Questions Asked on February 6, 2009

Given the two reactions1.PbCl2 <--->Pb^2+ + 2 Cl^-, K1= 1.82×10^−10 2. AgCl <----> Ag^+ + Cl^-, K2 = 1.15×10−4 what is the
1. 6 answers
2. asked by Saira
3. 5,201 views
A road sign at the top of a mountain indicates that for the next 4 miles the grade is 12%. Find the angle of the grade and the
1. 2 answers
2. asked by Henry
3. 5,133 views
For a cost function C = 100 + 10Q + Q2, the average variable cost of producing 20 units of output isA. 10 B. 20 C. 30 D. None of
1. 3 answers
2. asked by John
3. 4,791 views
how many milliliters of 5M NaCl are required to prepare 1500 ml of .002M solution?
1. 1 answer
2. asked by ash
3. 3,570 views
Find the longest side of triangle ABC, if measurement A=70, measurement B=2x-10, and measurement C=3x+20.
1. 5 answers
2. asked by sarah
3. 3,154 views
Snape has 2000 mL of a magic potion that is 30% DeMuggle Juice. He also has hundreds of 25 mL bottles that are full of 75%
1. 10 answers
2. asked by Meghan
3. 2,974 views
A 50.0g piece of iron an 152°C is dropped into 20.0g H2O(l) at 89°C in an open, thermally insulated container. How much water
1. 1 answer
2. asked by -
3. 2,741 views
I hear America singing, the varied carols I hear;Those of mechanics--each one singing his, as it should be, blithe and strong;
1. 3 answers
2. asked by peter
3. 1,788 views
What is the source of most of the sodium, magnesium, and calcium ions in seawater?A weathering of seafloor rocks B weathering
1. 3 answers
2. asked by Angie
3. 1,705 views
Waste produced by people in New York State has been dumped into the Atlantic Ocean, where it is distributed by surface ocean
1. 3 answers
2. asked by Angie
3. 1,666 views
What does Pablo Neruda refer to in the last verse of his poem "La Anaconda Copper Mining Company"?"Y hay una y otra cruz torcida
1. 1 answer
2. asked by Alice
3. 1,445 views
A 0.285 M solution of the sodium salt, NaA, of the weak monoprotic acid, HA, has a pH of 9.65. Calculate Ka for the acid HA.I
1. 3 answers
2. asked by Blair
3. 1,434 views
Sociology perspectives!?1. Although it does not endorse traditional gender roles, which sociological perspective implies that
1. 2 answers
2. asked by dean
3. 1,425 views
List 3 problems of Decentralized power that existed under the Articles of Confederation. For each problem, identify one solution
1. 3 answers
2. asked by K
3. 1,424 views
Which of the following cost functions exhibits cost complementarity?A. -4Q1Q2 + 8Q1 B. -4Q2 + 8Q1 C. 6Q1Q2 - Q1 D. 4Q2Q1 + 8Q1
1. 3 answers
2. asked by Eliza
3. 1,339 views
Sociology perspectives!?1. Although it does not endorse traditional gender roles, which sociological perspective implies that
1. 5 answers
2. asked by dean
3. 1,326 views
What is the difference between an ionic bond and a covalent bond? I just keep forgetting which one is which...any easy way to
1. 2 answers
2. asked by mysterychicken
3. 1,252 views
What is the history of french school in alberta?what is the canadian charte of rights? Why are there French schools in ALberta?
1. 1 answer
2. asked by Alizah
3. 1,119 views
Since the 1970s, American poetry hasa. been characterized by diverse voices and styles b. become increasingly narrow in subject
1. 2 answers
2. asked by Literature
3. 1,115 views
Why do pesticides create the greatest problems for carnivores?
1. 13 answers
2. asked by Brooke
3. 1,108 views
So the question is:What is the difference between an ionic bond and a covalent bond? My answer is: In an ionic bond, the
1. 0 answers
2. asked by mysterychicken
3. 1,088 views
1. Should American foreign policy be based on our values and beliefs or on “real politics” (the real world)? Explain2. Was
1. 2 answers
2. asked by sunshine
3. 1,086 views
By providing shelves low enough for children to select materials, you encourage the development ofA. social skills B. solitary
1. 2 answers
2. asked by Ann
3. 1,086 views
What chemical test (axcept a magnet) to use to distinguish between iron and sulphur?
