x-1)(2x^2 + 2x + 1^2) -> but this doesnt factor
1. 2 answers
2. asked by Gregory
3. 369 views
What is customer service in today's business environment?
1. 1 answer
2. asked by China
3. 503 views
1. The second seed came out of the earth.2. The second seed came out of the Earth. (Which one is correct? Do I have to use
1. 1 answer
2. asked by John
3. 584 views
1. There were two seeds.The first seed was negative, but the second seed was positive. 2. There were two seeds. One seed was
1. 1 answer
2. asked by John
3. 748 views
1. it is by far the best dictionary.2. It is far and away the best dictionary. 3. it is far the best dictionary. 4. it is a lot
1. 2 answers
2. asked by John
3. 563 views
1. He felt it hard to solve the problem.2. He felt that he should get up early. 3. He felt like a philosopher. 4. The fish
1. 1 answer
2. asked by John
3. 946 views
What are the distinguishing characteristics between the two catagories of igneous rocks? I know two are texture and color. But
1. 1 answer
2. asked by AMW
3. 561 views
Find the length and width of a rectangular lot with a perimeter of 70 meters if the length is 5 meters more than the width
1. 1 answer
2. asked by tonya
3. 726 views
How did people differ before the industrialization and after pre World War I to after the end of the war?
1. 0 answers
2. asked by Shir
3. 363 views
using axia educational resources
1. 1 answer
2. asked by pennet
3. 347 views
setting and achieving goals
1. 3 answers
2. asked by pennet
3. 464 views
fostering reading comperhension and retention
1. 4 answers
2. asked by pennet
3. 388 views
applying personality and learning styles
1. 1 answer
2. asked by pennet
3. 419 views
How did imperialism affect the relationships among the countries?
1. 0 answers
2. asked by kt1993
3. 380 views
provide the iupac name,ch3ch(c3h7)ch2ch2ch2ch2ch(c4h8)ch2ch(ch3)ch3
1. 0 answers
2. asked by shakirudeen
3. 489 views
I HAVE TO WRITE AN ARTICLE ON" SOCIAL IMPACT OF THE DIGITAL AGE " PLEASE TELL ME SOME BASIC POINTS ABOUT THIS ARTICLE .
1. 1 answer
2. asked by YUKTIKA
3. 451 views
The suspense that occurs in the highwaymanWhen the soldier come to the inn tie Bess up with a gun at her chest. what do you
1. 5 answers
2. asked by john
3. 1,731 views
Can anyone give more advise on this subject about doing a day to day plan to use a a job aide for an employment search?
1. 2 answers
2. asked by Heather
3. 638 views
A firm is a monopolist in the production of a fuel sensor system. It faces monthly market demand that varies according to the
1. 1 answer
2. asked by John
3. 551 views
would richard nixon be the best president if it weren't for the watergate scandal?
1. 4 answers
2. asked by bob
3. 850 views
1)exam #00779100 of penn foster i need help with the exam
1. 2 answers
2. asked by Anonymous
3. 604 views
Find the distance between A and B, where A and B have the following coordinates:A(–3, 5); B(5, –8). Show your work by using
1. 1 answer
2. asked by Elizabeth
3. 367 views
The true/false question from yesterday was Atp does not play a role in energy transfer in living things.You said did i mean stp.
1. 4 answers
2. asked by Terrie
3. 528 views
I HAVE A DIAMOND BRACELET THAT HAS THE MARKINGS OF JAFA STAMPED ON THE INSIDE OF IT ABOVE 05TW MEANING THE TOTAL WEIGHT. WHAT
1. 1 answer
2. asked by JOY
3. 1,350 views
When phosphate groups are joined together to make ATP, it gives off energy.Is this true?
1. 0 answers
2. asked by Terrie
3. 384 views
how do I factor20x+25x^2+4
1. 1 answer
2. asked by ferrer
3. 364 views
Summarize the effects of one type of sexual dysfunction that can affect both men and women. What are some factors that may cause
1. 2 answers
2. asked by Brittney
3. 697 views
meeting daily nutrient needs can best be accomplished by consuming?
1. 0 answers
2. asked by keith
3. 439 views
can you show me the work for factoring42a^2-43a+6 thanks
1. 1 answer
2. asked by ferrer
3. 428 views
i have to finished this cross word , and i need help on the last two . So thank you if you can solve it :)A substance that micro
1. 0 answers
2. asked by Saffron.
3. 537 views
How can masculine and feminine traits be described using the contimuum masculinity-femininity?
1. 1 answer
2. asked by Julie
3. 518 views
Calculate [H3O] in the following solutions.5.15x10-2M HCl and 7.62x10-2M NaC2H3O2 Responses HCl + NaC2H3O2. It appears there is
1. 4 answers
2. asked by tomi
3. 1,805 views
A sample of 7.80L of NH3(ammonia) gas at 22 degrees Celsius and 735torr is bubbled into a 0.350L solution of 0.400M HCl
1. 2 answers
2. asked by tomi
3. 814 views
how does granite turn to mud
1. 1 answer
2. asked by SUZIE
3. 328 views
A club has 50 members. If there is a 10% absentee rate per meeting, find mean and standard deviation: How do you do the problem
1. 1 answer
2. asked by ce
3. 790 views
is this correct7x+21y-7=7(x+3y-1)
1. 1 answer
2. asked by ferrer
3. 438 views
to assure childrens safety in a child care setting, teachers must provide continuous what ?
1. 2 answers
2. asked by marcella
3. 501 views
In the poem "God's Grandeur," we find the words reck and rod. By analysis we can determine that the word rod probably comes from
1. 4 answers
2. asked by YAHMIA
3. 867 views
2[1+3(6+5)]
1. 1 answer
2. asked by Brittany
3. 235 views
How much water mest be added to 6 ounces of a 20% acid solution to obtain a 15% acid solution?
1. 0 answers
2. asked by Brian
3. 405 views
Does this sound right for the following scenario?The mayor of a small seaside town faces a tough decision. A prominent developer
1. 1 answer
2. asked by AW
3. 538 views
hi! I am doing tomorrow a chant (body parts) with young learners of english as a foreign language.They need to sing and show the
1. 3 answers
2. asked by laxy
3. 586 views
How much water mest be added to 6 ounces of a 20% acid solution to obtain a 15% acid solution?
1. 1 answer
2. asked by Brian
3. 424 views
I would appreciate any help thanksselect two intergers between -12 and +12 write two equations that have the two intergers as
1. 1 answer
2. asked by yorkie16
3. 510 views
In need of assistance pleasetake two integers between -12 and +12 write two equations that have the two intergers selected as
1. 1 answer
2. asked by yorkie16
3. 534 views
Suppose that P dollars are invested in a savings account at interest rate I, compounded annually, for 2 years. The amount A in
1. 3 answers
2. asked by Cassie
3. 1,352 views
Find two binomials whose product is x^2 - 6x + 9 and explain how you decided on those two binomials.Thank you! :-)
1. 1 answer
2. asked by Cassie
3. 618 views
(a-b)(a+b)= a^2 - b^2. Explain how this result can be used to develop a fast way of multiplying 95 x 105.How would I explain
1. 1 answer
2. asked by Cassie
3. 313 views
What specific recommendations would you give on fuel selections and hydration to successfully run a 10 K race
1. 1 answer
2. asked by lt
3. 399 views
If an economy has elements of more than one economic system. it is a ________.
1. 1 answer
2. asked by Claudia
3. 618 views
what information is on a felxible budget?*** is this correct*** The flexible budget report consists of two sections: (1)
1. 1 answer
2. asked by scooby9132002
3. 565 views
A tennis ball is thrown vertically upward wih an initial velocity of 8.0m/s.A) What will its speed be wheen it returns to its
1. 2 answers
2. asked by Taylor
3. 2,915 views

Back to April 2009