1. 1 answer
2. asked by Liza
3. 1,066 views
For Literature i have to write a REGIONAL NARRATIVE. i know that a narrative is a story, but what is a REGIONAL narrative?i'm
1. 1 answer
2. asked by y912f
3. 1,059 views
Household bleach is 5.25% NaOCl by mass. Assume a density of 1.00g/ml. What is the pH of bleach? Hint: assume 100 ml. Answer:
1. 4 answers
2. asked by Kati
3. 1,054 views
the rainfall this year was 18.6 cm. this is 3.2 cm less than half of the rainfall last year. what was the rainfall last year?
1. 3 answers
2. asked by luke
3. 1,044 views
In a recent health study it was claimed that 18% of americans are underwieght.If 4 americans randomly selected what is the
1. 2 answers
2. asked by Angela
3. 1,029 views
It is found that 24.68 mL of 0.1165 NaOH is needed to titrate 0.2931 g of an unknown acid to the phenolphthalein end point. What
1. 1 answer
2. asked by Mini
3. 1,028 views
Hey guys I did a lab and I have to answer the questions relating to the lab. I did question 1 & 2, can someone check if they are
1. 3 answers
2. asked by Sev
3. 987 views
Matt travels 2 and one half miles to get to school. this is 3 times the distance that Jen travels. how far does jen travel?
1. 2 answers
2. asked by joe
3. 961 views
The marginal rate of technical substitutionA. Determines the rate at which a producer can substitute between two inputs in order
1. 1 answer
2. asked by Carol
3. 958 views
WHAT IS THE NUTRIENTS IN WHITE RICE
1. 1 answer
2. asked by SWIPER
3. 954 views
Suppose the marginal cost of pollution reduction is ½ R, where R is the amount of pollution reduced given in percentage terms.
1. 1 answer
2. asked by Brett
3. 946 views
A mixture initially contains A,B, and C in the following concentrations: A1 = 0.300 M, B1 = 1.15M, and C1 = 0.350 M. The
1. 2 answers
2. asked by Saira
3. 899 views
I have a couple questions I answer for home work could some look atthem and tell me If I am doing them right I also am having
1. 3 answers
2. asked by KEENE
3. 895 views
i've read the story "Everything Stuck To Him" and in the beggining there is a couple and the girl wants to know about when she
1. 1 answer
2. asked by Bella
3. 873 views
The vapour pressure of methyl alcohol is 40 mmHg at 5°C. Use this value and the calsius-clapeyron equation to estimate the
1. 4 answers
2. asked by need help
3. 873 views
Solve each equation , then write the general solutioncos(pi/2(x+1))=cospi/2 x x=1.5, 3.5 general solution: 1/2+4n but the back
1. 3 answers
2. asked by sh
3. 845 views
please check theseThe subject of the "Game" can BEST be described as a. survival of the fittest b. the dehumanization of
1. 2 answers
2. asked by Bella
3. 828 views
I need so help figuring out which statement is true or false.1. A parameter always describes a larger group than a statistic. 2.
1. 3 answers
2. asked by Sue
3. 813 views
Suppose the market for good X has a four-firm concentration ratio of 0.50. Furthermore, assume that total sales in the industry
1. 2 answers
2. asked by Carol
3. 807 views
Does anyone know what this word is?Uhboci was sent to me
1. 0 answers
2. asked by Debbie
3. 802 views
How many electrons must be removed from each of two 5.40kg copper spheres to make the electrical force of repulsion between them
1. 1 answer
2. asked by Brooke
3. 767 views
"The Girl Who Wouldn't Talk"the narrator's attitude in this story when she begins to antagonize the quiet girl is that the quiet
1. 1 answer
2. asked by Bella
3. 753 views
i have to write an evaluative essay on a work of literature. i have chosen Hiroshima; The Noiseless Flash.in this essay i will
1. 3 answers
2. asked by Bella
3. 752 views
Tank 1 initial contains 70 L (liters) of waterand 450 g of salt, while tank 2 initially contains 20 L of water and 200 g of
1. 2 answers
2. asked by alice
3. 718 views
What is a cell wall or cell membrane?
1. 3 answers
2. asked by Angelica
3. 710 views
HelloI have a quick question. I have to write an english paper on the recent issues in business. it says that "purpose in
1. 4 answers
2. asked by bob
3. 702 views
Okay so this is actually for an english assignment where we have to report on a problem in our field....mine happens to be
1. 1 answer
2. asked by Stefanie
3. 698 views
So the question is:What is the difference between an ionic bond and a covalent bond? My answer is: In an ionic bond, the
1. 3 answers
2. asked by mysterychicken
3. 696 views
hi.i would like to know if someone can send me websites other than wikipedia that might be able to help me find out stories of
1. 1 answer
2. asked by Trixie
3. 692 views
how many grams of solid NaOH are required to prepare 200 ml of a .05 M solution?
1. 2 answers
2. asked by ash
3. 666 views
3/5 of the members of a hiking club went on the last hiking trip. if 39 people went on the last hiking trip how many are in the
1. 4 answers
2. asked by meagan
3. 664 views
Please check my answers to see if they are correct, if not, can you please fix them! Thank you.American citizens buy something
1. 1 answer
2. asked by Anonymous
3. 664 views
A sample of an ideal gas consists of 2 moles, pressure = 1 atm, volume = 0.5 litersFind the temperature pV=nRT T = p*V/(n*R) T =
1. 1 answer
2. asked by chemstudent
3. 659 views
the heaviest human of all time weighed 486 kg this is 12 kg less than 6 times juans weight. how much does juan weigh?
1. 4 answers
2. asked by megan
3. 646 views
What is the molarity of a solution of sodium hydroxide, NaOH, if 23.64 mL of this solution is needed to neutralize 0.5632 g of
1. 0 answers
2. asked by Mini
3. 639 views
I would just like to know if I have correctly written the first sentence in which it is an attributive adjective sentence. And
1. 1 answer
2. asked by Odette
3. 613 views
my homework is to write a poem in which i make something in nature speak and describe its growing process. i can either write a
1. 4 answers
2. asked by y912f
3. 604 views
neil was growin a culture of a bacteria for biology experiement. he noticed that the population doubled after 90 minutes. if the
1. 3 answers
2. asked by renee
3. 603 views
Review the Constructive Feedback Tutorial at Note: This tutorial uses audio narration and is about ten minutes in length. A
1. 0 answers
2. asked by smeffy
3. 588 views
This is one of my pre-writing exercise: Have you ever noticed that some reviewers list the criteria they use to evaluate
1. 0 answers
2. asked by y912f
3. 588 views
can u please proof read this?My sister had really wanted an X-box 360, but my mom had told her it was too expensive, and if she
1. 9 answers
2. asked by sorrymypostissolong:)
3. 584 views
January 20, 2009 is a date that will not soon be forgotten. On that day, former Senator Barack Hussein Obama was inaugurated the
1. 3 answers
2. asked by Anonymous
3. 576 views
Look at the Chart below: Then answer the question.Bounce: 0, 1, 2, 3, 4 Height: 100, 50, 25, 13, 6 (cm.) Ordered pairs:
1. 3 answers
2. asked by HAPPY FACE (I NEED MS. SUE OR WRITEACHER!!) HELP!!
3. 574 views
Why do pesticides create the greatest problems for carnivores?
1. 3 answers
2. asked by Brooke
3. 564 views
The complete combustion of 0.100 mol of CH4 in oxygen in a bomb calorimeter caused the water of the calorimeter to rise in
1. 0 answers
2. asked by HELP!!!
3. 563 views
West Point lies on the west bank of the Hudson River in New York state, about 80 km from where the river enters the Atlantic
1. 1 answer
2. asked by Angie
3. 560 views
What happened at Massacre at Wounded Knee?a. American soldiers killed more than 200 unarmed Sioux b. General Custer's cavalry
1. 1 answer
2. asked by y912f
3. 559 views
Imagine that you teach in a large, linguistically diverse school district where nearly 20 different languages are spoken. How
1. 5 answers
2. asked by troyer0269
3. 558 views
Suggest an appropriate reducing reagent for the following substrates and predict the product of the reactions :(a) 2-hexanone
1. 2 answers
2. asked by cassie
3. 551 views
please check this question for meWhat are the two essential elements of satire? a. realism and naturalism b. hostility and
1. 2 answers
2. asked by Bella
3. 547 views
Dear SirI need help for the below questions Please help thanks larry King 1) Sally bought some erasers and pens 16.50. She
1. 0 answers
2. asked by Larry King
3. 546 views
Often the percent of an animal species in the wild that survive to breed again is lower following a successful breeding season.
1. 1 answer
2. asked by kate
3. 544 views
Please help me! I am writing this article. It is an article prior to the attack on pearl harbor. I have to choose if 1) the u.s
1. 1 answer
2. asked by Amy
3. 544 views
Lead metal is added to 0.140 Cr^3+(aq).Pb(s)+ 2Cr^3(aq)<---> Pb^2+(aq)+2Cr^2+(aq) KC=3.2*10^{-10} A. What is Pb^2+ when
1. 2 answers
2. asked by Saira
3. 544 views
or the compound:carbon in the middle with 3 bonds -double bond to oxygen -bond to Mn(CO)5 -bond to CH3 group is the oxidation
1. 0 answers
2. asked by mary
3. 539 views
The following essay is meant to be one of opinion. In it, I am trying to express my opinion on President Obama and his plans for
1. 3 answers
2. asked by Anonymous
3. 539 views
i really need to know who zuxi is and google isn't coming up with anything and for some reason, my last question was deleted.
1. 5 answers
2. asked by jane
3. 538 views
In a recent health study it was claimed that 18% of americans are underwieght.If 4 americans randomly selected what is the
1. 2 answers
2. asked by Angela
3. 537 views
A state sales tax rate is 6.5%. If the tax on a purchase was $16.51, what was the price of the purchase.6.5%/$16.51=$254.00
1. 2 answers
2. asked by Johnnie
3. 530 views
I have removed your latest post for two reasons:1. <b>Do not put any teachers' names in your subject or name.</b> 2. You have
1. 3 answers
2. asked by Writeacher
3. 528 views
or the compound:carbon in the middle with 3 bonds -double bond to oxygen -bond to Mn(CO)5 -bond to CH3 group is the oxidation
1. 0 answers
2. asked by mary
3. 520 views
In the sentence "ou prenez vous des cours de maths?" can I replace "des cours de maths" with "en?"
1. 1 answer
2. asked by rc
3. 519 views
please help with this problem- i've been working for the last 2 hours and can't seem to find a solutionthe integral of
1. 1 answer
2. asked by Lexi
3. 518 views
Why are there usually more producers in an ecosystem than consumers?
1. 2 answers
2. asked by Brooke
3. 513 views
the price of a t.v. set on sale is $360. this is 2/3 of the regular price. find the regular price.
1. 1 answer
2. asked by megan
3. 509 views
As a prewriting exercise for my evaluative essay, I have to open the story that i have chosen and write two quick paragraphs or
1. 1 answer
2. asked by y912f
3. 509 views
Has anyone read the story "Son" by John Updike..i have a few questions about it.please let me know :)
1. 2 answers
2. asked by y912f
3. 508 views
Can someone summaries Warren G. Harding inaugural address in 1921 because i don't get it.what are the main ideas?
1. 1 answer
2. asked by LANI
3. 507 views
Can someone help me solve this problem:cos^2x + 5cosx - 2= 0 I am having trouble finding x
1. 1 answer
2. asked by Anonymous
3. 506 views
Je sais qu'on peut dire:"Je dois aller avec ma mère" mais serait-il correct aussi de dire: "il faut que je vais avec ma
1. 3 answers
2. asked by E.G.
3. 506 views
the price of a brick today is 49 cents. this is 3 cents less than 4 times the price 20 years ago. what was the price 20 years
1. 4 answers
2. asked by HELP
3. 505 views
the diameter of a small pizza is 16 centimeters. this is 2 cm more than 2/5 of the diameter of the large pizza so how big is the
1. 1 answer
2. asked by jake
3. 504 views
Is the answer to this question correct:1. Est-ce qu'il te faut un stylo? Ans: Oui, il me faut un.
1. 3 answers
2. asked by rc
3. 502 views
for all questions i asked i need suggestions and websites to best find these questions
1. 1 answer
2. asked by sherri r
3. 502 views
Show the reaction of 1-naphthylamine hydrochloride with sodium hydroxide using structural formulas. Indicate which layer
1. 1 answer
2. asked by sarah
3. 499 views
Ettenheim village is considering building a town swimming pool. The annual facility cost would be $200,000. Staff salaries for
1. 1 answer
2. asked by cindy
3. 498 views
1.Evaluate: (1/(x*sqrt(x^2-4))I know the answer is -1/2*arctan(2/sqrt(x^2-4)), but I am having trouble getting to this answer on
1. 0 answers
2. asked by Sandy
3. 497 views

Back to February 2009